{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fb7e166a-5872-4fcd-b04c-7baea9eab31b",
          "code": "5408-52-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5408-52-6",
          "code_system": "CAS",
          "references": [
            "3142c1b3-3ff1-49f2-9b01-772e24e045b4",
            "6a4aa65a-e60a-437c-ab6d-547ce233d6f6"
          ]
        },
        {
          "uuid": "64d0a075-7bdc-4810-a280-a92a7544b3a2",
          "code": "226-474-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.067",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3142c1b3-3ff1-49f2-9b01-772e24e045b4"
          ]
        },
        {
          "uuid": "9d92503d-6db2-4542-a36e-39709ff46c8d",
          "code": "m6969",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6969?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3142c1b3-3ff1-49f2-9b01-772e24e045b4"
          ]
        },
        {
          "uuid": "8f0de776-688d-4837-9301-0ccd62b55bf1",
          "code": "79415",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/79415",
          "code_system": "PUBCHEM",
          "references": [
            "3142c1b3-3ff1-49f2-9b01-772e24e045b4"
          ]
        },
        {
          "uuid": "73646d38-06e3-4690-badf-874f28ba8e16",
          "code": "3Z47P7XZ8D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ccd7412-110b-1066-c521-1dc6b4b73650",
          "code": "DTXSID50883926",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50883926",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "da28adae-266c-a3be-fbe9-15e572198c40",
          "code": "100000172792",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2cab8599-1aee-82c3-e7db-48ff0be80784"
          ]
        },
        {
          "uuid": "fce0355b-cafb-c510-5054-04be07bee685",
          "code": "10855",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10855",
          "code_system": "NSC",
          "references": [
            "7df9a8a4-0a0b-0fb1-1fae-0588d615cedc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f5bf8cbe-4c9b-42ca-8987-8f79a261485c",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "3b9c6079-d105-4668-b5c6-e78bc8cd84f7",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "62d11554-c8da-4063-875e-65910338340d",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "3f091f33-19df-4fea-827c-2641ebc75795",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2703ce80-371d-4647-bcb1-63bfab39f063",
          "name": "L-GLUTAMIC ACID, COMPD. WITH L-LYSINE (1:1)",
          "stdName": "L-GLUTAMIC ACID, COMPD. WITH L-LYSINE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2066d19a-f546-4680-86a4-43257800a09b",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a"
          ],
          "display_name": false
        },
        {
          "uuid": "ab7725fa-7ab1-4f2d-a743-1686d80a5b15",
          "name": "L-LYSINE L-GLUTAMATE",
          "stdName": "L-LYSINE L-GLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2066d19a-f546-4680-86a4-43257800a09b",
            "5d7527ce-1879-4643-a13b-ca39855af2ec",
            "9b96714a-f128-4969-8e73-891043be696a",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a"
          ],
          "display_name": false
        },
        {
          "uuid": "8c2fb799-2af7-4ded-bad7-bf8b76c2f7a8",
          "name": "L-LYSINE L-GLUTAMATE [MI]",
          "stdName": "L-LYSINE L-GLUTAMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b96714a-f128-4969-8e73-891043be696a",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a"
          ],
          "display_name": false
        },
        {
          "uuid": "c047ef44-3446-4ef2-a618-fc0be4d2a060",
          "name": "LYSINE GLUTAMATE",
          "stdName": "LYSINE GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "432b50ac-ee1e-4f39-9c11-a1f831140d0c",
            "d23f3072-9f0e-466b-974d-0d6425b05f27",
            "6c335b11-f4af-4ab6-94e0-c4e9e5579978",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a",
            "ec6d035d-9d6a-4769-8178-b7517d851199"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "db0178db-78e2-4017-b8c0-011dc4bcb051",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c7232dba-027a-4128-9110-af2a10c644a5",
          "name": "LYSINE L-GLUTAMATE, L-",
          "stdName": "LYSINE L-GLUTAMATE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff7078db-831b-40d0-b71e-a8e6ef2f9e0d",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a"
          ],
          "display_name": false
        },
        {
          "uuid": "6abd4463-c176-a359-6a2a-b78c480dbe04",
          "name": "Lysine glutamate [WHO-DD]",
          "stdName": "LYSINE GLUTAMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d35ed6a-3f17-0901-09bd-0ebca0df5786"
          ],
          "display_name": false
        },
        {
          "uuid": "ddc2b165-03f9-4123-8172-414d0aeac934",
          "name": "NSC-10855",
          "stdName": "NSC-10855",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2066d19a-f546-4680-86a4-43257800a09b",
            "b0d33fe4-9ca6-4044-b421-5c71a6ac960a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "432b50ac-ee1e-4f39-9c11-a1f831140d0c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2066d19a-f546-4680-86a4-43257800a09b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0d33fe4-9ca6-4044-b421-5c71a6ac960a",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff7078db-831b-40d0-b71e-a8e6ef2f9e0d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec6d035d-9d6a-4769-8178-b7517d851199",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b96714a-f128-4969-8e73-891043be696a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3142c1b3-3ff1-49f2-9b01-772e24e045b4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d117112-8708-4cd2-ac88-efecfa855cf4",
