{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "05e89a47-a774-4246-9005-e80f9e2588c2", "code": "61276-17-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=61276-17-3", "code_system": "CAS", "references": [ "db8e5f70-d2b6-4224-aeee-a978042b9746", "3cf69d68-a181-44b0-bdcb-5775ec383978" ] }, { "uuid": "cd0cba74-18ff-4c4f-81c3-99cfbd00f592", "code": "5281800", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281800", "code_system": "PUBCHEM", "references": [ "db8e5f70-d2b6-4224-aeee-a978042b9746" ] }, { "uuid": "c66eb183-bcf5-4b6b-b516-ca86185cac09", "code": "Acteoside", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Acteoside", "code_system": "WIKIPEDIA", "references": [ "6b37087f-15a5-c32a-36b6-1a9ad996b105" ] }, { "uuid": "53533dc7-1eee-8beb-5e88-9788f42e7e0e", "code": "3474 (Number of products:7)", "comments": "Dietary Supplement Label Database|chemical|Verbascoside", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3474&item=Verbascoside", "code_system": "DSLD", "references": [ "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78" ] }, { "uuid": "6d43a534-7a4b-68c2-e9c4-5d13c571321e", "code": "DB12996", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB12996", "code_system": "DRUG BANK", "references": [ "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78" ] }, { "uuid": "df8f223d-2573-4f94-ac39-e98dc3c01fc9", "code": "3TGX09BD5B", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0ae281e7-7bc4-3594-d176-3c0bdd32d839", "code": "132853", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:132853", "code_system": "CHEBI", "references": [ "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78" ] }, { "uuid": "b08b483f-582a-f110-8973-f5104a63a0db", "code": "1711455", "type": "PRIMARY", "url": "https://store.usp.org/product/1711455", "code_system": "RS_ITEM_NUM", "references": [ "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78" ] }, { "uuid": "87001ecf-e193-4d0c-8c5f-c8e21d381d2b", "code": "300000037158", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d8b0abf2-7eb1-b681-b986-9dbf91f83edd" ] }, { "uuid": "c2635967-69e4-4d1f-cc9a-730580e31823", "code": "DTXSID701021953", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701021953", "code_system": "EPA CompTox", "references": [ "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78" ] }, { "uuid": "4428132d-8aa1-f721-0b41-392756bc3f29", "code": "603831", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=603831", "code_system": "NSC", "references": [ "7c70daf2-96ef-e470-5b78-32e4d9dd2152" ] } ], "relationships": [ { "uuid": "16b99a8d-de91-4106-9f62-e08824cb1675", "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "related_substance": { "uuid": "d35964b6-b526-4141-9c4f-67eda96a53f9", "refuuid": "5e494203-2ea9-4a36-8094-04a0ba669a9b", "name": "HARPAGOPHYTUM ZEYHERI ROOT", "unii": "1CTB7R80VI", "linking_id": "1CTB7R80VI", "ref_pname": "HARPAGOPHYTUM ZEYHERI ROOT" } } ], "substance_class": "chemical", "names": [ { "uuid": "6ac9c0ce-dafb-472b-9c97-485e95da0564", "name": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL 3-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-, 4-((2E)-3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE)", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL 3-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-, 4-((2E)-3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "f638c6ff-eda6-44f8-8b61-a1330be8af74", "name": "ACTEOSIDE", "stdName": "ACTEOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "078c2fb0-0cb8-436d-9bf7-856cb7478ded", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "3c7bacd6-f522-4d3a-8c6f-a40caef477e3", "name": "KUSAGININ", "stdName": "KUSAGININ", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "971d30d2-6888-4466-bc87-35cffd54a182", "name": "NSC-603831", "stdName": "NSC-603831", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "078c2fb0-0cb8-436d-9bf7-856cb7478ded", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "22ff6b33-9a1d-4496-b98f-c7b58f72f20d", "name": "RUSSETINOL", "stdName": "RUSSETINOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "43b0a4b0-b4fb-4a5f-b2d8-02d58b7ffa27", "name": "STEREOSPERMIN", "stdName": "STEREOSPERMIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "042b271a-8324-4263-88fe-20e32110dad5", "name": "TJC-160", "stdName": "TJC-160", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": false }, { "uuid": "c26a7149-ec23-4342-adb8-a8252ca82c91", "name": "VERBASCOSIDE", "stdName": "VERBASCOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3bfc18e5-f161-43e9-a640-08f035b0b97f", "3044ac3d-37d6-4b39-b4e7-7c90318d47b3", "bc23d71b-4f4b-446d-8a0c-0be881d78617", "07a4b645-6837-426b-bc88-73228d1f6897" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b26b4fe1-d1ec-4d38-9a5b-d5180cfa5489", "name_org": "INCI" } ] }, { "uuid": "522240ec-1486-60a0-532e-3ef9e0f137ca", "name": "VERBASCOSIDE [USP-RS]", "stdName": "VERBASCOSIDE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853f1db5-231f-13fe-8882-8e1e139fd247" ], "display_name": false } ], "references": [ { "uuid": "078c2fb0-0cb8-436d-9bf7-856cb7478ded", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "07a4b645-6837-426b-bc88-73228d1f6897", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bc23d71b-4f4b-446d-8a0c-0be881d78617", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3bfc18e5-f161-43e9-a640-08f035b0b97f", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "db8e5f70-d2b6-4224-aeee-a978042b9746", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392507000, "tags": [ "NOMEN" ] }, { "uuid": "80b5626a-28de-4dda-a077-bf557895cc9d", "citation": "SRS import [3TGX09BD5B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3TGX09BD5B", "doc_type": "SRS", "public_domain": true, "document_date": 1493392507000, "tags": [ "NOMEN" ] }, { "uuid": "3044ac3d-37d6-4b39-b4e7-7c90318d47b3", "citation": "VERBASCOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6b37087f-15a5-c32a-36b6-1a9ad996b105", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Acteoside", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d8b0abf2-7eb1-b681-b986-9dbf91f83edd", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "853f1db5-231f-13fe-8882-8e1e139fd247", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "0ae1898b-1b9b-d39e-93a3-b4e2f8b5da78", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "3cf69d68-a181-44b0-bdcb-5775ec383978", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7c70daf2-96ef-e470-5b78-32e4d9dd2152", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "73f9b55d-52ca-4f5b-ac68-407225421d66", "id": "73f9b55d-52ca-4f5b-ac68-407225421d66", "molfile": "\n Marvin 01132106012D \n\n 44 47 0 0 1 0 999 V2000\n 8.5144 -8.1867 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.5276 -7.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2318 -8.6257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2150 -9.4466 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.0639 -9.7329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0110 -9.3645 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.7329 -9.7934 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.7365 -10.6136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4554 -9.3998 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.1813 -9.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9038 -9.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6218 -9.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3482 -9.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3430 -8.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0694 -8.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7834 -8.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5018 -8.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7829 -9.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5049 -9.9257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0621 -9.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4518 -8.5796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7378 -8.1555 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.7302 -7.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4591 -6.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0114 -8.5466 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.2935 -8.1202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2899 -7.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0083 -6.9040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5685 -6.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5689 -6.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8430 -5.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8458 -4.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1238 -4.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3990 -4.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6730 -4.3353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4026 -5.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -5.9757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1245 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4894 -9.8296 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.4822 -10.7531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7721 -9.3906 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.0414 -9.