{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5f71fa82-4bcd-4932-a078-1517ac1560af", "code": "N07BC01", "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|buprenorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N07BC01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "b78b468c-a68d-4bee-802e-f1edd4a8df2a", "code": "N02AE01", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Oripavine derivatives|buprenorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AE01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "15d67596-54f2-44ca-8fce-7225bf0e1d28", "code": "N0000175685", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Opioid Receptor Interactions [MoA]|Opioid Agonists [MoA]|Partial Opioid Agonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175685", "code_system": "NDF-RT", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "6b90611b-6650-4e28-8474-396c9acbf5a4", "code": "N0000175689", "comments": "Established Pharmacologic Class [EPC]|Partial Opioid Agonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175689", "code_system": "NDF-RT", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "fa0fc87a-25ef-4eb1-a5a9-593edf8ecadc", "code": "QN07BC01", "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|buprenorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07BC01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "0029fde8-32a8-45a1-8c41-764be7d0b9c9", "code": "QN07BC51", "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|buprenorphine, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07BC51&showdescription=yes", "code_system": "WHO-VATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "fbbd058f-80b5-4a8d-9823-ca9939b2787e", "code": "QN02AE01", "comments": "VATC|ANALGESICS|OPIOIDS|Oripavine derivatives|buprenorphine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AE01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "e0b9358a-5f6d-48ca-90ab-e6af3f54a9b4", "code": "52485-79-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52485-79-7", "code_system": "CAS", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700", "2b7944d4-a6bb-404e-8594-86bad05b9ef1" ] }, { "uuid": "2f654bd6-842b-4ce0-a797-2eb3258565b0", "code": "C61656", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61656", "code_system": "NCI_THESAURUS", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "370841e4-86eb-4523-b9c7-07986992ba77", "code": "D002047", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68002047", "code_system": "MESH", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "6b3aee93-33ad-4f9a-bed0-20fd2c419681", "code": "NBK548871", "comments": "LiverTox|Substance abuse agent|Opiate addiction|Opiate agonist-antagonist", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548871/", "code_system": "LIVERTOX", "references": [ "4f989bd7-c60d-fe53-1d74-f0a576ebdd31" ] }, { "uuid": "8cf128ad-e5ca-4994-90ac-3e04bdda5003", "code": "BUPRENORPHINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Buprenorphine", "code_system": "WIKIPEDIA", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "e86608bf-6e76-4328-81cf-29ab7e278ba4", "code": "N07BC51", "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|DRUGS USED IN ADDICTIVE DISORDERS|Drugs used in opioid dependence|buprenorphine, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N07BC51&showdescription=yes", "code_system": "WHO-ATC", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "e8860d05-a129-4dd2-919c-7ba7d16a1cde", "code": "SUB05985MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "67163568-b41c-422f-9270-f9a9372eb501", "code": "3403", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3403", "code_system": "INN", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "d33b796e-c897-4f50-a82b-2f43f6586a55", "code": "SUBOXONE (AUTHORIZED: OPIOID-RELATED DISEASES)", "comments": "EMA EPAR|PSYCHIATRY AND PSYCHOLOGY|MENTAL DISORDERS|SUBSTANCE-RELATED DISORDERS|OPIOID-RELATED DISORDERS", "type": "PRIMARY", "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000697/human_med_001067.jsp&mid=WC0b01ac058001d124", "code_system": "EMA ASSESSMENT REPORTS", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "72e121d2-29cc-4a67-9e38-3d5464b6ca0f", "code": "9064", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Narcotic drugs", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "184e0f64-4ff3-4d74-96ea-c081e5b5d622", "code": "1670", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1670", "code_system": "IUPHAR", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "32f9d108-2b63-42f3-a134-b3fce185b57e", "code": "1819", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1819/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "62fc6d33-ab0b-445a-a6a2-967b11f4f30c", "code": "m2771", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2771?q=authorize", "code_system": "MERCK INDEX", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "fff83862-a8dc-4e87-bf09-57c20fd4b54b", "code": "DB00921", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00921", "code_system": "DRUG BANK", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "2288bb2a-ddd2-40f8-b2bc-f7b27fafe302", "code": "CHEMBL511142", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL511142", "code_system": "ChEMBL", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "2c01259c-3678-4af7-b7fd-c9229ed006aa", "code": "257-950-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.664", "code_system": "ECHA (EC/EINECS)", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "0fca6f74-9bf5-4bf9-b52a-8021ec4ca897", "code": "644073", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/644073", "code_system": "PUBCHEM", "references": [ "60d716b7-ee05-4fce-89b9-eb37fecc2700" ] }, { "uuid": "f522fe0a-24c2-56a3-ed40-2d240036886c", "code": "DTXSID2022705", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2022705", "code_system": "EPA CompTox", "references": [ "da295629-f3c5-eedb-f631-6b85c514bbd0" ] }, { "uuid": "cc8c7e46-7542-2168-e3ba-a38627cdb3f9", "code": "79093", "comments": "ORPHAN DRUG|Designated/Approved|Treatment of opiate addiction in opiate users", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=79093", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "bdb79f33-2b4a-8b32-ae88-460f098d2fe8", "code": "C67413", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413", "code_system": "NCI_THESAURUS", "references": [ "c91ec71c-c97a-0cec-4dab-310e0c08333d" ] }, { "uuid": "a1fb265e-1e7e-a1d4-f5ff-8c8b195926a6", "code": "C1506", "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid[C221]|Opioid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1506", "code_system": "NCI_THESAURUS", "references": [ "c91ec71c-c97a-0cec-4dab-310e0c08333d" ] }, { "uuid": "99d16ff5-eae9-4e81-9e0d-e30a4edf533e", "code": "40D3SCR4GZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ae10ba44-f342-8a09-ca8d-691d1c131cf1", "code": "Buprenorphine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM338/", "code_system": "LACTMED", "references": [ "4f989bd7-c60d-fe53-1d74-f0a576ebdd31" ] }, { "uuid": "9d1fd655-e89d-09a1-a9b3-88de49c9e315", "code": "434", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/434", "code_system": "DRUG CENTRAL", "references": [ "4f989bd7-c60d-fe53-1d74-f0a576ebdd31" ] }, { "uuid": "f18b47ac-6826-797a-7032-2250ffa1fb21", "code": "3216", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3216", "code_system": "CHEBI", "references": [ "4f989bd7-c60d-fe53-1d74-f0a576ebdd31" ] }, { "uuid": "fe6cacec-ba47-1fb1-c590-2f2cb12a2749", "code": "541116", "comments": "ORPHAN DRUG|Designated|Treatment of opioid withdrawal syndrome in the pediatric population", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=541116", "code_system": "FDA ORPHAN DRUG", "references": [ "4f989bd7-c60d-fe53-1d74-f0a576ebdd31" ] }, { "uuid": "f9eed466-8cce-8d95-0f3f-6b7fbb2dd3e2", "code": "100000085263", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "f1d46eed-d0fc-81e6-b71d-dfca201b272a" ] }, { "uuid": "c0123723-523a-a2da-fd1a-20bfaff345c0", "code": "40D3SCR4GZ", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=40D3SCR4GZ", "code_system": "DAILYMED", "references": [ "76f2df59-762a-2db6-f594-8b98d42ca9a2" ] } ], "substance_class": "chemical", "references": [ { "uuid": "a48ff4a1-f110-4691-9140-c6b25857c6b3", "citation": "http://www.ncbi.nlm.nih.gov/pmc/articles/PMC3560935/", "url": "http://www.ncbi.nlm.nih.gov/pmc/articles/PMC3560935/", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05f2f5e1-a395-4161-8f89-7d9467b93ad9", "citation": "ANESTHESIOLOGY. 2011 DEC;115(6):1251-60.", "url": "http://www.ncbi.nlm.nih.gov/pubmed/22037640", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5815945-1a0e-435a-a53c-031079cb8259", "citation": "SRS import [40D3SCR4GZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=40D3SCR4GZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493389711000, "tags": [ "NOMEN" ] }, { "uuid": "aaa29254-e0b9-4d88-afe4-dde12f562b27", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "32a0a922-29aa-46f7-b12a-04398369f85d", "citation": "BUPRENORPHINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "da5b9f49-4f15-4667-b581-54d3a87957fd", "citation": "BUPRENORPHINE [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f0e961fb-56cd-47fc-8934-120ca78be83c", "citation": "BUPRENORPHINE [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "41719767-ff59-48dd-9903-3e5d349e2110", "citation": "BUPRENORPHINE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f5ceadbf-aaa4-451d-adf6-1dda8f31628a", "citation": "BUPRENORPHINE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3b27ea83-92dc-4c0f-bf5f-1c59d18b43b0", "citation": "BUPRENORPHINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c66d2833-5e34-4ccd-a3ca-c180396855a9", "citation": "BUPRENORPHINE [EMA EPAR]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6639b649-af25-4b1e-97f7-76ccb617fff4", "citation": "BUPRENORPHINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "57c696eb-19dd-45fc-b5f3-2b3e34909eef", "citation": "BUPRENORPHINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4a6e0b3e-02f2-4e04-b25e-099e4eed69e2", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b2eb7c0b-a62c-41e2-9ede-8687082d4a64", "citation": "INN Proposed List 29", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL29.