{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bcb88575-ca71-4587-a10b-fa57eca3a381",
          "code": "90-94-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-94-8",
          "code_system": "CAS",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d",
            "0f2ec403-dc10-4c22-b989-d2bf30e6215f"
          ]
        },
        {
          "uuid": "859835c9-bb97-4b0c-b0bc-d121754625f9",
          "code": "C44403",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44403",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d"
          ]
        },
        {
          "uuid": "a3e1b275-1324-4cc9-901b-b713be0de4da",
          "code": "C014682",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67014682",
          "code_system": "MESH",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d"
          ]
        },
        {
          "uuid": "f26a31d5-0f0b-447b-be84-15e7ea0778b8",
          "code": "202-027-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.843",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d"
          ]
        },
        {
          "uuid": "e54c081f-ad85-4b65-8343-759040246144",
          "code": "m7526",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7526?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d"
          ]
        },
        {
          "uuid": "722c2a2e-0d59-4eba-8a1e-1980469efebc",
          "code": "7031",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7031",
          "code_system": "PUBCHEM",
          "references": [
            "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d"
          ]
        },
        {
          "uuid": "ba59da68-68ee-cbd8-6ad9-59fc0c817e22",
          "code": "2865",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2865",
          "code_system": "HSDB",
          "references": [
            "af9df18a-388f-71e5-d350-682039557521"
          ]
        },
        {
          "uuid": "36087518-f2a0-264e-d9b8-6266ae755be5",
          "code": "DTXSID2020894",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2020894",
          "code_system": "EPA CompTox",
          "references": [
            "3e6f4867-5228-0822-2f89-57dcc2705476"
          ]
        },
        {
          "uuid": "637ae3b0-bdba-ec6b-e205-d9cacc296e3d",
          "code": "C45175",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45175",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fc40efbc-2415-6412-a4bb-ab0b8c04eb78"
          ]
        },
        {
          "uuid": "a72b2479-d07c-9d2e-65de-5553fc01adca",
          "code": "Michler's ketone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Michler%27s_ketone",
          "code_system": "WIKIPEDIA",
          "references": [
            "ec25e697-9972-5878-0652-9a5b2e21e75f"
          ]
        },
        {
          "uuid": "1f101cab-62ec-43c4-95c0-9b46c8fd914a",
          "code": "3Z2SN6B347",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7f7455df-e636-aaf4-6b98-7afc91d252d0",
          "code": "9602",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9602",
          "code_system": "NSC",
          "references": [
            "c872fd70-61e5-444b-f48a-fcd865bd140d"
          ]
        },
        {
          "uuid": "9879c9f8-12f6-6a2b-4787-c1b38f286b39",
          "code": "300000053719",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d27a5959-8f1a-8721-a01e-a454cbfa8076"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9ec75450-848a-4a36-b0a3-f9a1b9aca9c5",
          "name": "4,4'-BIS(DIMETHYLAMINO)BENZOPHENONE",
          "stdName": "4,4'-BIS(DIMETHYLAMINO)BENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dbc8f35-35ca-4d09-af2e-e9c9a8eab04b",
            "053ba463-2080-48e9-986d-b16be414b7be",
            "5ef59789-0906-45a2-a7b7-33583b1a4a98",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "39299bac-8040-4e17-8926-7b38d5282966",
          "name": "4,4'-BIS(DIMETHYLAMINO)BENZOPHENONE [HSDB]",
          "stdName": "4,4'-BIS(DIMETHYLAMINO)BENZOPHENONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dbc8f35-35ca-4d09-af2e-e9c9a8eab04b",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "d0967cf5-5b02-412a-8e31-15b3051cffb0",
          "name": "BIS(4-(DIMETHYLAMINO)PHENYL)METHANONE",
          "stdName": "BIS(4-(DIMETHYLAMINO)PHENYL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ef59789-0906-45a2-a7b7-33583b1a4a98",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "0d9b5221-8bd6-478f-bea1-13e3b815e86e",
          "name": "MICHLER'S KETONE",
          "stdName": "MICHLER'S KETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5af4c8d-f0cb-4e06-8cc0-65a850ad8825",
            "a3844563-f062-4703-af57-20a4889f5d05",
            "41e501aa-988b-43bd-9688-6f56c211deeb",
            "5af518e6-d1dd-47d3-9283-70d85c4acdd3"
          ],
          "display_name": true
        },
        {
          "uuid": "3d57927c-4ffd-42d1-b2ea-ecce0af34b75",
          "name": "MICHLER'S KETONE [MI]",
          "stdName": "MICHLER'S KETONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3844563-f062-4703-af57-20a4889f5d05",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "a15bafd9-6cec-4cd0-8e18-841be9aeba10",
          "name": "NCI-C02006",
