{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5869586a-b34a-436f-a6bf-d643360fb715",
          "code": "14937-32-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14937-32-7",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "35f940a3-acbd-43ee-a842-117b3216d83d"
          ]
        },
        {
          "uuid": "e2d8fce0-78f1-4d57-af48-bec1b3587b72",
          "code": "94008-28-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94008-28-3",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "5e2d7a67-4e71-46c1-bc0c-f8dc60e2b3cb"
          ]
        },
        {
          "uuid": "c106c616-c216-4b93-bf05-2f1eb836dac4",
          "code": "98731-29-4",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98731-29-4",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "5389edec-9d8a-458f-b56f-fc4485cd94ed"
          ]
        },
        {
          "uuid": "4a4bca9d-c690-4a26-81d4-277efde35911",
          "code": "99935-72-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99935-72-5",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "e6660da0-6dc0-4881-8cf0-6f1fd3ec6a6b"
          ]
        },
        {
          "uuid": "147df404-68e9-4a64-8de2-186d2fbaa40a",
          "code": "102694-50-8",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102694-50-8",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "e5d0d921-a69b-4f3a-b18c-7f7561c77d83"
          ]
        },
        {
          "uuid": "13533b4b-8822-4430-a5c8-42da042a5128",
          "code": "131647-34-2",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131647-34-2",
          "code_system": "CAS",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc",
            "47e066b7-17cb-468f-9928-23001755b516"
          ]
        },
        {
          "uuid": "f2e29fdf-d80c-408c-91d4-361914eead35",
          "code": "65238",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65238",
          "code_system": "PUBCHEM",
          "references": [
            "6dc64232-289d-46de-a500-93e8a236d9fc"
          ]
        },
        {
          "uuid": "05a25af3-2e5a-4a12-9a22-2955dd4b1f9b",
          "code": "3UI3K8W93I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "13591215-0dcd-f480-25b3-7bf5cfb48ca9",
          "code": "18082",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18082",
          "code_system": "CHEBI",
          "references": [
            "5f0949af-3a5c-66a9-fc02-82632fe7f91f"
          ]
        },
        {
          "uuid": "8129a8cf-835d-d8ac-b897-ce2d69e017c8",
          "code": "1,2,3,4,6-Pentagalloyl glucose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/1,2,3,4,6-Pentagalloyl_glucose",
          "code_system": "WIKIPEDIA",
          "references": [
            "dea4b16d-ed2e-77b5-6ded-43758e39014d"
          ]
        },
        {
          "uuid": "23901212-b420-148e-10f6-96e19255df97",
          "code": "DTXSID901029765",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901029765",
          "code_system": "EPA CompTox",
          "references": [
            "5f0949af-3a5c-66a9-fc02-82632fe7f91f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4ec8cc47-2957-4f6b-b90d-2b1794fa0aa9",
          "comments": "PGG decreased the level of extracellular HBV (IC50, 1.0m g/ml) in a dose-dependent manner. PGG also reduced the HBsAg level by 25% at a concentration of 4m g/ml.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "99790722-5535-4a7e-902c-5cfc27764a32"
          ],
          "related_substance": {
            "uuid": "18b86e2d-abd6-4e0f-852b-f36b08466de9",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "63318314-7da8-43e4-bb57-3154568a7837",
          "comments": "MIC 160 mg/L of ATCC 700392 and ATCC 700824 strains of H. pylori",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "73ec7df2-a2bb-4eab-9eec-59fbd67534dd"
          ],
          "related_substance": {
            "uuid": "e6023828-45b7-4259-bdd7-e6dd25bd0eb5",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a7065bf-2df4-498d-a770-102c6dfffa1d",
          "comments": "The inhibition of protein tyrosine phosphatase 1B (PTP1B) is of substantial interest for the treatment of type-2 diabetes mellitus. Using an in vitro enzyme assay with human recombinant PTP1B 1,2,3,4,6-penta-O-galloyl-D-glucopyranose(1) was isolated from the roots of Paeonia lactiflora as an inhibitor of PTP1B, with an IC50 value of 4.8 uM.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "8d10cd89-9625-4b84-9a87-a2635af32b20"
          ],
          "related_substance": {
            "uuid": "8f9d0429-77a9-4ffb-8235-32e42a1c9457",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "23bd59ba-63bc-48db-9d24-1ab6cb2ebc5f",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "a36a20a8-bd80-4385-a1e2-814446be705c"