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "31930acb-d36d-40a7-8646-7f6a137be449", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a4d5ee1-d3d8-4b7a-9403-7d9054c1dc65", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6362cd50-ba45-4e32-80cc-c9db85c7d56e", "citation": "KEGG", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "08a53262-1bcf-4f84-ba14-b50dae16ac95", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1054cb2a-bc80-4b17-91b4-055648888790", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9ff5ba31-127b-410e-9408-1415ddf24a6a", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "19b9a91f-991f-46ff-81c9-159e692b6c52", "citation": "D07132", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2835c7e9-9ca2-436f-9b0f-a2c642725561", "citation": "EMA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b859daa8-a17e-434d-9f99-8d4f2733d52d", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5c696b8-8a7d-4f6a-a170-cc73bb4654ae", "citation": "http://www.recoveryhelpdesk.com/probuphine/", "url": "http://www.recoveryhelpdesk.com/probuphine/", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8265adfb-62ca-4f8f-b685-57e20e0b9c25", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dd5c0e7b-6a09-4983-8431-46080e88f158", "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000697/human_med_001067.", "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000697/human_med_001067.", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1e57fdc2-df01-420d-bcae-0daf73f30b1b", "citation": "https://de.wikipedia.org/wiki/Buprenorphin", "url": "https://de.wikipedia.org/wiki/Buprenorphin", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "60d716b7-ee05-4fce-89b9-eb37fecc2700", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389711000, "tags": [ "NOMEN" ] }, { "uuid": "5e0af580-1527-d0c0-0f48-e7f0b9359bd6", "citation": "http://onlinelibrary.wiley.com/doi/10.1111/jcpt.12404/full", "doc_type": "JA", "public_domain": true }, { "uuid": "7e206f22-ab3b-b69d-5cf3-490eb4370bb2", "citation": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?labeltype=all&query=butrans", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "da295629-f3c5-eedb-f631-6b85c514bbd0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52485-79-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e9251f96-686f-5b1a-4092-ca94dfa9a2ed", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+52485-79-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4723ebd2-f929-c216-de73-ad713212a8ce", "citation": "https://en.wikipedia.org/wiki/Buprenorphine/samidorphan", "doc_type": "WIKI", "public_domain": true }, { "uuid": "24d136e0-eff3-62c3-417f-620116878d45", "citation": "DRUGS@FDA", "doc_type": "DRUGS@FDA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "66761c20-cbaa-b5db-79da-8c5ebf8ef9ad", "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549176#f_pharmacokinetics", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "f1d46eed-d0fc-81e6-b71d-dfca201b272a", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "01eed3c3-b2ec-42e4-a639-f62d7457ade9", "citation": "Drug Information Handbook, 2016-2017 - 25th edition; Lexicomp Drug Reference Handbook; ISBN13: 9781591953531", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a170b49f-3058-a805-dff5-188fa08f9c98", "citation": "GREEN BOOK", "doc_type": "SRS", "public_domain": true }, { "uuid": "178c99f9-76c8-3f17-a08e-e45eebd2ff77", "citation": "Leander, J. D. \"Buprenorphine has potent kappa opioid receptor antagonist activity.\" Neuropharmacology 26.9 (1987): 1445-1447.", "url": "https://www.sciencedirect.com/science/article/pii/0028390887901122", "doc_type": "JA", "public_domain": true }, { "uuid": "c91ec71c-c97a-0cec-4dab-310e0c08333d", "citation": "https://www.accessdata.fda.gov/scripts/cder/daf/index.cfm?event=overview.process&ApplNo=210136", "doc_type": "DRUGS@FDA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "2b7944d4-a6bb-404e-8594-86bad05b9ef1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bca6d8d2-9b4c-4324-bff6-4ea2e10e60b0", "citation": "Stinchcomb, Audra L., et al. \"A solubility and related physicochemical property comparison of buprenorphine and its 3-alkyl esters.\" Pharmaceutical research 12.10 (1995): 1526-1529.", "url": "https://link.springer.com/article/10.1023/A%3A1016299824162", "doc_type": "JA", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4f989bd7-c60d-fe53-1d74-f0a576ebdd31", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "a976fa0d-5652-4bdf-9781-a47b39fcb73f", "citation": "Chang, Yan, David E. Moody, and Elinore F. McCance-Katz. \"Novel metabolites of buprenorphine detected in human liver microsomes and human urine.\" Drug Metabolism and Disposition 34.3 (2006): 440-448.", "url": "http://dmd.aspetjournals.org/content/dmd/34/3/440.full.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "692a820c-9c4d-42d7-97ec-80513402cd8c", "citation": "Drug Metab Dispos 1984;12(5):577", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f301088f-1a44-464f-896e-0aceeb100285", "citation": "Drug Metab Dispos 1984;12(5):577", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dacacb8d-691b-6efb-7a6e-c08467e20f72", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "9034e7c6-b7f5-4a4b-bdfa-0fe007651fef", "citation": "Drug Metab Dispos 1984;12(5):577", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e4af5c62-6f1d-aedd-f125-dc3cc0a428d6", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "76f2df59-762a-2db6-f594-8b98d42ca9a2", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "4520da4d-b3e8-4ef6-b19c-b42065333de9", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "83a2656e-4934-43fe-b31c-4696b04f35c1", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f9f4385e-9c36-44b6-92aa-331ed0e10536", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cb9d6752-b179-4185-af0e-2a7b7cbf5d28", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f28c9c65-aa0b-4f26-ba17-d5f463b26e4d", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "124e1c78-8bbc-40f3-8d84-c59eaee42010", "citation": "Cami-Kobeci, Gerta, et al. \"Structural determinants of opioid and NOP receptor activity in derivatives of buprenorphine.