{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "be9ed5b3-3ea4-47db-bc1c-f60d1c8b2990",
          "code": "GERANYL ACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=1603",
          "code_system": "JECFA EVALUATION",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "4fa163a8-e0f2-4ba9-83eb-cae2072c25b0",
          "code": "105-87-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=105-87-3",
          "code_system": "CAS",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011",
            "190cd555-5565-44e8-b146-012dc600767a"
          ]
        },
        {
          "uuid": "0bcd610d-09ef-47a6-acc4-074a047af6af",
          "code": "GERANYL ACETATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Geranyl_acetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "cea7f954-74a7-435f-ae92-885360ccfb4a",
          "code": "203-341-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.038",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "14a36a07-0827-43ef-8d64-398fcca99c59",
          "code": "SUB77425",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "5c7ad213-e106-4d82-a268-98a39f135eed",
          "code": "1807120",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1807120/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "6ef2e203-89a5-4552-8919-59e6fb270cb4",
          "code": "1549026",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1549026",
          "code_system": "PUBCHEM",
          "references": [
            "374efa34-76f9-4d73-8aa6-76df7f5d1011"
          ]
        },
        {
          "uuid": "f06e2169-3e59-b199-2355-777200b5e82a",
          "code": "586",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/586",
          "code_system": "HSDB",
          "references": [
            "7fcc0908-9dfc-7def-2cd8-da153824a274"
          ]
        },
        {
          "uuid": "3f1325e6-8038-d943-98ab-7e6357c5e9d7",
          "code": "DTXSID0020654",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0020654",
          "code_system": "EPA CompTox",
          "references": [
            "9762b10c-cb42-c916-98a1-5ee61a20e855"
          ]
        },
        {
          "uuid": "6a581ab5-68a2-4c18-b16b-09a3e511f11f",
          "code": "3W81YG7P9R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a43d040-5413-41c2-2ca7-4a9da6cf61c9",
          "code": "5331",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5331",
          "code_system": "CHEBI",
          "references": [
            "042eca57-3478-22b3-59ca-ad315f6124e3"
          ]
        },
        {
          "uuid": "cc5382ac-9689-330c-f7e5-b95daae0b4fe",
          "code": "100000138104",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d1b4d220-799f-cb91-8af1-755b0f06114a"
          ]
        },
        {
          "uuid": "b7300510-1765-058f-960d-886033cae013",
          "code": "2584",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2584",
          "code_system": "NSC",
          "references": [
            "e69f7c97-40cd-f174-9369-a968c5306206"
          ]
        },
        {
          "uuid": "f1247d44-5a6f-648c-03e0-fcd5324ecc3b",
          "code": "3W81YG7P9R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3W81YG7P9R",
          "code_system": "DAILYMED",
          "references": [
            "a689f530-6b9d-f2d3-18e2-ae25bff93635"
          ]
        },
        {
          "uuid": "5b07e0f4-369b-b753-2f92-957b7129e438",
          "code": "625",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/625/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "a7dce1f8-2f5f-31ba-3011-28abb5791c6e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "06f8e994-f698-486f-aee3-60c08841b584",
          "name": "2,6-OCTADIEN-1-OL, 3,7-DIMETHYL-, ACETATE, (E)-",
          "stdName": "2,6-OCTADIEN-1-OL, 3,7-DIMETHYL-, ACETATE, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "1f85473e-f65d-4544-bab4-e182696d61fd"
          ],
          "display_name": false
        },
        {
          "uuid": "4ba023fa-cb2a-4dc1-8c36-54435bb5b3fd",
          "name": "3,7-DIMETHYL-2-TRANS, 6-OCTADIENYL ACETATE",
          "stdName": "3,7-DIMETHYL-2-TRANS, 6-OCTADIENYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "1f85473e-f65d-4544-bab4-e182696d61fd"
          ],
          "display_name": false
        },
        {
          "uuid": "85a6976c-ed82-45a0-87de-89e308831009",
          "name": "BAY PINE (OYSTER) OIL",
          "stdName": "BAY PINE (OYSTER) OIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "3dadefff-cc77-49d5-9b32-71e1f11c6e68"
          ],
          "display_name": false
