{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9f95ffcf-a8eb-4f06-b0dc-f997e496d176", "code": "10138-36-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10138-36-0", "code_system": "CAS", "references": [ "6900e668-c64a-48cb-b84f-6bc301852eba", "e27c184e-2a13-4b3e-872a-971167d6c6cc" ] }, { "uuid": "ebe17ca0-720a-4753-b493-62660ebec649", "code": "202332", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/202332", "code_system": "PUBCHEM", "references": [ "6900e668-c64a-48cb-b84f-6bc301852eba" ] }, { "uuid": "9a1b7085-6c76-6dfd-1172-bcaa5a180812", "code": "DTXSID60906099", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60906099", "code_system": "EPA CompTox" }, { "uuid": "6a10cdb4-051f-4dc7-ad84-f4b02f915d53", "code": "3U65A3B3ED", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c65b8cb4-bc4c-4025-a6a0-9605d17abbbd", "name": "3,4-Bis(2-ethylhexyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate", "stdName": "3,4-BIS(2-ETHYLHEXYL) 7-OXABICYCLO(4.1.0)HEPTANE-3,4-DICARBOXYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e27c184e-2a13-4b3e-872a-971167d6c6cc" ], "display_name": false }, { "uuid": "7fdb489f-ca6a-40b4-a99a-0d8c06154aca", "name": "7-Oxabicyclo[4.1.0]heptane-3,4-dicarboxylic acid, 3,4-bis(2-ethylhexyl) ester", "stdName": "7-OXABICYCLO(4.1.0)HEPTANE-3,4-DICARBOXYLIC ACID, 3,4-BIS(2-ETHYLHEXYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e27c184e-2a13-4b3e-872a-971167d6c6cc" ], "display_name": false }, { "uuid": "7d636c0c-e159-44de-8d83-26727d4582ad", "name": "Bis(2-ethylhexyl) 4,5-epoxyhexahydrophthalate", "stdName": "BIS(2-ETHYLHEXYL) 4,5-EPOXYHEXAHYDROPHTHALATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d2eac68c-5b54-4c20-bd73-309e60672180" ], "display_name": true }, { "uuid": "bbf3bf96-bef0-484a-a825-47556e83dc49", "name": "Bis(2-ethylhexyl)-4,5-epoxycyclohexane-1,2-dicarboxylate", "stdName": "BIS(2-ETHYLHEXYL)-4,5-EPOXYCYCLOHEXANE-1,2-DICARBOXYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75442abd-e96b-4c7c-a6f2-0b3ee7446fb1" ], "display_name": false } ], "references": [ { "uuid": "6900e668-c64a-48cb-b84f-6bc301852eba", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392223000, "tags": [ "NOMEN" ] }, { "uuid": "d2eac68c-5b54-4c20-bd73-309e60672180", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e27c184e-2a13-4b3e-872a-971167d6c6cc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "75442abd-e96b-4c7c-a6f2-0b3ee7446fb1", "citation": "PUBCHEM", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/202332", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "35fc93b8-7f02-4b60-91e1-c94949eb3faf", "id": "35fc93b8-7f02-4b60-91e1-c94949eb3faf", "molfile": "\n Marvin 01132102522D \n\n 29 30 0 0 0 0 999 V2000\n 9.9792 -4.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2707 -4.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5522 -4.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8437 -4.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1252 -4.5206 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.1252 -5.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8437 -5.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4166 -4.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4166 -3.2932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6981 -2.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9896 -3.2932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6981 -2.0557 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.4166 -1.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4166 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.4166 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6981 -0.4092 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.9896 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9896 -1.6466 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.2811 -2.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5626 -1.6466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2811 -2.8740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5626 -3.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8541 -2.8740 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8541 -2.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1355 -1.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1355 -3.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4270 -2.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7085 -3.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 18 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 26 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)C1CC2C(CC1C(=O)OCC(CC)CCCC)O2", "formula": "C24H42O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9d6a01cf-497d-47ae-ba74-582483c85aeb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "410.5882", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "86ee89a0-bfa9-4535-977f-364d0a9d3ce3", "version": "7", "structure": { "id": "078ac7f9-ddc1-4236-8dbc-e410208da195", "molfile": "\n JSDraw209132417522D\n\n 29 30 0 0 0 0 0 V2000\n 43.5514 -8.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.9914 -8.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.2097 -9.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.6497 -9.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8679 -10.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.6462 -12.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.2062 -12.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3079 -10.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.5262 -12.1697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9662 -12.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1879 -10.8157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1844 -13.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9629 -14.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1813 -16.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6213 -16.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8429 -14.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6244 -13.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8458 -12.1642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6271 -10.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2858 -12.1626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5071 -10.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9471 -10.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1658 -12.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6058 -12.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1684 -9.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6084 -9.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8298 -8.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2698 -8.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3998 -17.5728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 12 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 15 29 1 0 0 0 0\n 14 29 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)C1CC2C(CC1C(=O)OCC(CC)CCCC)O2", "formula": "C24H42O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "410.5882", "optical_activity": "UNSPECIFIED", "references": [ "d2eac68c-5b54-4c20-bd73-309e60672180" ], "stereo_centers": 6 }, "unii": "3U65A3B3ED" } ] }