{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bdd82587-0f8e-4005-8e85-99ad3989142d",
          "code": "C015445",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67015445",
          "code_system": "MESH",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "a1b531ba-7d48-4dfd-b5da-07de6f0718a4",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "41f790b6-b3c7-4836-92b3-7f99c3fa4b00",
          "code": "21 CFR 178.3297",
          "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297",
          "code_system": "CFR",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "a00939e5-c4e4-44bd-b64b-ced405d5ae05",
          "code": "1424646",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1424646/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "ac54ea18-f67b-4878-8f8c-4502f9cfdd33",
          "code": "m3775",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3775?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "f92cbec6-d45d-4d85-b94b-7db1f59d6b04",
          "code": "SUB180902",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "aa178c0d-1eac-4658-9d07-be83aae7466b",
          "code": "PHTHALOCYANINE BLUE NCF",
          "type": "PRIMARY",
          "url": "http://chemicalland21.com/specialtychem/finechem/PHTHALOCYANINE%20BLUE%20NCF.htm",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "bd9b45e4-7e3f-4fe4-931f-acf4eff5be7d",
          "code": "205-685-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.169",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "7d261b58-e1c9-4464-a744-05680fbfc359",
          "code": "6531516",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6531516",
          "code_system": "PUBCHEM",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098"
          ]
        },
        {
          "uuid": "5bbedfd1-ec4e-40d8-8386-55a69440a49b",
          "code": "147-14-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=147-14-8",
          "code_system": "CAS",
          "references": [
            "7f823dca-8001-4930-b969-9357bebc8098",
            "8232285a-645f-4909-a241-917aee6fbe2c"
          ]
        },
        {
          "uuid": "db055049-89d0-5bc8-db74-4721019302bd",
          "code": "2925",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2925",
          "code_system": "HSDB",
          "references": [
            "64644133-05e0-401b-578c-c6997e440b38"
          ]
        },
        {
          "uuid": "de47f6b8-6b68-48ef-9cdc-8ccc0c225779",
          "code": "3VEX9T7UT5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3fa832c8-bea7-0cb5-05d8-28f962fa3f3f",
          "code": "Phthalocyanine Blue BN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phthalocyanine_Blue_BN",
          "code_system": "WIKIPEDIA",
          "references": [
            "3e9b8424-1648-96ad-dec6-3c50015f46b2"
          ]
        },
        {
          "uuid": "32da2fe6-48b6-00f4-b1f0-c7239088195f",
          "code": "3VEX9T7UT5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3VEX9T7UT5",
          "code_system": "DAILYMED",
          "references": [
            "2544968d-569a-04a2-8805-8248b7b95892"
          ]
        },
        {
          "uuid": "92046653-2255-59da-2ba7-c4494f231469",
          "code": "100000086017",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5826af69-a482-4406-80d2-1c239f082241"
          ]
        },
        {
          "uuid": "c803de98-a2b6-7478-8f81-94d27e74798c",
          "code": "15976",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=15976",
          "code_system": "NSC",
          "references": [
            "b6e05897-d364-3442-49d9-1b6f2bb7bea6"
          ]
        },
        {
          "uuid": "892fc914-989b-095b-9ca6-f2ca4c6c7b99",
          "code": "155903",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:155903",
          "code_system": "CHEBI",
          "references": [
            "aa3e4193-a4be-858c-b993-ac757ff57425"
          ]
        },
        {
          "uuid": "50d384a9-742d-64fc-2372-7e48618beb8b",
          "code": "DTXSID8027117",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8027117",
          "code_system": "EPA CompTox",
          "references": [
            "87be59fd-95c0-bc7f-e7ea-939712b8908c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f326c56f-8912-4fcb-bc4a-3404bbd65e27",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "05cde168-d6ea-4720-b99a-6c81efc7845e",
            "refuuid": "fb2b9b51-d768-4c6f-99e7-99071d83a4fb",
            "name": "CUPRIC CATION",
            "unii": "8CBV67279L",
            "linking_id": "8CBV67279L",
            "ref_pname": "CUPRIC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d1bafbe-4849-4324-b562-4272a8205b6e",
          "name": "(PHTHALOCYANINATO(2-)) COPPER",
          "stdName": "(PHTHALOCYANINATO(2-)) COPPER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f3833dc1-380d-4085-be5f-a5d77a839d7e",
            "16879d4f-6b90-4033-9310-c64fdfe22882"
          ],