\" Journal of medicinal chemistry 54.19 (2011): 6531-6537.", "url": "https://pubs.acs.org/doi/epdf/10.1021/jm2003238", "doc_type": "JA", "public_domain": true }, { "uuid": "2980255d-d3f1-434a-a75e-5e810c38b411", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "38c94dd6-abde-4225-a729-32758648b6e6", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f84ee130-c92b-4f92-9088-346d7a122fd5", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "57fb6389-e9c5-4d81-8ea1-687df8de2f34", "citation": "BUPRENORPHINE monograph", "doc_type": "EP", "public_domain": true }, { "uuid": "192bc492-f45f-409c-a9c6-f975581f2302", "citation": "11.5", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d8633b48-4a3a-4b89-86d6-20806fd4957e", "id": "d8633b48-4a3a-4b89-86d6-20806fd4957e", "molfile": "\n Marvin 01132111132D \n\n 34 40 0 0 1 0 999 V2000\n -1.1970 -6.4104 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -2.0222 -6.8791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8348 -6.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4191 -5.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8348 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4254 -4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6034 -4.2945 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -1.2159 -3.6537 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -1.2189 -2.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9972 -2.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4535 -1.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9005 -2.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6126 -4.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7534 -4.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6034 -5.6977 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -1.1908 -4.9852 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -0.4750 -5.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1500 -5.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3720 -6.4166 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 0.0407 -7.1355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8626 -7.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2844 -5.7603 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -0.2844 -4.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0595 -5.3070 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 0.6032 -4.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5002 -4.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8346 -5.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6098 -6.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6098 -5.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8253 -6.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6380 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0475 -5.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6506 -6.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0600 -7.0949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 15 1 0 0 0 0\n 1 19 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 33 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 15 4 1 6 0 0 0\n 6 5 1 0 0 0 0\n 31 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 16 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 23 1 1 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 6 0 0 0\n 19 22 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 6 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 6 0 0 0\n 24 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 27 1 0 0 0 0\n 30 27 1 0 0 0 0\n 32 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\nM END", "smiles": "CC(C)(C)[C@](C)([C@H]1C[C@]23CC[C@@]1([C@H]4[C@]53CCN(CC6CC6)[C@@H]2Cc7ccc(c(c75)O4)O)OC)O", "formula": "C29H41NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e4307b0c-b8a5-48d9-847b-b044d151ebe4" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "467.6412", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "6f802d94-9ec7-4859-b7c1-8149e9222fbf", "version": "65", "structure": { "id": "49ce0c26-389a-40e6-aebb-acddf9696e02", "molfile": "\n Marvin 01132103522D \n\n 36 42 0 0 1 0 999 V2000\n -1.6034 -5.6977 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.1908 -4.9852 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.1970 -6.4104 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.3720 -6.4166 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -2.4191 -5.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2844 -5.7603 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -2.8348 -6.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0222 -6.8791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6034 -4.2945 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.2159 -3.6537 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -2.8348 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2844 -4.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0595 -5.3070 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -2.4254 -4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4750 -5.