{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0dbef3e7-7fd5-1570-82da-b2e0cc955eee", "code": "17353", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17353", "code_system": "PUBCHEM", "references": [ "c84b3e79-2a03-f215-c596-27ad0aa1428d" ] }, { "uuid": "6400939e-3767-50af-c41c-4d04cae18116", "code": "DTXSID50948382", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50948382", "code_system": "EPA CompTox" }, { "uuid": "ecdc44c9-d4dd-42fc-afb2-756bf656ac7a", "code": "2549-90-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2549-90-8", "code_system": "CAS", "references": [ "6d37b1ef-428d-488b-b2f4-f69217add0ec" ] }, { "uuid": "0c744134-a5e6-4988-a945-6783d87a5fc7", "code": "3UET5R68HV", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "68ba0cab-152f-4e05-859d-778146b53f21", "name": "(4-((2-ETHYLHEXYL)OXY)-2-HYDROXYPHENYL)PHENYLMETHANONE", "stdName": "(4-((2-ETHYLHEXYL)OXY)-2-HYDROXYPHENYL)PHENYLMETHANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": true }, { "uuid": "b86b9f63-350d-4b9b-89ec-1ce3ee67668f", "name": "2-HYDROXY-4-((2-ETHYLHEXYL)OXY)BENZOPHENONE", "stdName": "2-HYDROXY-4-((2-ETHYLHEXYL)OXY)BENZOPHENONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": false }, { "uuid": "6ab72c90-6d05-4a5b-91d9-b673e4f51eaa", "name": "4-(2-ETHYLHEXYLOXY)-2-HYDROXYBENZOPHENONE", "stdName": "4-(2-ETHYLHEXYLOXY)-2-HYDROXYBENZOPHENONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": false }, { "uuid": "0d78eaed-8144-4c9e-923e-b81078bdfbe2", "name": "METHANONE, (4-((2-ETHYLHEXYL)OXY)-2-HYDROXYPHENYL)PHENYL-", "stdName": "METHANONE, (4-((2-ETHYLHEXYL)OXY)-2-HYDROXYPHENYL)PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": false }, { "uuid": "bc4e683b-d876-4712-beb7-e01b3a578bb4", "name": "UF-5", "stdName": "UF-5", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": false }, { "uuid": "14663b50-6d3a-424c-9077-def763f8c771", "name": "UVINUL-408", "stdName": "UVINUL-408", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "display_name": false } ], "references": [ { "uuid": "43a2ebcf-ebd7-45b7-afdb-30c4faf2f380", "citation": "SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c84b3e79-2a03-f215-c596-27ad0aa1428d", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "e6ba8133-4222-4070-a6ff-a6d1c88f77bd", "citation": "SCIFINDER", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6d37b1ef-428d-488b-b2f4-f69217add0ec", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d9d594f4-fb91-4a21-bc31-ec44faeb318c", "id": "d9d594f4-fb91-4a21-bc31-ec44faeb318c", "molfile": "\n Marvin 01132111182D \n\n 24 25 0 0 0 0 999 V2000\n 2.0735 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7879 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5024 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2169 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9313 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.9313 -5.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2169 -5.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6458 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3603 -4.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0747 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5037 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5037 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2182 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2182 -2.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9326 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9326 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6471 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3616 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3616 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6471 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -2.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0747 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 24 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 22 2 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COc1ccc(c(c1)O)C(=O)c2ccccc2", "formula": "C21H26O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "170ff82d-d0ad-4e7e-ab86-e6722eeb21eb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "326.4301", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "8ddd46b7-855c-43ac-ac5a-7cf16f958618", "version": "7", "structure": { "id": "bdd88ef7-3bfc-421a-b9d9-012294db64d9", "molfile": "\n Marvin 01132109492D \n\n 24 25 0 0 0 0 999 V2000\n 9.2182 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5037 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0747 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0747 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5037 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2182 -2.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9326 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9326 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6471 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3616 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3616 -3.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6471 -2.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3603 -4.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6458 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9313 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2169 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5024 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7879 -4.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0735 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9313 -5.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2169 -5.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7892 -2.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 2 7 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 9 14 1 0 0 0 0\n 1 8 2 0 0 0 0\n 1 9 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 15 16 1 0 0 0 0\n 22 23 1 0 0 0 0\n 17 22 1 0 0 0 0\n 5 15 1 0 0 0 0\n 3 24 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COc1ccc(c(c1)O)C(=O)c2ccccc2", "formula": "C21H26O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "326.4301", "optical_activity": "( + / - )", "references": [ "43a2ebcf-ebd7-45b7-afdb-30c4faf2f380", "e6ba8133-4222-4070-a6ff-a6d1c88f77bd" ], "stereo_centers": 1 }, "unii": "3UET5R68HV" } ] }