          "display_name": false
        },
        {
          "uuid": "a7fd1453-06f6-4fbe-9a46-d80871c2f84b",
          "name": "AO404",
          "stdName": "AO404",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "03c8094b-0b8a-41f8-8e81-f7d085773879",
            "70fe7ba1-72e1-4a82-880e-2b2b21a1c3c8"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "eb311673-2b7c-46a8-a475-757818c0432c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6c020b24-ab09-42c5-b13b-78e261fd89c6",
          "name": "BLUE NO 404",
          "stdName": "BLUE NO 404",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abf5abe3-fae1-4c7b-acb1-653a7594c4ed",
            "01b33de3-79bd-45ba-8120-ba3868e98472"
          ],
          "display_name": false
        },
        {
          "uuid": "c2c02bf0-dc0f-4330-b80f-631269f82645",
          "name": "BLUE NO. 404",
          "stdName": "BLUE NO. 404",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cfe40d1-618b-4334-a4ec-0f09aee89294"
          ],
          "display_name": false
        },
        {
          "uuid": "4cbbfe09-ad96-4e23-88be-5cbee5c65269",
          "name": "C.I. 74160",
          "stdName": "C.I. 74160",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01b33de3-79bd-45ba-8120-ba3868e98472"
          ],
          "display_name": false
        },
        {
          "uuid": "d407bee5-19bc-463d-bbf4-f705427d1066",
          "name": "C.I. NO.74160 (PIGMENT BLUE 15)",
          "stdName": "C.I. NO.74160 (PIGMENT BLUE 15)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bee0461d-e682-4ebe-ba2e-9507bf08ccf8"
          ],
          "display_name": false
        },
        {
          "uuid": "178cd924-186f-4166-8875-676bf955c862",
          "name": "C.I. PIGMENT BLUE 15:3",
          "stdName": "C.I. PIGMENT BLUE 15:3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff784c54-c4c2-494e-83e0-85bf23c42e8b"
          ],
          "display_name": false
        },
        {
          "uuid": "f34ed297-fd64-4d66-aeb2-95907ac02427",
          "name": "C.I. PIGMENT BLUE 15:4",
          "stdName": "C.I. PIGMENT BLUE 15:4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff784c54-c4c2-494e-83e0-85bf23c42e8b"
          ],
          "display_name": false
        },
        {
          "uuid": "d0ed05b2-f87f-474c-93c6-a73f43c6ca79",
          "name": "CHROMOFINE PHTHALOCYANINE BLUE",
          "stdName": "CHROMOFINE PHTHALOCYANINE BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        },
        {
          "uuid": "6b81c1b0-8a72-4499-bda1-38d4874c18da",
          "name": "CI 74160",
          "stdName": "CI 74160",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "abf5abe3-fae1-4c7b-acb1-653a7594c4ed",
            "01b33de3-79bd-45ba-8120-ba3868e98472",
            "26b97019-0623-4813-b5e5-0daf594819b0"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a67c9a15-5505-4b3f-b052-90d8caf42721",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "149dc912-11df-442b-9ac2-d54682aa4469",
          "name": "COPPER PHTHALOCYANINE",
          "stdName": "COPPER PHTHALOCYANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2eaf31d-6435-42f0-86bf-a7b0c2ad050a",
            "abf5abe3-fae1-4c7b-acb1-653a7594c4ed",
            "6bb49739-08a5-4e72-aa7b-45556f46d711",
            "eb34f4d7-cf34-4b28-ac67-944efd55aa77"
          ],
          "display_name": false
        },
        {
          "uuid": "19c8fcdf-3691-45d6-b9b3-dcce041b0507",
          "name": "COPPER PHTHALOCYANINE BLUE",
          "stdName": "COPPER PHTHALOCYANINE BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3ae1f83-fab4-40a3-aafe-86236a1866c1"
          ],
          "display_name": false
        },
        {
          "uuid": "0892eeba-152c-4e94-b857-d1eb053deed6",
          "name": "COPPER PHTHALOCYANINE [MI]",
          "stdName": "COPPER PHTHALOCYANINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb34f4d7-cf34-4b28-ac67-944efd55aa77"
          ],
          "display_name": false
        },
        {
          "uuid": "4dff98c3-3834-428d-a54e-c339257dd341",
          "name": "COPPER TETRABENZOPORPHYRAZINE",
          "stdName": "COPPER TETRABENZOPORPHYRAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3ae1f83-fab4-40a3-aafe-86236a1866c1"
          ],
          "display_name": false
        },
        {
          "uuid": "5d12d7b7-f17b-4a13-84b8-051853cf33a4",
          "name": "NPHK-5097",
          "stdName": "NPHK-5097",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        },
        {
          "uuid": "56e9655e-21c6-4b10-9455-16e83bc2d174",
          "name": "NSC-15976",
          "stdName": "NSC-15976",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        },
        {
          "uuid": "974fbd9e-dcb3-4837-876b-d849859e0f99",
          "name": "PHTHALOCYANINE BLUE",
          "stdName": "PHTHALOCYANINE BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf398e3-8b4b-436f-90a7-8d408bcc3500"
          ],
