{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88543a27-df9e-43ad-ac0d-0700f0d2a55f",
          "code": "545-48-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=545-48-2",
          "code_system": "CAS",
          "references": [
            "7b353463-0d9f-41cf-a4cd-d946f0d294d9",
            "88e05bf0-34ef-4856-9537-70322338ed61"
          ]
        },
        {
          "uuid": "632d0d86-3059-4365-ad24-c29bd88cd82f",
          "code": "208-890-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.083",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7b353463-0d9f-41cf-a4cd-d946f0d294d9"
          ]
        },
        {
          "uuid": "7bfe33f0-b986-4d3e-87ee-e8577c603753",
          "code": "101761",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101761",
          "code_system": "PUBCHEM",
          "references": [
            "7b353463-0d9f-41cf-a4cd-d946f0d294d9"
          ]
        },
        {
          "uuid": "707c4b49-91d5-d7dc-27c0-22ae7e6aab89",
          "code": "4157 (Number of products:6)",
          "comments": "Dietary Supplement Label Database|chemical|Erythrodiol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4157&item=Erythrodiol",
          "code_system": "DSLD",
          "references": [
            "f1479947-be48-bf9a-fb12-c8f419aaa967"
          ]
        },
        {
          "uuid": "773a0fee-c7bf-467e-bb11-ac7a604c72d7",
          "code": "3VWF903FSS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "abb5b898-f37d-23f8-faf2-40fcf0abdf48",
          "code": "67939",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:67939",
          "code_system": "CHEBI",
          "references": [
            "f1479947-be48-bf9a-fb12-c8f419aaa967"
          ]
        },
        {
          "uuid": "fcaab34f-8f11-0789-9e3c-874fef3a25e0",
          "code": "DTXSID401015931",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401015931",
          "code_system": "EPA CompTox",
          "references": [
            "f1479947-be48-bf9a-fb12-c8f419aaa967"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c0150878-dee4-4562-885c-7e451e25dd68",
          "comments": "CALENDULA OFFICINALIS FLOWER terpenoid",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "d8544612-0967-41c0-978b-8e1987506bc6"
          ],
          "related_substance": {
            "uuid": "dafe638a-cc97-4c54-9d88-07bbd79f7196",
            "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9",
            "name": "CALENDULA OFFICINALIS FLOWER",
            "unii": "P0M7O4Y7YD",
            "linking_id": "P0M7O4Y7YD",
            "ref_pname": "CALENDULA OFFICINALIS FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "132ee5dd-a5d2-49f9-9dda-a74900d46879",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "d8544612-0967-41c0-978b-8e1987506bc6"
          ],
          "related_substance": {
            "uuid": "2f008d82-a83b-4959-8b26-a9a398ef76cf",
            "refuuid": "2f00e021-a109-40d1-bf86-43b69127d5f4",
            "name": "CENTAURIUM ERYTHRAEA WHOLE",
            "unii": "T0N9DND3W1",
            "linking_id": "T0N9DND3W1",
            "ref_pname": "CENTAURIUM ERYTHRAEA WHOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3bdc035-3a23-449c-8e75-15e31f414faf",
          "name": "(3.BETA.)-OLEAN-12-ENE-3,28-DIOL",
          "stdName": "(3.BETA.)-OLEAN-12-ENE-3,28-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        },
        {
          "uuid": "75b40355-ddd6-4de8-be66-29ae18b17370",
          "name": "3.BETA.,28-DIHYDROXYOLEAN-12-ENE",
          "stdName": "3.BETA.,28-DIHYDROXYOLEAN-12-ENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        },
        {
          "uuid": "c3f579b5-f531-46f0-8b37-510538417a08",
          "name": "3.BETA.-ERYTHRODIOL",
          "stdName": "3.BETA.-ERYTHRODIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        },
        {
          "uuid": "11070e8d-2da5-40de-80c9-a0b63140c8f3",
          "name": "ERYTHRODIOL",
          "stdName": "ERYTHRODIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb4e6384-94a7-4b73-bf34-e526066aeabf",
            "a8fda538-3545-448d-9abf-7ed672ad18c9",
            "cc2c872f-c7f2-4742-84b4-da3cb075bacb",
            "51cf882c-518f-43bf-a8f9-5e2a35bb24d1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "416dd851-61d5-4f5e-a9d6-7bbc995c4dec",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7fae754c-fc6e-4a26-9f04-fd4efc3334b6",
          "name": "ERYTHRODIOL, (+)-",
          "stdName": "ERYTHRODIOL, (+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        },
        {
          "uuid": "1356fa48-b006-4cac-8156-14482bae77a8",
          "name": "OLEAN-12-ENE-3,28-DIOL, (3.BETA.)-",
          "stdName": "OLEAN-12-ENE-3,28-DIOL, (3.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        },
        {
          "uuid": "ee2324f2-e9cf-43de-ae8d-f56e19654ed5",
          "name": "OLEAN-12-ENE-3.BETA.,28-DIOL",
          "stdName": "OLEAN-12-ENE-3.BETA.,28-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
            "a8fda538-3545-448d-9abf-7ed672ad18c9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb4e6384-94a7-4b73-bf34-e526066aeabf",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "51cf882c-518f-43bf-a8f9-5e2a35bb24d1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8fda538-3545-448d-9abf-7ed672ad18c9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3919476c-9ecd-43d9-a3a6-ae70d1d410be",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b353463-0d9f-41cf-a4cd-d946f0d294d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391109000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8544612-0967-41c0-978b-8e1987506bc6",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4218c25-1408-4bff-8aa5-be6331338906",
          "citation": "SRS import [3VWF903FSS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3VWF903FSS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391109000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d908b7ff-526e-4840-bd55-4ff2187e122b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc2c872f-c7f2-4742-84b4-da3cb075bacb",
          "citation": "ERYTHRODIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1479947-be48-bf9a-fb12-c8f419aaa967",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "88e05bf0-34ef-4856-9537-70322338ed61",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "26709bb4-6ca2-4cca-b0c6-9bb11ff5d9a2",