          ],
          "related_substance": {
            "uuid": "8503d7f9-0759-47ba-8a5a-e8cd3a745506",
            "refuuid": "2658cbca-abfb-460f-9f40-15dad3f2b7dd",
            "name": "LAGERSTROEMIA SPECIOSA LEAF",
            "unii": "OUK5B3W9E4",
            "linking_id": "OUK5B3W9E4",
            "ref_pname": "LAGERSTROEMIA SPECIOSA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "96a004a8-f778-4b7d-9578-9692d1809bca",
          "name": ".BETA.-1,2,3,4,6-PENTAGALLOYLGLUCOSE",
          "stdName": ".BETA.-1,2,3,4,6-PENTAGALLOYLGLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6491d0c-5851-4bf7-9de5-a13ad73443a0",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "fafdaa96-7cbc-483c-b7e3-85328d7765a6",
          "name": ".BETA.-D-GLUCOPYRANOSE, 1,2,3,4,6-PENTAKIS(3,4,5-TRIHYDROXYBENZOATE)",
          "stdName": ".BETA.-D-GLUCOPYRANOSE, 1,2,3,4,6-PENTAKIS(3,4,5-TRIHYDROXYBENZOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6491d0c-5851-4bf7-9de5-a13ad73443a0",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "cf422779-99a1-4962-b880-1ec6680f13c2",
          "name": "1,2,3,4,6-PENTA-O-GALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "stdName": "1,2,3,4,6-PENTA-O-GALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a6223dd-5b01-4ee4-8539-07b3660bd6f6",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "37e77312-360c-4980-83f1-3ada0e13a36c",
          "name": "1,2,3,4,6-PENTA-O-GALLOYL-.BETA.-GLUCOSE",
          "stdName": "1,2,3,4,6-PENTA-O-GALLOYL-.BETA.-GLUCOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57814101-e598-4516-9efe-e609633adaf3",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "65f89fc6-64f3-4d60-a460-f052bfbac39b",
          "name": "1,2,3,4,6-PENTA-O-GALLOYL-D-GLUCOPYRANOSE",
          "stdName": "1,2,3,4,6-PENTA-O-GALLOYL-D-GLUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1714be3-8238-4b4d-b77f-2f37a982e47d",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "7196661b-4376-42dc-b44e-72366c51a893",
          "name": "1,2,3,4,6-PENTAGALLOYL GLUCOSE",
          "stdName": "1,2,3,4,6-PENTAGALLOYL GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dfdc481-147d-4fcb-b35e-9c65e810ee20",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "89972961-b199-4c51-87f8-301170185dd1",
          "name": "1,2,3,4,6-PENTAGALLOYL GLUCOSE (CONSTITUENT OF BANABA LEAF) [DSC]",
          "stdName": "1,2,3,4,6-PENTAGALLOYL GLUCOSE (CONSTITUENT OF BANABA LEAF) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3834c2c8-1805-46d2-8cb8-a1616f04103a",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "245892fd-c2f2-42f8-b40a-44bc7bcbab83",
          "name": "1,2,3,4,6-PENTAGALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "stdName": "1,2,3,4,6-PENTAGALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a6223dd-5b01-4ee4-8539-07b3660bd6f6",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "f63d3fc7-f8a1-4eb0-be4c-fca7b84063d4",
          "name": "1,2,3,4,6-PENTAGALLOYL-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "1,2,3,4,6-PENTAGALLOYL-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a6223dd-5b01-4ee4-8539-07b3660bd6f6",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "12441155-fc55-4b89-8aff-4691865c989d",
          "name": "1,2,3,4,6-PENTAKIS-O-(3,4,5-TRIHYDROXYBENZOYL)-.BETA.-D-GLUCOPYRANOSE",
          "stdName": "1,2,3,4,6-PENTAKIS-O-(3,4,5-TRIHYDROXYBENZOYL)-.BETA.-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dfdc481-147d-4fcb-b35e-9c65e810ee20",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "4551d84c-af3e-4108-a98c-226f9a20f819",
          "name": "5GG",
          "stdName": "5GG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dfdc481-147d-4fcb-b35e-9c65e810ee20",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "237d2190-9bbd-443a-b30d-20318ca10f17",
          "name": "BETA-PENTA-O-GALLOYL-GLUCOSE",
          "stdName": "BETA-PENTA-O-GALLOYL-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0177a2cd-9799-4c3c-b7da-7677b713f97e",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "50ee6066-47f2-408c-ba30-443856dba37b",
          "name": "C04576",
          "stdName": "C04576",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60e05437-56db-4024-9ec7-85a63b67ae90",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "b1cda23f-d9a1-4f87-9a4a-964745acf8f3",
          "name": "GALLOTANNIN 15",
          "stdName": "GALLOTANNIN 15",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6491d0c-5851-4bf7-9de5-a13ad73443a0",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "a1a33337-687d-4cf8-9780-8265af192f78",
          "name": "J277.746K",