          "display_name": true
        },
        {
          "uuid": "534f40b6-0d02-4416-a1f1-174a30dbe029",
          "name": "PHTHALOCYANINE BLUE BN",
          "stdName": "PHTHALOCYANINE BLUE BN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3ae1f83-fab4-40a3-aafe-86236a1866c1"
          ],
          "display_name": false
        },
        {
          "uuid": "6f60fe62-cfbb-4fe2-9ad5-c4608e544288",
          "name": "PHTHALOCYANINE BLUE NCF",
          "stdName": "PHTHALOCYANINE BLUE NCF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91ba22d3-bead-414d-822b-e72b01b55a4a"
          ],
          "display_name": false
        },
        {
          "uuid": "e0749ff4-20f1-4846-b684-3a63211aacbc",
          "name": "PIGMENT BLUE 15",
          "stdName": "PIGMENT BLUE 15",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "2ce81ccb-b245-4956-9f94-953254ee424d",
            "3d27e64e-2c16-47d4-b94f-b93817376d50",
            "01b33de3-79bd-45ba-8120-ba3868e98472",
            "07ebdb48-b19a-497f-8ba3-55a0b47acec4"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1e80c455-56c6-4232-a75e-affe37011af0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f15d2f61-a290-4492-b13b-0140159566bf",
          "name": "PIGMENT BLUE 15 [HSDB]",
          "stdName": "PIGMENT BLUE 15 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07ebdb48-b19a-497f-8ba3-55a0b47acec4"
          ],
          "display_name": false
        },
        {
          "uuid": "8413ae32-2fbd-4995-bd98-d94faa126afe",
          "name": "PIGMENT BLUE 15:1",
          "stdName": "PIGMENT BLUE 15:1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ebc11983-7fc9-42a2-8a6b-91d9c6aa301c",
            "01b33de3-79bd-45ba-8120-ba3868e98472",
            "70fe7ba1-72e1-4a82-880e-2b2b21a1c3c8"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "51d7f3bb-7f7b-4eac-8415-8be4aa0d3c4f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7c53a2a5-37a6-481a-8dbe-547e3f3e65d3",
          "name": "SUNFAST BLUE 249-1284",
          "stdName": "SUNFAST BLUE 249-1284",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        },
        {
          "uuid": "7dafac95-bd05-4dc3-8466-caf0e6203688",
          "name": "SUPRAPAL GREEN 3X4A041",
          "stdName": "SUPRAPAL GREEN 3X4A041",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        },
        {
          "uuid": "a60a358d-4865-43b3-babe-5fa2db835c48",
          "name": "W-51924",
          "stdName": "W-51924",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab3fe9b-99d9-43bb-b507-1f143278c503"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e3ae1f83-fab4-40a3-aafe-86236a1866c1",
          "citation": "WIKEPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "16879d4f-6b90-4033-9310-c64fdfe22882",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3833dc1-380d-4085-be5f-a5d77a839d7e",
          "citation": "21CFR74.3045",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec73926-031e-4c75-a61c-018b5f2a22e6",
          "citation": "STN(CTFA 10)",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01b33de3-79bd-45ba-8120-ba3868e98472",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abf5abe3-fae1-4c7b-acb1-653a7594c4ed",
          "citation": "CTFA 10",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bb49739-08a5-4e72-aa7b-45556f46d711",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cfe40d1-618b-4334-a4ec-0f09aee89294",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb34f4d7-cf34-4b28-ac67-944efd55aa77",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70fe7ba1-72e1-4a82-880e-2b2b21a1c3c8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07ebdb48-b19a-497f-8ba3-55a0b47acec4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acf398e3-8b4b-436f-90a7-8d408bcc3500",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fab3fe9b-99d9-43bb-b507-1f143278c503",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bee0461d-e682-4ebe-ba2e-9507bf08ccf8",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff784c54-c4c2-494e-83e0-85bf23c42e8b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91ba22d3-bead-414d-822b-e72b01b55a4a",
          "citation": "http://chemicalland21.com/specialtychem/finechem/PHTHALOCYANINE%20BLUE%20NCF.htm",
          "url": "http://chemicalland21.com/specialtychem/finechem/PHTHALOCYANINE%20BLUE%20NCF.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f823dca-8001-4930-b969-9357bebc8098",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abc8dfe2-f40f-4627-9aa5-a71ce9d46773",
          "citation": "SRS import [3VEX9T7UT5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3VEX9T7UT5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2eaf31d-6435-42f0-86bf-a7b0c2ad050a",
          "citation": "COPPER PHTHALOCYANINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d27e64e-2c16-47d4-b94f-b93817376d50",
          "citation": "PIGMENT BLUE 15 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26b97019-0623-4813-b5e5-0daf594819b0",
