{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "651f39ee-3148-463b-bb16-17a1c0af3a75",
          "code": "98086-36-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98086-36-3",
          "code_system": "CAS",
          "references": [
            "9c3ce222-0df7-4dbb-aa44-86a880b9632b",
            "f14d6186-793c-448b-a613-0c6477fed843"
          ]
        },
        {
          "uuid": "28a94fe7-dc0f-42ed-b9a0-cf1314362173",
          "code": "CHLOROETHYLCLONIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chloroethylclonidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "9c3ce222-0df7-4dbb-aa44-86a880b9632b"
          ]
        },
        {
          "uuid": "b88f60ca-b861-4702-86c3-37b4dbf1838b",
          "code": "104973",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104973",
          "code_system": "PUBCHEM",
          "references": [
            "9c3ce222-0df7-4dbb-aa44-86a880b9632b"
          ]
        },
        {
          "uuid": "45c90a02-5082-4194-8f74-550a5339be81",
          "code": "3X825O680H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bbba6081-9e6e-4e55-9e48-9db68ae9a03a",
          "code": "77472-95-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77472-95-8",
          "code_system": "CAS",
          "references": [
            "f14d6186-793c-448b-a613-0c6477fed843"
          ]
        },
        {
          "uuid": "aa4f3592-7d0c-a32e-44b7-146401848825",
          "code": "DTXSID40913463",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40913463",
          "code_system": "EPA CompTox",
          "references": [
            "4804853b-ca9b-8b3b-7ece-91650cfe0dd3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "207526e9-2838-49a9-920c-2a079172d3c8",
          "name": "1H-IMIDAZOL-2-AMINE, N-(2,6-DICHLORO-4-(((2-CHLOROETHYL)METHYLAMINO)METHYL)PHENYL)-4,5-DIHYDRO-",
          "stdName": "1H-IMIDAZOL-2-AMINE, N-(2,6-DICHLORO-4-(((2-CHLOROETHYL)METHYLAMINO)METHYL)PHENYL)-4,5-DIHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62e1b638-b42c-4f17-b3ed-73fdb930f755",
            "11c081ac-3d3c-4b1e-9687-bbaed23cb07c"
          ],
          "display_name": false
        },
        {
          "uuid": "bb40a39f-843c-46f0-91c1-c3ef8e27dbef",
          "name": "CEC",
          "stdName": "CEC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62e1b638-b42c-4f17-b3ed-73fdb930f755",
            "11c081ac-3d3c-4b1e-9687-bbaed23cb07c"
          ],
          "display_name": false
        },
        {
          "uuid": "4c7beca6-0e47-4640-85c6-88e6abce1b8a",
          "name": "CHLORETHYLCLONIDINE",
          "stdName": "CHLORETHYLCLONIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7cb9d55-1dc0-453a-83a0-bf6b9bc7c49f",
            "5b2c5807-defa-43b2-be07-0f6fbdc17de7"
          ],
          "display_name": true
        },
        {
          "uuid": "53c3b34b-adb0-4e38-a27e-e18d436d97bf",
          "name": "CHLOROETHYLCLONIDINE",
          "stdName": "CHLOROETHYLCLONIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad2efc8b-f8a2-496a-9ea8-ef1c6d23705f",
            "11c081ac-3d3c-4b1e-9687-bbaed23cb07c"
          ],
          "display_name": false
        },
        {
          "uuid": "bc284b97-bbd9-4996-9e81-6b100becbd7b",
          "name": "NC-17",
          "stdName": "NC-17",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62e1b638-b42c-4f17-b3ed-73fdb930f755",
            "11c081ac-3d3c-4b1e-9687-bbaed23cb07c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5b2c5807-defa-43b2-be07-0f6fbdc17de7",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e7cb9d55-1dc0-453a-83a0-bf6b9bc7c49f",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad2efc8b-f8a2-496a-9ea8-ef1c6d23705f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11c081ac-3d3c-4b1e-9687-bbaed23cb07c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62e1b638-b42c-4f17-b3ed-73fdb930f755",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c3ce222-0df7-4dbb-aa44-86a880b9632b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391215000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a26b624-48bd-457d-9d40-343c517da504",
          "citation": "SRS import [3X825O680H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3X825O680H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391215000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb2f1a72-95bc-4392-ba9e-049c26c87de5",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f14d6186-793c-448b-a613-0c6477fed843",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4804853b-ca9b-8b3b-7ece-91650cfe0dd3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "eb285d0b-5abc-4e21-8251-951eceb3f35c",
          "id": "eb285d0b-5abc-4e21-8251-951eceb3f35c",
          "molfile": "\n  Marvin  01132112102D          \n\n 20 21  0  0  0  0            999 V2000\n    3.4723   -3.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4750   -4.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1875   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9000   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6125   -4.6000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7646   -4.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0495   -4.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0466   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3313   -2.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3288   -2.1330    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.6194   -3.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0952   -2.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8125   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4818   -2.8799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1468   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8943   -4.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0693   -4.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6182   -4.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0966   -4.6101    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.3331   -4.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 20  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 17 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CN(CCCl)Cc1cc(c(c(c1)Cl)NC2=NCCN2)Cl",
          "formula": "C13H17Cl3N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "53c70711-8e12-4180-860f-1ce14b8b36a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "335.6602",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9b0b9abe-4e29-4bd9-b9da-5dc3dedfcd98",
      "version": "4",
      "structure": {
        "id": "30d0ea61-76bc-4717-a900-9528bf8e052c",
        "molfile": "\n  Marvin  01132102372D          \n\n 20 21  0  0  0  0            999 V2000\n   -1.8943   -4.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0693   -4.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8125   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4818   -2.8799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1468   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6194   -3.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6182   -4.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3331   -4.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0495   -4.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0466   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3313   -2.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3288   -2.1330    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0966   -4.6101    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7646   -4.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0952   -2.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4750   -4.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1875   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9000   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6125   -4.6000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4723   -3.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  1  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  6  1  0  0  0  0\n  1  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n  6  7  2  0  0  0  0\n  9 14  1  0  0  0  0\n  2  3  2  0  0  0  0\n  6 15  1  0  0  0  0\n 15  3  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14 16  1  0  0  0  0\n  3  4  1  0  0  0  0\n 16 17  1  0  0  0  0\n  8  9  2  0  0  0  0\n 17 18  1  0  0  0  0\n  4  5  1  0  0  0  0\n 18 19  1  0  0  0  0\n  9 10  1  0  0  0  0\n 16 20  1  0  0  0  0\nM  END",
        "smiles": "CN(CCCl)Cc1cc(c(c(c1)Cl)NC2=NCCN2)Cl",
        "formula": "C13H17Cl3N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "335.6602",
        "optical_activity": "NONE",
        "references": [
          "4a26b624-48bd-457d-9d40-343c517da504",
          "eb2f1a72-95bc-4392-ba9e-049c26c87de5"
        ],
        "stereo_centers": 0
      },
      "unii": "3X825O680H"
    }
  ]
}