{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2105365e-fa2b-4a62-85ae-7a76d3ad3423",
          "code": "85-84-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85-84-7",
          "code_system": "CAS",
          "references": [
            "d7a4205c-6eea-4d85-905b-1b8180a8c90e",
            "b813dc94-2d3c-4eb3-8fe6-a1578995393e"
          ]
        },
        {
          "uuid": "6871d23c-b33e-4905-acc5-6c83b58451bd",
          "code": "C80141",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80141",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d7a4205c-6eea-4d85-905b-1b8180a8c90e"
          ]
        },
        {
          "uuid": "0630c294-3065-4fae-92a1-3e0fe5cd7e11",
          "code": "201-636-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.488",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d7a4205c-6eea-4d85-905b-1b8180a8c90e"
          ]
        },
        {
          "uuid": "a6e7fdbb-8914-4936-8732-5bfe32dd0b77",
          "code": "m11563",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11563?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d7a4205c-6eea-4d85-905b-1b8180a8c90e"
          ]
        },
        {
          "uuid": "3c4577f4-30bd-476a-b36a-8ec8af9c84ef",
          "code": "6824",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6824",
          "code_system": "PUBCHEM",
          "references": [
            "d7a4205c-6eea-4d85-905b-1b8180a8c90e"
          ]
        },
        {
          "uuid": "16da7b71-ec2d-d6a4-06dc-9852e6091e77",
          "code": "1041",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1041",
          "code_system": "HSDB",
          "references": [
            "c44f4f9c-665f-6c48-45aa-7bc7b339d025"
          ]
        },
        {
          "uuid": "04695105-3e07-2a7b-7649-6c58dca97990",
          "code": "1430252",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1430252/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "4d265ab7-f9c8-48ed-a6bd-8e28c0139a92",
          "code": "3VSI4D701X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ef40f4c-5149-adda-f934-d2d62e204b3c",
          "code": "DTXSID0058932",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0058932",
          "code_system": "EPA CompTox",
          "references": [
            "aa4b795f-b047-7a64-1a68-c305061580af"
          ]
        },
        {
          "uuid": "3af40c21-ec35-1998-3389-29e5b3f4c872",
          "code": "11228",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=11228",
          "code_system": "NSC",
          "references": [
            "a51106b5-5c79-6f59-a63f-b3f037026c41"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bfd5106a-732f-4fa1-9f94-7106c60e8086",
          "name": "1-(PHENYLAZO)-2-NAPHTHYLAMINE",
          "stdName": "1-(PHENYLAZO)-2-NAPHTHYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a140a5eb-6ee9-497a-987e-f52aa9dfa952",
            "401be4b0-b314-4763-b99a-950133bf8486",
            "a8698d8c-e34a-488a-b31c-600e6f31d555"
          ],
          "display_name": true
        },
        {
          "uuid": "f23bc658-8740-4de6-9b26-f89f475f5a65",
          "name": "1-(PHENYLAZO)-2-NAPHTHYLAMINE [II]",
          "stdName": "1-(PHENYLAZO)-2-NAPHTHYLAMINE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a140a5eb-6ee9-497a-987e-f52aa9dfa952",
            "401be4b0-b314-4763-b99a-950133bf8486"
          ],
          "display_name": false
        },
        {
          "uuid": "99511ed8-d1ce-4359-a218-6813d05ba75a",
          "name": "1-PHENYLAZO-2-NAPHTHYLAMINE",
          "stdName": "1-PHENYLAZO-2-NAPHTHYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d002c07-cda0-4c39-a76b-d80420226d83"
          ],
          "display_name": false
        },
        {
          "uuid": "8edfec9b-f535-497a-9af5-5a21d97a995d",
          "name": "C.I. FOOD YELLOW 10",
          "stdName": "C.I. FOOD YELLOW 10",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cf31253-f757-4b9e-93f3-8927c7e36737",
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f",
            "01ce9cdd-dfdd-4565-ba8b-59e6c5a46d6b",
            "401be4b0-b314-4763-b99a-950133bf8486",
            "69ddcf0b-ba59-4fe3-a1e1-37d014e3bef4"
          ],
          "display_name": false
        },
        {
          "uuid": "8c35141c-cecf-4270-b364-687756b6f9e7",
          "name": "C.I. FOOD YELLOW 10 [HSDB]",
          "stdName": "C.I. FOOD YELLOW 10 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cf31253-f757-4b9e-93f3-8927c7e36737",
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f"
          ],
          "display_name": false
        },
        {
          "uuid": "0e7e8568-24ff-407e-bb6b-1727fa015a6d",
          "name": "FD&C YELLOW NO. 3 (DELISTED)",
          "stdName": "FD&C YELLOW NO. 3 (DELISTED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f",
            "4b8bd1a0-f3b9-4ca6-b290-524989b5ec75"
          ],
          "display_name": false
        },
        {
          "uuid": "7d329ac8-2649-4e57-83d3-8e978feafc7e",
          "name": "KI404",
          "stdName": "KI404",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f",
            "506db0c8-538c-4c41-9af3-8654828a4058",
            "613d207c-d226-496c-adac-41bddad742b7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b3ac4135-02c7-448d-97a4-dd892d78132a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "62ee996e-4d41-470c-85f1-066e66121db8",
          "name": "NSC-11228",
          "stdName": "NSC-11228",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8990784f-a075-444e-bbfa-b38687fd49bd",
            "401be4b0-b314-4763-b99a-950133bf8486"
          ],
          "display_name": false
        },
        {
          "uuid": "e771c9a5-8244-47b6-9fee-4f4fc162b809",
          "name": "YELLOW AB",
          "stdName": "YELLOW AB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3239b5a-38cb-45ac-a127-f6666cec2950",
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f",
            "a140a5eb-6ee9-497a-987e-f52aa9dfa952",
            "a41baf8e-104e-459c-9c5d-3ee4761d48b6"
          ],
          "display_name": false
        },
        {
          "uuid": "e4d45ca5-35d9-fe0a-01b9-5f09b0493252",
          "name": "YELLOW AB [IARC]",
          "stdName": "YELLOW AB [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd354be4-3bcd-21d3-fabe-f91f131bb8dd"
          ],
          "display_name": false
        },
        {
          "uuid": "12d34854-a95c-482d-b247-7721a2bea690",
          "name": "YELLOW AB [MI]",
          "stdName": "YELLOW AB [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3239b5a-38cb-45ac-a127-f6666cec2950",