          "citation": "CI 74160 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ce81ccb-b245-4956-9f94-953254ee424d",
          "citation": "PIGMENT BLUE 15 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03c8094b-0b8a-41f8-8e81-f7d085773879",
          "citation": "AO404 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebc11983-7fc9-42a2-8a6b-91d9c6aa301c",
          "citation": "PIGMENT BLUE 15:1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64644133-05e0-401b-578c-c6997e440b38",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+147-14-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8b8848a4-2cfb-4c41-a924-58e392042e9d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=147-14-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5826af69-a482-4406-80d2-1c239f082241",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3e9b8424-1648-96ad-dec6-3c50015f46b2",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "aa3e4193-a4be-858c-b993-ac757ff57425",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8232285a-645f-4909-a241-917aee6fbe2c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b6e05897-d364-3442-49d9-1b6f2bb7bea6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2544968d-569a-04a2-8805-8248b7b95892",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "87be59fd-95c0-bc7f-e7ea-939712b8908c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3761cf22-40a5-47c6-b497-0649608a3f25",
          "id": "3761cf22-40a5-47c6-b497-0649608a3f25",
          "molfile": "\n  Marvin  01132102572D          \n\n  1  0  0  0  0  0            999 V2000\n   11.5058   -8.7404    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Cu+2]",
          "formula": "Cu",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "625d9334-f29e-4eb7-b8df-e0277bbdc3ef"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.5456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a2f5ede2-b909-41b9-bc4d-8849596e08a5",
          "id": "a2f5ede2-b909-41b9-bc4d-8849596e08a5",
          "molfile": "\n  Marvin  01132108282D          \n\n 40 48  0  0  0  0            999 V2000\n    9.4433   -5.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8546   -6.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -7.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8538   -7.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2295   -8.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0456   -7.9630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1735   -7.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8839   -6.7294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5948   -7.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7272   -7.9584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5432   -8.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9485   -8.7939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5347   -9.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7176   -9.6342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5848  -10.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8791  -10.8680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1688  -10.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0361   -9.6390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2189   -9.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8099   -8.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8443  -10.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0500  -10.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8442  -11.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4382  -11.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2335  -11.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4347  -10.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3195  -10.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5297  -11.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3241  -11.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9083  -11.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6932  -10.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9046  -10.2445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9142   -7.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7104   -7.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9225   -6.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3281   -5.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5355   -5.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3280   -6.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4435   -6.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2377   -5.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 40  1  2  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 39  2  0  0  0  0\n  5  6  2  0  0  0  0\n  5 20  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 39  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 38  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 33 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 32 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 27  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 26  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 26 21  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 32 27  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 38 33  2  0  0  0  0\n 34 35  2  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  2  0  0  0  0\n 37 38  1  0  0  0  0\n 39 40  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c3[nH]c2nc4-c5ccccc5-c(n4)nc6-c7ccccc7-c(n6)nc8-c9ccccc9-c(n8)[nH]3",
