{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2be17dfe-9ae7-40d5-8424-fa22e9273483",
          "code": "933-48-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=933-48-2",
          "code_system": "CAS",
          "references": [
            "57929b76-811c-49a2-ac79-19a255af41ef",
            "823b46b4-78cc-43a0-86f2-da8bd0c3c10a"
          ]
        },
        {
          "uuid": "f58ab29b-a4f6-43da-b53b-b7af877f9e10",
          "code": "213-268-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.062",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "57929b76-811c-49a2-ac79-19a255af41ef"
          ]
        },
        {
          "uuid": "731f0100-cc3f-2170-5992-31cc21b1224a",
          "code": "DTXSID1047570",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1047570",
          "code_system": "EPA CompTox",
          "references": [
            "d31b7d25-5da3-f0cf-9d26-61d5936af2e8"
          ]
        },
        {
          "uuid": "f51a50a9-215a-4609-a06f-82ce17caec0e",
          "code": "3T046ESA4Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5e67db7a-9fff-42ac-af17-e1b37a110dea",
          "name": "(1R,5R)-3,3,5-TRIMETHYLCYCLOHEXANOL, (±)-",
          "stdName": "(1R,5R)-3,3,5-TRIMETHYLCYCLOHEXANOL, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9980e4f8-f469-4e64-8058-20a659ce3a6a",
            "5e2155d2-7776-486c-b3e8-201c71f132d7"
          ],
          "display_name": false
        },
        {
          "uuid": "2bd214af-4d38-40a2-a891-d25aecf2c703",
          "name": "3,3,5-TRIMETHYLCYCLOHEXANOL, CIS-(±)-",
          "stdName": "3,3,5-TRIMETHYLCYCLOHEXANOL, CIS-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9980e4f8-f469-4e64-8058-20a659ce3a6a",
            "5e2155d2-7776-486c-b3e8-201c71f132d7"
          ],
          "display_name": true
        },
        {
          "uuid": "fb4dd610-7a89-4989-ba90-0634961d1b96",
          "name": "CIS-3,3,5-TRIMETHYLCYCLOHEXANOL",
          "stdName": "CIS-3,3,5-TRIMETHYLCYCLOHEXANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2798d415-6032-43df-864b-3de436b6207e",
            "5e2155d2-7776-486c-b3e8-201c71f132d7"
          ],
          "display_name": false
        },
        {
          "uuid": "becf7679-fc18-4c83-82cf-9c0001ce8eaa",
          "name": "CIS-3,5,5-TRIMETHYLCYCLOHEXANOL",
          "stdName": "CIS-3,5,5-TRIMETHYLCYCLOHEXANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2798d415-6032-43df-864b-3de436b6207e",
            "5e2155d2-7776-486c-b3e8-201c71f132d7"
          ],
          "display_name": false
        },
        {
          "uuid": "c2fd2949-d216-4eee-a2a2-9483b3ef848f",
          "name": "CYCLOHEXANOL, 3,3,5-TRIMETHYL-, (1R,5R)-REL-",
          "stdName": "CYCLOHEXANOL, 3,3,5-TRIMETHYL-, (1R,5R)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2798d415-6032-43df-864b-3de436b6207e",
            "5e2155d2-7776-486c-b3e8-201c71f132d7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9980e4f8-f469-4e64-8058-20a659ce3a6a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e2155d2-7776-486c-b3e8-201c71f132d7",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2798d415-6032-43df-864b-3de436b6207e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57929b76-811c-49a2-ac79-19a255af41ef",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392508000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6120a07-8cfa-4a2b-81e7-8e0c47a40a85",
          "citation": "SRS import [3T046ESA4Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3T046ESA4Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392508000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d31b7d25-5da3-f0cf-9d26-61d5936af2e8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=933-48-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "823b46b4-78cc-43a0-86f2-da8bd0c3c10a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39055238-a0fa-20f0-a026-62406d0c3b9c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3656a8f0-83f0-40a5-b037-4b2fe7e06916",
          "id": "3656a8f0-83f0-40a5-b037-4b2fe7e06916",
          "molfile": "\n  Marvin  01132102542D          \n\n 10 10  0  0  0  0            999 V2000\n    8.1524  -10.7159    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.4379  -10.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524  -11.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8669  -11.9533    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.8669  -12.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5814  -11.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5814  -10.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3938  -10.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8635   -9.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8669  -10.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1C[C@@H](CC(C)(C)C1)O",
          "formula": "C9H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "00182cd6-a134-491d-9594-3d1be94fa69e"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "142.239",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c6bb8b26-5878-4113-8b4c-e462a8388eae",
      "version": "7",
      "structure": {
        "id": "018b649b-e219-44b3-9fc7-452804a3c4e5",
        "molfile": "\n  Marvin  01132100242D          \n\n 10 10  0  0  0  0            999 V2000\n   10.3938  -10.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5814  -10.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5814  -11.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8669  -11.9533    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8669  -12.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524  -11.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1524  -10.7159    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4379  -10.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8669  -10.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8635   -9.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  2  9  1  0  0  0  0\n  2 10  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1C[C@@H](CC(C)(C)C1)O",
        "formula": "C9H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "142.239",
        "optical_activity": "( + / - )",
        "references": [
          "e6120a07-8cfa-4a2b-81e7-8e0c47a40a85",
          "2798d415-6032-43df-864b-3de436b6207e"
        ],
        "stereo_centers": 2
      },
      "unii": "3T046ESA4Q"
    }
  ]
}