{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f49e7895-5e57-48ea-aa12-612b240c2461",
          "code": "26040-51-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26040-51-7",
          "code_system": "CAS",
          "references": [
            "54ae29b9-c543-402d-b6d3-c97434c9c394",
            "31c804f2-affd-4364-aab2-ff61e289d41f"
          ]
        },
        {
          "uuid": "27a5018d-6064-4a46-9ddf-cd0749f778b8",
          "code": "247-426-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.099",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "54ae29b9-c543-402d-b6d3-c97434c9c394"
          ]
        },
        {
          "uuid": "7bd63491-7d15-44c5-a0a6-4048c4a4a001",
          "code": "117291",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/117291",
          "code_system": "PUBCHEM",
          "references": [
            "54ae29b9-c543-402d-b6d3-c97434c9c394"
          ]
        },
        {
          "uuid": "acc61cc7-6514-47bc-301b-ac412b1c78d4",
          "code": "8216",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8216",
          "code_system": "HSDB",
          "references": [
            "d19df282-7d92-843e-399c-fde4df6c8c6e"
          ]
        },
        {
          "uuid": "44bb458e-08ae-7de3-9d56-8916aa26b484",
          "code": "DTXSID7027887",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7027887",
          "code_system": "EPA CompTox",
          "references": [
            "5fb04db5-4e4f-0926-81a8-b47390812c0f"
          ]
        },
        {
          "uuid": "bfd4fb86-14c9-44d0-9253-78003968a28e",
          "code": "413M0N3V1G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b2c9be0-4dac-4227-a3c8-e7cee3b96092",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, 3,4,5,6-TETRABROMO-, 1,2-BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, 3,4,5,6-TETRABROMO-, 1,2-BIS(2-ETHYLHEXYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "970dba2e-62a0-497b-a923-723800cfab3b",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, 3,4,5,6-TETRABROMO-, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, 3,4,5,6-TETRABROMO-, BIS(2-ETHYLHEXYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "f46a5d2e-74d3-4abc-b9d0-d5b06232c3f8",
          "name": "BIS(2-ETHYL-1-HEXYL) TETRABROMOPHTHALATE",
          "stdName": "BIS(2-ETHYL-1-HEXYL) TETRABROMOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "7e4311f5-1d7e-4fa4-bf52-a865d0390cb6",
          "name": "BIS(2-ETHYLHEXYL) 2,3,4,5-TETRABROMOPHTHALATE",
          "stdName": "BIS(2-ETHYLHEXYL) 2,3,4,5-TETRABROMOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "ecc67b3e-ebb1-44be-aab8-879308565933",
          "name": "BIS(2-ETHYLHEXYL) 3,4,5,6-TETRABROMOPHTHALATE",
          "stdName": "BIS(2-ETHYLHEXYL) 3,4,5,6-TETRABROMOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "f35bb9ce-779c-4169-8ed4-26ed99473e85",
          "name": "BIS(2-ETHYLHEXYL) TETRABROMOPHTHALATE",
          "stdName": "BIS(2-ETHYLHEXYL) TETRABROMOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e509a293-0aac-4c62-9d14-ca9212e71297"
          ],
          "display_name": true
        },
        {
          "uuid": "e676ebcd-4083-4fb9-98df-c15dd317d63e",
          "name": "DI(2-ETHYLHEXYL) TETRABROMOPHTHALATE",
          "stdName": "DI(2-ETHYLHEXYL) TETRABROMOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "0b53992a-4585-49d3-8748-20d4a55b4ed8",
          "name": "DP 45",
          "stdName": "DP 45",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "762c8767-7b01-46dc-a13c-c7768563ee56",
          "name": "FRP 45",
          "stdName": "FRP 45",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "357ec17b-cce1-4b39-8966-090755ef3677",
          "name": "PHTHALIC ACID, TETRABROMO-, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "PHTHALIC ACID, TETRABROMO-, BIS(2-ETHYLHEXYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        },
        {
          "uuid": "8409c9d0-9661-4780-a909-1355d44900fe",
          "name": "PYRONIL 45",
          "stdName": "PYRONIL 45",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca074bfa-9831-419d-9dbc-3e3007597139"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e509a293-0aac-4c62-9d14-ca9212e71297",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ca074bfa-9831-419d-9dbc-3e3007597139",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54ae29b9-c543-402d-b6d3-c97434c9c394",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392846000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccb3f3af-639e-43a1-807a-e6e0156d8f67",
          "citation": "SRS import [413M0N3V1G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=413M0N3V1G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392846000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d19df282-7d92-843e-399c-fde4df6c8c6e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+26040-51-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5fb04db5-4e4f-0926-81a8-b47390812c0f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26040-51-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31c804f2-affd-4364-aab2-ff61e289d41f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d7ced6e-7ad4-435c-aaf3-aee2939d1acf",
          "id": "8d7ced6e-7ad4-435c-aaf3-aee2939d1acf",
          "molfile": "\n  Marvin  01132107212D          \n\n 32 32  0  0  0  0            999 V2000\n    5.3594   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3594   -2.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -2.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3594   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.1844   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6002   -2.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1318   -4.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7094   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1318   -5.7026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -5.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -6.4089    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -5.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -6.4089    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4158   -4.9898    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -3.5576    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7094   -3.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -2.8447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -2.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8909   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4158   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 21  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 29  1  0  0  0  0\n 27 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1c(c(c(c(c1Br)Br)Br)Br)C(=O)OCC(CC)CCCC",
          "formula": "C24H34Br4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "17425b61-eae3-448d-a5f1-bb65dc98f956"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "706.1394",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a6746f1-aa67-4e62-9bcb-c71cd781d626",
      "version": "4",
      "structure": {
        "id": "3ba86298-0b1c-40cc-9597-c0aa26ee51b0",
        "molfile": "\n  Marvin  01132103102D          \n\n 32 32  0  0  0  0            999 V2000\n    2.8909   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -5.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -5.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7094   -4.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1318   -5.7026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1318   -4.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7094   -3.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -2.8447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -3.5576    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4158   -4.9898    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -6.4089    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -6.4089    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3594   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -2.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3594   -2.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9502   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3594   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1844   -3.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6002   -2.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -2.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2409   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4158   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8909   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4685    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 16  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 15  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 14  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 13  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 25  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 31  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1c(c(c(c(c1Br)Br)Br)Br)C(=O)OCC(CC)CCCC",
        "formula": "C24H34Br4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "706.1394",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e509a293-0aac-4c62-9d14-ca9212e71297",
          "ccb3f3af-639e-43a1-807a-e6e0156d8f67"
        ],
        "stereo_centers": 2
      },
      "unii": "413M0N3V1G"
    }
  ]
}