          "stdName": "J277.746K",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf464ea3-15dc-47ce-b474-a746263a90d9",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "aa72705f-80a0-46a3-8fda-7f428607949f",
          "name": "PENTA-O-GALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "stdName": "PENTA-O-GALLOYL-.BETA.-D-GLUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6491d0c-5851-4bf7-9de5-a13ad73443a0",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "da43b8a1-fd53-4bb7-81fd-eebb8d02c8df",
          "name": "PENTAGALLOYL GLUCOSE",
          "stdName": "PENTAGALLOYL GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dfdc481-147d-4fcb-b35e-9c65e810ee20",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "ba3299ae-7cea-432a-af2a-40d423e2a4ec",
          "name": "PENTAGALLOYL-BETA-D-GLUCOSE",
          "stdName": "PENTAGALLOYL-BETA-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf464ea3-15dc-47ce-b474-a746263a90d9",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        },
        {
          "uuid": "c94a2caf-3d4c-4492-b017-4efe2965578f",
          "name": "PENTAGALLOYLGLUCOSE",
          "stdName": "PENTAGALLOYLGLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf464ea3-15dc-47ce-b474-a746263a90d9",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": true
        },
        {
          "uuid": "b8b869f2-76b0-46ca-9673-21a679e39166",
          "name": "PGG",
          "stdName": "PGG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ca08b84-70d0-4861-95fd-378d4c26920a",
            "7470180f-f340-459b-9dfc-51bf949c0f81"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b6491d0c-5851-4bf7-9de5-a13ad73443a0",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7470180f-f340-459b-9dfc-51bf949c0f81",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1714be3-8238-4b4d-b77f-2f37a982e47d",
          "citation": "http://pubs.acs.org/doi/pdf/10.1021/np100258e",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/np100258e",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ca08b84-70d0-4861-95fd-378d4c26920a",
          "citation": "http://pubs.acs.org/doi/pdf/10.1021/jf3035034",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jf3035034",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a6223dd-5b01-4ee4-8539-07b3660bd6f6",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5dfdc481-147d-4fcb-b35e-9c65e810ee20",
          "citation": "http://www.chemspider.com/Chemical-Structure.58735.html?rid=cc886768-189b-4bc7-a399-c07c8d0cb892",
          "url": "http://www.chemspider.com/Chemical-Structure.58735.html?rid=cc886768-189b-4bc7-a399-c07c8d0cb892",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e05437-56db-4024-9ec7-85a63b67ae90",
          "citation": "http://www.genome.jp/dbget-bin/www_bget?cpd:C04576",
          "url": "http://www.genome.jp/dbget-bin/www_bget?cpd:C04576",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf464ea3-15dc-47ce-b474-a746263a90d9",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J277.746K",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J277.746K",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57814101-e598-4516-9efe-e609633adaf3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0177a2cd-9799-4c3c-b7da-7677b713f97e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3834c2c8-1805-46d2-8cb8-a1616f04103a",
          "citation": "DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dc64232-289d-46de-a500-93e8a236d9fc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392238000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99790722-5535-4a7e-902c-5cfc27764a32",
          "citation": "LEE, S-J ET AL, BIOLOGICAL & PHARMACEUTICAL BULLETIN, 29(10)2131-2134,2006",
          "url": "https://www.jstage.jst.go.jp/article/bpb/29/10/29_10_2131/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73ec7df2-a2bb-4eab-9eec-59fbd67534dd",
          "citation": "NGAN LTM, ET AL, J AGRIC FOOD CHEMISTRY 60, 9062−9073, 2012",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jf3035034",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d10cd89-9625-4b84-9a87-a2635af32b20",
          "citation": "BAUMGARTNER RR ET AL, J. NAT. PROD. , 73(9) 1578?1581, 2010",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/np100258e",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a36a20a8-bd80-4385-a1e2-814446be705c",
          "citation": "USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3accb375-4c3e-4420-a372-f84b9c545250",
