{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c4eb5166-d359-4d8f-bb4c-c4edb1d1a817",
          "code": "A10BX06",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Other blood glucose lowering drugs, excl. insulins|benfluorex",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A10BX06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "e6c22629-3a57-44a6-8cfd-f247d9851aef",
          "code": "QA10BX06",
          "comments": "VATC|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Other blood glucose lowering drugs, excl. insulins|benfluorex",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA10BX06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "5f026d0a-a971-4d3c-9ad7-bd394d7c3611",
          "code": "23602-78-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23602-78-0",
          "code_system": "CAS",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3",
            "49ce0524-033e-4280-9ab3-638318839267"
          ]
        },
        {
          "uuid": "fbcd3591-2132-40fd-b7a7-fb5e26123a50",
          "code": "C72936",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72936",
          "code_system": "NCI_THESAURUS",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "edf5082b-8dc9-49c7-bc99-0c05232bb7aa",
          "code": "C001584",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67001584",
          "code_system": "MESH",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "c198f42a-579f-4da0-ac7c-7b7b00d36fe4",
          "code": "BENFLUOREX",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benfluorex",
          "code_system": "WIKIPEDIA",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "fcd7159c-332c-48f9-ab0e-1e02acfaf29b",
          "code": "SUB05714MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "e77a7424-de1a-4947-ab7e-75b111852746",
          "code": "3054",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3054",
          "code_system": "INN",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "b439b2dd-eb1c-4f14-a600-9792d42184c9",
          "code": "18880",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/18880/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "a3cf9a02-4a68-45ec-93dd-3590323038ab",
          "code": "m2311",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2311?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "b59e3ef3-835f-4cc3-8d28-9fd1573ed3c4",
          "code": "CHEMBL400599",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL400599",
          "code_system": "ChEMBL",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "7d3d5350-5987-4b97-a85a-77d7fb7b7628",
          "code": "245-777-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.601",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "7402bb30-895a-4f72-ae2e-87d950225a26",
          "code": "2318",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2318",
          "code_system": "PUBCHEM",
          "references": [
            "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3"
          ]
        },
        {
          "uuid": "18cf7749-559b-5f50-34ee-80776a88011b",
          "code": "DTXSID5048471",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5048471",
          "code_system": "EPA CompTox",
          "references": [
            "aa125c85-c753-46ab-e76d-5e5f7afa366d"
          ]
        },
        {
          "uuid": "23841a3b-ad70-3ce0-fe4d-ef4bd7743fe1",
          "code": "C29728",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anorexiant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29728",
          "code_system": "NCI_THESAURUS",
          "references": [
            "57f5ef1f-0672-8d87-9d3a-6e7351f55d69"
          ]
        },
        {
          "uuid": "b07bc506-ea5d-2754-396e-1814244de229",
          "code": "C29703",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29703",
          "code_system": "NCI_THESAURUS",
          "references": [
            "57f5ef1f-0672-8d87-9d3a-6e7351f55d69"
          ]
        },
        {
          "uuid": "39f8f69b-3128-4054-b992-bb1f0f667949",
          "code": "403FO0NQG3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1018ff34-3c84-7d9c-c0f2-880deeb4b3c7",
          "code": "307",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/307",
          "code_system": "DRUG CENTRAL",
          "references": [
            "57f5ef1f-0672-8d87-9d3a-6e7351f55d69"
          ]
        },
        {
          "uuid": "6b048df7-1ce6-3935-b6ac-17d81d3604fa",
          "code": "DB09022",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09022",
          "code_system": "DRUG BANK",
          "references": [
            "57f5ef1f-0672-8d87-9d3a-6e7351f55d69"
          ]
        },
        {
          "uuid": "ae8613c3-d2d1-ffeb-c60c-788a41072a76",
          "code": "100000086617",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8f686167-a7e9-dbef-d5c8-9014e3ec2000"
          ]
        },
        {
          "uuid": "3cb5ea50-2b57-063c-cd14-32460dc56455",
          "code": "757396",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757396",
          "code_system": "NSC",
          "references": [
            "5a01e802-a22e-e85c-5b54-a9dde16d5f4d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "05856f89-c652-44eb-aebd-d6c94c91dfb7",
          "amount": {
            "uuid": "c421c358-1587-4f4f-aa77-c8c62b4dc27e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0f2f46b6-5d57-43fe-8bc5-daba46756873",
            "refuuid": "eff235da-0aba-4a40-9f1d-1a66fb2009c0",
            "name": "BENFLUOREX",
            "unii": "403FO0NQG3",
            "linking_id": "403FO0NQG3",
            "ref_pname": "BENFLUOREX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3cc20ef1-4a87-41fa-80cd-4a6ffb066736",
