{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ec221c2a-18b1-43c8-9ebb-a3ab5dab4ab2", "code": "A07EC01", "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIDIARRHEALS, INTESTINAL ANTIINFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFLAMMATORY AGENTS|Aminosalicylic acid and similar agents|sulfasalazine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=A07EC01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "1c2bf163-6aae-40b1-8b7f-a5bf7da5b31a", "code": "N0000005760", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Phenols [Chemical/Ingredient]|Hydroxybenzoic Acids [Chemical/Ingredient]|Salicylic Acids [Chemical/Ingredient]|Aminosalicylic Acids [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000005760", "code_system": "NDF-RT", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "95d04a87-4408-4f89-be74-3c1466a03dd0", "code": "N0000005760", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Carboxylic Acids [Chemical/Ingredient]|Acids, Carbocyclic [Chemical/Ingredient]|Benzoic Acids [Chemical/Ingredient]|Hydroxybenzoic Acids [Chemical/Ingredient]|Salicylic Acids [Chemical/Ingredient]|Aminosalicylic Acids [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000005760", "code_system": "NDF-RT", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "fc1d129e-2a20-4745-a712-30e3b14483cf", "code": "N0000005760", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Carboxylic Acids [Chemical/Ingredient]|Hydroxy Acids [Chemical/Ingredient]|Hydroxybenzoic Acids [Chemical/Ingredient]|Salicylic Acids [Chemical/Ingredient]|Aminosalicylic Acids [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000005760", "code_system": "NDF-RT", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "09b87292-897c-4fe4-ae21-75c24536a08b", "code": "N0000005760", "comments": "Chemical Ingredients [Chemical/Ingredient]|Chemical Classes for Pharmacologic Classification [Chemical/Ingredient]|Nonsteroidal Anti-inflammatory Compounds [Chemical/Ingredient]|Salicylic Acids [Chemical/Ingredient]|Aminosalicylic Acids [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000005760", "code_system": "NDF-RT", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "a658c9df-7530-46ba-9499-e14a7266130d", "code": "N0000175781", "comments": "Established Pharmacologic Class [EPC]|Aminosalicylate [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175781", "code_system": "NDF-RT", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "3cd19d8a-824c-4317-b070-c43c6816631f", "code": "QA07EC01", "comments": "VATC|ANTIDIARRHEALS, INTESTINAL ANTI-INFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFLAMMATORY AGENTS|Aminosalicylic acid and similar agents|sulfasalazine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA07EC01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "1a2b6d55-1769-44e5-841f-7c4f3b890eb4", "code": "599-79-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=599-79-1", "code_system": "CAS", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f", "bfc1e9de-6e94-44cc-8507-e8f9ee828d83" ] }, { "uuid": "0b5ee068-e21f-443b-9261-95b4cd82073a", "code": "C29469", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29469", "code_system": "NCI_THESAURUS", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "7d2652d9-4294-40cc-a0a2-63c46b5f597c", "code": "NBK548792", "comments": "LiverTox|Gastroinestinal|Inflammatory bowel disease|Salicylate/sulfonamide", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548792/", "code_system": "LIVERTOX", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "cac33ad5-d98b-4e91-89d0-c80c5f2920ef", "code": "2.4", "comments": "WHO ESSENTIAL MEDICINES LIST|Analgesics, antipyretics, non-steroidal anti-inflammatory medicines (NSAIMs), medicines used to treat gout and disease modifying agents in rheumatoid disorders (DMARDs)|Disease modifying agents used in rheumatoid disorders (DMARDs)", "type": "PRIMARY", "url": "http://prais.paho.org/medicine/28/?section=37#type85", "code_system": "WHO-ESSENTIAL MEDICINES LIST", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "f1406a7a-f0ce-4185-ae7d-9483ada63277", "code": "17.3", "comments": "WHO ESSENTIAL MEDICINES LIST|Gastrointestinal medicines|Anti-inflammatory medicines", "type": "PRIMARY", "url": "http://prais.paho.org/medicine/28/?section=113#type86", "code_system": "WHO-ESSENTIAL MEDICINES LIST", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "037d6960-4183-4c0f-bee4-a23eeb5419c6", "code": "D012460", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68012460", "code_system": "MESH", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "74c15ef7-0e0f-49f8-ad6f-fae07cbfb93c", "code": "SUB10727MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "17ff1c8f-79ce-42c3-80c0-950889e4b841", "code": "2210", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2210", "code_system": "INN", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "a9472281-6678-4513-b84a-bea4a5766f2e", "code": "209-974-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.069", "code_system": "ECHA (EC/EINECS)", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "c4724100-430e-42e3-b4b9-e15ee48c37bf", "code": "4840", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4840", "code_system": "IUPHAR", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "92772f30-3416-4012-8b16-225624ef695f", "code": "SULFASALAZINE", "comments": "Description: A bright yellow to brownish yellow powder; odourless. Solubility: Practically insoluble in water and ether R; very slightly soluble in ethanol (~750 g/l) TS; soluble in alkali hydroxides. Category: Antibacterial drug. Storage: Sulfasalazine should be kept in a tightly closed container, protected from light. Additional information: Sulfasalazine melts at about 255?C with decomposition. Definition: Sulfasalazine contains not less than 93.0% and not more than 103.0% of C18H14N4O5S, calculated with reference to the dried substance.", "type": "PRIMARY", "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.409.pdf", "code_system": "WHO INTERNATIONAL PHARMACOPEIA", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "6c517be9-6c7d-47cb-9115-3dcce8aad2a8", "code": "9524", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/9524/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "b936c8dd-1ab9-493a-9482-5e8dba449e98", "code": "m10343", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10343?q=authorize", "code_system": "MERCK INDEX", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "9a270843-bcbd-4ec8-b096-61f5ac76c3f1", "code": "DB00795", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00795", "code_system": "DRUG BANK", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "59dd38aa-4850-407a-adad-fd7b082675df", "code": "SUB20720", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "b97e7150-948f-405f-b062-ec15c80320b6", "code": "CHEMBL421", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL421", "code_system": "ChEMBL", "references": [ "294f59e6-4263-4efd-94c4-4ca6d4fec72f" ] }, { "uuid": "d6d3ea21-e389-b245-3182-58637ee12a2b", "code": "Sulfasalazine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Sulfasalazine", "code_system": "WIKIPEDIA", "references": [ "cf91f9a1-3df6-b7c4-a4d0-cb32644a0917" ] }, { "uuid": "9defd13f-b560-d0de-e114-19589e3b13c7", "code": "3395", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3395", "code_system": "HSDB", "references": [ "516b35fe-d7be-049f-a50b-16d05c6c47e1" ] }, { "uuid": "05c38dc6-7650-5eb1-3391-e93c567ee2f9", "code": "DTXSID0021256", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021256", "code_system": "EPA CompTox", "references": [ "e38f86f2-8bab-bf2f-ed80-41ebaa65ef82" ] }, { "uuid": "5bc3748e-31e4-c0bb-3b50-15d4b0b4f21a", "code": "C257", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257", "code_system": "NCI_THESAURUS", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "0a3040c2-93d6-40a7-a571-0e825e5df86a", "code": "3XC8GUZ6CB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "efc95219-4a5c-5a62-8b54-5805f4596b9c", "code": "Sulfasalazine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM442/", "code_system": "LACTMED", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "26307ebe-cbf3-2253-5964-31eda7fb2e85", "code": "2525", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2525", "code_system": "DRUG CENTRAL", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "ec13382b-3885-e2c3-e5f2-8ce02dc9c098", "code": "9334", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9334", "code_system": "CHEBI", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "59c5e213-626f-70bd-ede6-ea9e5f87ebda", "code": "1636005", "type": "PRIMARY", "url": "https://store.usp.org/product/1636005", "code_system": "RS_ITEM_NUM", "references": [ "389050ac-6054-a783-3681-cd6c8548b6fb" ] }, { "uuid": "3df3282d-89f9-18c9-83c8-91860ae4cd0b", "code": "3XC8GUZ6CB", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3XC8GUZ6CB", "code_system": "DAILYMED", "references": [ "f308671a-68a9-8d11-70c9-3e776f34634e" ] }, { "uuid": "76bac6f1-c50c-1c1d-0ef2-a6824f460a43", "code": "100000091572", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "147430c8-650f-cdba-9e78-480551eb961e" ] }, { "uuid": "6db05476-f256-56a7-8482-4742bde06057", "code": "667219", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=667219", "code_system": "NSC", "references": [ "6a410b66-f973-df6d-c8b8-9744e4faf31d" ] }, { "uuid": "4d5c2218-0099-7f3f-df2b-c19fc79aab4a", "code": "203730", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=203730", "code_system": "NSC", "references": [ "6a410b66-f973-df6d-c8b8-9744e4faf31d" ] } ], "substance_class": "chemical", "references": [ { "uuid": "20a0b04f-51c4-4890-af85-e697a3ad85fa", "citation": "EP", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2dafe032-1201-49e4-882a-f2f0c7658bfe", "citation": "USP Dictionary 2007", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4421b6d8-8129-4195-a762-621bba5e9695", "citation": "INN Proposed List 55", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL55.