{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b0c46703-7e57-4a40-9ab0-e7f196d2c2e9", "code": "119313-12-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=119313-12-1", "code_system": "CAS", "references": [ "c3443fbd-454d-4dcf-b2b0-46b714d5e7bc", "6f03b3cd-74c4-461a-b9f7-d8f447381317" ] }, { "uuid": "99f1e2c5-570d-447f-9ed1-ffa358d6dc40", "code": "86171", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86171", "code_system": "PUBCHEM", "references": [ "c3443fbd-454d-4dcf-b2b0-46b714d5e7bc" ] }, { "uuid": "45aacd5e-f866-7392-5f28-b73b338fa5c1", "code": "DTXSID5044786", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5044786", "code_system": "EPA CompTox", "references": [ "bc82f3ac-7343-259f-8ecd-ec08fae934cf" ] }, { "uuid": "3f06fa53-ae32-447e-894e-4d882714a65e", "code": "413O6RKS6B", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "cfa45da6-9b7a-fe81-cae8-dffd9e5f6b7d", "code": "300000053015", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "edf29585-0ee7-0687-7216-40727e61ba36" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7fc87dc3-048c-42a8-8423-67cb6716e2e5", "name": ".ALPHA.-BENZYL-.ALPHA.-(DIMETHYLAMINO)-4-MORPHOLINOBUTYROPHENONE", "stdName": ".ALPHA.-BENZYL-.ALPHA.-(DIMETHYLAMINO)-4-MORPHOLINOBUTYROPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e857ad9-a324-4962-a406-fbab0084f37a" ], "display_name": false }, { "uuid": "015cd6d7-ef97-4208-b279-80f730e6b842", "name": "1-BUTANONE, 2-(DIMETHYLAMINO)-1-(4-(4-MORPHOLINYL)PHENYL)-2-(PHENYLMETHYL)-", "stdName": "1-BUTANONE, 2-(DIMETHYLAMINO)-1-(4-(4-MORPHOLINYL)PHENYL)-2-(PHENYLMETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e857ad9-a324-4962-a406-fbab0084f37a" ], "display_name": false }, { "uuid": "b2513a4a-f6d8-4903-906a-c1e57cb4b463", "name": "2-(DIMETHYLAMINO)-1-(4-MORPHOLINOPHENYL)-2-BENZYL-1-BUTANONE", "stdName": "2-(DIMETHYLAMINO)-1-(4-MORPHOLINOPHENYL)-2-BENZYL-1-BUTANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e857ad9-a324-4962-a406-fbab0084f37a" ], "display_name": false }, { "uuid": "8913bdfa-13de-4044-842e-885c81413410", "name": "2-BENZYL-2-(DIMETHYLAMINO)-1-(4-(MORPHOLIN-4-YL)PHENYL)BUTAN-1-ONE", "stdName": "2-BENZYL-2-(DIMETHYLAMINO)-1-(4-(MORPHOLIN-4-YL)PHENYL)BUTAN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fd022a92-8964-4b79-9889-1d26db634552" ], "display_name": true }, { "uuid": "e93bb21c-7929-4b84-9200-9092c1dd0888", "name": "2-BENZYL-2-DIMETHYLAMINO-4'-MORPHOLINOBUTYROPHENONE", "stdName": "2-BENZYL-2-DIMETHYLAMINO-4'-MORPHOLINOBUTYROPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9032cc9c-718f-4aa2-aa8a-0e718a2932c8" ], "display_name": false }, { "uuid": "abdcd12e-e0f9-4c4d-86d0-560b01ee92e9", "name": "2-BENZYL-2-N,N-DIMETHYLAMINO-1-(4-MORPHOLINOPHENYL)-1-BUTANONE", "stdName": "2-BENZYL-2-N,N-DIMETHYLAMINO-1-(4-MORPHOLINOPHENYL)-1-BUTANONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e857ad9-a324-4962-a406-fbab0084f37a" ], "display_name": false }, { "uuid": "be579bd4-cbbb-4032-be83-260c2d24b038", "name": "IRGACURE 369", "stdName": "IRGACURE 369", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5d417545-c77b-4141-812a-8bb80bbcb7e1" ], "display_name": false }, { "uuid": "33a30a52-ee6c-4887-930c-1cba333afa5d", "name": "J261.950D", "stdName": "J261.950D", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5d417545-c77b-4141-812a-8bb80bbcb7e1" ], "display_name": false }, { "uuid": "a17a9a05-90ef-41e1-8777-42d41b046424", "name": "PHOTOINITIATOR 369", "stdName": "PHOTOINITIATOR 369", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e857ad9-a324-4962-a406-fbab0084f37a" ], "display_name": false } ], "references": [ { "uuid": "fd022a92-8964-4b79-9889-1d26db634552", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2e857ad9-a324-4962-a406-fbab0084f37a", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9032cc9c-718f-4aa2-aa8a-0e718a2932c8", "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/119313-12-1", "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/119313-12-1", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5d417545-c77b-4141-812a-8bb80bbcb7e1", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J261.950D", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J261.950D", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c3443fbd-454d-4dcf-b2b0-46b714d5e7bc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393361000, "tags": [ "NOMEN" ] }, { "uuid": "acba7148-7886-442d-806c-bb33a2686ae6", "citation": "SRS import [413O6RKS6B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=413O6RKS6B", "doc_type": "SRS", "public_domain": true, "document_date": 1493393361000, "tags": [ "NOMEN" ] }, { "uuid": "bc82f3ac-7343-259f-8ecd-ec08fae934cf", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119313-12-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6f03b3cd-74c4-461a-b9f7-d8f447381317", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "edf29585-0ee7-0687-7216-40727e61ba36", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f483e1f9-7fb5-4e93-aaba-9b54e41be2a5", "id": "f483e1f9-7fb5-4e93-aaba-9b54e41be2a5", "molfile": "\n Marvin 01132112412D \n\n 27 29 0 0 0 0 999 V2000\n 4.6498 -0.