          "stdName": "NCI-C02006",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "702fba80-6c4b-4a4a-8150-17e0dd79fe3b",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "ff805d81-fbb7-4a82-9630-156d65f88292",
          "name": "NSC-9602",
          "stdName": "NSC-9602",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "702fba80-6c4b-4a4a-8150-17e0dd79fe3b",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "5da8e2a0-9bbc-4d90-9aa1-a3d39621c124",
          "name": "TETRAMETHYLDIAMINOBENZOPHENONE",
          "stdName": "TETRAMETHYLDIAMINOBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ef59789-0906-45a2-a7b7-33583b1a4a98",
            "41e501aa-988b-43bd-9688-6f56c211deeb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d5af4c8d-f0cb-4e06-8cc0-65a850ad8825",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3844563-f062-4703-af57-20a4889f5d05",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41e501aa-988b-43bd-9688-6f56c211deeb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ef59789-0906-45a2-a7b7-33583b1a4a98",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "702fba80-6c4b-4a4a-8150-17e0dd79fe3b",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dbc8f35-35ca-4d09-af2e-e9c9a8eab04b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7990b1e5-a1d5-41bd-b16f-bd4e6d3bf51d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390878000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9731e5df-9277-407f-b635-c9596eb974d8",
          "citation": "SRS import [3Z2SN6B347]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3Z2SN6B347",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390878000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f97a48c-0550-4f89-bf37-da93d6d731d9",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5af518e6-d1dd-47d3-9283-70d85c4acdd3",
          "citation": "MICHLER'S KETONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "053ba463-2080-48e9-986d-b16be414b7be",
          "citation": "4,4'-BIS(DIMETHYLAMINO)BENZOPHENONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af9df18a-388f-71e5-d350-682039557521",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+90-94-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e6f4867-5228-0822-2f89-57dcc2705476",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-94-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc40efbc-2415-6412-a4bb-ab0b8c04eb78",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ec25e697-9972-5878-0652-9a5b2e21e75f",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "0f2ec403-dc10-4c22-b989-d2bf30e6215f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c872fd70-61e5-444b-f48a-fcd865bd140d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d27a5959-8f1a-8721-a01e-a454cbfa8076",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a8decfea-d856-4916-8506-45150ee20313",
          "id": "a8decfea-d856-4916-8506-45150ee20313",
          "molfile": "\n  Marvin  01132108462D          \n\n 20 21  0  0  0  0            999 V2000\n    3.8174   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8174   -4.4457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1029   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -6.9207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -4.4457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2476   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 10  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CN(C)c1ccc(cc1)C(=O)c2ccc(cc2)N(C)C",
          "formula": "C17H20N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f17278fd-021c-40e2-abf6-f8fb4983f12e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "268.3541",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "33bce07d-8e13-41ef-bbac-6d36b4981d55",
      "version": "8",
      "structure": {
        "id": "2873b5bb-af34-4897-a5c8-125cf233d6f1",
        "molfile": "\n  Marvin  01132102132D          \n\n 20 21  0  0  0  0            999 V2000\n    8.1042   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8186   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1042   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5319   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2463   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8174   -4.4457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8174   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1029   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6752   -6.9207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -4.4457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2476   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5331   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  8  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n  7 17  2  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CN(C)c1ccc(cc1)C(=O)c2ccc(cc2)N(C)C",
        "formula": "C17H20N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.3541",
        "optical_activity": "NONE",
        "references": [
          "9731e5df-9277-407f-b635-c9596eb974d8",
          "9f97a48c-0550-4f89-bf37-da93d6d731d9"
        ],
        "stereo_centers": 0
      },
      "unii": "3Z2SN6B347"
    }
  ]
}