{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a5ad4184-30f1-4350-83a6-978d4e433917", "code": "1079061-47-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1079061-47-4", "code_system": "CAS", "references": [ "24e6d927-5550-48f9-a22b-07a156edfb9f", "a5ce32ba-2ede-4e40-8da0-755329deb9e5" ] }, { "uuid": "63bbdbba-5fa5-4c44-8210-44e4a270d499", "code": "33512", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33512", "code_system": "PUBCHEM", "references": [ "24e6d927-5550-48f9-a22b-07a156edfb9f" ] }, { "uuid": "cc73f9ca-7aa6-e428-5f6e-b6643f30256c", "code": "DTXSID30274035", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30274035", "code_system": "EPA CompTox", "references": [ "f7ce82ab-b7b1-a659-7866-9aa4280c6dc3" ] }, { "uuid": "b64466fd-e017-4d64-b059-8449626e97d9", "code": "42LCB0IYC6", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c2fb1b44-0aac-4a31-844d-e7f8c7b27eee", "name": "AMMONIUM 2,4-DIMETHYLBENZENESULFONATE", "stdName": "AMMONIUM 2,4-DIMETHYLBENZENESULFONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "57351391-53ac-4395-9094-23b3dc46d91e", "023bab9a-b8fd-4e2d-9abe-ea5d50538e2e" ], "display_name": true }, { "uuid": "6b5e1957-ab02-4ba8-8cf2-f69dce73e489", "name": "BENZENESULFONIC ACID, 2,4-DIMETHYL-, AMMONIUM SALT (1:1)", "stdName": "BENZENESULFONIC ACID, 2,4-DIMETHYL-, AMMONIUM SALT (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "57351391-53ac-4395-9094-23b3dc46d91e", "bbca7e0c-af89-4a13-a0cb-6cd680cd2017" ], "display_name": false } ], "references": [ { "uuid": "bbca7e0c-af89-4a13-a0cb-6cd680cd2017", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "57351391-53ac-4395-9094-23b3dc46d91e", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "023bab9a-b8fd-4e2d-9abe-ea5d50538e2e", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "24e6d927-5550-48f9-a22b-07a156edfb9f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389657000, "tags": [ "NOMEN" ] }, { "uuid": "caf47cbd-cbdf-473f-a13b-7a2709d51ac5", "citation": "SRS import [42LCB0IYC6]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=42LCB0IYC6", "doc_type": "SRS", "public_domain": true, "document_date": 1493389657000, "tags": [ "NOMEN" ] }, { "uuid": "f7ce82ab-b7b1-a659-7866-9aa4280c6dc3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1079061-47-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a5ce32ba-2ede-4e40-8da0-755329deb9e5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a3f14a44-efff-40ce-88a3-05c990aece96", "id": "a3f14a44-efff-40ce-88a3-05c990aece96", "molfile": "\n Marvin 01132108312D \n\n 1 0 0 0 0 0 999 V2000\n 2.8305 -0.8658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "N", "formula": "H3N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a708f9ed-385a-46a2-be9a-796dade8acbf" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "17.0305", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "c91a8566-e26e-4881-b2ce-da89296d94eb", "id": "c91a8566-e26e-4881-b2ce-da89296d94eb", "molfile": "\n Marvin 01132110232D \n\n 12 12 0 0 0 0 999 V2000\n 1.3396 -3.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3545 -3.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0714 -2.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0714 -2.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3545 -1.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6326 -2.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6326 -2.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3545 -0.8360 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1359 -0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5954 -0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3396 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 8 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 5 9 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 2 0 0 0 0\n 12 9 2 0 0 0 0\nM END", "smiles": "Cc1ccc(c(C)c1)S(=O)(=O)O", "formula": "C8H10O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b008e1b2-799f-45e3-ac91-2d6cc92ca8be" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "186.2296", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6acc2c13-cf89-4b6d-8312-c372583a73e1", "version": "4", "structure": { "id": "a9c526f9-27c7-431e-9955-58375c6587cb", "molfile": "\n Marvin 01132108492D \n\n 13 12 0 0 0 0 999 V2000\n 1.3545 -0.8360 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3545 -1.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6326 -2.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1359 -0.8360 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.5954 -0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3396 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0714 -2.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6326 -2.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0714 -2.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3545 -3.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3396 -3.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8305 -0.8658 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 2 0 0 0 0\n 6 1 2 0 0 0 0\n 7 2 2 0 0 0 0\n 8 3 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 3 1 0 0 0 0\n 12 10 1 0 0 0 0\n 10 8 1 0 0 0 0\nM CHG 2 4 -1 13 1\nM END", "smiles": "Cc1ccc(c(C)c1)S(=O)(=O)[O-].[NH4+]", "formula": "C8H9O3S.H4N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "203.2601", "optical_activity": "NONE", "references": [ "caf47cbd-cbdf-473f-a13b-7a2709d51ac5", "bbca7e0c-af89-4a13-a0cb-6cd680cd2017" ], "stereo_centers": 0 }, "unii": "42LCB0IYC6" } ] }