{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "57732b83-76db-44c2-b6c1-f9a4ab4dfaed",
          "code": "86209-51-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86209-51-0",
          "code_system": "CAS",
          "references": [
            "5200c4f7-30e1-49d4-81de-a8fd27a9972a",
            "e430905b-5615-4c65-babd-35467022e071"
          ]
        },
        {
          "uuid": "93f62a8c-4b95-485c-b177-80a9f740562e",
          "code": "128973",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3560",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5200c4f7-30e1-49d4-81de-a8fd27a9972a"
          ]
        },
        {
          "uuid": "038b9ab7-ec7c-417e-bcdd-5605f382218e",
          "code": "m9136",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9136?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5200c4f7-30e1-49d4-81de-a8fd27a9972a"
          ]
        },
        {
          "uuid": "d5bd6b71-e653-4f3a-b14c-4ab11d44ff2c",
          "code": "101525",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101525",
          "code_system": "PUBCHEM",
          "references": [
            "5200c4f7-30e1-49d4-81de-a8fd27a9972a"
          ]
        },
        {
          "uuid": "f438dc5e-2697-9d0d-468d-e69e883dc0f6",
          "code": "7062",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7062",
          "code_system": "HSDB",
          "references": [
            "14402443-6982-df8e-0259-a69636bfb922"
          ]
        },
        {
          "uuid": "4dd4ae94-bac8-6080-d0dc-88a64895fa61",
          "code": "DTXSID8032463",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8032463",
          "code_system": "EPA CompTox",
          "references": [
            "a5989264-84b4-123e-67d4-1cba12f03a8f"
          ]
        },
        {
          "uuid": "1636fc84-2495-4b55-9970-d8e6cf9544a9",
          "code": "3TN6B6S8JP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e26ef682-16ce-f977-f5e9-e24649f7e525",
          "code": "primisulfuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/primisulfuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "04cb7db8-fa96-e995-7480-2fcd8701f9f2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ece2dee1-729d-4a65-bf8c-15b15f5dc25f",
          "name": "BEACON",
          "stdName": "BEACON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "b9a5c8ff-fffc-4da6-9ee7-a9af8b085f12"
          ],
          "display_name": false
        },
        {
          "uuid": "fe863a75-93f1-435a-9663-67e37fae64c3",
          "name": "CGA-136872",
          "stdName": "CGA-136872",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "b9a5c8ff-fffc-4da6-9ee7-a9af8b085f12"
          ],
          "display_name": false
        },
        {
          "uuid": "ccdb897e-eb54-47d5-93b5-c4dbf1ccb7eb",
          "name": "N-(2-METHOXYCARBONYLPHENYLSULFONYL)-N'-(4,6-BIS(DIFLUOROMETHOXY)PYRIMIDIN-2-YL)UREA",
          "stdName": "N-(2-METHOXYCARBONYLPHENYLSULFONYL)-N'-(4,6-BIS(DIFLUOROMETHOXY)PYRIMIDIN-2-YL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "b9a5c8ff-fffc-4da6-9ee7-a9af8b085f12"
          ],
          "display_name": false
        },
        {
          "uuid": "2b428395-64ca-4b82-99d3-c7a0b5547c0d",
          "name": "PRIMISULFURON-METHYL",
          "stdName": "PRIMISULFURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "6b500cd8-f614-4474-92e4-33fa32a112b6",
            "f139f6a0-0624-4713-a97b-a77781af5b6a",
            "46a338ad-a200-467a-90ae-eebedfd86d8b",
            "9ca3b038-b677-4266-8aa1-83edd02d59fb",
            "bd50d77a-a0a3-4c05-91bf-5eee01353584",
            "f994871e-4a7b-453f-bd60-8e66a0624481",
            "134f0064-e3a3-4d98-be91-e6125757ad6b"
          ],
          "display_name": true
        },
        {
          "uuid": "be02af1d-20aa-44bb-87ab-f66e31765ef1",
          "name": "PRIMISULFURON-METHYL [HSDB]",
          "stdName": "PRIMISULFURON-METHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "46a338ad-a200-467a-90ae-eebedfd86d8b"
          ],
          "display_name": false
        },
        {
          "uuid": "7d2fd6d0-2286-4d7c-9244-b99f457e0ba8",
          "name": "PRIMISULFURON-METHYL [ISO]",
          "stdName": "PRIMISULFURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "134f0064-e3a3-4d98-be91-e6125757ad6b"
          ],
          "display_name": false
        },
        {
          "uuid": "7f618f14-3108-4dfa-99ea-fa27a14acb28",
          "name": "PRIMISULFURON-METHYL [MI]",
          "stdName": "PRIMISULFURON-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "9ca3b038-b677-4266-8aa1-83edd02d59fb"
          ],
          "display_name": false
        },
        {
          "uuid": "3eb40991-0f74-4479-930a-4a43f1449798",
          "name": "TELL",
          "stdName": "TELL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54bf263-a991-48d4-99c6-546e65838b0c",
            "b9a5c8ff-fffc-4da6-9ee7-a9af8b085f12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f139f6a0-0624-4713-a97b-a77781af5b6a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9ca3b038-b677-4266-8aa1-83edd02d59fb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d54bf263-a991-48d4-99c6-546e65838b0c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9a5c8ff-fffc-4da6-9ee7-a9af8b085f12",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46a338ad-a200-467a-90ae-eebedfd86d8b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "134f0064-e3a3-4d98-be91-e6125757ad6b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5200c4f7-30e1-49d4-81de-a8fd27a9972a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86e337aa-55f8-4470-8ae2-47301fb7ac3b",
          "citation": "SRS import [3TN6B6S8JP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3TN6B6S8JP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb1e7a97-2054-4084-9252-6c0cd7f44b09",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd50d77a-a0a3-4c05-91bf-5eee01353584",
          "citation": "PRIMISULFURON-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f994871e-4a7b-453f-bd60-8e66a0624481",
