{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "77030c68-e780-468b-9c24-63c946e3184c", "code": "QJ01FA11", "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|MACROLIDES, LINCOSAMIDES AND STREPTOGRAMINS|Macrolides|miocamycin", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01FA11&showdescription=yes", "code_system": "WHO-VATC", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "a6dc8b3c-153a-401a-bd4e-e40c2f87666f", "code": "55881-07-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=55881-07-7", "code_system": "CAS", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c", "8ffa5deb-5f45-4814-b0f3-a57c41ebcc77" ] }, { "uuid": "ad5f0427-7a4e-4ba5-aa8d-c143bedf256f", "code": "D015644", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68015644", "code_system": "MESH", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "ae357861-473f-460f-9d2a-aace5b7fc204", "code": "MIOCAMYCIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Miocamycin", "code_system": "WIKIPEDIA", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "fc0b7f9a-5512-4f7c-8128-3485e56bc5d9", "code": "J01FA11", "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|MACROLIDES, LINCOSAMIDES AND STREPTOGRAMINS|Macrolides|miocamycin", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=J01FA11&showdescription=yes", "code_system": "WHO-ATC", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "fabdae0c-67d9-49fc-9ffb-251d43aab13e", "code": "6985", "type": "ALTERNATIVE", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6985/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "9d3d1348-93f9-4f9b-8337-b038451b9999", "code": "236200", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236200/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "f022e397-c49e-4a88-b65e-3509162e885e", "code": "SUB21789", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "733d9600-91e8-4a90-9ec3-38786eaa3fc9", "code": "CHEMBL1908336", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1908336", "code_system": "ChEMBL", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "89c4cd57-b4c4-4300-8c28-84a4f93bf11f", "code": "CHEMBL1091024", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1091024", "code_system": "ChEMBL", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "a0e9859b-6c62-4413-8165-cf12eb1c2209", "code": "5282188", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282188", "code_system": "PUBCHEM", "references": [ "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c" ] }, { "uuid": "7dab97dc-8a4d-b3d3-defc-7b862ef22809", "code": "1815", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1815", "code_system": "DRUG CENTRAL", "references": [ "a6ba8426-ab5c-0f60-6b7a-2f9a8d3cad2d" ] }, { "uuid": "4239f28d-13d5-5003-c6e4-9d553de89213", "code": "DB13287", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB13287", "code_system": "DRUG BANK", "references": [ "a6ba8426-ab5c-0f60-6b7a-2f9a8d3cad2d" ] }, { "uuid": "32b6d0c2-0709-4c9f-b275-2ff0a54ff220", "code": "3T48CPS7U2", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "23e0ae4e-30a6-d6d4-b90f-b88d0d7aa494", "code": "100000088900", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "7b4f3c54-8636-bafe-a14c-298e1e0a2a0f" ] }, { "uuid": "0f25c33e-4de7-38d4-82c3-d4d470f7767e", "code": "DTXSID60905087", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60905087", "code_system": "EPA CompTox", "references": [ "a6ba8426-ab5c-0f60-6b7a-2f9a8d3cad2d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "be652166-c6eb-428b-90d5-12d2319abaea", "name": "3'',9-DIACETYLMYDECAMYCIN", "stdName": "3'',9-DIACETYLMYDECAMYCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "28feef2b-6bca-4563-b939-64ff08f52431", "name": "9,3''-DI-O-ACETYLMIDECAMYCIN", "stdName": "9,3''-DI-O-ACETYLMIDECAMYCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "153abdfc-6397-4395-877d-d9e13a218e5f", "name": "ACECAMYCIN", "stdName": "ACECAMYCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "07f65020-ec9c-4bc2-b79e-59b2b7806189", "name": "LEUCOMYCIN V, 3B,9-DIACETATE 3,4B-DIPROPANOATE", "stdName": "LEUCOMYCIN V, 3B,9-DIACETATE 3,4B-DIPROPANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "2c693f11-e3ed-4806-87c4-67702225a8fd", "name": "MIDECAMYCIN ACETATE", "stdName": "MIDECAMYCIN ACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f4bc2065-a360-47aa-84e0-66654a5c225e", "399b28ef-1da2-494f-a353-b1066e87da7c", "299c4bd2-3ad8-48b0-a2f2-5d0ef94e3018", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": true }, { "uuid": "0db676d3-25fe-4e0d-a419-e5b389cc519c", "name": "MIDECAMYCIN ACETATE [JAN]", "stdName": "MIDECAMYCIN ACETATE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6ed3edb5-810f-f46b-e268-1b34d9293f8e" ], "display_name": false }, { "uuid": "d6cfc323-1101-4fa4-befd-84fab7b498b4", "name": "MIDECAMYCIN DIACETATE", "stdName": "MIDECAMYCIN DIACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1a56924e-33bd-45db-a450-b70dd43537e5", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "df0ca695-d219-4041-a18f-241c6d9def11", "name": "MIOCAMYCIN", "stdName": "MIOCAMYCIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f52fa0fc-f5ca-4bcb-b444-b6314d5df835", "5ed598c4-0702-4172-9f77-35baee0edace", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "1bf66a98-68f7-497e-b424-4be4fa2910c2", "name": "MIOCAMYCIN [MI]", "stdName": "MIOCAMYCIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f52fa0fc-f5ca-4bcb-b444-b6314d5df835", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "236ee1fd-6c05-4eb1-8948-b19ed9413799", "name": "MOM", "stdName": "MOM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f52fa0fc-f5ca-4bcb-b444-b6314d5df835", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false }, { "uuid": "fc3eb939-62a6-38dd-01f9-4fe7307486d7", "name": "Midecamycin acetate [WHO-DD]", "stdName": "MIDECAMYCIN ACETATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9fcd5cf3-1ff1-307c-af93-55988ab3e806" ], "display_name": false }, { "uuid": "ecaf7c3f-95fe-4a9f-b58b-16a8c5f34036", "name": "PONSINOMYCIN", "stdName": "PONSINOMYCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "4dd92e5a-d40c-4caf-b263-51625757f0d9" ], "display_name": false } ], "references": [ { "uuid": "f4bc2065-a360-47aa-84e0-66654a5c225e", "citation": "NCI CADD 2012;WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4dd92e5a-d40c-4caf-b263-51625757f0d9", "citation": "NCI DRUG