          "citation": "SRS import [3UI3K8W93I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3UI3K8W93I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392238000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dea4b16d-ed2e-77b5-6ded-43758e39014d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "5f0949af-3a5c-66a9-fc02-82632fe7f91f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5e2d7a67-4e71-46c1-bc0c-f8dc60e2b3cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5389edec-9d8a-458f-b56f-fc4485cd94ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e6660da0-6dc0-4881-8cf0-6f1fd3ec6a6b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e5d0d921-a69b-4f3a-b18c-7f7561c77d83",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47e066b7-17cb-468f-9928-23001755b516",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "35f940a3-acbd-43ee-a842-117b3216d83d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "972c0e6a-1a8f-4c9c-8902-b9a021096f11",
          "id": "972c0e6a-1a8f-4c9c-8902-b9a021096f11",
          "molfile": "\n  Marvin  01132107512D          \n\n 67 72  0  0  1  0            999 V2000\n    5.0037   -4.9501    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.2858   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -4.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8608   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8608   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -4.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -6.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -4.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -5.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -6.1823    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.7108   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -8.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -8.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -9.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -9.8895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -9.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287  -10.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -9.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -9.8895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -8.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -5.7644    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1466   -6.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -4.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6823   -5.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -7.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6823   -7.4144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -8.2394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -7.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -4.9501    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1466   -4.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -3.3001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -2.0572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -1.2321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -4.5322    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7108   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -1.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -1.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 15  1  0  0  0  0\n 55  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 14  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 29 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 28 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 30  1  1  0  0  0\n 42 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  2  0  0  0  0\n 33 31  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 41  2  0  0  0  0\n 35 34  2  0  0  0  0\n 35 36  1  0  0  0  0\n 37 35  1  0  0  0  0\n 37 38  1  0  0  0  0\n 39 37  2  0  0  0  0\n 39 40  1  0  0  0  0\n 41 39  1  0  0  0  0\n 42 43  1  6  0  0  0\n 42 55  1  0  0  0  0\n 44 43  1  0  0  0  0\n 44 45  2  0  0  0  0\n 46 44  1  0  0  0  0\n 46 47  1  0  0  0  0\n 46 54  2  0  0  0  0\n 48 47  2  0  0  0  0\n 48 49  1  0  0  0  0\n 50 48  1  0  0  0  0\n 50 51  1  0  0  0  0\n 52 50  2  0  0  0  0\n 52 53  1  0  0  0  0\n 54 52  1  0  0  0  0\n 55 56  1  1  0  0  0\n 56 57  1  0  0  0  0\n 57 58  2  0  0  0  0\n 59 57  1  0  0  0  0\n 59 60  1  0  0  0  0\n 59 67  2  0  0  0  0\n 61 60  2  0  0  0  0\n 61 62  1  0  0  0  0\n 63 61  1  0  0  0  0\n 63 64  1  0  0  0  0\n 65 63  2  0  0  0  0\n 65 66  1  0  0  0  0\n 67 65  1  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1O)O)O)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)c3cc(c(c(c3)O)O)O)OC(=O)c4cc(c(c(c4)O)O)O)OC(=O)c5cc(c(c(c5)O)O)O)OC(=O)c6cc(c(c(c6)O)O)O",
          "formula": "C41H32O26",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7c9a1014-65c8-4ff5-86da-ef282fa0782c"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "940.6788",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8805d5b0-8e91-4255-aa32-83d8789976a2",