          "amount": {
            "uuid": "8c616e58-6339-49c0-849f-4cf6c2a02c86"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f402574e-0527-44b4-85f6-c00b1cc16a24",
            "refuuid": "f59dc070-bd80-4153-89f0-73f7a4c02742",
            "name": "BENFLUOREX HYDROCHLORIDE",
            "unii": "X7O165XZ00",
            "linking_id": "X7O165XZ00",
            "ref_pname": "BENFLUOREX HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a6db653d-de4a-4373-97cd-427bc8fe9a72",
          "amount": {
            "uuid": "27d72e21-9f0b-4c8f-ad34-f14670db8ecb"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "70ea2524-70ae-4bf8-a70f-a499b5be4dcd",
            "refuuid": "12e64351-9d14-4ae0-b8d4-1c06997bbfe4",
            "name": "BENFLUOREX, (R)-",
            "unii": "8BUA1X0L5B",
            "linking_id": "8BUA1X0L5B",
            "ref_pname": "BENFLUOREX, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f234726d-b656-4363-9c11-f3b479fded2b",
          "amount": {
            "uuid": "4745f788-ec3a-4578-b849-6317f9fc87fd"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "17fe6862-69c6-4e82-9040-30b71b8e4e95",
            "refuuid": "516a631b-c764-4434-ad2a-7cd8f7f50d4f",
            "name": "BENFLUOREX, (S)-",
            "unii": "158VAA0Q5O",
            "linking_id": "158VAA0Q5O",
            "ref_pname": "BENFLUOREX, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cbeb80e0-aa64-4c1f-8145-fe8d2bd95443",
          "amount": {
            "uuid": "fa1198e2-4d7b-4c77-83ee-23ab56fe9444"
          },
          "comments": "Preferential stimulation of valvular 5-HT2B receptors by norfenfluramine, ergot drugs, or 5-HT released from carcinoid tumors (with or without accompanying 5-HT2A receptor activation) may contribute to valvular fibroplasia in humans.",
          "type": "METABOLITE TOXIC->PARENT",
          "references": [
            "2ee3de7b-0c6b-4665-9aa3-f66feb884bc8"
          ],
          "related_substance": {
            "uuid": "431baa05-98b0-4021-a870-7928e24257d5",
            "refuuid": "1a8941c5-05a3-4922-8ace-2249101efcd9",
            "name": "Norfenfluramine",
            "unii": "037A9J3PSW",
            "linking_id": "037A9J3PSW",
            "ref_pname": "Norfenfluramine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1d0566d1-1132-4e70-98a9-d485756ffdea",
          "name": "BENFLUOREX",
          "stdName": "BENFLUOREX",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af105cd4-d234-4193-a206-ac3f9e3174e3",
            "cc47df48-a663-44d9-a10a-0b82e2d17a7e",
            "4f9aa744-74f8-42a9-a63a-6fccd296f1e3",
            "14e07746-d1b8-4556-a5c1-4659bb2610dd",
            "0f11687e-1962-4802-9325-412a4cb2740f",
            "daf845a2-802d-4a95-88e4-2c7cdac21319",
            "44f7d027-b44b-4cce-94d2-2833cabd3fda",
            "bdc22fb1-d04d-4dfd-a990-713ce1f16c94"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "7cdc01e0-7867-452f-b3e0-51c1df648630",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d364dc27-9520-46e3-ab63-a12801b53795",
          "name": "BENFLUOREX [MI]",
          "stdName": "BENFLUOREX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc47df48-a663-44d9-a10a-0b82e2d17a7e",
            "bdc22fb1-d04d-4dfd-a990-713ce1f16c94"
          ],
          "display_name": false
        },
        {
          "uuid": "a4e1791c-7a69-f641-85f8-9c96a80a19d5",
          "name": "Benfluorex [WHO-DD]",
          "stdName": "BENFLUOREX [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a4c9ab-eab4-9931-9195-ca47c4d0cd0b"
          ],
          "display_name": false
        },
        {
          "uuid": "2289ff7a-1c3b-44f3-9fcf-58e011aee39e",
          "name": "MEDIAXAL",
          "stdName": "MEDIAXAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0ce1790-e9bf-4970-882c-690219e062b2",
            "ba8de837-5e28-4e41-82da-29ba685662ef"
          ],
          "display_name": false
        },
        {
          "uuid": "5348846f-14c5-7c97-38da-fcdd951ab3a0",
          "name": "NSC-757396",
          "stdName": "NSC-757396",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a01e802-a22e-e85c-5b54-a9dde16d5f4d"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec8a1ee-4021-48a9-8cd3-194b1d2651bb",
          "name": "benfluorex [INN]",
          "stdName": "BENFLUOREX [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f11687e-1962-4802-9325-412a4cb2740f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "14e07746-d1b8-4556-a5c1-4659bb2610dd",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f11687e-1962-4802-9325-412a4cb2740f",
          "citation": "INN Proposed List 25",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL25.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bdc22fb1-d04d-4dfd-a990-713ce1f16c94",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc47df48-a663-44d9-a10a-0b82e2d17a7e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba8de837-5e28-4e41-82da-29ba685662ef",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0ce1790-e9bf-4970-882c-690219e062b2",
          "citation": "D07192",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f9aa744-74f8-42a9-a63a-6fccd296f1e3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89c6cbc1-abb1-40bf-a270-1bf9a79d29c3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4284473-2385-44ce-920e-8474b6ebc7c3",
          "citation": "SRS import [403FO0NQG3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=403FO0NQG3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74abe6b2-f7f7-45a1-8e0a-58c09e34dab8",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af105cd4-d234-4193-a206-ac3f9e3174e3",
          "citation": "BENFLUOREX [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "daf845a2-802d-4a95-88e4-2c7cdac21319",