DICTIONARY", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "399b28ef-1da2-494f-a353-b1066e87da7c", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4a18b331-4ceb-4fa4-940e-c18e0d13e0b2", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f52fa0fc-f5ca-4bcb-b444-b6314d5df835", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a56924e-33bd-45db-a450-b70dd43537e5", "citation": "omop", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "14b3725f-c7a0-4b2b-b0cf-2ede251ef35c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391361000, "tags": [ "NOMEN" ] }, { "uuid": "d16a8a5b-c9a6-4b53-813d-7d429ac6f361", "citation": "SRS import [3T48CPS7U2]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3T48CPS7U2", "doc_type": "SRS", "public_domain": true, "document_date": 1493391361000, "tags": [ "NOMEN" ] }, { "uuid": "b15530d1-3fea-4307-b471-011ebe57e365", "citation": "CHEMID 2012", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "299c4bd2-3ad8-48b0-a2f2-5d0ef94e3018", "citation": "MIDECAMYCIN ACETATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5ed598c4-0702-4172-9f77-35baee0edace", "citation": "MIOCAMYCIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6ed3edb5-810f-f46b-e268-1b34d9293f8e", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7b4f3c54-8636-bafe-a14c-298e1e0a2a0f", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "a6ba8426-ab5c-0f60-6b7a-2f9a8d3cad2d", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "8ffa5deb-5f45-4814-b0f3-a57c41ebcc77", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9fcd5cf3-1ff1-307c-af93-55988ab3e806", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "887b7165-c8d0-4b2f-b4a1-fec12199a887", "id": "887b7165-c8d0-4b2f-b4a1-fec12199a887", "molfile": "\n Marvin 01132107052D \n\n 63 65 0 0 1 0 999 V2000\n 14.5985 -8.8542 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.0087 -9.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8329 -9.5636 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 16.5465 -9.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8329 -10.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1276 -11.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1276 -11.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4304 -10.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2307 -8.8624 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 16.9155 -8.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4979 -8.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4979 -7.8864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0802 -8.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6626 -8.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8329 -8.1570 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.2266 -7.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0169 -8.1570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7127 -9.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5645 -9.3750 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.1503 -8.6615 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.4250 -7.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3383 -8.6697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9324 -9.3873 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.9153 -9.3915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4800 -8.9403 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.4800 -8.1078 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.2303 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2427 -6.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8578 -6.6233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7582 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7582 -6.8693 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.3733 -6.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0241 -6.4429 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.0241 -5.5980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7295 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4308 -5.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7295 -4.3841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2819 -6.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2819 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -8.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -8.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8096 -9.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8096 -10.2239 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.0633 -10.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -10.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2737 -10.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2737 -9.3997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0241 -10.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7582 -10.2239 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.4390 -10.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4349 -11.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1320 -11.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7172 -11.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0159 -11.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7582 -9.3668 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.0405 -8.9403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0364 -8.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3383 -10.0844 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.8503 -10.5889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1585 -10.0844 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.4906 -10.6217 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 11.9985 -11.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3641 -10.