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "551dde06-8775-4f6f-9793-ab0633b48680", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3a686c36-4e0d-4fb0-b090-38cfeb33e5bf", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9b8b2bd5-fb58-471c-b4e9-224290d05550", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5e61f6a2-1602-456e-a82e-e8d739c3da4a", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "716419df-ef05-415a-bd61-02084e63f08b", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2f602414-ac78-453d-b2a9-7138f309c1cf", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e69618a2-deb8-431c-a288-2f4a7471c9ff", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1d4f59bc-514f-4dd6-9961-bd0b36db23b8", "citation": "D00448", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "977f0b55-8ccc-418f-b3df-ddac3b3da1f7", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c53c6dc0-660b-47f1-849e-0c066c315da0", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cd9a45f5-2801-40ce-8c13-eca936f95b14", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1b2c80b3-7f0b-4d2c-8387-3e68bd7f3235", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "add1a2d4-9549-4ce2-a4c7-c7945a32ed3d", "citation": "clinical trials", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0d50ea39-b065-40dd-a590-57eb1585285b", "citation": "dmf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c100a842-69fb-4090-9d1a-315612cb7503", "citation": "WHO-IP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2488971c-bbe5-4b8d-b066-3d7f10bf7f84", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "97ba058a-e338-4728-858b-368a19d41eb6", "citation": "http://www.medbroadcast.com/drug/getdrug/Salazopyrin", "url": "http://www.medbroadcast.com/drug/getdrug/Salazopyrin", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "294f59e6-4263-4efd-94c4-4ca6d4fec72f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390309000, "tags": [ "NOMEN" ] }, { "uuid": "198fa0ca-a2a7-48e0-8440-755c3d5a57f0", "citation": "EP 7.8 SULFASALAZINE MONOGRAPH", "doc_type": "EUROPEAN PHARMACOPEIA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "15eb1bbf-6c24-4f43-8951-6dcbe8748fa7", "citation": "USP 36 SULFASALAZINE MONOGRAPH", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d1399e8f-b12f-4e4d-8e69-5967e7771539", "citation": "FREE RADICAL BIOLOGY & MEDICINE, VOL.10, PP. 41-49.", "url": "http://www.sciencedirect.com/science/article/pii/0891584991900204#", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "83bee95e-9e98-4a5a-969d-c0c49da077dc", "citation": "http://onlinelibrary.wiley.com/doi/10.1002/jps.2600780313/epdf", "url": "http://onlinelibrary.wiley.com/doi/10.1002/jps.2600780313/epdf", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4b83046f-4901-4fca-849c-b18f391ec891", "citation": "SRS import [3XC8GUZ6CB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3XC8GUZ6CB", "doc_type": "SRS", "public_domain": true, "document_date": 1493390309000, "tags": [ "NOMEN" ] }, { "uuid": "5fc68e39-447e-496d-b924-14a59b371eb1", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2885c8cb-ded5-4fea-90a6-cb464fa6dc36", "citation": "SULFASALAZINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1712f10d-a8c2-45a1-a14b-a64af9c55817", "citation": "SULFASALAZINE [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "28796a3e-aebb-4024-9308-ed36184f4e90", "citation": "SULFASALAZINE [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c1d46516-3ee8-4004-99bd-ce057ade3e6d", "citation": "SULFASALAZINE [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "18f4cce1-8e58-426f-bb3d-26870f243df3", "citation": "SULFASALAZINE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0f8533af-a238-41fb-af16-43a1b9310809", "citation": "SULFASALAZINE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3e6c6a93-39a8-4e1d-bf19-b6d22dc7e7b7", "citation": "SULFASALAZINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e9a4c57f-d3aa-4f2c-ada4-b54fba8c2bfe", "citation": "SULFASALAZINE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "8364ae86-d578-40d8-9be4-182c1cdf4da2", "citation": "SULFASALAZINE [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b95ed523-df27-46ca-aa72-9d69717cced8", "citation": "SULFASALAZINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bf06eeb1-32e6-4760-b00e-91137279aa4c", "citation": "SULFASALAZINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "30fdc483-16d9-4d62-9a1d-997975d935fc", "citation": "SULFASALAZINE [WHO-IP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "147430c8-650f-cdba-9e78-480551eb961e", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "2a9d93ce-4ed7-c4b3-c9bf-b77d1923ddae", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "516b35fe-d7be-049f-a50b-16d05c6c47e1", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+599-79-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cf91f9a1-3df6-b7c4-a4d0-cb32644a0917", "citation": "Sulfasalazine", "url": "https://en.wikipedia.org/wiki/Sulfasalazine", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e38f86f2-8bab-bf2f-ed80-41ebaa65ef82", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=599-79-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d81ff6da-f1ec-4aa1-abe4-ae2f9427ce42", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+599-79-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0f4f8ab1-c51a-4eb9-bc99-574f497d470a", "citation": "Tang, Xiang, et al. \"Research progress on SLC7A11 in the regulation of cystine/cysteine metabolism in tumors.