{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ab1635e-a86e-4bed-afb6-dff6e25c685d",
          "code": "802286-83-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=802286-83-5",
          "code_system": "CAS",
          "references": [
            "6d7e0cf4-1263-4672-8dfd-8fe44cac3c7d",
            "a0b9341e-7569-4c90-80b2-1b82b3b08544"
          ]
        },
        {
          "uuid": "d87dd33d-9861-42ec-a2e2-88acbc65e708",
          "code": "DIBUTYLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dibutylone",
          "code_system": "WIKIPEDIA",
          "references": [
            "6d7e0cf4-1263-4672-8dfd-8fe44cac3c7d"
          ]
        },
        {
          "uuid": "56d09f12-3699-45df-8d28-ad508913a4be",
          "code": "71308182",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71308182",
          "code_system": "PUBCHEM",
          "references": [
            "6d7e0cf4-1263-4672-8dfd-8fe44cac3c7d"
          ]
        },
        {
          "uuid": "53d60b2c-80db-4722-a2c5-7cf0aacae3bc",
          "code": "3ZLY5MSD6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5f453d43-8f9b-51ee-4115-080051f0150c",
          "code": "Designer-drugs-Dibutylone",
          "comments": "Wikipedia|List of designer drugs|Empathogens|MDxx (Substituted methylenedioxyphenethylamines)",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "4b226829-9d9f-add5-14e4-8b1155ca9a6d"
          ]
        },
        {
          "uuid": "8930c2b1-3309-5d52-da70-eacbd76f7202",
          "code": "100000177569",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "09368b55-b6d2-d019-54b1-17f50cb7348d"
          ]
        },
        {
          "uuid": "4ba3bdf8-5768-76ed-13d1-6e83830bf7a9",
          "code": "DTXSID201016921",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201016921",
          "code_system": "EPA CompTox",
          "references": [
            "29ff6231-d942-0700-3ad9-941aa52634c0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "794bde68-c9ee-4a6b-9b62-5c0982ebfd32",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "93b57f7d-0f57-4dc1-a69b-27c42f05973c",
            "refuuid": "a0f695a7-6229-4693-92fa-8bfdb5358db2",
            "name": "DIBUTYLONE HYDROCHLORIDE",
            "unii": "75DNR1UL8R",
            "linking_id": "75DNR1UL8R",
            "ref_pname": "DIBUTYLONE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3ef999e-8d93-4ba4-87ea-ddc78fbc712c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "620a5c9a-2711-405a-8f60-4ae6e548de38",
            "refuuid": "a306dc5d-bc68-447f-a11f-aaba86a9f739",
            "name": "DIBUTYLONE",
            "unii": "3ZLY5MSD6N",
            "linking_id": "3ZLY5MSD6N",
            "ref_pname": "DIBUTYLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d8bfdbc5-ca2a-4c17-915e-f2ae94359691",
          "name": "1-(BENZO(D)(1,3)DIOXOL-5-YL)-2-(DIMETHYLAMINO)BUTAN-1-ONE",
          "stdName": "1-(BENZO(D)(1,3)DIOXOL-5-YL)-2-(DIMETHYLAMINO)BUTAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36eef556-4fee-4ade-b9ad-60a7b9595da2",
            "848b3c87-78d8-4886-bd45-8761b89de62a"
          ],
          "display_name": false
        },
        {
          "uuid": "8de9b59a-5c74-4566-a5f7-71fbe13824cf",
          "name": "BK-DMBDB",
          "stdName": "BK-DMBDB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36eef556-4fee-4ade-b9ad-60a7b9595da2",
            "848b3c87-78d8-4886-bd45-8761b89de62a"
          ],
          "display_name": false
        },
        {
          "uuid": "de9f526c-3d28-4c9a-b315-74ca52180fee",
          "name": "DIBUTYLONE",
          "stdName": "DIBUTYLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1affe707-0d05-4fe4-83b5-4123f3ee44ea",
            "848b3c87-78d8-4886-bd45-8761b89de62a"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "1affe707-0d05-4fe4-83b5-4123f3ee44ea",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "848b3c87-78d8-4886-bd45-8761b89de62a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36eef556-4fee-4ade-b9ad-60a7b9595da2",
          "citation": "https://en.wikipedia.org/wiki/Dibutylone",
          "url": "https://en.wikipedia.org/wiki/Dibutylone",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d7e0cf4-1263-4672-8dfd-8fe44cac3c7d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393019000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8121d79e-792f-4d75-95c8-693123c0a9cc",
          "citation": "SRS import [3ZLY5MSD6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3ZLY5MSD6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393019000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2358699d-874e-48dd-9adf-3bd0a4b5541a",
          "citation": "CHEMID RECORD 802286-83-5",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09368b55-b6d2-d019-54b1-17f50cb7348d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4b226829-9d9f-add5-14e4-8b1155ca9a6d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a0b9341e-7569-4c90-80b2-1b82b3b08544",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "29ff6231-d942-0700-3ad9-941aa52634c0",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35b6727d-170a-4c34-8cf9-bd58e29ddc4f",
          "id": "35b6727d-170a-4c34-8cf9-bd58e29ddc4f",
          "molfile": "\n  Marvin  01132102522D          \n\n 17 18  0  0  0  0            999 V2000\n   -0.7662   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4807   -1.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4807   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.7662    0.1179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0518   -0.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7662    0.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1952    0.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1952    0.9429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9096   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9096   -1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6241   -1.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3386   -1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1231   -1.3746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.6081   -0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1232   -0.0397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3386   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6241    0.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 17  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 16 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CCC(C(=O)c1ccc2c(c1)OCO2)N(C)C",
          "formula": "C13H17NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "052640fa-785b-4361-abd0-f23d5a5fc062"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "235.2795",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a306dc5d-bc68-447f-a11f-aaba86a9f739",
      "version": "11",
      "structure": {
        "id": "3d436ff8-64fa-4e37-841c-08a3f9126e62",
        "molfile": "\n  Marvin  01132103152D          \n\n 17 18  0  0  0  0            999 V2000\n   -3.6241    0.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3386   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3386   -1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6241   -1.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9096   -1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9096   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1231   -1.3746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.6081   -0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1232   -0.0397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1952    0.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1952    0.9429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4807   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7662    0.1179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0518   -0.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7662    0.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4807   -1.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7662   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  2  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "CCC(C(=O)c1ccc2c(c1)OCO2)N(C)C",
        "formula": "C13H17NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "235.2795",
        "optical_activity": "( + / - )",
        "references": [
          "2358699d-874e-48dd-9adf-3bd0a4b5541a",
          "8121d79e-792f-4d75-95c8-693123c0a9cc"
        ],
        "stereo_centers": 1
      },
      "unii": "3ZLY5MSD6N"
    }
  ]
}