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1500 -5.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7534 -4.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2189 -2.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8346 -5.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6506 -6.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9972 -2.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6126 -4.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4535 -1.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9005 -2.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6380 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0407 -7.1355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0475 -5.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5002 -4.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0600 -7.0949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6032 -4.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6098 -6.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6098 -5.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8253 -6.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8626 -7.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0595 -6.2103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2002 -7.2948 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 5 2 0 0 0 0\n 3 8 1 0 0 0 0\n 9 2 1 0 0 0 0\n 10 22 1 0 0 0 0\n 11 5 1 0 0 0 0\n 12 2 1 0 0 0 0\n 13 6 1 0 0 0 0\n 14 11 1 0 0 0 0\n 2 15 1 6 0 0 0\n 4 16 1 6 0 0 0\n 1 17 1 1 0 0 0\n 18 10 1 0 0 0 0\n 19 13 1 0 0 0 0\n 20 7 1 0 0 0 0\n 21 18 1 0 0 0 0\n 22 17 1 0 0 0 0\n 23 21 1 0 0 0 0\n 24 21 1 0 0 0 0\n 25 11 2 0 0 0 0\n 26 4 1 0 0 0 0\n 27 25 1 0 0 0 0\n 13 28 1 6 0 0 0\n 29 20 1 0 0 0 0\n 13 30 1 1 0 0 0\n 31 19 1 0 0 0 0\n 32 19 1 0 0 0 0\n 33 19 1 0 0 0 0\n 34 26 1 0 0 0 0\n 6 35 1 1 0 0 0\n 8 7 1 0 0 0 0\n 6 12 1 0 0 0 0\n 14 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 16 15 1 0 0 0 0\n 20 27 2 0 0 0 0\n 23 24 1 0 0 0 0\n 3 36 1 1 0 0 0\nM END", "smiles": "CC(C)(C)[C@](C)([C@@]1([H])C[C@]23CC[C@@]1([C@@]4([H])[C@]53CCN(CC6CC6)[C@@H]2Cc7ccc(c(c75)O4)O)OC)O", "formula": "C29H41NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "467.6412", "optical_activity": "( - )", "references": [ "aaa29254-e0b9-4d88-afe4-dde12f562b27", "f5815945-1a0e-435a-a53c-031079cb8259", "b2eb7c0b-a62c-41e2-9ede-8687082d4a64" ], "stereo_centers": 7 }, "unii": "40D3SCR4GZ", "relationships": [ { "uuid": "613c6fb1-8b5c-4453-ae0c-c509cbdc27f5", "amount": { "uuid": "2ba6653a-0300-4e7a-94b1-0ab3b55c2dcd" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "20dda58a-f6da-4c13-88df-c0d02a670c30", "refuuid": "6f802d94-9ec7-4859-b7c1-8149e9222fbf", "name": "Buprenorphine", "unii": "40D3SCR4GZ", "linking_id": "40D3SCR4GZ", "ref_pname": "Buprenorphine", "substance_class": "reference" } }, { "uuid": "044b98ad-43fe-4037-ba58-00004a5d4763", "amount": { "uuid": "b8940f9f-672e-4484-9abb-c6d726655df5" }, "comments": "receptor binding and pharmacological activity", "type": "METABOLITE ACTIVE->PARENT", "references": [ "a48ff4a1-f110-4691-9140-c6b25857c6b3" ], "related_substance": { "uuid": "ed51741a-e77f-4eea-9369-eb0945cbede0", "refuuid": "d000d12a-237e-4e9d-9910-9a486a80c660", "name": "BUPRENORPHINE 3-GLUCURONIDE", "unii": "L7FYM9GI97", "linking_id": "L7FYM9GI97", "ref_pname": "BUPRENORPHINE 3-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "fd3f47ae-a727-4535-b5a9-9d5fe1416c4a", "amount": { "uuid": "857d02a3-6b70-4e0c-83f9-fd3e603f5624" }, "comments": "receptor binding and pharmacological activity", "type": "METABOLITE->PARENT", "references": [ "a48ff4a1-f110-4691-9140-c6b25857c6b3" ], "related_substance": { "uuid": "694d9edb-54fa-44dc-85ce-13a34c0299c8", "refuuid": "18c97113-dd25-4e0f-a756-68bdd65a9541", "name": "NORBUPRENORPHINE 3-GLUCURONIDE", "unii": "YPZ2R0PR50", "linking_id": "YPZ2R0PR50", "ref_pname": "NORBUPRENORPHINE 3-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "192d60ef-f476-4076-a814-161f9243aa13", "amount": { "uuid": "8f935001-5462-44a0-8cdd-ccb419d02a3f" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "aa2968cc-aafd-4430-9282-a7a1f5270221", "refuuid": "72311a45-c968-4741-9e48-a11af3d47736", "name": "Buprenorphine hydrochloride", "unii": "56W8MW3EN1", "linking_id": "56W8MW3EN1", "ref_pname": "Buprenorphine hydrochloride", "substance_class": "reference" } }, { "uuid": "117667e2-f0d8-4d6e-99b4-d42ccd0e7e66", "amount": { "uuid": "ad918b80-f89e-4f4f-a8c7-ac198abf2cff" }, "qualification": "FECAL; URINE", "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "2ff1d2bc-e58d-4c81-82c1-e4095407643e", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "9034e7c6-b7f5-4a4b-bdfa-0fe007651fef" ], "related_substance": { "uuid": "da8452e4-237b-4168-95a4-a4341bc6c3c2", "refuuid": "a6c47946-4e5e-4a58-af5e-e351cc815095", "name": "NORBUPRENORPHINE", "unii": "7E53B4O073", "linking_id": "7E53B4O073", "ref_pname": "NORBUPRENORPHINE", "substance_class": "reference" } }, { "uuid": "2edddb06-c3e5-4d1c-8a2f-066030bf6809", "amount": { "uuid": "61d1aa30-30fb-4dfe-b7a9-f18a84a36781", "average": 1.5, "high": 2.3, "low": 0.7, "units": "NANOMOLAR" }, "comments": "PARTIAL AGONIST", "qualification": "Ki", "type": "TARGET->PARTIAL AGONIST", "interaction_type": "BINDING", "references": [ "178c99f9-76c8-3f17-a08e-e45eebd2ff77" ], "related_substance": { "uuid": "7b039db3-d9b0-4c9e-a33b-507952a10b87", "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e", "name": "MU-TYPE OPIOID RECEPTOR", "unii": "1PE72K8X46", "linking_id": "1PE72K8X46", "ref_pname": "MU-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "ef7e69a6-66e1-4de0-82b1-61ae87beef62", "amount": { "uuid": "f23e581c-5a00-4a62-999d-55c9f05ae420", "average": 2.5, "high": 3.7, "low": 1.3, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INHIBITOR", "interaction_type": "BINDING", "references": [ "178c99f9-76c8-3f17-a08e-e45eebd2ff77", "124e1c78-8bbc-40f3-8d84-c59eaee42010" ], "related_substance": { "uuid": "602e7558-383a-403e-8056-a60a7177064d", "refuuid": "e30554c1-6304-468b-ad15-e72ab401a9d3", "name": "KAPPA-TYPE OPIOID RECEPTOR", "unii": "2BJ58BX78W", "linking_id": "2BJ58BX78W", "ref_pname": "KAPPA-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "c89b0123-5c1b-466e-8172-4145d601b3f6", "amount": { "uuid": "42ec0a93-a6c2-467c-a61c-0f253a65c142", "average": 6.1, "high": 6.5, "low": 5.7, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->INHIBITOR", "interaction_type": "BINDING", "references": [ "5e0af580-1527-d0c0-0f48-e7f0b9359bd6", "124e1c78-8bbc-40f3-8d84-c59eaee42010" ], "related_substance": { "uuid": "b2a23ae6-8ae0-4815-af54-455aeaa8d03f", "refuuid": "f7fdf82e-009b-4d48-8e86-35e9456cf4ef", "name": "DELTA-TYPE OPIOID RECEPTOR", "unii": "EV0PWK6TT6", "linking_id": "EV0PWK6TT6", "ref_pname": "DELTA-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "7db909ce-9588-47fa-9ab6-aaddebf5557e", "amount": { "uuid": "9a0eb281-eb2f-4cc8-82db-ba15265d50b8", "average": 96, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "66761c20-cbaa-b5db-79da-8c5ebf8ef9ad" ], "related_substance": { "uuid": "54041bd6-4b89-4e62-b308-8c215aa8324b", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "80318988-7d07-4a77-b5a0-a693b7506a1c", "amount": { "uuid": "8226526c-20ba-4caf-8fa8-6b760df3f2a2" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "a976fa0d-5652-4bdf-9781-a47b39fcb73f" ], "related_substance": { "uuid": "659fec81-df7f-4fdd-b679-0f9e08869bf5", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" } }, { "uuid": "f1fe3ab9-879c-45d8-9db1-fc594e6750c7", "amount": { "uuid": "910c7d19-60c2-41be-bfc2-01e4e960dc92" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "a976fa0d-5652-4bdf-9781-a47b39fcb73f" ], "related_substance": { "uuid": "d3314571-8047-4739-a205-355f1186a651", "refuuid": "067f0cda-3bfe-4af9-ba1e-dcd127c8a228", "name": "CYTOCHROME P450 3A5", "unii": "805SU96HKF", "linking_id": "805SU96HKF", "ref_pname": "CYTOCHROME P450 3A5", "substance_class": "reference" } }, { "uuid": "156ed2e6-74d4-4462-8f08-d5f0f432bd52", "amount": { "uuid": "0ba8fa2b-d554-48c5-9196-9052fb48e003" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "a976fa0d-5652-4bdf-9781-a47b39fcb73f" ], "related_substance": { "uuid": "fe607a7e-bcaf-473b-b556-139c8aceb3c2", "refuuid": "dfc5c3ca-bf96-45b7-acc6-3034e22bc3ee", "name": "CYTOCHROME P450 2C8", "unii": "L0423Z5LDW", "linking_id": "L0423Z5LDW", "ref_pname": "CYTOCHROME P450 2C8", "substance_class": "reference" } }, { "uuid": "acaea3a0-c1b7-4931-8ccd-1a439fea865d", "amount": { "uuid": "a1f1db3f-b3bb-4e83-af4d-f15f7735b80d" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "a976fa0d-5652-4bdf-9781-a47b39fcb73f" ], "related_substance": { "uuid": "fc63ffc7-b3b5-403d-acd5-ca4c6d818a91", "refuuid": "b01e4333-770a-4671-9605-3166a5889c91", "name": "CYTOCHROME P450 3A7", "unii": "5APY6NN4AW", "linking_id": "5APY6NN4AW", "ref_pname": "CYTOCHROME P450 3A7", "substance_class": "reference" } }, { "uuid": "ba1f0960-6567-4c55-8bd2-ea07636e5db0", "amount": { "uuid": "c2581445-066c-400c-976c-61d725b79054" }, "type": "DERIVATIVE->PARENT", "references": [ "bca6d8d2-9b4c-4324-bff6-4ea2e10e60b0" ], "related_substance": { "uuid": "f4d71a5a-f619-45ab-937b-9ed7c17a8794", "refuuid": "691c7418-54a3-4099-85ef-07bca165778d", "name": "BUPRENORPHINE 3-HEXANOATE", "unii": "P7291Y4I7Z", "linking_id": "P7291Y4I7Z", "ref_pname": "BUPRENORPHINE 3-HEXANOATE" } }, { "uuid": "8205ff90-826b-48db-bbf8-92b968745ec3", "amount": { "uuid": "1800de52-71f5-41f9-bd8b-b094316ccf18" }, "type": "IMPURITY->PARENT", "references": [ "38c94dd6-abde-4225-a729-32758648b6e6" ], "related_substance": { "uuid": "9353794c-7e3d-474c-b87e-036666fdd8d6", "refuuid": "a8f71c9d-e1df-4a05-b68a-751198be7805", "name": "N-Cyanonorbuprenorphine 3-methyl ether", "unii": "KG39DS8EEH", "linking_id": "KG39DS8EEH", "ref_pname": "N-Cyanonorbuprenorphine 3-methyl ether", "substance_class": "reference" } }, { "uuid": "278307ef-aca7-41dd-91e0-2b1faf11b3f7", "amount": { "uuid": "34f1786d-9e2a-49cf-a631-6f0f7cbf6e8b" }, "type": "IMPURITY->PARENT", "references": [ "83a2656e-4934-43fe-b31c-4696b04f35c1" ], "related_substance": { "uuid": "570385a7-135b-4cf8-a8e0-2d2ebf50ec3c", "refuuid": "85453e40-a956-4220-97b1-bf9008536e44", "name": "ETHENOBUPRENORPHINE", "unii": "BB3EB8AQ3P", "linking_id": "BB3EB8AQ3P", "ref_pname": "ETHENOBUPRENORPHINE", "substance_class": "reference" } }, { "uuid": "fcdb22d0-e256-4b71-90e7-80f398982579", "amount": { "uuid": "6d0c95e4-8591-4490-9951-d2afb1cb5ba5" }, "type": "IMPURITY->PARENT", "references": [ "f9f4385e-9c36-44b6-92aa-331ed0e10536" ], "related_substance": { "uuid": "f0c9804f-7608-4c06-8e4f-02d4ff7477b1", "refuuid": "550ad8b2-9c49-4ef9-8bbb-ec2328cf0073", "name": "Buprenorphine