{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "30bafb52-2ec8-c3b2-5cda-856ce4132e02",
          "code": "3037558",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3037558",
          "code_system": "PUBCHEM",
          "references": [
            "06abdec2-9f12-5b5a-8fa0-c9b8ff7c640b"
          ]
        },
        {
          "uuid": "6368e8b4-7e32-48d1-9fdc-655983d8ebc6",
          "code": "63-42-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63-42-3",
          "code_system": "CAS",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805",
            "fdce4c5a-aa4a-4629-bbb3-adf06ee962ad"
          ]
        },
        {
          "uuid": "b83e07b2-18dc-45b2-9ce6-a1dc7afd2fe7",
          "code": "ANHYDROUS LACTOSE",
          "comments": "Description: A white or almost white, crystalline powder; odourless. Solubility: Freely but slowly soluble in water; very slightly soluble in ethanol (~750 g/l) TS; practically insoluble in ether R. Category: Tablet and capsule diluent. Storage: Lactose should be kept in a well-closed container.Labelling: The designation on the container of Lactose should state whether it is the monohydrate or the anhydrous form. Additional information: Attention should be paid to the microbiological purity, since Lactose is of natural origin.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.238.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "eed386ae-0aa0-40fe-b8c7-cd6ec355b643",
          "code": "16984-38-6",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16984-38-6",
          "code_system": "CAS",
          "references": [
            "45ddbeb1-3a11-e3fe-5910-5c8d736e4161"
          ]
        },
        {
          "uuid": "15e89e51-f354-4057-af8c-3bea0db799ab",
          "code": "C74579",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74579",
          "code_system": "NCI_THESAURUS",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "bc8b3939-b147-4cb1-8ddc-fa9e4fdc1a31",
          "code": "DB04465",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04465",
          "code_system": "DRUG BANK",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "3546f8e9-b181-1eaf-8621-0b18cf79d080",
          "code": "7962",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7962",
          "code_system": "HSDB",
          "references": [
            "b6fcf21d-9fcb-0676-7ef5-afdcb69f2004"
          ]
        },
        {
          "uuid": "1f8ee992-f8b1-649b-cac9-80f66a344a47",
          "code": "DTXSID2023193",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023193",
          "code_system": "EPA CompTox",
          "references": [
            "419ce289-ba0a-9bd7-5d61-ed118443ae3a"
          ]
        },
        {
          "uuid": "dd4003bb-e1d7-4739-a655-66d87cb78bf4",
          "code": "200-559-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.509",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "8aa545ed-e0a4-4b80-84a9-dddee1f09108",
          "code": "1307662",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1307662/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "2f34ac5e-0fab-4b2d-a4e9-01e09409f8ee",
          "code": "m6662",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6662?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "0487f210-494b-4a28-b5eb-12914d97a96d",
          "code": "3SY5LH9PMK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f5729302-5ac8-48c3-97eb-9278d882da0f",
          "code": "SUB14318MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "e814ebf3-d055-4906-a6b6-7e107c134c9b",
          "code": "CHEMBL417016",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL417016",
          "code_system": "ChEMBL",
          "references": [
            "640b0666-caf0-4a9b-ab92-4b3ed25bd805"
          ]
        },
        {
          "uuid": "5a16ba54-5f81-c2b7-d96e-97b2ccd05fb3",
          "code": "C68472",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Disaccharide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68472",
          "code_system": "NCI_THESAURUS",
          "references": [
            "95ac5eab-0ead-42c9-2b7c-d8b1bb8d6d34"
          ]
        },
        {
          "uuid": "ba960398-02d7-3646-e6b5-f7903c637491",
          "code": "36219",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36219",
          "code_system": "CHEBI",
          "references": [
            "95ac5eab-0ead-42c9-2b7c-d8b1bb8d6d34"
          ]
        },
        {
          "uuid": "a57a5659-216c-224f-acfe-a5da40ea3095",
          "code": "1356676",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1356676",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "95ac5eab-0ead-42c9-2b7c-d8b1bb8d6d34"
          ]
        },
        {
          "uuid": "827f3db6-39ef-63fe-6a29-cb5c198476b9",