\" Oncology Letters 23.2 (2022): 1-9.", "url": "https://www.spandidos-publications.com/10.3892/ol.2021.13165", "doc_type": "JA", "public_domain": true }, { "uuid": "ef832537-db4d-e133-6c79-8ddc854b6175", "citation": "IARC", "doc_type": "IARC", "public_domain": true }, { "uuid": "ada4b737-c71b-4b0e-5d4e-ae3ddb6d7433", "citation": "https://www.clinicalkey.com/pharmacology/monograph/582?sec=monphar", "doc_type": "CLINICAL PHARMACOLOGY", "public_domain": true }, { "uuid": "e9e4e8d5-b467-9c64-a6b4-0ffdad440430", "citation": "https://www.drugbank.ca/drugs/DB00795", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "68d48c24-1d1a-10fb-e802-1474f77ce215", "citation": "EP", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "13456b63-cf26-0746-e9e7-686b3e2c3a35", "citation": "https://www.ncbi.nlm.nih.gov/pubmed/10449939", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "389050ac-6054-a783-3681-cd6c8548b6fb", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "bfc1e9de-6e94-44cc-8507-e8f9ee828d83", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ced74d49-e2a9-bbf7-df97-fbd4ed220980", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "e0766400-d3b9-f283-5fc3-f12a61c7cf58", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "de66100d-a491-4b9f-cc84-8993752e1b59", "citation": "USP/NF", "doc_type": "USPNF", "public_domain": true }, { "uuid": "6a410b66-f973-df6d-c8b8-9744e4faf31d", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "f308671a-68a9-8d11-70c9-3e776f34634e", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "8d109568-1bae-3ea8-feba-a377929e955a", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "64747024-9839-4604-979d-b0028764741f", "citation": "Haskó, György, et al. \"Sulphasalazine inhibits macrophage activation: inhibitory effects on inducible nitric oxide synthase expression, interleukin‐12 production and major histocompatibility complex II expression.\" Immunology 103.4 (2001): 473-478.", "url": "https://onlinelibrary.wiley.com/doi/full/10.1046/j.1365-2567.2001.01272.x", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9cb69691-bea8-4ead-8e33-7164e6744ef0", "id": "9cb69691-bea8-4ead-8e33-7164e6744ef0", "molfile": "\n Marvin 01132108092D \n\n 28 30 0 0 0 0 999 V2000\n 5.7319 -0.6809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1520 -1.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9769 -1.3821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7471 -2.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9221 -2.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5185 -2.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9344 -3.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7580 -3.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1680 -2.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9946 -2.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6927 -2.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2776 -2.1336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4504 -2.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0420 -1.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2173 -1.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8089 -2.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2043 -2.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0420 -2.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0471 -2.1728 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0523 -1.3194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0523 -3.0237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8980 -2.1807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3168 -1.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9084 -0.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3535 -0.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1703 -0.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5969 -0.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2017 -1.4346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 9 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 11 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 18 13 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 19 1 0 0 0 0\n 18 17 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 19 2 0 0 0 0\n 22 19 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 28 23 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "c1ccnc(c1)NS(=O)(=O)c2ccc(cc2)/N=N/c3ccc(c(c3)C(=O)O)O", "formula": "C18H14N4O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3fcd022d-4ec3-4a70-b316-a28b8fdd9755" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "398.3943", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c29a29ec-2f53-4604-90b8-b62b219b2860", "version": "80", "structure": { "id": "127c537a-65e1-4da4-baa8-07e24a013cc9", "molfile": "\n Marvin 01132101102D \n\n 28 30 0 0 0 0 999 V2000\n 3.6927 -2.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5185 -2.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9221 -2.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7471 -2.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1680 -2.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7580 -3.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9344 -3.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9946 -2.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1520 -1.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7319 -0.6809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9769 -1.3821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0471 -2.1728 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8980 -2.1807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8089 -2.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2776 -2.1336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3168 -1.