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6417 -1.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3546 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7758 -1.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5535 -1.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1772 -1.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9549 -1.3447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1007 -0.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4770 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6993 -0.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0755 -2.4869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7884 -2.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0593 -3.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9414 -2.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3464 -3.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1232 -2.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7101 -3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8838 -3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4788 -2.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8920 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7182 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6525 -2.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2313 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4050 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.7623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4050 -2.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2313 -2.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 11 1 0 0 0 0\n 3 14 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 2 0 0 0 0\n 19 22 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 27 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "CCC(Cc1ccccc1)(C(=O)c2ccc(cc2)N3CCOCC3)N(C)C", "formula": "C23H30N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "54b5e090-6079-419d-96bf-3689ccd838d3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "366.4974", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "9240abe5-a5ed-4118-b8ce-c4d5993e64c7", "version": "4", "structure": { "id": "b2c527ab-80d4-4a21-88a0-010f72fb77f2", "molfile": "\n Marvin 01132109162D \n\n 27 29 0 0 0 0 999 V2000\n 5.3546 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9414 -2.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7758 -1.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0755 -2.4869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6417 -1.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3464 -3.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1232 -2.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5535 -1.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7884 -2.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0593 -3.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6498 -0.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7101 -3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7182 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1772 -1.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6993 -0.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8838 -3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8920 -2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9549 -1.3447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4770 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4788 -2.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1007 -0.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6525 -2.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2313 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2313 -2.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4050 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4050 -2.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.7623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 2 6 2 0 0 0 0\n 2 7 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 11 1 0 0 0 0\n 7 12 2 0 0 0 0\n 7 13 1 0 0 0 0\n 8 14 2 0 0 0 0\n 8 15 1 0 0 0 0\n 12 16 1 0 0 0 0\n 13 17 2 0 0 0 0\n 14 18 1 0 0 0 0\n 15 19 2 0 0 0 0\n 16 20 2 0 0 0 0\n 17 20 1 0 0 0 0\n 18 21 2 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCC(Cc1ccccc1)(C(=O)c2ccc(cc2)N3CCOCC3)N(C)C", "formula": "C23H30N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "366.4974", "optical_activity": "( + / - )", "references": [ "acba7148-7886-442d-806c-bb33a2686ae6", "fd022a92-8964-4b79-9889-1d26db634552" ], "stereo_centers": 1 }, "unii": "413O6RKS6B" } ] }