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7898 -8.5648 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.0723 -8.1305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 43 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 39 4 1 0 0 0 0\n 6 5 1 1 0 0 0\n 6 7 1 0 0 0 0\n 25 6 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 21 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 20 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 1 0 0 0\n 25 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 26 1 6 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 38 31 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 34 36 2 0 0 0 0\n 37 36 1 0 0 0 0\n 36 38 1 0 0 0 0\n 39 40 1 6 0 0 0\n 41 39 1 0 0 0 0\n 41 42 1 6 0 0 0\n 43 41 1 0 0 0 0\n 43 44 1 1 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](OCCc3ccc(c(c3)O)O)O[C@H](CO)[C@H]2OC(=O)/C=C/c4ccc(c(c4)O)O)O)O)O)O", "formula": "C29H36O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "91e5623e-2a24-4d6f-b9e3-fbeada8f5544" }, "defined_stereo": 10, "ez_centers": 1, "molecular_weight": "624.5883", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "3135d07a-a628-40f7-b388-10c2f2c9a7b5", "version": "16", "structure": { "id": "92fcf27e-e4ac-42e3-b1af-82a253062f4f", "molfile": "\n Marvin 01132107372D \n\n 45 48 0 0 1 0 999 V2000\n 11.0110 -9.3645 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.2150 -9.4466 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.0114 -8.5466 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.7329 -9.7934 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.4894 -9.8296 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7721 -9.3906 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.0639 -9.7329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2318 -8.6257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4518 -8.5796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4554 -9.3998 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7898 -8.5648 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.7378 -8.1555 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.5144 -8.1867 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.7829 -9.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7834 -8.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0621 -9.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4822 -10.7531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7365 -10.6136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0414 -9.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0694 -8.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1813 -9.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0723 -8.1305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3482 -9.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5049 -9.9257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3430 -8.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7302 -7.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5018 -8.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9038 -9.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4591 -6.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5276 -7.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6218 -9.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2935 -8.1202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2899 -7.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5685 -6.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4026 -5.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5689 -6.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3990 -4.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1245 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0083 -6.9040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8430 -5.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1238 -4.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -5.9757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8458 -4.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6730 -4.3353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4241 -10.2397 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 2 7 1 0 0 0 0\n 1 7 1 1 0 0 0\n 8 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 6 1 0 0 0 0\n 9 12 1 0 0 0 0\n 12 3 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 8 1 0 0 0 0\n 15 14 2 0 0 0 0\n 14 16 1 0 0 0 0\n 5 17 1 6 0 0 0\n 4 18 1 6 0 0 0\n 6 19 1 6 0 0 0\n 15 20 1 0 0 0 0\n 10 21 1 1 0 0 0\n 11 22 1 1 0 0 0\n 16 23 2 0 0 0 0\n 24 14 1 0 0 0 0\n 20 25 2 0 0 0 0\n 25 23 1 0 0 0 0\n 12 26 1 1 0 0 0\n 27 15 1 0 0 0 0\n 28 21 1 0 0 0 0\n 29 26 1 0 0 0 0\n 13 30 1 6 0 0 0\n 23 31 1 0 0 0 0\n 31 28 1 0 0 0 0\n 3 32 1 6 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 36 34 2 0 0 0 0\n 37 35 1 0 0 0 0\n 35 38 2 0 0 0 0\n 39 33 2 0 0 0 0\n 38 40 1 0 0 0 0\n 40 36 1 0 0 0 0\n 37 41 2 0 0 0 0\n 42 35 1 0 0 0 0\n 41 43 1 0 0 0 0\n 43 40 2 0 0 0 0\n 44 37 1 0 0 0 0\n 2 45 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@]([H])(O1)O[C@@H]2[C@H]([C@H](OCCc3ccc(c(c3)O)O)O[C@H](CO)[C@H]2OC(=O)/C=C/c4ccc(c(c4)O)O)O)O)O)O", "formula": "C29H36O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 1, "molecular_weight": "624.5883", "optical_activity": "UNSPECIFIED", "references": [ "80b5626a-28de-4dda-a077-bf557895cc9d", "078c2fb0-0cb8-436d-9bf7-856cb7478ded" ], "stereo_centers": 10 }, "unii": "3TGX09BD5B" } ] }