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0523 -1.3194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0523 -3.0237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2017 -1.4346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2043 -2.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2173 -1.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4504 -2.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0420 -1.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0420 -2.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5969 -0.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9084 -0.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1703 -0.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3535 -0.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 2 1 0 0 0 0\n 5 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 23 21 2 0 0 0 0\n 24 20 1 0 0 0 0\n 25 19 2 0 0 0 0\n 26 16 2 0 0 0 0\n 27 28 2 0 0 0 0\n 28 26 1 0 0 0 0\n 24 22 2 0 0 0 0\n 27 25 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 22 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 18 12 2 0 0 0 0\n 19 16 1 0 0 0 0\n 20 14 2 0 0 0 0\n 21 14 1 0 0 0 0\n 22 23 1 0 0 0 0\n 15 1 2 0 0 0 0\nM END", "smiles": "c1ccnc(c1)NS(=O)(=O)c2ccc(cc2)/N=N/c3ccc(c(c3)C(=O)O)O", "formula": "C18H14N4O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "398.3943", "optical_activity": "NONE", "references": [ "5fc68e39-447e-496d-b924-14a59b371eb1", "4b83046f-4901-4fca-849c-b18f391ec891", "4421b6d8-8129-4195-a762-621bba5e9695" ], "stereo_centers": 0 }, "unii": "3XC8GUZ6CB", "relationships": [ { "uuid": "cf50ddb8-bce8-40fb-bc41-8114037d152a", "amount": { "uuid": "0b90b2e3-8251-4137-81bc-1ea869fd3205", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 101.5, "low_limit": 97 }, "qualification": "EP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (HPLC)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "9aea5e61-d3c5-47ee-82e1-e3e485456676", "refuuid": "c29a29ec-2f53-4604-90b8-b62b219b2860", "name": "Sulfasalazine", "unii": "3XC8GUZ6CB", "linking_id": "3XC8GUZ6CB", "ref_pname": "Sulfasalazine", "substance_class": "reference" } }, { "uuid": "4cfd790e-a12d-48af-b06a-0ed760417c7b", "amount": { "uuid": "d836f477-7cd4-43da-a53c-cd5637e06d11", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 101.5, "low_limit": 97 }, "qualification": "USP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (HPLC)", "references": [ "15eb1bbf-6c24-4f43-8951-6dcbe8748fa7" ], "related_substance": { "uuid": "541b001a-9702-4283-a29c-860def9ea551", "refuuid": "c29a29ec-2f53-4604-90b8-b62b219b2860", "name": "Sulfasalazine", "unii": "3XC8GUZ6CB", "linking_id": "3XC8GUZ6CB", "ref_pname": "Sulfasalazine", "substance_class": "reference" } }, { "uuid": "c2b9ea25-8594-41f9-a09d-c68391ee9903", "amount": { "uuid": "257dcd20-034f-4baf-9c2c-48bb2a152ddc", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "200781d0-035c-49d9-a692-15f264c7eb27", "refuuid": "b31f973d-46d0-42cf-aba1-4bb09f5b548d", "name": "4,4'-((4-Hydroxy-1,3-phenylene)bis(diazenediyl))bis(n-(pyridin-2-yl)benzenesulfonamide)", "unii": "C56X1P8LAD", "linking_id": "C56X1P8LAD", "ref_pname": "4,4'-((4-Hydroxy-1,3-phenylene)bis(diazenediyl))bis(n-(pyridin-2-yl)benzenesulfonamide)", "substance_class": "reference" } }, { "uuid": "273900ea-cff2-452d-8c04-37bde6b0ec7b", "amount": { "uuid": "8bbf69c7-74be-4666-9ad3-3e7a13f60f28", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "5faab466-3e1f-4b91-bf0b-5e7cdad58592", "refuuid": "887ce60e-33d6-4bec-b292-e91e3955d5eb", "name": "2-Hydroxy-3,5-bis(2-(4-(pyridin-2-ylsulfamoyl)phenyl)diazenyl)benzoic acid", "unii": "96255OEK8L", "linking_id": "96255OEK8L", "ref_pname": "2-Hydroxy-3,5-bis(2-(4-(pyridin-2-ylsulfamoyl)phenyl)diazenyl)benzoic acid", "substance_class": "reference" } }, { "uuid": "9bbc75eb-467b-4067-aa2d-9697800cba89", "amount": { "uuid": "6b9c1102-fdb2-43d8-90c3-ec6d6511e2ad", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "22198aa0-b127-4aa8-8023-52c3365249d4", "refuuid": "cc6be2ae-8539-4d71-a8f7-e14130ceff37", "name": "Salicylazoiminopyridine", "unii": "ENY1P1H0Y5", "linking_id": "ENY1P1H0Y5", "ref_pname": "Salicylazoiminopyridine", "substance_class": "reference" } }, { "uuid": "273e9002-3326-4a60-b543-fcad60a06c15", "amount": { "uuid": "759a0809-8f3a-448e-90f1-c75bd185d2e5", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "fff23d1a-381a-4850-963d-9760a062d06c", "refuuid": "ff75cfc0-51b6-47a1-baaa-2d471ba2cc2f", "name": "4-(2-(2-Hydroxyphenyl)diazenyl)-n-(pyridin-2-yl)benzenesulfonamide", "unii": "XS57THZ3GT", "linking_id": "XS57THZ3GT", "ref_pname": "4-(2-(2-Hydroxyphenyl)diazenyl)-n-(pyridin-2-yl)benzenesulfonamide", "substance_class": "reference" } }, { "uuid": "e85a9e74-acfe-4593-a855-6d8b9a85d720", "amount": { "uuid": "16a4e9d6-1fb5-4244-9bb2-0740b0f75124", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "c58411da-1401-4b75-b753-ea30102dc2ca", "refuuid": "b426a999-b02b-4512-be2d-b41900aa27a3", "name": "2-Hydroxy-4'-(pyridin-2-ylsulfamoyl)-5-(2-(4-(pyridin-2-ylsulfamoyl)phenyl)diazenyl)biphenyl-3-carboxylic acid", "unii": "MH1C2K5PXT", "linking_id": "MH1C2K5PXT", "ref_pname": "2-Hydroxy-4'-(pyridin-2-ylsulfamoyl)-5-(2-(4-(pyridin-2-ylsulfamoyl)phenyl)diazenyl)biphenyl-3-carboxylic