        },
        {
          "uuid": "43de1d18-23f9-4286-a9cb-cfeccf4dd905",
          "name": "FEMA NO. 2509",
          "stdName": "FEMA NO. 2509",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5873ee8-1503-4895-99e8-0fb17744cec4"
          ],
          "display_name": false
        },
        {
          "uuid": "16fe56ef-8d61-4458-8075-e4eab0ce083e",
          "name": "GERANIOL ACETATE",
          "stdName": "GERANIOL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "1f85473e-f65d-4544-bab4-e182696d61fd"
          ],
          "display_name": false
        },
        {
          "uuid": "8fdae4fb-ebbd-4a8e-835f-099a55a4ece2",
          "name": "GERANYL ACETATE",
          "stdName": "GERANYL ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50cf7bd-78b1-45da-9597-bb3665b85d00",
            "3f070cfa-9885-4b02-a56e-39f97f3093d9",
            "1f85473e-f65d-4544-bab4-e182696d61fd",
            "02773d97-a50d-4bd3-94bc-43943c2a11de",
            "acb5fb84-019d-4da7-a7e4-d6fa68e7d9e9",
            "b695eec8-f8dc-43be-a0ff-55a3e196d9c1",
            "6907f46b-db45-454d-bcf4-c494b83bc61b",
            "34c5e96c-20ce-47bc-b3e1-3c360eaae9f7",
            "53f98226-33b7-4f3b-a9fe-455b8b947da3",
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "c3f68b0f-f7c6-476e-be48-938f56eb8328"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b5d47a5c-5ab8-4e65-b110-bc848edc0fab",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5323bda5-d9d5-49cd-96ef-1aee8e9c696b",
          "name": "GERANYL ACETATE [FCC]",
          "stdName": "GERANYL ACETATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "acb5fb84-019d-4da7-a7e4-d6fa68e7d9e9"
          ],
          "display_name": false
        },
        {
          "uuid": "d66743d5-02c9-4e2d-9ac2-22c36e53a40a",
          "name": "GERANYL ACETATE [FHFI]",
          "stdName": "GERANYL ACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b695eec8-f8dc-43be-a0ff-55a3e196d9c1",
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc"
          ],
          "display_name": false
        },
        {
          "uuid": "aa4ad2b2-d57b-4ff7-9268-4f07d376da3b",
          "name": "GERANYL ACETATE [HSDB]",
          "stdName": "GERANYL ACETATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50cf7bd-78b1-45da-9597-bb3665b85d00",
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc"
          ],
          "display_name": false
        },
        {
          "uuid": "72750cee-8006-4714-8c26-6aedb15ef7f9",
          "name": "GERANYL ETHANOATE",
          "stdName": "GERANYL ETHANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "3dadefff-cc77-49d5-9b32-71e1f11c6e68"
          ],
          "display_name": false
        },
        {
          "uuid": "a04867cf-9abf-49de-863d-bbf9065857e9",
          "name": "NSC-2584",
          "stdName": "NSC-2584",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "3dadefff-cc77-49d5-9b32-71e1f11c6e68"
          ],
          "display_name": false
        },
        {
          "uuid": "86f49ef2-3f57-41b5-9b73-55bc76558883",
          "name": "TRANS-2,6-DIMETHYL-2,6-OCTADIEN-8-YL ETHANOATE",
          "stdName": "TRANS-2,6-DIMETHYL-2,6-OCTADIEN-8-YL ETHANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "1f85473e-f65d-4544-bab4-e182696d61fd"
          ],
          "display_name": false
        },
        {
          "uuid": "54ed02ed-7aa0-4a38-ac72-2d227e9ed00a",
          "name": "TRANS-3,7-DIMETHYL-2,6-OCTADIEN-1-YL ACETATE",
          "stdName": "TRANS-3,7-DIMETHYL-2,6-OCTADIEN-1-YL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
            "1f85473e-f65d-4544-bab4-e182696d61fd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f85473e-f65d-4544-bab4-e182696d61fd",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6907f46b-db45-454d-bcf4-c494b83bc61b",
          "citation": "DL",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e4c684f-dab2-4b0c-bd3c-2166eaae07cc",
          "citation": "DOSE",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5873ee8-1503-4895-99e8-0fb17744cec4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b695eec8-f8dc-43be-a0ff-55a3e196d9c1",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34c5e96c-20ce-47bc-b3e1-3c360eaae9f7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acb5fb84-019d-4da7-a7e4-d6fa68e7d9e9",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c50cf7bd-78b1-45da-9597-bb3665b85d00",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dadefff-cc77-49d5-9b32-71e1f11c6e68",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "374efa34-76f9-4d73-8aa6-76df7f5d1011",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "306f1bd0-61cc-46e7-93a7-28a66db34db2",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22413e97-ac47-4997-b787-25be9be081c8",