          "code": "100000077075",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a802e263-e151-a862-2c6f-e07d111938a7"
          ]
        },
        {
          "uuid": "6197cc98-889c-9894-fc75-90a226e3ae3b",
          "code": "3SY5LH9PMK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3SY5LH9PMK",
          "code_system": "DAILYMED",
          "references": [
            "8e41225d-ba86-925e-8a1a-f239fd97d00a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5abd6179-38dc-41b7-9e15-a311e10d8e5a",
          "amount": {
            "uuid": "c5a25013-bb97-457a-9ea3-a65437898b4d"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "b2d6722d-c52f-49d4-b828-0037840fc0a0",
            "refuuid": "76527b27-56ea-4e3f-ac6f-4d1dce8f0a83",
            "name": "ALTERNATIVE DEFINITION for [ANHYDROUS LACTOSE]",
            "linking_id": "76527b27-56ea-4e3f-ac6f-4d1dce8f0a83",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "23fb3751-55b8-bd27-66fe-f53eb234e5c0",
          "amount": {
            "uuid": "affd68a0-92fb-42d3-8dd2-120302cf5dee"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "fdce4c5a-aa4a-4629-bbb3-adf06ee962ad"
          ],
          "related_substance": {
            "uuid": "e256036b-f689-4780-bda9-49fdd60e0006",
            "refuuid": "1730a448-7562-4c3a-bad7-c25333ac2a95",
            "name": "LACTOSE MONOHYDRATE",
            "unii": "EWQ57Q8I5X",
            "linking_id": "EWQ57Q8I5X",
            "ref_pname": "LACTOSE MONOHYDRATE"
          }
        },
        {
          "uuid": "c79e4b15-e179-4b6f-af1e-6231e9580d5e",
          "amount": {
            "uuid": "b05604f7-5cb5-4bfe-adc3-dde5e7c8e08d"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "cd6cfa74-4746-4bc1-a2b3-978a8b9a9670",
            "refuuid": "7db3a17e-f88f-43db-8959-d8dec8755792",
            "name": "ALTERNATIVE DEFINITION for [ANHYDROUS LACTOSE]",
            "linking_id": "7db3a17e-f88f-43db-8959-d8dec8755792",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "2fa2d1f1-e0f3-4656-a957-eb9d9b8d3ce9",
          "amount": {
            "uuid": "5e562303-e6cc-452e-b8d0-8fd916b2e057"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "53500a5c-83ea-4a89-acdf-6878ab0b5e8d",
            "refuuid": "a2e05e3b-d29c-4fb1-9f26-71513ae863f4",
            "name": "ANHYDROUS LACTOSE",
            "unii": "3SY5LH9PMK",
            "linking_id": "3SY5LH9PMK",
            "ref_pname": "ANHYDROUS LACTOSE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f8ffa3dd-e898-4bb3-8589-90f60404aa0b",
          "amount": {
            "uuid": "d5713747-8f7c-4167-8952-131a8133ca5e",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 3
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "abef3d26-64bb-4d51-b9ba-8b7c43496f22"
          ],
          "related_substance": {
            "uuid": "1f13b7fd-7f14-4135-a13f-2602a2049dc7",
            "refuuid": "49d00b2c-998a-41f0-84c7-02a9a8324597",
            "name": "LACTULOSE",
            "unii": "9U7D5QH5AE",
            "linking_id": "9U7D5QH5AE",
            "ref_pname": "LACTULOSE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cc56d12c-0317-4081-a5bc-2776cdea7d5a",
          "name": "ANHYDROUS LACTOSE",
          "stdName": "ANHYDROUS LACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75dbaad2-21ac-4f15-a87b-8c1289532475",
            "060fc220-a66a-450e-91d1-c8df76e9ff8e",
            "854b502d-f5f9-4c58-b8f7-ea5ec76bb85b",
            "44a34334-a5f5-43e1-92bf-fde175281c6e",
            "86dbaa9f-e15b-4607-b649-40881d258591",
            "b3d09198-ef21-4367-aa13-b1ee2a174232",
            "eb9a2f24-63df-4d61-8570-953b5f8964ad"
          ],
          "display_name": true
        },
        {
          "uuid": "3f67b8e8-3a0f-47f7-a510-69649401ea0f",
          "name": "ANHYDROUS LACTOSE IS PRIMARILY BETA LACTOSE OR A MIXTURE OF ALPHA AND BETA LACTOSE",
          "stdName": "ANHYDROUS LACTOSE IS PRIMARILY BETA LACTOSE OR A MIXTURE OF ALPHA AND BETA LACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ef1a503-464c-432d-b55a-3005ec5c8f4c"
          ],
          "display_name": false
        },
        {
          "uuid": "b3ead22c-95c2-86a4-0369-23c58a8d47c4",
          "name": "ANHYDROUS LACTOSE [EP IMPURITY]",
          "stdName": "ANHYDROUS LACTOSE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb9a2f24-63df-4d61-8570-953b5f8964ad"
          ],
          "display_name": false
        },
        {
          "uuid": "874340fc-562f-4189-8611-6fe75630d474",
          "name": "ANHYDROUS LACTOSE [II]",
          "stdName": "ANHYDROUS LACTOSE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86dbaa9f-e15b-4607-b649-40881d258591"
          ],
          "display_name": false
        },
        {
          "uuid": "d3db319d-62ec-4461-be16-8c2f9c6348a2",
          "name": "ANHYDROUS LACTOSE [JAN]",