Furan", "unii": "Z7N3HL2G9P", "linking_id": "Z7N3HL2G9P", "ref_pname": "Buprenorphine Furan", "substance_class": "reference" } }, { "uuid": "9c397d4d-89bc-421f-b721-22194c8e3721", "amount": { "uuid": "563b3aba-cf29-4a7b-bab7-563968557a81" }, "type": "IMPURITY->PARENT", "references": [ "2980255d-d3f1-434a-a75e-5e810c38b411" ], "related_substance": { "uuid": "e3483211-8a99-44b6-bf24-4523e2e7c7c2", "refuuid": "e18dd88e-14b8-4575-9025-6afaa1cce1f9", "name": "Buprenorphine 2,2’-dimer", "unii": "43MH6YYF5W", "linking_id": "43MH6YYF5W", "ref_pname": "Buprenorphine 2,2’-dimer", "substance_class": "reference" } }, { "uuid": "3491cc25-8a24-4752-bb93-9ff8bd28ffbe", "amount": { "uuid": "fa0a4eff-3f0d-4658-98d2-2f0ad443323b", "average": 116, "high": 204, "low": 28, "units": "NANOMOLAR" }, "comments": "[35S]GTPγS Binding, 21.0 +/- 8.4 simulation", "qualification": "EC50", "type": "TARGET->PARTIAL AGONIST", "related_substance": { "uuid": "fd1c96da-f777-4717-9102-b7ad4c4e08d5", "refuuid": "60afa5d8-41dd-4038-a21b-d3db3032e5e5", "name": "NOCICEPTIN RECEPTOR", "unii": "DVO6VKD7IJ", "linking_id": "DVO6VKD7IJ", "ref_pname": "NOCICEPTIN RECEPTOR", "substance_class": "reference" } }, { "uuid": "440f4c4d-4df0-40d2-9e2c-c9443307ae2a", "amount": { "uuid": "c0bb1755-5e58-4b78-bd7d-17de22989681", "average": 10.2, "high": 12.4, "low": 8, "units": "NANOMOLAR" }, "comments": "[35S]GTPγS Binding, 28.7 +/- 1.1 simulation", "qualification": "EC50", "type": "TARGET->PARTIAL AGONIST", "references": [ "124e1c78-8bbc-40f3-8d84-c59eaee42010" ], "related_substance": { "uuid": "ed55833a-4e47-42fd-942a-e0c6e62ff699", "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e", "name": "MU-TYPE OPIOID RECEPTOR", "unii": "1PE72K8X46", "linking_id": "1PE72K8X46", "ref_pname": "MU-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "823682e2-ed24-458b-8b91-16436a56f1e6", "amount": { "uuid": "7653d239-b126-47e3-b311-d4d93ee65095", "average": 77.4, "high": 93.4, "low": 61.4, "units": "NANOMOLAR" }, "qualification": "Ki", "type": "TARGET->PARTIAL AGONIST", "related_substance": { "uuid": "c1c1eadd-3437-4a5c-a997-888338b31e86", "refuuid": "60afa5d8-41dd-4038-a21b-d3db3032e5e5", "name": "NOCICEPTIN RECEPTOR", "unii": "DVO6VKD7IJ", "linking_id": "DVO6VKD7IJ", "ref_pname": "NOCICEPTIN RECEPTOR", "substance_class": "reference" } }, { "uuid": "35b275b3-ba34-4a70-8772-da3a525fc2d7", "amount": { "uuid": "ce0285f7-f064-4416-b49b-dbc0fd54a02b" }, "type": "IMPURITY->PARENT", "references": [ "cb9d6752-b179-4185-af0e-2a7b7cbf5d28" ], "related_substance": { "uuid": "bdf8c316-7370-432e-bc88-e8dc3c0674ad", "refuuid": "fd68033c-7b3b-4fb4-994f-9f5385c5a535", "name": "7-Dehydroxy Buprenorphine", "unii": "Z9M3CU4K4V", "linking_id": "Z9M3CU4K4V", "ref_pname": "7-Dehydroxy Buprenorphine", "substance_class": "reference" } }, { "uuid": "56d19b02-3ecd-43af-ad2f-7fe508b0a22f", "amount": { "uuid": "5f67f182-43f1-4f57-b016-1a52ca2954de" }, "type": "IMPURITY->PARENT", "references": [ "f28c9c65-aa0b-4f26-ba17-d5f463b26e4d" ], "related_substance": { "uuid": "d58e92f6-c3ca-42b2-bfb0-e987a6401387", "refuuid": "aaf64b48-b19b-4c64-b8b4-13234be9ac78", "name": "N-(3-N-Butyl)norbuprenorphine", "unii": "2CCA2UA7DQ", "linking_id": "2CCA2UA7DQ", "ref_pname": "N-(3-N-Butyl)norbuprenorphine", "substance_class": "reference" } }, { "uuid": "336da015-e4ab-43f3-be25-c6388f6e517f", "amount": { "uuid": "2f5352b4-d515-4899-87c2-a8cb5622ef6b" }, "type": "IMPURITY->PARENT", "references": [ "192bc492-f45f-409c-a9c6-f975581f2302" ], "related_substance": { "uuid": "291622ea-9102-4ec4-8496-0790525037bd", "refuuid": "2c7695f2-e3b4-41d3-836f-3c3f579f56ee", "name": "N-(3-BUTENYL)NORBUPRENORPHINE", "unii": "FK1305SA1B", "linking_id": "FK1305SA1B", "ref_pname": "N-(3-BUTENYL)NORBUPRENORPHINE", "substance_class": "reference" } }, { "uuid": "3afdbff6-356d-4c80-9095-fe6912fa3e6e", "amount": { "uuid": "36571c40-ea44-4057-8981-cbb29272f750" }, "type": "IMPURITY->PARENT", "references": [ "f84ee130-c92b-4f92-9088-346d7a122fd5" ], "related_substance": { "uuid": "010f5883-fde3-4ca6-9cd8-1e605d471da6", "refuuid": "4d4b61a7-6cff-4b6d-8c2f-e0e031a01a40", "name": "3-O-Methylbuprenorphine", "unii": "YW439G497A", "linking_id": "YW439G497A", "ref_pname": "3-O-Methylbuprenorphine", "substance_class": "reference" } }, { "uuid": "d1f417c7-0df8-4504-be0d-47d208e7feb1", "amount": { "uuid": "8fb147aa-e3e0-498f-96bb-2c6dea756af5" }, "type": "IMPURITY->PARENT", "references": [ "4520da4d-b3e8-4ef6-b19c-b42065333de9" ], "related_substance": { "uuid": "97025d31-0e08-44c6-aefe-b61526b05a3d", "refuuid": "4bcdea8a-bb6a-455f-93a4-99c63747d797", "name": "6-O-Desmethyl Buprenorphine", "unii": "YX9AX89DKP", "linking_id": "YX9AX89DKP", "ref_pname": "6-O-Desmethyl Buprenorphine", "substance_class": "reference" } } ], "names": [ { "uuid": "e435d147-afe0-8ad1-a663-322deb6a81af", "name": "ALKS-5461 COMPONENT BUPRENORPHINE", "stdName": "ALKS-5461 COMPONENT BUPRENORPHINE", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4723ebd2-f929-c216-de73-ad713212a8ce" ], "display_name": false }, { "uuid": "cf73414f-b6a0-37c9-5532-eb7c84c73aa1", "name": "BRIXADI", "stdName": "BRIXADI", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c91ec71c-c97a-0cec-4dab-310e0c08333d" ], "display_name": false }, { "uuid": "88036899-2b82-4a31-91d3-ec4286103547", "name": "BUPRENORPHIN", "stdName": "BUPRENORPHIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e57fdc2-df01-420d-bcae-0daf73f30b1b", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "51accc24-ccb0-49d7-8d50-48b66046a515", "name": "BUPRENORPHINE [EMA EPAR]", "stdName": "BUPRENORPHINE [EMA EPAR]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2835c7e9-9ca2-436f-9b0f-a2c642725561", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "e20bbe0b-3838-9a39-ad50-00d3de495c7f", "name": "BUPRENORPHINE [EP IMPURITY]", "stdName": "BUPRENORPHINE [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "31930acb-d36d-40a7-8646-7f6a137be449" ], "display_name": false }, { "uuid": "720c1561-0785-5e03-a80c-eb388a716d0b", "name": "BUPRENORPHINE [EP MONOGRAPH]", "stdName": "BUPRENORPHINE [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dacacb8d-691b-6efb-7a6e-c08467e20f72" ], "display_name": false }, { "uuid": "2f8d185e-9ba9-4516-afd3-af8c5f8aab02", "name": "BUPRENORPHINE [JAN]", "stdName": "BUPRENORPHINE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5a4d5ee1-d3d8-4b7a-9403-7d9054c1dc65", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "9a347602-fa1c-410c-afc4-5635fbd01c46", "name": "BUPRENORPHINE [MART.]", "stdName": "BUPRENORPHINE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1054cb2a-bc80-4b17-91b4-055648888790" ], "display_name": false }, { "uuid": "93667f2b-3b50-47da-917b-aad8a6414e8b", "name": "BUPRENORPHINE [MI]", "stdName": "BUPRENORPHINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9ff5ba31-127b-410e-9408-1415ddf24a6a", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "705c2479-c558-43c0-982c-eb6bb7e0ef1c", "name": "BUPRENORPHINE [ORANGE BOOK]", "stdName": "BUPRENORPHINE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "08a53262-1bcf-4f84-ba14-b50dae16ac95" ], "display_name": false }, { "uuid": "6defe135-2869-4b44-bb64-1b28e9744314", "name": "BUPRENORPHINE [VANDF]", "stdName": "BUPRENORPHINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8265adfb-62ca-4f8f-b685-57e20e0b9c25", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "a9dca5c1-abf3-1a19-4899-b0706701334c", "name": "BUTRANS", "stdName": "BUTRANS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "7e206f22-ab3b-b69d-5cf3-490eb4370bb2" ], "display_name": false }, { "uuid": "61039975-114f-46c5-87dd-c8dca769c170", "name": "Buprenorphine", "stdName": "BUPRENORPHINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "c66d2833-5e34-4ccd-a3ca-c180396855a9", "da5b9f49-4f15-4667-b581-54d3a87957fd", "6639b649-af25-4b1e-97f7-76ccb617fff4", "b2eb7c0b-a62c-41e2-9ede-8687082d4a64", "f0e961fb-56cd-47fc-8934-120ca78be83c", "3b27ea83-92dc-4c0f-bf5f-1c59d18b43b0", "2835c7e9-9ca2-436f-9b0f-a2c642725561", "08a53262-1bcf-4f84-ba14-b50dae16ac95", "1054cb2a-bc80-4b17-91b4-055648888790", "4a6e0b3e-02f2-4e04-b25e-099e4eed69e2", "b859daa8-a17e-434d-9f99-8d4f2733d52d", "5a4d5ee1-d3d8-4b7a-9403-7d9054c1dc65", "9ff5ba31-127b-410e-9408-1415ddf24a6a", "32a0a922-29aa-46f7-b12a-04398369f85d", "31930acb-d36d-40a7-8646-7f6a137be449", "8265adfb-62ca-4f8f-b685-57e20e0b9c25", "41719767-ff59-48dd-9903-3e5d349e2110", "f5ceadbf-aaa4-451d-adf6-1dda8f31628a", "57c696eb-19dd-45fc-b5f3-2b3e34909eef", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "b71923d4-ddd6-41f8-ba73-8d6572c80617", "name_org": "INN" } ] }, { "uuid": "5bf130df-b2f3-7761-d019-abca85c7de8d", "name": "Buprenorphine [WHO-DD]", "stdName": "BUPRENORPHINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e4af5c62-6f1d-aedd-f125-dc3cc0a428d6" ], "display_name": false }, { "uuid": "c5371cad-ac74-42ac-8ed7-c8e27009d322", "name": "PROBUPHINE", "stdName": "PROBUPHINE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f5c696b8-8a7d-4f6a-a170-cc73bb4654ae", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "031b5d8d-6e62-9797-c4e4-ead53ddc17e6", "name": "SUBLOCADE", "stdName": "SUBLOCADE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "24d136e0-eff3-62c3-417f-620116878d45" ], "display_name": false }, { "uuid": "530226ad-3bc2-4b2d-97d7-baba4ab2d946", "name": "SUBOXONE", "stdName": "SUBOXONE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "dd5c0e7b-6a09-4983-8431-46080e88f158", "6362cd50-ba45-4e32-80cc-c9db85c7d56e" ], "display_name": false }, { "uuid": "fbf01cad-50a8-4b99-9b83-e69a71a758a4", "name": "TEMGESIC", "stdName": "TEMGESIC", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "19b9a91f-991f-46ff-81c9-159e692b6c52", "5a4d5ee1-d3d8-4b7a-9403-7d9054c1dc65" ], "display_name": false }, { "uuid": "850a9b36-79e6-4704-b41f-10348af48deb", "name": "buprenorphine [INN]", "stdName": "BUPRENORPHINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b2eb7c0b-a62c-41e2-9ede-8687082d4a64" ], "display_name": false } ], "properties": [ { "uuid": "5ad8a5bb-b61f-4421-9b43-206035b5a07f", "name": "Volume of Distribution", "value": { "uuid": "a89eb431-7f38-4df7-b21e-cf13550f4b19", "average": 142, "high": 187, "low": 97, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "01eed3c3-b2ec-42e4-a639-f62d7457ade9" ] }, { "uuid": "2b146d18-ffaa-41d0-b6fe-1a50b61a2bd7", "name": "Biological Half-life", "value": { "uuid": "d8193851-87a1-4940-b664-da65e48d7775", "average": 35, "high": 49, "low": 21, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "66761c20-cbaa-b5db-79da-8c5ebf8ef9ad" ] } ], "modifications": { "uuid": "674b28ee-3ac7-411c-a394-d56adcc209e5" } } ] }