          "id": "26709bb4-6ca2-4cca-b0c6-9bb11ff5d9a2",
          "molfile": "\n  Marvin  01132102072D          \n\n 32 36  0  0  1  0            999 V2000\n    2.6917   -8.7572    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.9803   -9.1749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6917   -7.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3986   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1100   -7.9218    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1100   -7.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1100   -8.7572    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.8214   -9.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -8.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -7.9218    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5283   -7.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8214   -7.5041    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.8214   -6.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2397   -6.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9512   -6.2511    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.9512   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6627   -4.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1394   -4.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1860   -4.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6627   -6.6688    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3741   -7.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -7.9218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6627   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9512   -7.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2397   -7.5041    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.2397   -8.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3986   -9.1749    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8798   -9.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9218   -9.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 30  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  5 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 30  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 10 28  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  6  0  0  0\n 15 28  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 23  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 18  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  1  0  0  0\n 23 26  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  6  0  0  0\n 31 30  1  0  0  0  0\n 32 30  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)[C@@H]2C1)CO",
          "formula": "C30H50O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b035630e-8fb6-4dfb-9234-2f2a1d393c79"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "442.7179",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9e83e5f2-bbcb-4dd7-995a-3c4c32016602",
      "version": "6",
      "structure": {
        "id": "81ef3a5f-d36f-4668-a6fb-6e806f221cb9",
        "molfile": "\n  Marvin  01132106442D          \n\n 35 39  0  0  1  0            999 V2000\n    6.2397   -7.5041    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6627   -6.6688    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9512   -6.2511    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8214   -7.5041    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1100   -7.9218    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.6917   -8.7572    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1100   -8.7572    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5283   -7.9218    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9512   -7.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6627   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6627   -4.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9512   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2397   -6.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8214   -6.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3986   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6917   -7.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3986   -9.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8214   -9.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -8.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5283   -7.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4078   -8.3579    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8798   -9.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9218   -9.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9803   -9.1749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1100   -7.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8214   -8.3303    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9512   -7.0772    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1394   -4.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1860   -4.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -7.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3741   -7.9218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2397   -8.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  3  1  0  0  0  0\n  3 15  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17  4  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19  6  1  0  0  0  0\n  6 20  1  0  0  0  0\n 20  7  1  0  0  0  0\n  7 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22  8  1  0  0  0  0\n  8 23  1  1  0  0  0\n  7 24  1  6  0  0  0\n 25 20  1  0  0  0  0\n 26 20  1  0  0  0  0\n  6 27  1  1  0  0  0\n  5 28  1  1  0  0  0\n  4 29  1  6  0  0  0\n  3 30  1  1  0  0  0\n 31 13  1  0  0  0  0\n 32 13  1  0  0  0  0\n  2 33  1  1  0  0  0\n 34 33  1  0  0  0  0\n  1 35  1  6  0  0  0\nM  END",
        "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@]2([H])C1)CO",
        "formula": "C30H50O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "442.7179",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d908b7ff-526e-4840-bd55-4ff2187e122b",
          "d4218c25-1408-4bff-8aa5-be6331338906"
        ],
        "stereo_centers": 8
      },
      "unii": "3VWF903FSS"
    }
  ]
}