          "stdName": "ANHYDROUS LACTOSE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a32fe5e8-c500-4856-9ffe-f590fb30f55a"
          ],
          "display_name": false
        },
        {
          "uuid": "f62c025c-fdce-4682-a3cb-eb294d3b3aa7",
          "name": "ANHYDROUS LACTOSE [NF]",
          "stdName": "ANHYDROUS LACTOSE [NF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "854b502d-f5f9-4c58-b8f7-ea5ec76bb85b"
          ],
          "display_name": false
        },
        {
          "uuid": "83606df3-0c0e-40e1-b585-6fc5ad5e3db1",
          "name": "ANHYDROUS LACTOSE [USP-RS]",
          "stdName": "ANHYDROUS LACTOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "854b502d-f5f9-4c58-b8f7-ea5ec76bb85b"
          ],
          "display_name": false
        },
        {
          "uuid": "99588422-c5c1-f4fb-049d-76c5e4a216ea",
          "name": "LACTOPRESS ANHYDROUS",
          "stdName": "LACTOPRESS ANHYDROUS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d9dc471-2570-2200-0f43-e69622fca851"
          ],
          "display_name": false
        },
        {
          "uuid": "d1abc184-cf8d-47ac-9eba-38864dd98ad4",
          "name": "LACTOSE ANHYDROUS",
          "stdName": "LACTOSE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c01b5f44-c672-4c11-97af-ecb56269b78a",
            "8c0417bc-62a2-41a5-a699-273c7aa116ad",
            "21290fc7-b4a6-46c7-bc23-412e83bc87aa"
          ],
          "display_name": false
        },
        {
          "uuid": "af7a6966-2eb5-4b59-869e-dbb5d47a46cf",
          "name": "LACTOSE [MI]",
          "stdName": "LACTOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f76e6add-5300-4d9a-b6f3-fe5237a68a49"
          ],
          "display_name": false
        },
        {
          "uuid": "a8d642be-7e9d-4ae9-b848-93303674383c",
          "name": "LACTOSE, ANHYDROUS",
          "stdName": "LACTOSE, ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71b0fc3c-b6d3-4096-868e-fce2c5f956a1",
            "a32fe5e8-c500-4856-9ffe-f590fb30f55a",
            "0d416cc1-72be-4c9a-b9a9-f056947fbd74",
            "b88ed10e-c4bc-4f09-a994-d448c391c0db",
            "a2e114f7-5bdc-4aac-a450-688f905c5ffb",
            "b7adfe18-302c-4583-ac60-cd2d6a74190b",
            "4c27c0c1-7465-4353-b96f-fadecbd3105a"
          ],
          "display_name": false
        },
        {
          "uuid": "c964ba8d-44f6-034c-f5ab-12d03f812611",
          "name": "LACTOSE, ANHYDROUS [EP IMPURITY]",
          "stdName": "LACTOSE, ANHYDROUS [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d416cc1-72be-4c9a-b9a9-f056947fbd74"
          ],
          "display_name": false
        },
        {
          "uuid": "14a76245-2615-43ba-b68f-311e31384331",
          "name": "LACTOSE, ANHYDROUS [WHO-IP]",
          "stdName": "LACTOSE, ANHYDROUS [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c27c0c1-7465-4353-b96f-fadecbd3105a"
          ],
          "display_name": false
        },
        {
          "uuid": "a9a46cd5-1101-41a8-a8ae-257373f8daf7",
          "name": "LACTOSE,ANHYDROUS",
          "stdName": "LACTOSE,ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4df01b20-1943-47c8-bff9-430309d4c161",
            "4c0f50d7-d239-4116-9340-fa477e47d832"
          ],
          "display_name": false
        },
        {
          "uuid": "b4013737-a034-4451-ae8a-f811a9f7df11",
          "name": "LACTOSE,ANHYDROUS [VANDF]",
          "stdName": "LACTOSE,ANHYDROUS [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4df01b20-1943-47c8-bff9-430309d4c161"
          ],
          "display_name": false
        },
        {
          "uuid": "8ac67011-679e-4847-802f-d464cba922b6",
          "name": "LACTOSUM, ANHYDROUS [WHO-IP LATIN]",
          "stdName": "LACTOSUM, ANHYDROUS [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c27c0c1-7465-4353-b96f-fadecbd3105a"
          ],
          "display_name": false
        },
        {
          "uuid": "5ad41766-41c3-203d-7df1-4bf66eb5b992",
          "name": "LACTULOSE IMPURITY C [EP IMPURITY]",
          "stdName": "LACTULOSE IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "943be4d3-65aa-a724-c5f0-3fb3a7a28a29"
          ],
          "display_name": false
        },
        {
          "uuid": "c529fd65-2ea3-b0f8-c13b-3c9e7da3f91e",
          "name": "Lactose anhydrous [WHO-DD]",
          "stdName": "LACTOSE ANHYDROUS [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1e56cd6-7dfb-65ac-2eac-2e46a7b36500"
          ],
          "display_name": false
        },
        {
          "uuid": "a18e33cd-ec78-925a-7fd4-4bbd4f7e6fc3",
          "name": "SUPERTAB 21AN",
          "stdName": "SUPERTAB 21AN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d9dc471-2570-2200-0f43-e69622fca851"
          ],
          "display_name": false
        },
        {