          "citation": "SRS import [3W81YG7P9R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3W81YG7P9R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02773d97-a50d-4bd3-94bc-43943c2a11de",
          "citation": "GERANYL ACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53f98226-33b7-4f3b-a9fe-455b8b947da3",
          "citation": "GERANYL ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f070cfa-9885-4b02-a56e-39f97f3093d9",
          "citation": "GERANYL ACETATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c3f68b0f-f7c6-476e-be48-938f56eb8328",
          "citation": "GERANYL ACETATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7fcc0908-9dfc-7def-2cd8-da153824a274",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+105-87-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9762b10c-cb42-c916-98a1-5ee61a20e855",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=105-87-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1b4d220-799f-cb91-8af1-755b0f06114a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "190cd555-5565-44e8-b146-012dc600767a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "042eca57-3478-22b3-59ca-ad315f6124e3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e69f7c97-40cd-f174-9369-a968c5306206",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a689f530-6b9d-f2d3-18e2-ae25bff93635",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a7dce1f8-2f5f-31ba-3011-28abb5791c6e",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "50913459-e77c-4000-8beb-20ee02e2c776",
          "id": "50913459-e77c-4000-8beb-20ee02e2c776",
          "molfile": "\n  Marvin  01132104122D          \n\n 14 13  0  0  0  0            999 V2000\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6980   -0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6747   -1.2564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4296   -0.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1276   -0.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8566   -0.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5546   -0.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5313   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2809   -0.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9867   -0.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -0.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4085   -0.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1375   -0.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3853   -1.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/COC(=O)C)/C)C",
          "formula": "C12H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "16dd42ae-7b7b-41bd-b7f2-6a783c1d7cca"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "196.2865",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5055ef2c-6c59-4c5f-a313-165b2a0ca003",
      "version": "11",
      "structure": {
        "id": "9cf45a69-8911-4a5f-bfa5-85b2ab10ac69",
        "molfile": "\n  Marvin  01132108092D          \n\n 14 13  0  0  0  0            999 V2000\n    0.6980   -0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6747   -1.2564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5546   -0.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4085   -0.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8566   -0.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7105   -0.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4296   -0.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1276   -0.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9867   -0.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2809   -0.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1375   -0.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3853   -1.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5313   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  5  2  0  0  0  0\n  4  6  2  0  0  0  0\n  5  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  3  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/COC(=O)C)/C)C",
        "formula": "C12H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "196.2865",
        "optical_activity": "NONE",
        "references": [
          "22413e97-ac47-4997-b787-25be9be081c8",
          "1f85473e-f65d-4544-bab4-e182696d61fd"
        ],
        "stereo_centers": 0
      },
      "unii": "3W81YG7P9R"
    }
  ]
}