{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b74e9318-4fb2-42fc-9f94-b0cfe8176f4f",
          "code": "885058-30-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=885058-30-0",
          "code_system": "CAS",
          "references": [
            "5d5999b6-0d13-4e30-b326-4c1f660b90b9",
            "1d364852-6117-4b61-8c41-0d6f299fa805"
          ]
        },
        {
          "uuid": "9164769e-e141-4e16-b172-221b255ebadb",
          "code": "23721982",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23721982",
          "code_system": "PUBCHEM",
          "references": [
            "5d5999b6-0d13-4e30-b326-4c1f660b90b9"
          ]
        },
        {
          "uuid": "3209728c-13c3-4e8e-877e-e013c018a63f",
          "code": "42D4RUI684",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f1cdcb8-7eaf-f1a7-deb9-7abc8dd80b4d",
          "code": "DTXSID90237085",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90237085",
          "code_system": "EPA CompTox",
          "references": [
            "535f9be5-2d20-33e3-8472-2dce18317994"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fdc8290b-a221-4593-abfa-f396688977b5",
          "name": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, POTASSIUM SALT",
          "stdName": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66a39cc9-bb20-4526-aeab-2b19120121c7",
            "2cc9532f-369f-4fc2-b7e0-86670c5a6547"
          ],
          "display_name": false
        },
        {
          "uuid": "91308c53-2478-4759-a26e-f9d789718ce4",
          "name": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, POTASSIUM SALT (1:1), (2E)-",
          "stdName": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, POTASSIUM SALT (1:1), (2E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f142b39-f3dd-4e2e-a538-4cff327ab5ba",
            "2cc9532f-369f-4fc2-b7e0-86670c5a6547"
          ],
          "display_name": false
        },
        {
          "uuid": "80405e04-8224-4781-8bcd-130269c837f7",
          "name": "POTASSIUM 4-METHOXYCINNAMATE",
          "stdName": "POTASSIUM 4-METHOXYCINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f142b39-f3dd-4e2e-a538-4cff327ab5ba",
            "2cc9532f-369f-4fc2-b7e0-86670c5a6547"
          ],
          "display_name": false
        },
        {
          "uuid": "00bb0157-449f-4e10-955f-837ba327c6f1",
          "name": "POTASSIUM METHOXYCINNAMATE",
          "stdName": "POTASSIUM METHOXYCINNAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db249c89-f789-4a09-931d-1b49e62103ed",
            "2cc9532f-369f-4fc2-b7e0-86670c5a6547",
            "8e161ecf-635f-4ed3-bb78-40a23c63ca17"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a0aa808d-37b9-47f8-90c8-2080511c8327",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5f61e63e-45bc-4a7c-83f3-9d2ed6b00d60",
          "name": "POTASSIUM P-METHOXYCINNAMATE",
          "stdName": "POTASSIUM P-METHOXYCINNAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f142b39-f3dd-4e2e-a538-4cff327ab5ba",
            "2cc9532f-369f-4fc2-b7e0-86670c5a6547"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "db249c89-f789-4a09-931d-1b49e62103ed",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2cc9532f-369f-4fc2-b7e0-86670c5a6547",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f142b39-f3dd-4e2e-a538-4cff327ab5ba",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66a39cc9-bb20-4526-aeab-2b19120121c7",
          "citation": "http://www.specialchem4cosmetics.com/services/inci/ingredient.aspx?id=10981",
          "url": "http://www.specialchem4cosmetics.com/services/inci/ingredient.aspx?id=10981",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d5999b6-0d13-4e30-b326-4c1f660b90b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44f2c422-eabf-41ce-b924-5d8d26e22f1b",
          "citation": "SRS import [42D4RUI684]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=42D4RUI684",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e161ecf-635f-4ed3-bb78-40a23c63ca17",
          "citation": "POTASSIUM METHOXYCINNAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3295b579-711c-32c8-eb8c-2548e3a4f190",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=885058-30-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d364852-6117-4b61-8c41-0d6f299fa805",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "535f9be5-2d20-33e3-8472-2dce18317994",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9de736d0-0efb-40f3-a81d-0bc20b27115d",
          "id": "9de736d0-0efb-40f3-a81d-0bc20b27115d",
          "molfile": "\n  Marvin  01132108122D          \n\n  1  0  0  0  0  0            999 V2000\n    3.7379   -4.3351    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7bdff147-bf83-40f5-8cca-b45090070e6f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d96a8563-4e22-4de7-a3da-27a6468e93c0",
          "id": "d96a8563-4e22-4de7-a3da-27a6468e93c0",
          "molfile": "\n  Marvin  01132111162D          \n\n 13 13  0  0  0  0            999 V2000\n    5.3857   -5.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0998   -6.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8127   -5.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8127   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -4.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2422   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2422   -5.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -6.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9569   -4.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9569   -3.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6742   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3864   -3.7187    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6742   -2.4808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  1  12  -1\nM  END",
          "smiles": "COc1ccc(cc1)/C=C/C(=O)[O-]",
          "formula": "C10H9O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d6ef30af-54ff-46d6-86f6-568232a6634a"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "177.177",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4ad8de5d-9e1b-423e-91da-14a843bdd49b",
      "version": "6",
      "structure": {
        "id": "1b2c2b60-994f-404b-a37d-3bd04cccece6",
        "molfile": "\n  Marvin  01132101352D          \n\n 14 13  0  0  0  0            999 V2000\n   10.3864   -3.7187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6742   -2.4808    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6742   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9569   -3.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9569   -4.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -4.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8127   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8127   -5.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -6.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2422   -5.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2422   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0998   -6.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3857   -5.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7379   -4.3351    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n 12  8  1  0  0  0  0\n  3  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n 11  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 13 12  1  0  0  0  0\nM  CHG  2   2  -1  14   1\nM  END",
        "smiles": "COc1ccc(cc1)/C=C/C(=O)[O-].[K+]",
        "formula": "C10H9O3.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "216.2753",
        "optical_activity": "NONE",
        "references": [
          "44f2c422-eabf-41ce-b924-5d8d26e22f1b",
          "0f142b39-f3dd-4e2e-a538-4cff327ab5ba"
        ],
        "stereo_centers": 0
      },
      "unii": "42D4RUI684"
    }
  ]
}