          "uuid": "9e2f5aa6-9f69-c65c-3340-64f06def4124",
          "name": "SUPERTAB 22AN",
          "stdName": "SUPERTAB 22AN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d9dc471-2570-2200-0f43-e69622fca851"
          ],
          "display_name": false
        },
        {
          "uuid": "7d721d74-9aa1-de5e-a4d8-c224c8ae01e1",
          "name": "SUPERTAB 24AN",
          "stdName": "SUPERTAB 24AN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d9dc471-2570-2200-0f43-e69622fca851"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a802e263-e151-a862-2c6f-e07d111938a7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c40e5430-c349-4e9d-9768-9fcbfa57286e",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "943be4d3-65aa-a724-c5f0-3fb3a7a28a29",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fdce4c5a-aa4a-4629-bbb3-adf06ee962ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1d9dc471-2570-2200-0f43-e69622fca851",
          "citation": "dfe pharma",
          "doc_type": "MANUFACTURER PRODUCT DESCRIPTION",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "45ddbeb1-3a11-e3fe-5910-5c8d736e4161",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b6fcf21d-9fcb-0676-7ef5-afdcb69f2004",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+63-42-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "419ce289-ba0a-9bd7-5d61-ed118443ae3a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=63-42-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a2e114f7-5bdc-4aac-a450-688f905c5ffb",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1ef1a503-464c-432d-b55a-3005ec5c8f4c",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86dbaa9f-e15b-4607-b649-40881d258591",
          "citation": "NF 28",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c01b5f44-c672-4c11-97af-ecb56269b78a",
          "citation": "ema list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d416cc1-72be-4c9a-b9a9-f056947fbd74",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a32fe5e8-c500-4856-9ffe-f590fb30f55a",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f76e6add-5300-4d9a-b6f3-fe5237a68a49",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "854b502d-f5f9-4c58-b8f7-ea5ec76bb85b",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c0417bc-62a2-41a5-a699-273c7aa116ad",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4df01b20-1943-47c8-bff9-430309d4c161",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb9a2f24-63df-4d61-8570-953b5f8964ad",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c27c0c1-7465-4353-b96f-fadecbd3105a",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20b19997-56e0-4b8e-8c3d-c0e4bcf49e22",
          "citation": "FSA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "640b0666-caf0-4a9b-ab92-4b3ed25bd805",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390727000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef051adf-542a-4f93-83bf-f1c5b667a25a",
          "citation": "SRS import [3SY5LH9PMK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3SY5LH9PMK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390727000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbe76b54-f024-480c-bb1a-4ff200acf9b5",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7adfe18-302c-4583-ac60-cd2d6a74190b",
          "citation": "LACTOSE, ANHYDROUS [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71b0fc3c-b6d3-4096-868e-fce2c5f956a1",
          "citation": "LACTOSE, ANHYDROUS [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b3d09198-ef21-4367-aa13-b1ee2a174232",
          "citation": "ANHYDROUS LACTOSE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44a34334-a5f5-43e1-92bf-fde175281c6e",
          "citation": "ANHYDROUS LACTOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "21290fc7-b4a6-46c7-bc23-412e83bc87aa",
          "citation": "LACTOSE ANHYDROUS [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c0f50d7-d239-4116-9340-fa477e47d832",
          "citation": "LACTOSE,ANHYDROUS [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75dbaad2-21ac-4f15-a87b-8c1289532475",
          "citation": "ANHYDROUS LACTOSE [NF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "060fc220-a66a-450e-91d1-c8df76e9ff8e",
          "citation": "ANHYDROUS LACTOSE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b88ed10e-c4bc-4f09-a994-d448c391c0db",
          "citation": "LACTOSE, ANHYDROUS [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abef3d26-64bb-4d51-b9ba-8b7c43496f22",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3defc8ce-74d1-42a2-bd32-b09a1912fccd",