acid", "substance_class": "reference" } }, { "uuid": "7d67d9ba-abce-4616-b044-905ee1aa9b85", "amount": { "uuid": "11de8205-0fc1-4f5e-a608-19e632f02f4d", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "507b0816-5934-495f-a288-b9bee75fade9", "refuuid": "844fa75f-6711-4118-8823-ca813f8785dc", "name": "Sulfasalazine 3-isomer", "unii": "657BS640RM", "linking_id": "657BS640RM", "ref_pname": "Sulfasalazine 3-isomer", "substance_class": "reference" } }, { "uuid": "51982d19-9daa-4c46-82ce-27c6d93e5a5c", "amount": { "uuid": "b98febab-a822-4b4e-899a-c359b65525fc", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "c80e8f9a-c9ca-4028-a3ef-b9daaaa084fb", "refuuid": "3ca417a1-71b7-4a6d-9c0a-a1fec328c4e2", "name": "5-(2-(4',5-Bis(pyridin-2-ylsulfamoyl)biphenyl-2-yl)diazenyl)-2-hydroxybenzoic acid", "unii": "9Q73VA76OF", "linking_id": "9Q73VA76OF", "ref_pname": "5-(2-(4',5-Bis(pyridin-2-ylsulfamoyl)biphenyl-2-yl)diazenyl)-2-hydroxybenzoic acid", "substance_class": "reference" } }, { "uuid": "215fa6c8-fc60-470d-bc1a-08f35e39f066", "amount": { "uuid": "bd025cbf-f77b-43d5-b519-64d6f67c154b", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "0fcd74a2-8fd7-4b8a-9111-9d0334e7d94b", "refuuid": "a589426a-fbf1-4ab6-9661-89ffb41ab926", "name": "MORDANT YELLOW 10 FREE ACID", "unii": "D0GUO5L1MO", "linking_id": "D0GUO5L1MO", "ref_pname": "MORDANT YELLOW 10 FREE ACID", "substance_class": "reference" } }, { "uuid": "5ab9cc28-6134-427f-8a6d-0bd266918915", "amount": { "uuid": "d7321ae5-27dd-4b65-8bdc-efb3018c5b17", "units": "PERCENT PEAK AREA", "high_limit": 1 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "20a0b04f-51c4-4890-af85-e697a3ad85fa" ], "related_substance": { "uuid": "625989eb-e10a-4eb5-b12d-a60d0b601556", "refuuid": "77ecc185-155e-4f2d-8b74-81c91be840d2", "name": "Salicylic acid", "unii": "O414PZ4LPZ", "linking_id": "O414PZ4LPZ", "ref_pname": "Salicylic acid", "substance_class": "reference" } }, { "uuid": "bfbbb226-c394-4faa-b7cf-803399ae0210", "amount": { "uuid": "d4cae689-e2fd-4c93-b055-e2999a99365a", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 0.5 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "198fa0ca-a2a7-48e0-8440-755c3d5a57f0" ], "related_substance": { "uuid": "1d6eca20-b45f-4b8a-8834-439ecbd5900e", "refuuid": "c733cd99-5dda-4642-a82a-efc5f35047e0", "name": "Sulfapyridine", "unii": "Y5V2N1KE8U", "linking_id": "Y5V2N1KE8U", "ref_pname": "Sulfapyridine", "substance_class": "reference" } }, { "uuid": "d273d1ac-b110-4ca9-beb9-85d1b4bac8d9", "amount": { "uuid": "fef0d5a6-424e-454c-91f8-d3d89529f621" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "d10fdd2e-fe89-466c-a1a4-bdd8ebe2c6b5", "refuuid": "c29a29ec-2f53-4604-90b8-b62b219b2860", "name": "Sulfasalazine", "unii": "3XC8GUZ6CB", "linking_id": "3XC8GUZ6CB", "ref_pname": "Sulfasalazine", "substance_class": "reference" } }, { "uuid": "37e2e565-d564-4151-b677-fa3477b6a5e8", "amount": { "uuid": "63f0eea0-e827-430e-a40d-6aab3b262675" }, "comments": "Inhibite the Hb-catalyzed peroxidative reaction", "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "040b9db9-4e6a-4386-ae1e-469769155fc1", "refuuid": "9b589a87-c467-4633-b380-236e9f5e39bb", "name": "INTESTINAL MICROBIOTA", "unii": "7V624678YX", "linking_id": "7V624678YX", "ref_pname": "INTESTINAL MICROBIOTA", "substance_class": "reference" }, "references": [ "d1399e8f-b12f-4e4d-8e69-5967e7771539" ], "related_substance": { "uuid": "48bd9098-3547-47af-b57b-27bf7bdafd80", "refuuid": "86eb03a8-d07f-4462-aa45-7f7e95c33efc", "name": "MESALAMINE", "unii": "4Q81I59GXC", "linking_id": "4Q81I59GXC", "ref_pname": "MESALAMINE", "substance_class": "reference" } }, { "uuid": "e2f5a3c4-d842-42b7-9a23-3551ac2aab68", "amount": { "uuid": "4ed2d74c-8d75-41f7-8a26-a95d651de67a" }, "comments": "Inhibite the Hb-catalyzed peroxidative reaction", "type": "METABOLITE LESS ACTIVE->PARENT", "references": [ "d1399e8f-b12f-4e4d-8e69-5967e7771539" ], "related_substance": { "uuid": "fb3bcb34-4573-4854-8b4d-2b20c1c4977f", "refuuid": "379c4d41-4d1b-415e-85fe-e78890bd7d78", "name": "N-ACETYL-5-AMINOSALICYLIC ACID", "unii": "9H126Z3PF5", "linking_id": "9H126Z3PF5", "ref_pname": "N-ACETYL-5-AMINOSALICYLIC ACID", "substance_class": "reference" } }, { "uuid": "4a610712-1d9e-42e8-8ed6-3f36eb694fbc", "amount": { "uuid": "6de0ccf2-f312-4c98-9bf3-78568e3b7b6e" }, "comments": "Not inhibite the Hb-catalyzed peroxidative reaction", "type": "METABOLITE INACTIVE->PARENT", "references": [ "d1399e8f-b12f-4e4d-8e69-5967e7771539" ], "related_substance": { "uuid": "deabeb85-57eb-49e3-a321-544f87cff2c2", "refuuid": "c733cd99-5dda-4642-a82a-efc5f35047e0", "name": "Sulfapyridine", "unii": "Y5V2N1KE8U", "linking_id": "Y5V2N1KE8U", "ref_pname": "Sulfapyridine", "substance_class": "reference" } }, { "uuid": "6029e54b-9941-4372-a693-96a8ee989d80", "amount": { "uuid": "4461d1fa-6c0c-4289-ae35-5430942c7e84" }, "type": "METABOLITE->PARENT", "references": [ "83bee95e-9e98-4a5a-969d-c0c49da077dc" ], "related_substance": { "uuid": "0c127937-d379-4ddb-a3af-ae6221f49394", "refuuid": "4591dbbb-d652-480c-88dc-b5e6626a0885", "name": "Acetylsulfapyridine", "unii": "3CM4B5MZJP", "linking_id": "3CM4B5MZJP", "ref_pname": "Acetylsulfapyridine", "substance_class": "reference" } }, { "uuid": "a41133ba-f5cd-47a2-8300-4843f7acc584", "amount": { "uuid": "32b8ae5e-1fd3-488b-a61e-e2fd1fc6a024" }, "type": "TARGET->INHIBITOR", "references": [ "e9e4e8d5-b467-9c64-a6b4-0ffdad440430" ], "related_substance": { "uuid": "dba74739-eb2f-4c6e-8a2e-96ec4ba8c0a8", "refuuid": "0aa86765-10d3-42c7-a71f-6a6386cbf793", "name": "ARACHIDONATE 5-LIPOXYGENASE-ACTIVATING PROTEIN", "unii": "C2A7BK79TZ", "linking_id": "C2A7BK79TZ", "ref_pname": "ARACHIDONATE 5-LIPOXYGENASE-ACTIVATING PROTEIN", "substance_class": "reference" } }, { "uuid": "b8fb4fab-908b-444b-8b0b-746171fde1a9", "amount": { "uuid": "908b14e5-f2e9-4e64-bcbe-53092a93acd2" }, "type": "TARGET->INHIBITOR", "references": [ "e9e4e8d5-b467-9c64-a6b4-0ffdad440430" ], "related_substance": { "uuid": "9b0d97c4-ff1b-4f50-9dd2-512a4e5d14af", "refuuid": "96aca590-4206-4721-bc4b-95d02aa3a057", "name": "COX-2", "unii": "D8T754TT2I", "linking_id": "D8T754TT2I", "ref_pname": "COX-2", "substance_class": "reference" } }, { "uuid": "3c0ec7a2-ccbb-4ce6-8f35-2a66788c117f", "amount": { "uuid": "8760ab98-afed-48fd-9e1d-20696a1879e9" }, "type": "TARGET->AGONIST", "references": [ "e9e4e8d5-b467-9c64-a6b4-0ffdad440430" ], "related_substance": { "uuid": "fd453302-d261-41b1-804e-dfd911791763", "refuuid": "e41f6658-1392-4a0f-ae16-fe62c0b08440", "name": "PEROXISOME PROLIFERATOR-ACTIVATED RECEPTOR GAMMA", "unii": "AL17N8ZSWL", "linking_id": "AL17N8ZSWL", "ref_pname": "PEROXISOME PROLIFERATOR-ACTIVATED RECEPTOR GAMMA", "substance_class": "reference" } }, { "uuid": "9dfbe864-5f31-454d-82e8-003e8041ca72", "amount": { "uuid": "ae34f1db-5888-4de2-b06e-db6872fb0e5f" }, "type": "TARGET->INHIBITOR", "references": [ "0f4f8ab1-c51a-4eb9-bc99-574f497d470a" ], "related_substance": { "uuid": "af1af983-4241-4db4-8c7d-bc288b9a600c", "refuuid": "0bcb7bbe-1c0c-4918-9796-2d59a59ffb15", "name": "Cystine-glutamate antiporter system", "unii": "68ZV6GS9MH", "linking_id": "68ZV6GS9MH", "ref_pname": "Cystine-glutamate antiporter system", "substance_class": "reference" } }, { "uuid": "cb394f5b-8ebf-455a-9953-b7f7a24e09c9", "amount": { "uuid": "fca70e4b-6465-46e0-848b-cd9e54ee5419" }, "type": "METABOLIC ENZYME->SUBSTRATE", "related_substance": { "uuid": "4a477548-c8ac-47bb-abc3-0b25e02b9e75", "refuuid": "9b589a87-c467-4633-b380-236e9f5e39bb", "name": "INTESTINAL MICROBIOTA", "unii": "7V624678YX", "linking_id": "7V624678YX", "ref_pname": "INTESTINAL MICROBIOTA", "substance_class": "reference" } }, { "uuid": "a9da444f-886a-4453-bfda-669137692d58", "amount": { "uuid": "7327d89f-1e1d-4a10-8bbb-86f15fa2f7b9" }, "comments": "Prevents translocation into nuclease ", "type": "TARGET->INHIBITOR", "references": [ "64747024-9839-4604-979d-b0028764741f" ], "related_substance": { "uuid": "5c016935-8754-4e0c-9536-e1af31b14470", "refuuid": "346aa21b-6b8d-42e9-bfac-cac7374fba0e", "name": "NF-κB", "unii": "7V91R4MWD2", "linking_id": "7V91R4MWD2", "ref_pname": "NF-κB", "substance_class": "reference" } } ], "names": [ { "uuid": "d233d479-a3c2-4d4a-91bd-507b056e5d7a", "name": "2-Hydroxy-5-((4-((2-pyridinylamino)sulfonyl)phenyl)azo)benzoic acid [WHO-IP]", "stdName": "2-HYDROXY-5-((4-((2-PYRIDINYLAMINO)SULFONYL)PHENYL)AZO)BENZOIC ACID [WHO-IP]", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c100a842-69fb-4090-9d1a-315612cb7503" ], "display_name": false }, { "uuid": "7f99530b-bd54-45a2-8b3f-a567b89929d3", "name": "Azulfidine", "stdName": "AZULFIDINE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "1d4f59bc-514f-4dd6-9961-bd0b36db23b8", "e69618a2-deb8-431c-a288-2f4a7471c9ff" ], "display_name": false }, { "uuid": "dbcf29f3-856c-4d16-94e0-f38308f68263", "name": "Benzoic acid, 2-hydroxy-5-[2-[4-[(2-pyridinylamino)sulfonyl]phenyl]diazenyl]-", "stdName": "BENZOIC ACID, 2-HYDROXY-5-(2-(4-((2-PYRIDINYLAMINO)SULFONYL)PHENYL)DIAZENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2488971c-bbe5-4b8d-b066-3d7f10bf7f84" ], "display_name": false }, { "uuid": "b63c00c2-3b5c-4850-96a3-95436dd78b88", "name": "Benzosulfa", "stdName": "BENZOSULFA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2488971c-bbe5-4b8d-b066-3d7f10bf7f84" ], "display_name": false }, { "uuid": "a17272a6-bdc2-4bab-88a2-dc5b9bdafa70", "name": "NSC-203730", "stdName": "NSC-203730", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2488971c-bbe5-4b8d-b066-3d7f10bf7f84" ], "display_name": false }, { "uuid": "a2233f12-c061-4846-8d2b-68d6a1669947", "name": "NSC-667219", "stdName": "NSC-667219", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2488971c-bbe5-4b8d-b066-3d7f10bf7f84" ], "display_name": false }, { "uuid": "cf0fda4c-7f56-bc79-3751-91a67b58b58d", "name": "SULFASALAZOPYRIDINE", "stdName": "SULFASALAZOPYRIDINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "13456b63-cf26-0746-e9e7-686b3e2c3a35" ], "display_name": false }, { "uuid": "3a46f1fe-0ddd-4f02-b662-472c18d6fff7", "name": "Salazopyrin", "stdName": "SALAZOPYRIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "97ba058a-e338-4728-858b-368a19d41eb6" ], "display_name": false }, { "uuid": "30db9974-eeae-4259-ae16-20d884d1275a", "name": "Salazosulfapyridine [JAN]", "stdName": "SALAZOSULFAPYRIDINE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2a9d93ce-4ed7-c4b3-c9bf-b77d1923ddae" ], "display_name": false }, { "uuid": "9d5bb8f6-a8f9-4cdb-a27a-ca67451229c5", "name": "Salicylazosulfapyridine", "stdName": "SALICYLAZOSULFAPYRIDINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0d50ea39-b065-40dd-a590-57eb1585285b" ], "display_name": false }, { "uuid": "9098c090-a9b1-4bda-91cb-fb330743fdda", "name": "Sulfasalazine", "stdName": "SULFASALAZINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "18f4cce1-8e58-426f-bb3d-26870f243df3", "716419df-ef05-415a-bd61-02084e63f08b", "e9a4c57f-d3aa-4f2c-ada4-b54fba8c2bfe", "9b8b2bd5-fb58-471c-b4e9-224290d05550", "0f8533af-a238-41fb-af16-43a1b9310809", "c1d46516-3ee8-4004-99bd-ce057ade3e6d", "3e6c6a93-39a8-4e1d-bf19-b6d22dc7e7b7", "2885c8cb-ded5-4fea-90a6-cb464fa6dc36", "28796a3e-aebb-4024-9308-ed36184f4e90", "2f602414-ac78-453d-b2a9-7138f309c1cf", "1712f10d-a8c2-45a1-a14b-a64af9c55817", "bf06eeb1-32e6-4760-b00e-91137279aa4c", "c100a842-69fb-4090-9d1a-315612cb7503", "2dafe032-1201-49e4-882a-f2f0c7658bfe", "977f0b55-8ccc-418f-b3df-ddac3b3da1f7", "30fdc483-16d9-4d62-9a1d-997975d935fc", "cd9a45f5-2801-40ce-8c13-eca936f95b14", "1b2c80b3-7f0b-4d2c-8387-3e68bd7f3235", "c53c6dc0-660b-47f1-849e-0c066c315da0", "b95ed523-df27-46ca-aa72-9d69717cced8", "3a686c36-4e0d-4fb0-b090-38cfeb33e5bf", "8364ae86-d578-40d8-9be4-182c1cdf4da2", "551dde06-8775-4f6f-9793-ab0633b48680", "4421b6d8-8129-4195-a762-621bba5e9695", "5e61f6a2-1602-456e-a82e-e8d739c3da4a" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "b08a8eac-be19-45b2-93ec-4ec5f3f958d6", "name_org": "INN" }, { "uuid": "989d1434-6a7a-4854-bee8-80f7fd221560", "name_org": "USAN" } ] }, { "uuid": "3c48345c-fb96-8ff3-2985-f2682af1c6ad", "name": "Sulfasalazine [EP MONOGRAPH]", "stdName": "SULFASALAZINE [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e0766400-d3b9-f283-5fc3-f12a61c7cf58" ], "display_name": false }, { "uuid": "de1fbb5a-0dee-4db5-9090-ec26f2350d13", "name": "Sulfasalazine [HSDB]", "stdName": "SULFASALAZINE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "977f0b55-8ccc-418f-b3df-ddac3b3da1f7" ], "display_name": false }, { "uuid": "ba6e7125-265a-4754-d8e0-b8e1d70350db", "name": "Sulfasalazine [IARC]", "stdName": "SULFASALAZINE [IARC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ef832537-db4d-e133-6c79-8ddc854b6175" ], "display_name": false }, { "uuid": "0fd28cc3-409c-485d-8c7e-89a14b3f4cad", "name": "Sulfasalazine [INN]", "stdName": "SULFASALAZINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4421b6d8-8129-4195-a762-621bba5e9695" ], "display_name": false }, { "uuid": "3c4a1e9a-13b6-4871-96ea-056d473f6f6d", "name": "Sulfasalazine [MART.]", "stdName": "SULFASALAZINE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "716419df-ef05-415a-bd61-02084e63f08b" ], "display_name": false }, { "uuid": "54ff1c14-861b-48b9-96b0-914ada4377a3", "name": "Sulfasalazine [MI]", "stdName": "SULFASALAZINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2f602414-ac78-453d-b2a9-7138f309c1cf" ], "display_name": false }, { "uuid": "11446a2a-acf1-4052-b54c-5cc39d92fc45", "name": "Sulfasalazine [ORANGE BOOK]", "stdName": "SULFASALAZINE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5e61f6a2-1602-456e-a82e-e8d739c3da4a" ], "display_name": false }, { "uuid": "0d85f7d4-3e15-4f75-a97e-ce578516a67c", "name": "Sulfasalazine [USAN]", "stdName": "SULFASALAZINE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "551dde06-8775-4f6f-9793-ab0633b48680" ], "display_name": false }, { "uuid": "af694528-d05f-b1ab-fcea-92dfe56850e2", "name": "Sulfasalazine [USP MONOGRAPH]", "stdName": "SULFASALAZINE [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "de66100d-a491-4b9f-cc84-8993752e1b59" ], "display_name": false }, { "uuid": "578d72ac-d260-496d-b675-bcef4e0bab13", "name": "Sulfasalazine [USP-RS]", "stdName": "SULFASALAZINE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c53c6dc0-660b-47f1-849e-0c066c315da0" ], "display_name": false }, { "uuid": "584f0138-796b-4117-ac10-04186cda2d51", "name": "Sulfasalazine [VANDF]", "stdName": "SULFASALAZINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1b2c80b3-7f0b-4d2c-8387-3e68bd7f3235" ], "display_name": false }, { "uuid": "aaf6dd75-ec18-4351-47d3-8bb59a60f87b", "name": "Sulfasalazine [WHO-DD]", "stdName": "SULFASALAZINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8d109568-1bae-3ea8-feba-a377929e955a" ], "display_name": false }, { "uuid": "d1f65c0e-0704-41e1-882c-379ba8b51012", "name": "Sulfasalazine [WHO-IP]", "stdName": "SULFASALAZINE [WHO-IP]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c100a842-69fb-4090-9d1a-315612cb7503" ], "display_name": false }, { "uuid": "62c89d73-30da-4c61-a8de-93e437768dac", "name": "Sulfasalazinum [WHO-IP LATIN]", "stdName": "SULFASALAZINUM [WHO-IP LATIN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c100a842-69fb-4090-9d1a-315612cb7503" ], "display_name": false }, { "uuid": "e9ef1a87-66a3-4744-866a-863207b874fd", "name": "Sulphasalazine", "stdName": "SULPHASALAZINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "add1a2d4-9549-4ce2-a4c7-c7945a32ed3d" ], "display_name": false } ], "properties": [ { "uuid": "f84f2767-3bea-475e-b887-dc12deea7ab0", "name": "Biological Half-life", "value": { "uuid": "0413ec8d-533d-4f7b-99d5-62dfa6abaef1", "average": 5.7, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "ada4b737-c71b-4b0e-5d4e-ae3ddb6d7433" ] }, { "uuid": "4f14a63e-2e9d-4ce2-b7a2-9dd4aa58cb60", "name": "Volume of Distribution", "value": { "uuid": "dcf33acf-b844-4033-99d0-c28da8d89200", "high": 0.13, "low": 0.08, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "ada4b737-c71b-4b0e-5d4e-ae3ddb6d7433" ] } ] } ] }