{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "35462315-273d-4056-8d58-dc734f3fbf17",
          "code": "24558-01-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24558-01-8",
          "code_system": "CAS",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec",
            "42809667-3535-49ea-83e1-5a90560f6327"
          ]
        },
        {
          "uuid": "415c1e3d-352f-4d36-b434-86eb0bd79cad",
          "code": "C81053",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81053",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "25bd6edb-9752-43c3-91f0-4daf41da8298",
          "code": "SUB08469MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "55f8e83c-b8e5-42e7-9990-664cff25dbf0",
          "code": "1157",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1157",
          "code_system": "INN",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "c2f7778f-5673-4b64-ac54-7090c7802581",
          "code": "m6791",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6791?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "971fc0ab-3451-4de3-9dd3-d0858dfde48b",
          "code": "CHEMBL2104874",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104874",
          "code_system": "ChEMBL",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "19b5e598-f9ad-481c-bf59-11c12a18afbd",
          "code": "15706387",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15706387",
          "code_system": "PUBCHEM",
          "references": [
            "ae2cfec0-2c54-4366-bac6-b506071485ec"
          ]
        },
        {
          "uuid": "c55713b4-c235-2448-300e-d1f0d63eccf1",
          "code": "DTXSID50179295",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50179295",
          "code_system": "EPA CompTox",
          "references": [
            "3f47a7a6-209a-9d11-fbdc-47d3c96cdde3"
          ]
        },
        {
          "uuid": "43465d79-7286-37c6-59ca-43ba1eea279f",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "766a1e58-ba70-3826-d8c8-a95916ed2a12"
          ]
        },
        {
          "uuid": "04c7c668-eb83-47b2-861c-e1b0d71acfe0",
          "code": "3SZ9ZII529",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fad46306-f105-edb3-50ea-c0fdf69435e8",
          "code": "3319",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3319",
          "code_system": "DRUG CENTRAL",
          "references": [
            "766a1e58-ba70-3826-d8c8-a95916ed2a12"
          ]
        },
        {
          "uuid": "14a8edfa-d741-62c0-135b-6973f553ce3f",
          "code": "Levophacetoperane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Levophacetoperane",
          "code_system": "WIKIPEDIA",
          "references": [
            "7bd8df54-8a05-6edf-2d02-1e6b65caac16"
          ]
        },
        {
          "uuid": "25509b09-4c9d-ca40-9376-46a2b7ae190d",
          "code": "100000082275",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "121777f2-1fbf-a263-a172-c0b5c3772455"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fe6e1631-af8a-4ef8-823f-990bed8ce126",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "06bcc6b1-bca7-44ee-a1a0-a6305dcd73c3",
            "refuuid": "f66c0d3f-cbed-4ccc-a0a1-5f51038ed762",
            "name": "LEVOFACETOPERANE",
            "unii": "3SZ9ZII529",
            "linking_id": "3SZ9ZII529",
            "ref_pname": "LEVOFACETOPERANE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1751cc31-8f96-471e-a238-deb550506473",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "696bd68a-07c0-41e9-b9d9-21ad1b8a3ed3",
            "refuuid": "fcf397fa-86f3-4416-bf4f-6bda9e07744f",
            "name": "LEVOFACETOPERANE HYDROCHLORIDE",
            "unii": "67UU667C62",
            "linking_id": "67UU667C62",
            "ref_pname": "LEVOFACETOPERANE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3464478d-0866-4874-9b3d-d5d83ad6e8bb",
          "name": "(-)-.ALPHA.-PHENYL-2-PIPERIDINEMETHANOL ACETATE (ESTER)",
          "stdName": "(-)-.ALPHA.-PHENYL-2-PIPERIDINEMETHANOL ACETATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e915ae19-2267-4cf9-b5df-02510b90884f"
          ],
          "display_name": false
        },
        {
          "uuid": "187eaaaf-a52b-425e-9e66-af975293cc22",
          "name": "(-)-THREO-1-ACETOXY-1-PHENYL-1-(2-PIPERIDYL)METHANE",
          "stdName": "(-)-THREO-1-ACETOXY-1-PHENYL-1-(2-PIPERIDYL)METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9779b38f-8d29-4b9b-99c5-c23b1f5232b1",
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f"
          ],
          "display_name": false
        },
        {
          "uuid": "0b6791a5-6843-456a-aad3-52a061acb299",
          "name": "(R,R)-(-)-PHACETOPERANE",
          "stdName": "(R,R)-(-)-PHACETOPERANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f",
            "b1d39861-ef77-44e6-9cfd-0901fea43104"
          ],
          "display_name": false
        },
        {
          "uuid": "87ba67d1-95fd-4a31-80bd-7498a99f7fb4",
          "name": "2-PIPERIDINEMETHANOL, .ALPHA.-PHENYL-, 2-ACETATE, (.ALPHA.R,2R)-",
          "stdName": "2-PIPERIDINEMETHANOL, .ALPHA.-PHENYL-, 2-ACETATE, (.ALPHA.R,2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f",
            "b1d39861-ef77-44e6-9cfd-0901fea43104"
          ],
          "display_name": false
        },
        {
          "uuid": "058ab0a6-600f-4268-b29f-8bee13b82bac",
          "name": "LEVOFACETOPERANE",
          "stdName": "LEVOFACETOPERANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e915ae19-2267-4cf9-b5df-02510b90884f",
            "f4c8c931-d1cc-44e4-9569-20efce780d60",
            "237ff3a8-8a61-425c-841d-df69122afae3"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "6b6b4b41-7100-4222-8d6f-936f0721c69b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "9d5b84b9-290b-43bc-b971-0af86f73f59e",
          "name": "LEVOPHACETOPERANE",
          "stdName": "LEVOPHACETOPERANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f08dd0e-d48d-4693-8663-72bf8641e58b",
            "9779b38f-8d29-4b9b-99c5-c23b1f5232b1",
            "c381d423-402d-4fb0-a8cf-1c025ac53f03",
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f"
          ],
          "display_name": false
        },
        {
          "uuid": "6fb95aad-af26-4ca8-8b67-64bb8c7ac543",
          "name": "LEVOPHACETOPERANE [MI]",
          "stdName": "LEVOPHACETOPERANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f08dd0e-d48d-4693-8663-72bf8641e58b",
