{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9311c2d9-3901-4600-98c9-31700643c96d",
          "code": "107534-96-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=107534-96-3",
          "code_system": "CAS",
          "references": [
            "ea4a8de3-ffd8-496a-b87f-edb309b085d7",
            "cf3796de-78b6-46b9-bbfb-9bff8fe4c1d1"
          ]
        },
        {
          "uuid": "d1e1d5eb-cfa8-444d-91b1-b942c148c387",
          "code": "128997",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3984",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ea4a8de3-ffd8-496a-b87f-edb309b085d7"
          ]
        },
        {
          "uuid": "f9f5cd91-3d5c-4645-a9bb-3eb8a10dead4",
          "code": "m10499",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10499?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ea4a8de3-ffd8-496a-b87f-edb309b085d7"
          ]
        },
        {
          "uuid": "aa7073d5-05cb-41cd-bac9-9b7d84bf6bcd",
          "code": "SUB181707",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ea4a8de3-ffd8-496a-b87f-edb309b085d7"
          ]
        },
        {
          "uuid": "538b5d3e-0423-49b3-808f-5d0641b4d128",
          "code": "86102",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86102",
          "code_system": "PUBCHEM",
          "references": [
            "ea4a8de3-ffd8-496a-b87f-edb309b085d7"
          ]
        },
        {
          "uuid": "00dcb7b1-63ab-6ce7-fac6-96c78db3ef17",
          "code": "Tebuconazole",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tebuconazole",
          "code_system": "WIKIPEDIA",
          "references": [
            "6c83ea6e-b28e-8c17-262c-c42aef1439e8"
          ]
        },
        {
          "uuid": "5bdcc7ed-f407-0e0a-8070-e4b8f0183e12",
          "code": "7448",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7448",
          "code_system": "HSDB",
          "references": [
            "9dd4b9cd-c9f2-948e-c5dc-47f569e93191"
          ]
        },
        {
          "uuid": "4e8ab903-7345-3d4c-3adc-9ea85462aec6",
          "code": "DTXSID9032113",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9032113",
          "code_system": "EPA CompTox",
          "references": [
            "41aeda7e-ca37-daf0-def3-6f945a4bfbf6"
          ]
        },
        {
          "uuid": "31a7cf14-ecc2-4710-8b5e-c67574629e71",
          "code": "401ATW8TRW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "86a2e0ca-5905-d12b-f1ca-e4ab6eba3d42",
          "code": "81781",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81781",
          "code_system": "CHEBI",
          "references": [
            "d0775709-276a-219b-f2f1-353ddecb8275"
          ]
        },
        {
          "uuid": "7027749e-ac03-7412-9b69-f3419f26edda",
          "code": "100000167479",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "23fbf16f-ff3c-3235-8790-233603ed36b9"
          ]
        },
        {
          "uuid": "de67a809-6ca6-6d93-d2c2-2d2800c42814",
          "code": "tebuconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tebuconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "d2f2e30b-32f1-2f3e-938a-cd1165fc26ab"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "62d6ff41-1aee-473f-8980-9aced51b9fd9",
          "name": "(RS)-1-(4-CHLOROPHENYL)-4,4-DIMETHYL-3-(1H-1,2,4-TRIAZOL-1- YLMETHYL)PENTAN-3-OL",
          "stdName": "(RS)-1-(4-CHLOROPHENYL)-4,4-DIMETHYL-3-(1H-1,2,4-TRIAZOL-1- YLMETHYL)PENTAN-3-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "26992c15-4964-4459-b206-ca6679ab58f1",
          "name": "(RS)-1-P-CHLOROPHENYL-4,4-DIMETHYL-3-(1H-1,2,4-TRIAZOL-1- YLMETHYL)PENTAN-3-OL",
          "stdName": "(RS)-1-P-CHLOROPHENYL-4,4-DIMETHYL-3-(1H-1,2,4-TRIAZOL-1- YLMETHYL)PENTAN-3-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "af8d1218-596d-43d9-aeac-e4652afdbba3",
          "name": ".ALPHA.-(2-(4-CHLOROPHENYL)ETHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)- 1H-1,2,4-TRIAZOLE-1-ETHANOL",
          "stdName": ".ALPHA.-(2-(4-CHLOROPHENYL)ETHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)- 1H-1,2,4-TRIAZOLE-1-ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "acf3674e-aa0d-47b6-af1a-fba82f025998",
          "name": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .ALPHA.-(2-(4- CHLOROPHENYL)ETHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)-",
          "stdName": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .ALPHA.-(2-(4- CHLOROPHENYL)ETHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "7bd39274-4b3b-48f3-b389-972b05d244a0",
          "name": "BAY-HWG-1608",
          "stdName": "BAY-HWG-1608",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "6760d483-f34e-48c9-8966-054733360071",
          "name": "ELITE",
          "stdName": "ELITE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "d0a78c0a-337f-46d6-b230-904fa0866f01",
          "name": "ETHYLTRIANOL",
          "stdName": "ETHYLTRIANOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "cda84fc1-7694-4ff3-b09f-b5fe8548b297",
          "name": "ETILTRIANOL",
          "stdName": "ETILTRIANOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "7581e2df-2036-4644-9139-b509c4f82c15",
          "name": "FENETRAZOLE",
          "stdName": "FENETRAZOLE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "830700e5-aac9-46a7-b58f-5d6df6323804",
          "name": "SILVACURE",
          "stdName": "SILVACURE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c978a94-5d53-4c2f-8c00-b60470f09af2",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "e12fd5ea-74ea-4228-bdc6-e92a11c3c896",
          "name": "SPARTA",
          "stdName": "SPARTA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c978a94-5d53-4c2f-8c00-b60470f09af2",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "81889254-c9e1-4512-bca7-cc41ca227351",
          "name": "TEBUCONAZOLE",
          "stdName": "TEBUCONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a8c08fe-f37b-4b58-95db-12105f0f6166",
            "21433ef2-8601-46a6-911c-f90f802691bc",
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786",
            "c6cc42bf-d52a-464f-baaa-88f791761f3b"
          ],
          "display_name": true
        },
        {