          "citation": "SRS import [3Z47P7XZ8D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3Z47P7XZ8D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d23f3072-9f0e-466b-974d-0d6425b05f27",
          "citation": "LYSINE GLUTAMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c335b11-f4af-4ab6-94e0-c4e9e5579978",
          "citation": "LYSINE GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d7527ce-1879-4643-a13b-ca39855af2ec",
          "citation": "L-LYSINE L-GLUTAMATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2cab8599-1aee-82c3-e7db-48ff0be80784",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7df9a8a4-0a0b-0fb1-1fae-0588d615cedc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6d35ed6a-3f17-0901-09bd-0ebca0df5786",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6a4aa65a-e60a-437c-ab6d-547ce233d6f6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "26b7dad8-0d65-451e-a6cf-cca8512bb4da",
          "id": "26b7dad8-0d65-451e-a6cf-cca8512bb4da",
          "molfile": "\n  Marvin  01132102082D          \n\n 10  9  0  0  1  0            999 V2000\n    3.0868   -1.9651    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3636   -2.7451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2791   -1.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7436   -2.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9267   -2.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3958   -2.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4120   -2.7775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6221   -1.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3498   -0.5619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4344   -1.4851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)O)N",
          "formula": "C6H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0fdd83e9-3924-4255-bf28-759b9db8e576"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "146.1878",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "3f91efb1-2e1b-42a6-8689-3c5169d25ee6",
          "id": "3f91efb1-2e1b-42a6-8689-3c5169d25ee6",
          "molfile": "\n  Marvin  01132103222D          \n\n 10  9  0  0  1  0            999 V2000\n    8.4335   -1.7688    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.0187   -2.4832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2585   -1.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6733   -2.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2585   -3.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4335   -3.1930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6641   -3.9120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0279   -1.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4335   -0.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2029   -1.0543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)[C@@H](C(=O)O)N",
          "formula": "C5H9NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80f81833-bffe-406a-95e0-dc6d04f71112"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "147.1295",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "752f26a1-eed2-4688-a4c4-e93203034daa",
      "version": "9",
      "structure": {
        "id": "65adb41e-b6c8-40e3-9f23-5b5392929e0a",
        "molfile": "\n  Marvin  01132105172D          \n\n 20 18  0  0  1  0            999 V2000\n    8.0393   -1.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4455   -0.3404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2131   -1.0558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4455   -1.7713    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0301   -2.4867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2716   -1.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6870   -2.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2716   -3.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4455   -3.1975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6778   -3.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6221   -1.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3498   -0.5619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0868   -1.9651    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.2791   -1.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7436   -2.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9267   -2.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3958   -2.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4120   -2.7775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3636   -2.7451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4344   -1.4851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 13 19  1  1  0  0  0\n 20 11  1  0  0  0  0\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)O)N.C(CC(=O)O)[C@@H](C(=O)O)N",
        "formula": "C6H14N2O2.C5H9NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "293.3173",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2066d19a-f546-4680-86a4-43257800a09b",
          "3d117112-8708-4cd2-ac88-efecfa855cf4"
        ],
        "stereo_centers": 2
      },
      "unii": "3Z47P7XZ8D"
    }
  ]
}