      "version": "6",
      "structure": {
        "id": "cf17f364-1bb8-4f29-9c40-093050dc1e93",
        "molfile": "\n  Marvin  01132110422D          \n\n 67 72  0  0  1  0            999 V2000\n    2.1429   -4.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -4.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8608   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8608   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -4.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -6.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -9.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -9.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -9.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -8.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -8.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -8.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -7.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -9.8895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287  -10.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -9.8895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -5.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -6.1823    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4287   -5.7644    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4287   -4.9501    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7108   -4.5322    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0037   -4.9501    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2858   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -4.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -3.3001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -2.0572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -1.2321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5394   -7.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -7.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9752   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -5.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -6.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8323   -4.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6823   -5.7644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6823   -7.4144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2573   -8.2394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -1.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -1.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7108   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2858   -3.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4287   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0037    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  6  2  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3 12  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4 11  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 32  1  0  0  0  0\n 13 18  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 23  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 24  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 27 20  1  6  0  0  0\n 30 25  1  1  0  0  0\n 25 63  1  0  0  0  0\n 26 31  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 52  1  1  0  0  0\n 29 30  1  0  0  0  0\n 29 40  1  6  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  6  0  0  0\n 33 38  2  0  0  0  0\n 33 34  1  0  0  0  0\n 33 39  1  0  0  0  0\n 34 35  2  0  0  0  0\n 35 36  1  0  0  0  0\n 35 44  1  0  0  0  0\n 36 37  2  0  0  0  0\n 36 43  1  0  0  0  0\n 37 38  1  0  0  0  0\n 37 42  1  0  0  0  0\n 39 40  1  0  0  0  0\n 39 41  2  0  0  0  0\n 45 50  2  0  0  0  0\n 45 46  1  0  0  0  0\n 45 51  1  0  0  0  0\n 46 47  2  0  0  0  0\n 47 48  1  0  0  0  0\n 47 56  1  0  0  0  0\n 48 49  2  0  0  0  0\n 48 55  1  0  0  0  0\n 49 50  1  0  0  0  0\n 49 54  1  0  0  0  0\n 51 52  1  0  0  0  0\n 51 53  2  0  0  0  0\n 57 62  2  0  0  0  0\n 57 58  1  0  0  0  0\n 57 63  1  0  0  0  0\n 58 59  2  0  0  0  0\n 59 60  1  0  0  0  0\n 59 67  1  0  0  0  0\n 60 61  2  0  0  0  0\n 60 66  1  0  0  0  0\n 61 62  1  0  0  0  0\n 61 65  1  0  0  0  0\n 63 64  2  0  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1O)O)O)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)c3cc(c(c(c3)O)O)O)OC(=O)c4cc(c(c(c4)O)O)O)OC(=O)c5cc(c(c(c5)O)O)O)OC(=O)c6cc(c(c(c6)O)O)O",
        "formula": "C41H32O26",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "940.6788",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0177a2cd-9799-4c3c-b7da-7677b713f97e",
          "3accb375-4c3e-4420-a372-f84b9c545250"
        ],
        "stereo_centers": 5
      },
      "unii": "3UI3K8W93I"
    }
  ]
}