            "815bc2c6-5dc7-45ec-81cc-e32788c21a4f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "401be4b0-b314-4763-b99a-950133bf8486",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a140a5eb-6ee9-497a-987e-f52aa9dfa952",
          "citation": "JOURNAL ARTICLE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8990784f-a075-444e-bbfa-b38687fd49bd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69ddcf0b-ba59-4fe3-a1e1-37d014e3bef4",
          "citation": "ChemIDPlus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "815bc2c6-5dc7-45ec-81cc-e32788c21a4f",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b8bd1a0-f3b9-4ca6-b290-524989b5ec75",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3239b5a-38cb-45ac-a127-f6666cec2950",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cf31253-f757-4b9e-93f3-8927c7e36737",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "613d207c-d226-496c-adac-41bddad742b7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7a4205c-6eea-4d85-905b-1b8180a8c90e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f392a52b-0890-4574-9ed9-a3d690bbafa0",
          "citation": "SRS import [3VSI4D701X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3VSI4D701X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a41baf8e-104e-459c-9c5d-3ee4761d48b6",
          "citation": "YELLOW AB [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a8698d8c-e34a-488a-b31c-600e6f31d555",
          "citation": "1-(PHENYLAZO)-2-NAPHTHYLAMINE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01ce9cdd-dfdd-4565-ba8b-59e6c5a46d6b",
          "citation": "C.I. FOOD YELLOW 10 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "506db0c8-538c-4c41-9af3-8654828a4058",
          "citation": "KI404 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c44f4f9c-665f-6c48-45aa-7bc7b339d025",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+85-84-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e2a09374-0a85-e458-9b01-fa042101270e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85-84-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd354be4-3bcd-21d3-fabe-f91f131bb8dd",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "6d002c07-cda0-4c39-a76b-d80420226d83",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a51106b5-5c79-6f59-a63f-b3f037026c41",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "aa4b795f-b047-7a64-1a68-c305061580af",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "b813dc94-2d3c-4eb3-8fe6-a1578995393e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4b457548-65ec-4e50-98b4-0de076adbb39",
          "id": "4b457548-65ec-4e50-98b4-0de076adbb39",
          "molfile": "\n  Marvin  01132103562D          \n\n 19 21  0  0  0  0            999 V2000\n    0.7760    0.5396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4917    0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4917   -0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037   -1.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9123   -0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6210   -1.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3379   -0.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3414    0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6280    0.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9158    0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037    0.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037    1.3708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4892    1.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4892    2.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2105    3.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2108    3.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4958    4.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7790    3.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7821    3.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 11  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)/N=N/c2c3ccccc3ccc2N",
          "formula": "C16H13N3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c94ff838-614f-4a39-aa98-ff7f1b12da9d"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "247.2951",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6814edb1-0c06-41ce-9323-545f2de41ee3",
      "version": "12",
      "structure": {
        "id": "fefd26c1-0b9f-4c14-a468-26feac87f788",
        "molfile": "\n  Marvin  01132113122D          \n\n 19 21  0  0  0  0            999 V2000\n    1.4917    0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4917   -0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037   -1.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037    0.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9158    0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9123   -0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6210   -1.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3379   -0.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3414    0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6280    0.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7760    0.5396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2037    1.3708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4892    1.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4892    2.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2105    3.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2108    3.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4958    4.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7790    3.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7821    3.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5  6  2  0  0  0  0\n  1 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n 12 13  2  0  0  0  0\n  1  4  2  0  0  0  0\n 13 14  1  0  0  0  0\n  2  3  2  0  0  0  0\n 14 15  2  0  0  0  0\n  3  6  1  0  0  0  0\n 15 16  1  0  0  0  0\n  5  4  1  0  0  0  0\n 16 17  2  0  0  0  0\n  5 10  1  0  0  0  0\n 17 18  1  0  0  0  0\n  6  7  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 14  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)/N=N/c2c3ccccc3ccc2N",
        "formula": "C16H13N3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "247.2951",
        "optical_activity": "NONE",
        "references": [
          "f392a52b-0890-4574-9ed9-a3d690bbafa0",
          "69ddcf0b-ba59-4fe3-a1e1-37d014e3bef4"
        ],
        "stereo_centers": 0
      },
      "unii": "3VSI4D701X"
    }
  ]
}