          "citation": "BENFLUOREX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44f7d027-b44b-4cce-94d2-2833cabd3fda",
          "citation": "BENFLUOREX [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa125c85-c753-46ab-e76d-5e5f7afa366d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23602-78-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f686167-a7e9-dbef-d5c8-9014e3ec2000",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "57f5ef1f-0672-8d87-9d3a-6e7351f55d69",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "49ce0524-033e-4280-9ab3-638318839267",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5a01e802-a22e-e85c-5b54-a9dde16d5f4d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "97a4c9ab-eab4-9931-9195-ca47c4d0cd0b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2ee3de7b-0c6b-4665-9aa3-f66feb884bc8",
          "citation": "Andrejak, Michel, and Christophe Tribouilloy. \"Drug-induced valvular heart disease: an update.\" Archives of Cardiovascular Diseases 106.5 (2013): 333-339.",
          "url": "https://www.sciencedirect.com/science/article/pii/S187521361300034X",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ffffef4e-1d78-4e96-a194-b73e28f39fd4",
          "id": "ffffef4e-1d78-4e96-a194-b73e28f39fd4",
          "molfile": "\n  Marvin  01132113152D          \n\n 25 26  0  0  0  0            999 V2000\n   -0.9156   -0.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9156    0.5056    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.6029    0.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3271    0.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340    0.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7434    0.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7434   -0.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -0.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3271   -0.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -1.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2239   -1.5096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8464   -1.5096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -2.3295    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1890    0.9009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4885    0.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2126    0.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8975    0.4222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6928    0.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6928    1.6888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4366    0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4366   -0.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1656   -0.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8922   -0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8922    0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1656    0.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 14  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1cccc(c1)C(F)(F)F)NCCOC(=O)c2ccccc2",
          "formula": "C19H20F3NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a1532286-7eb8-4a9e-a3a3-ffd02022377b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "351.3635",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eff235da-0aba-4a40-9f1d-1a66fb2009c0",
      "version": "18",
      "structure": {
        "id": "28fc9fb2-e9e3-4965-9f32-f129c7547a2d",
        "molfile": "\n  Marvin  01132102142D          \n\n 25 26  0  0  0  0            999 V2000\n   -2.3271    0.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3271   -0.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340    0.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6029    0.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -0.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7434    0.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9156    0.5056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7434   -0.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -1.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1890    0.9009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9156   -0.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2239   -1.5096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8464   -1.5096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0340   -2.3295    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4885    0.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2126    0.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8975    0.4222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6928    0.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4366    0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6928    1.6888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4366   -0.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1656    0.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1656   -0.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8922    0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8922   -0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  2  0  0  0  0\n 21 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n  6  8  1  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
        "smiles": "CC(Cc1cccc(c1)C(F)(F)F)NCCOC(=O)c2ccccc2",
        "formula": "C19H20F3NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "351.3635",
        "optical_activity": "( + / - )",
        "references": [
          "74abe6b2-f7f7-45a1-8e0a-58c09e34dab8",
          "d4284473-2385-44ce-920e-8474b6ebc7c3",
          "0f11687e-1962-4802-9325-412a4cb2740f"
        ],
        "stereo_centers": 1
      },
      "unii": "403FO0NQG3"
    }
  ]
}