          "formula": "C32H18N8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d622e3c-d684-472f-9900-0d6b79280355"
          },
          "defined_stereo": 0,
          "ez_centers": 3,
          "molecular_weight": "514.5401",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcc33011-4a2c-4237-84bf-5406208e7694",
      "version": "15",
      "structure": {
        "id": "1019ac22-5b0c-48e7-be1f-7b379d126ad7",
        "molfile": "\n  Marvin  01132101042D          \n\n 41 48  0  0  0  0            999 V2000\n   11.5058   -8.7404    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\n   11.1688  -10.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8791  -10.8680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5848  -10.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7176   -9.6342    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n   13.5347   -9.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9485   -8.7939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5432   -8.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9142   -7.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3280   -6.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5948   -7.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7272   -7.9584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8839   -6.7294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1735   -7.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4435   -6.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8538   -7.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -7.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8546   -6.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4433   -5.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2377   -5.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2295   -8.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8099   -8.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2189   -9.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8443  -10.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4347  -10.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2335  -11.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4382  -11.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8442  -11.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0500  -10.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0361   -9.6390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0456   -7.9630    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n   13.5355   -5.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3281   -5.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9225   -6.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7104   -7.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9046  -10.2445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3195  -10.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5297  -11.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3241  -11.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9083  -11.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6932  -10.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n  8 12  2  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 16 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n  2 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 24 29  1  0  0  0  0\n 23 30  1  0  0  0  0\n 30  2  2  0  0  0  0\n 21 31  1  0  0  0  0\n 31 14  1  0  0  0  0\n 32 10  1  0  0  0  0\n 33 32  2  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  2  0  0  0  0\n  9 35  1  0  0  0  0\n 36  6  1  0  0  0  0\n 36 37  2  0  0  0  0\n  4 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  2  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  2  0  0  0  0\n 41 36  1  0  0  0  0\nM  CHG  3   1   2   5  -1  31  -1\nM  END",
        "smiles": "c1ccc2c(c1)c3[n-]c2nc4-c5ccccc5-c(n4)nc6c7ccccc7c([n-]6)nc8-c9ccccc9-c(n8)n3.[Cu+2]",
        "formula": "C32H16N8.Cu",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 4,
        "molecular_weight": "576.0699",
        "optical_activity": "NONE",
        "references": [
          "abc8dfe2-f40f-4627-9aa5-a71ce9d46773",
          "6bb49739-08a5-4e72-aa7b-45556f46d711"
        ],
        "stereo_centers": 0
      },
      "unii": "3VEX9T7UT5"
    }
  ]
}