{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "35ed0422-8dc7-4796-bbb5-641e46a4b2c9",
          "code": "32181-59-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32181-59-2",
          "code_system": "CAS",
          "references": [
            "c41ab22c-7071-4ea4-836a-1ba02cb3db02",
            "f14942eb-717b-49e9-bf22-367b9de2c4f6"
          ]
        },
        {
          "uuid": "d79aa573-5911-4f23-bdaa-6904d983499e",
          "code": "119547",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119547",
          "code_system": "PUBCHEM",
          "references": [
            "c41ab22c-7071-4ea4-836a-1ba02cb3db02"
          ]
        },
        {
          "uuid": "79d8896a-d200-baf2-eedc-e0b5dd195227",
          "code": "N-Acetyllactosamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetyllactosamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "de074d58-a4da-3c8d-842f-ccfdc66e5888"
          ]
        },
        {
          "uuid": "ea209440-87a9-f62b-5585-a2cd0c431f46",
          "code": "DTXSID10954045",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10954045",
          "code_system": "EPA CompTox",
          "references": [
            "8456890d-e651-ef7d-bcbe-e9bf7a1e825a"
          ]
        },
        {
          "uuid": "f4543e55-42ea-4f70-9dc4-b93dad9eeba8",
          "code": "3Y5B2K5OOK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e6689050-676c-27a7-c9cd-754f1948e30d",
          "code": "16153",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16153",
          "code_system": "CHEBI"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "063c9e62-7505-4720-9326-cb0d86460655",
          "name": "2-ACETAMIDO-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCOSE",
          "stdName": "2-ACETAMIDO-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "b1985bd4-c057-42d8-81d6-7e00f369906d",
          "name": "ACETYL LACTOSAMINE",
          "stdName": "ACETYL LACTOSAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe543821-95b7-4a89-b242-349e849e9aa2",
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "21b5295f-b9c4-4f95-aef4-e4fb0b755a0e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e4d8a5d0-8560-452f-97a3-7e919e31ea55",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "77866727-f879-4147-9e04-3fdb5af41960",
          "name": "D-GLUCOSAMINE, N-ACETYL-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "stdName": "D-GLUCOSAMINE, N-ACETYL-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "bf1a0884-c8d2-4f0b-85ae-93c73bab0394",
          "name": "D-GLUCOSE, 2-(ACETYLAMINO)-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 2-(ACETYLAMINO)-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "59f7570f-eabe-4ff3-932c-61639ce9fe66",
          "name": "D-GLUCOSE, 2-ACETAMIDO-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 2-ACETAMIDO-2-DEOXY-4-O-.BETA.-D-GALACTOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "23d9a3f6-8f08-46ba-b476-b40e037ba3c1",
          "name": "LACTOSAMINE, N-ACETYL-",
          "stdName": "LACTOSAMINE, N-ACETYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "73478d47-8dd2-423c-b709-c8b9c1c318b3",
          "name": "N-ACETYL-4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCOSAMINE",
          "stdName": "N-ACETYL-4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCOSAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "f76f9a51-b8d3-4881-ab02-4eab86dc5b67",
          "name": "N-ACETYLLACTOSAMINE",
          "stdName": "N-ACETYLLACTOSAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "e47a64af-d7ae-42c4-a6e3-86f98eb4ff65",
          "name": "NALMINE",
          "stdName": "NALMINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99572712-6fa3-4e9f-8a9f-3d419c499596",
            "21b5295f-b9c4-4f95-aef4-e4fb0b755a0e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "21b5295f-b9c4-4f95-aef4-e4fb0b755a0e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99572712-6fa3-4e9f-8a9f-3d419c499596",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7aefe48-f4f3-4c37-87c7-432b1f5d2a7e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c41ab22c-7071-4ea4-836a-1ba02cb3db02",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "201aa3de-6c38-483f-b615-65dfdc6eb9c0",
          "citation": "SRS import [3Y5B2K5OOK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3Y5B2K5OOK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe543821-95b7-4a89-b242-349e849e9aa2",
          "citation": "ACETYL LACTOSAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de074d58-a4da-3c8d-842f-ccfdc66e5888",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/N-Acetyllactosamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f14942eb-717b-49e9-bf22-367b9de2c4f6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8456890d-e651-ef7d-bcbe-e9bf7a1e825a",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6e839353-5b99-419c-9120-0f8f0342982a",
          "id": "6e839353-5b99-419c-9120-0f8f0342982a",
          "molfile": "\n  Marvin  01132105442D          \n\n 26 26  0  0  1  0            999 V2000\n   14.6614  -11.8918    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.6614  -12.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3759  -11.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0822  -11.9040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9551  -11.4679    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.2405  -11.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -12.7045    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.9551  -13.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9551  -13.9432    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.6696  -14.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3841  -13.9432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -14.3547    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.2405  -15.1797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5240  -13.9432    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.8094  -14.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5240  -13.1181    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.8094  -12.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9551  -10.6429    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.2405  -10.2293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6696  -10.2293    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.6696   -9.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3820   -8.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0904   -9.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3820   -8.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3759  -10.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0904  -10.2416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O",
          "formula": "C14H25NO11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "81b2dd09-44d0-4416-9d73-040cb97309a4"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "383.349",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e7b8670c-d03a-4fa9-84e5-6d194bac828f",
      "version": "11",
      "structure": {
        "id": "cd095c54-06c4-44a6-993a-6856bce9805b",
        "molfile": "\n  Marvin  01132110352D          \n\n 27 27  0  0  1  0            999 V2000\n   13.2405  -11.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9551  -11.4679    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.9551  -10.6429    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.6696  -10.2293    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.6696   -9.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3820   -8.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0904   -9.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3820   -8.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3759  -10.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0904  -10.2416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -10.2293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6614  -11.8918    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.3759  -11.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0822  -11.9040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6614  -12.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -11.0544    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -12.7045    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.9551  -13.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9551  -13.9432    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.6696  -14.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3841  -13.9432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -14.3547    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.5240  -13.9432    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.5240  -13.1181    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.8094  -12.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8094  -14.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2405  -15.1797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  3 11  1  6  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 15  1  1  0  0  0\n  2 16  1  6  0  0  0\n 17  1  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 20 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 17 24  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n 23 26  1  6  0  0  0\n 22 27  1  6  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](C=O)[C@H]([C@@]([H])([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O",
        "formula": "C14H25NO11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "383.349",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "21b5295f-b9c4-4f95-aef4-e4fb0b755a0e",
          "201aa3de-6c38-483f-b615-65dfdc6eb9c0"
        ],
        "stereo_centers": 9
      },
      "unii": "3Y5B2K5OOK"
    }
  ]
}