          "citation": "PRIMISULFURON-METHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b500cd8-f614-4474-92e4-33fa32a112b6",
          "citation": "PRIMISULFURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14402443-6982-df8e-0259-a69636bfb922",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+86209-51-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5989264-84b4-123e-67d4-1cba12f03a8f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86209-51-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04cb7db8-fa96-e995-7480-2fcd8701f9f2",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e430905b-5615-4c65-babd-35467022e071",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1dae0ba0-00b8-4e2f-bf13-ad31986d461a",
          "id": "1dae0ba0-00b8-4e2f-bf13-ad31986d461a",
          "molfile": "\n  Marvin  01132101422D          \n\n 31 32  0  0  0  0            999 V2000\n    5.0324   -8.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5702   -7.4294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9376   -6.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5570   -6.6992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4898   -6.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6524   -6.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2236   -5.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6125   -4.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4347   -4.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8749   -5.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7030   -5.2903    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1207   -6.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2079   -4.3707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1135   -4.5612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9375   -4.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4109   -5.1255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3528   -3.8379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1789   -3.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5903   -4.5521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4093   -4.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8212   -5.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4063   -5.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8182   -6.7042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5797   -5.9894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8222   -3.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4085   -3.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8184   -2.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6498   -2.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0597   -1.6799    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0665   -3.1125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -3.1205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 31 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 31  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC(F)F)OC(F)F",
          "formula": "C15H12F4N4O7S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "932a3f4b-db58-44ef-86c6-7967bee93b8a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "468.3387",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7778c6ae-2bd0-4473-8f09-cdfafb045b7c",
      "version": "5",
      "structure": {
        "id": "c748f5af-cccb-49a3-88af-585df489d2ab",
        "molfile": "\n  Marvin  01132110182D          \n\n 31 32  0  0  0  0            999 V2000\n    3.6125   -4.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4347   -4.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8749   -5.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4898   -6.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9376   -6.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5702   -7.4294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0324   -8.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5570   -6.6992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6524   -6.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2236   -5.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7030   -5.2903    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1135   -4.5612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9375   -4.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3528   -3.8379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1789   -3.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -3.1205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4085   -3.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8222   -3.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4093   -4.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5903   -4.5521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8212   -5.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4063   -5.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8182   -6.7042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5797   -5.9894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8184   -2.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6498   -2.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0597   -1.6799    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0665   -3.1125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4109   -5.1255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1207   -6.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2079   -4.3707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  9  4  2  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 17 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 13 29  2  0  0  0  0\n 11 30  2  0  0  0  0\n 11 31  2  0  0  0  0\nM  END",
        "smiles": "COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC(F)F)OC(F)F",
        "formula": "C15H12F4N4O7S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "468.3387",
        "optical_activity": "NONE",
        "references": [
          "86e337aa-55f8-4470-8ae2-47301fb7ac3b",
          "bb1e7a97-2054-4084-9252-6c0cd7f44b09"
        ],
        "stereo_centers": 0
      },
      "unii": "3TN6B6S8JP"
    }
  ]
}