          "uuid": "f06ffafc-a379-429b-b9e0-ce67d0ec76ae",
          "name": "TEBUCONAZOLE [ISO]",
          "stdName": "TEBUCONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        },
        {
          "uuid": "359ca3cc-0429-4287-aa7b-79b02e1633a4",
          "name": "TEBUCONAZOLE [MI]",
          "stdName": "TEBUCONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a06f980a-8fa6-4e2a-b814-c139b9d89786",
            "c6cc42bf-d52a-464f-baaa-88f791761f3b"
          ],
          "display_name": false
        },
        {
          "uuid": "cbe38e1b-13e9-4695-a0c5-950404bb08c8",
          "name": "TIMBERTREAT T",
          "stdName": "TIMBERTREAT T",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c978a94-5d53-4c2f-8c00-b60470f09af2",
            "a06f980a-8fa6-4e2a-b814-c139b9d89786"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a06f980a-8fa6-4e2a-b814-c139b9d89786",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c978a94-5d53-4c2f-8c00-b60470f09af2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6cc42bf-d52a-464f-baaa-88f791761f3b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea4a8de3-ffd8-496a-b87f-edb309b085d7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "deefbd3c-0bd7-4d33-8461-560e39891371",
          "citation": "SRS import [401ATW8TRW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=401ATW8TRW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21433ef2-8601-46a6-911c-f90f802691bc",
          "citation": "TEBUCONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a8c08fe-f37b-4b58-95db-12105f0f6166",
          "citation": "TEBUCONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c83ea6e-b28e-8c17-262c-c42aef1439e8",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tebuconazole",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9dd4b9cd-c9f2-948e-c5dc-47f569e93191",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+107534-96-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "41aeda7e-ca37-daf0-def3-6f945a4bfbf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=107534-96-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "23fbf16f-ff3c-3235-8790-233603ed36b9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d2f2e30b-32f1-2f3e-938a-cd1165fc26ab",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d0775709-276a-219b-f2f1-353ddecb8275",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cf3796de-78b6-46b9-bbfb-9bff8fe4c1d1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "764f54a5-0dca-4d17-8601-589ef90fcbe1",
          "id": "764f54a5-0dca-4d17-8601-589ef90fcbe1",
          "molfile": "\n  Marvin  01132106082D          \n\n 21 22  0  0  0  0            999 V2000\n    0.8162   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412    0.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4662   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6412   -1.7246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4662   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8787   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7037   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1162   -2.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9412   -2.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3537   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1787   -1.6140    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9412   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1162   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8162   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4037   -1.6140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4168   -1.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5883   -2.5073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1262   -2.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7393   -2.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 21  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)C(CCc1ccc(cc1)Cl)(Cn2cncn2)O",
          "formula": "C16H22ClN3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eca4ba33-88cd-4e9f-8405-2c66efa7451d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "307.8189",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "89f823ee-b532-4f43-8d35-c4f629686387",
      "version": "8",
      "structure": {
        "id": "262d52aa-b2b9-4402-9dfd-1c3d0e53c7ed",
        "molfile": "\n  Marvin  01132102072D          \n\n 21 22  0  0  0  0            999 V2000\n    0.4037   -1.6140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7393   -2.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1262   -2.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5883   -2.5073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4168   -1.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8162   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412   -1.7246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8162   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6412    0.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4662   -0.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4662   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8787   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7037   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1162   -2.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9412   -2.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3537   -1.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9412   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1162   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1787   -1.6140    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  1  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  1  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  6  9  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n  6 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)C(CCc1ccc(cc1)Cl)(Cn2cncn2)O",
        "formula": "C16H22ClN3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.8189",
        "optical_activity": "( + / - )",
        "references": [
          "deefbd3c-0bd7-4d33-8461-560e39891371",
          "3f44eb73-f3fc-4cc9-aa75-bc52f67814a4"
        ],
        "stereo_centers": 1
      },
      "unii": "401ATW8TRW"
    }
  ]
}