          "citation": "EP: 07/2019:1230",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06abdec2-9f12-5b5a-8fa0-c9b8ff7c640b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "95ac5eab-0ead-42c9-2b7c-d8b1bb8d6d34",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e1e56cd6-7dfb-65ac-2eac-2e46a7b36500",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8e41225d-ba86-925e-8a1a-f239fd97d00a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "75f55677-09f0-4705-b820-dac8de7603c3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "debb5487-5edc-c5c6-c5fb-9c8fdba96906",
          "id": "debb5487-5edc-c5c6-c5fb-9c8fdba96906",
          "molfile": "\n  Marvin  01132111322D          \n\n 23 23  0  0  1  0            999 V2000\n   16.2969   -2.4670    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.0094   -2.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5844   -2.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8928   -2.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2969   -3.2920    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   15.5844   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8679   -4.1211    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.1470   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4345   -4.1211    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.7220   -3.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0804   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4345   -4.9460    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.7220   -5.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1470   -5.3585    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.1470   -6.1877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8679   -4.9460    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   15.5844   -5.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0094   -3.7045    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.0094   -4.5336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7344   -3.2920    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   18.4510   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7344   -2.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5427   -1.9711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 12  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  6  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6bd66c3b-b63a-42a9-acb8-0eba81e5258b"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a2e05e3b-d29c-4fb1-9f26-71513ae863f4",
      "version": "51",
      "structure": {
        "id": "69409f0d-675e-ed41-ddb2-4b1f3b474006",
        "molfile": ".BETA.-LACTOSE\n  Marvin  01132105282D          \n\n 25 25  0  0  1  0            999 V2000\n   14.8679   -4.1211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.2969   -3.2920    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8679   -4.9460    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.0094   -3.7045    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.7344   -3.2920    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1470   -5.3585    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1470   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5844   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0094   -2.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7344   -2.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4345   -4.9460    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2969   -2.4670    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4345   -4.1211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.5844   -5.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4510   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0094   -4.5336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1470   -6.1877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7220   -5.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5427   -1.9711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5844   -2.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7220   -3.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0804   -3.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8928   -2.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5803   -4.5336    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3435   -3.0488    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  7  1  0  0  0  0\n  3 14  1  6  0  0  0\n  5 15  1  6  0  0  0\n  4 16  1  1  0  0  0\n  6 17  1  1  0  0  0\n 11 18  1  1  0  0  0\n 10 19  2  0  0  0  0\n 12 20  1  1  0  0  0\n 13 21  1  1  0  0  0\n 22 21  1  0  0  0  0\n 23 20  1  0  0  0  0\n 13 11  1  0  0  0  0\n  5 10  1  0  0  0  0\n  1 24  1  6  0  0  0\n  2 25  1  1  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@]([H])([C@@H](CO)O)O[C@@]1([H])[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "20b19997-56e0-4b8e-8c3d-c0e4bcf49e22"
        ],
        "stereo_centers": 9
      },
      "unii": "3SY5LH9PMK"
    }
  ]
}