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f"
          ],
          "display_name": false
        },
        {
          "uuid": "684fb95b-03df-48cc-a4bd-c72a17370849",
          "name": "LIDEPRAN",
          "stdName": "LIDEPRAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6008cd1c-2466-4dcc-b9db-3e4216658890",
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f"
          ],
          "display_name": false
        },
        {
          "uuid": "06b6e276-c1ca-4cd8-b843-6b43e53b59ec",
          "name": "RP-8228",
          "stdName": "RP-8228",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "844ab2ba-3571-41d2-b86e-09aa9df8c71f",
            "b1d39861-ef77-44e6-9cfd-0901fea43104"
          ],
          "display_name": false
        },
        {
          "uuid": "450ec2c6-6a68-4da3-86be-7ee524e317b2",
          "name": "levofacetoperane [INN]",
          "stdName": "LEVOFACETOPERANE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4c8c931-d1cc-44e4-9569-20efce780d60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e915ae19-2267-4cf9-b5df-02510b90884f",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f4c8c931-d1cc-44e4-9569-20efce780d60",
          "citation": "INN Proposed List 41",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL41.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3f08dd0e-d48d-4693-8663-72bf8641e58b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "844ab2ba-3571-41d2-b86e-09aa9df8c71f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9779b38f-8d29-4b9b-99c5-c23b1f5232b1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1d39861-ef77-44e6-9cfd-0901fea43104",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6008cd1c-2466-4dcc-b9db-3e4216658890",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae2cfec0-2c54-4366-bac6-b506071485ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "214c0d62-b1c3-40aa-b6ce-4d702d9278bb",
          "citation": "SRS import [3SZ9ZII529]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3SZ9ZII529",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "237ff3a8-8a61-425c-841d-df69122afae3",
          "citation": "LEVOFACETOPERANE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c381d423-402d-4fb0-a8cf-1c025ac53f03",
          "citation": "LEVOPHACETOPERANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f47a7a6-209a-9d11-fbdc-47d3c96cdde3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24558-01-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "121777f2-1fbf-a263-a172-c0b5c3772455",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "766a1e58-ba70-3826-d8c8-a95916ed2a12",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "42809667-3535-49ea-83e1-5a90560f6327",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7bd8df54-8a05-6edf-2d02-1e6b65caac16",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "83f5e228-ddf6-40b9-8d83-233e6f6db1ce",
          "id": "83f5e228-ddf6-40b9-8d83-233e6f6db1ce",
          "molfile": "\n  Marvin  01132106512D          \n\n 17 18  0  0  1  0            999 V2000\n    3.7358   -1.9969    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.5483   -2.1401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0786   -1.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8910   -1.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7964   -0.7329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4536   -1.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9839   -0.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7017    0.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8893    0.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3590   -0.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6411   -1.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2055   -2.6289    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.4910   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4910   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2055   -4.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9200   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9200   -3.0414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  6  1  0  0  0  0\n 12  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  1  6  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[C@H](c1ccccc1)[C@H]2CCCCN2",
          "formula": "C14H19NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7bc81540-d1fa-4fe0-b1c1-5924664ba240"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "233.3067",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f66c0d3f-cbed-4ccc-a0a1-5f51038ed762",
      "version": "8",
      "structure": {
        "id": "a791b419-2b43-48d7-83f1-b0e78f48dba7",
        "molfile": "\n  Marvin  01132108422D          \n\n 18 19  0  0  1  0            999 V2000\n    3.4536   -1.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9839   -0.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7017    0.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8893    0.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3590   -0.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6411   -1.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7358   -1.9969    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2055   -2.6289    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.4910   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4910   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2055   -4.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9200   -3.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9200   -3.0414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6752   -1.9969    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5483   -2.1401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0786   -1.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8910   -1.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7964   -0.7329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  8 14  1  1  0  0  0\n  7 15  1  1  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[C@H](c1ccccc1)[C@@]2([H])CCCCN2",
        "formula": "C14H19NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "233.3067",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e915ae19-2267-4cf9-b5df-02510b90884f",
          "214c0d62-b1c3-40aa-b6ce-4d702d9278bb",
          "f4c8c931-d1cc-44e4-9569-20efce780d60"
        ],
        "stereo_centers": 2
      },
      "unii": "3SZ9ZII529"
    }
  ]
}