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 17 1 0 0 0 0\n 1 18 1 6 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 9 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 9 10 1 6 0 0 0\n 9 15 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 15 17 1 0 0 0 0\n 19 18 1 1 0 0 0\n 19 20 1 0 0 0 0\n 60 19 1 0 0 0 0\n 20 21 1 6 0 0 0\n 20 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 6 0 0 0\n 23 58 1 0 0 0 0\n 25 24 1 6 0 0 0\n 25 26 1 0 0 0 0\n 25 55 1 0 0 0 0\n 26 27 1 6 0 0 0\n 26 30 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 31 32 1 6 0 0 0\n 33 31 1 0 0 0 0\n 33 34 1 6 0 0 0\n 33 38 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 6 0 0 0\n 43 45 1 0 0 0 0\n 46 45 1 0 0 0 0\n 46 47 2 0 0 0 0\n 48 46 1 0 0 0 0\n 49 48 1 0 0 0 0\n 49 50 1 6 0 0 0\n 55 49 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 2 0 0 0 0\n 51 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 55 56 1 6 0 0 0\n 56 57 1 0 0 0 0\n 58 59 1 1 0 0 0\n 58 60 1 0 0 0 0\n 60 61 1 6 0 0 0\n 61 62 1 0 0 0 0\n 61 63 1 0 0 0 0\nM END", "smiles": "CCC(=O)O[C@@H]1CC(=O)O[C@H](C)C/C=C/C=C/[C@@H]([C@H](C)C[C@H](CC=O)[C@@H]([C@H]1OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](C)O2)O[C@H]3C[C@](C)([C@H]([C@H](C)O3)OC(=O)CC)OC(=O)C)N(C)C)O)OC(=O)C", "formula": "C45H71NO17", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "55f52289-d1cf-4b61-88e0-4e836af043c7" }, "defined_stereo": 16, "ez_centers": 2, "molecular_weight": "898.0435", "optical_activity": "UNSPECIFIED", "stereo_centers": 16 } ], "definition_level": "COMPLETE", "uuid": "92192edc-f2a7-460d-b932-e6c6b962dc9b", "version": "18", "structure": { "id": "fafafea8-8336-4ffc-b5ff-3479fe776ec0", "molfile": "\n Marvin 01132113002D \n\n 63 65 0 0 1 0 999 V2000\n 8.4800 -8.9403 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7582 -9.3668 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7582 -10.2239 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.8096 -10.2239 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0241 -6.4429 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7582 -6.8693 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4800 -8.1078 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.9324 -9.3873 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.3383 -10.0844 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1585 -10.0844 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.5645 -9.3750 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.5985 -8.8542 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.8329 -9.5636 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.2307 -8.8624 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.8329 -8.1570 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1503 -8.6615 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.0241 -10.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2737 -10.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -10.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8096 -9.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -8.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5519 -8.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2819 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2819 -6.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7582 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2303 -7.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2427 -6.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8578 -6.6233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3733 -6.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0241 -5.5980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7295 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4308 -5.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7295 -4.3841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0633 -10.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2737 -9.3997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4390 -10.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4349 -11.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7172 -11.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0159 -11.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1320 -11.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0405 -8.9403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0364 -8.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9153 -9.3915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7127 -9.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0087 -9.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9155 -8.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4979 -8.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0802 -8.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6626 -8.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4979 -7.8864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0169 -8.1570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2266 -7.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8329 -10.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1276 -11.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1276 -11.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4304 -10.6709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5465 -9.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3383 -8.6697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4250 -7.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4906 -10.6217 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 11.9985 -11.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3641 -10.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8503 -10.5889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 1 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 11 1 0 0 0 0\n 3 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 4 1 0 0 0 0\n 4 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 5 24 1 0 0 0 0\n 24 23 2 0 0 0 0\n 7 25 1 0 0 0 0\n 25 6 1 0 0 0 0\n 7 26 1 6 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 6 29 1 6 0 0 0\n 5 30 1 6 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 4 34 1 6 0 0 0\n 18 35 2 0 0 0 0\n 3 36 1 6 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 37 40 2 0 0 0 0\n 2 41 1 6 0 0 0\n 41 42 1 0 0 0 0\n 1 43 1 6 0 0 0\n 8 43 1 6 0 0 0\n 11 44 1 1 0 0 0\n 12 44 1 6 0 0 0\n 12 45 1 0 0 0 0\n 45 13 1 0 0 0 0\n 14 46 1 6 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 47 50 2 0 0 0 0\n 12 51 1 0 0 0 0\n 51 15 1 0 0 0 0\n 15 52 1 1 0 0 0\n 13 53 1 6 0 0 0\n 53 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 54 56 2 0 0 0 0\n 13 57 1 1 0 0 0\n 8 58 1 0 0 0 0\n 58 16 1 0 0 0 0\n 16 59 1 6 0 0 0\n 10 60 1 6 0 0 0\n 60 61 1 0 0 0 0\n 60 62 1 0 0 0 0\n 9 63 1 1 0 0 0\nM END", "smiles": "CCC(=O)O[C@@H]1CC(=O)O[C@H](C)C/C=C/C=C/[C@@H]([C@H](C)C[C@H](CC=O)[C@@H]([C@H]1OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](C)O2)O[C@H]3C[C@](C)([C@H]([C@H](C)O3)OC(=O)CC)OC(=O)C)N(C)C)O)OC(=O)C", "formula": "C45H71NO17", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 16, "ez_centers": 2, "molecular_weight": "898.0435", "optical_activity": "UNSPECIFIED", "references": [ "d16a8a5b-c9a6-4b53-813d-7d429ac6f361", "b15530d1-3fea-4307-b471-011ebe57e365" ], "stereo_centers": 16 }, "unii": "3T48CPS7U2" } ] }