{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "149bc571-b6bf-417a-87d3-1254da6c777d", "code": "7023-61-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7023-61-2", "code_system": "CAS", "references": [ "6bf0008e-84fc-495c-b298-e1f92293c8d1", "768733fa-52aa-4c56-873c-8089268de2e2" ] }, { "uuid": "e731fcaf-4a14-4a71-92e0-69cd24c821d7", "code": "230-303-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.548", "code_system": "ECHA (EC/EINECS)", "references": [ "6bf0008e-84fc-495c-b298-e1f92293c8d1" ] }, { "uuid": "773a12fa-f4e5-4a91-80e3-2f31671ca1f2", "code": "3S62RPH1XY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "418a050f-1957-bcb1-d7f4-3bc9f5970992", "code": "DTXSID0027642", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0027642", "code_system": "EPA CompTox", "references": [ "f95ab17b-b8e9-4801-dfb5-34ff061033d7" ] } ], "substance_class": "chemical", "names": [ { "uuid": "5a7e138e-91f1-4f64-b246-f580176b421f", "name": "2-NAPHTHALENECARBOXYLIC ACID, 4-((5-CHLORO-4-METHYL-2-SULFOPHENYL)AZO)-3-HYDROXY-, CALCIUM SALT (1:1)", "stdName": "2-NAPHTHALENECARBOXYLIC ACID, 4-((5-CHLORO-4-METHYL-2-SULFOPHENYL)AZO)-3-HYDROXY-, CALCIUM SALT (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "1076c5b9-2c1c-4ead-b3a2-42d8f381629f", "name": "2-NAPHTHALENECARBOXYLIC ACID, 4-(2-(5-CHLORO-4-METHYL-2-SULFOPHENYL)DIAZENYL)-3-HYDROXY-, CALCIUM SALT (1:1)", "stdName": "2-NAPHTHALENECARBOXYLIC ACID, 4-(2-(5-CHLORO-4-METHYL-2-SULFOPHENYL)DIAZENYL)-3-HYDROXY-, CALCIUM SALT (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "4c6c8eb7-3ec6-441b-ac7e-1635d0908dc6", "name": "2-NAPHTHOIC ACID, 4-(5-CHLORO-2-SULFO-P-TOLYLAZO)-3-HYDROXY-, CALCIUM SALT", "stdName": "2-NAPHTHOIC ACID, 4-(5-CHLORO-2-SULFO-P-TOLYLAZO)-3-HYDROXY-, CALCIUM SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "88bd66d9-1b33-4183-8d7b-24d59b9c01f9", "name": "C.I. PIGMENT RED 48, CALCIUM SALT", "stdName": "C.I. PIGMENT RED 48, CALCIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4fad329b-5b36-4548-b06a-71ce9b1eee50" ], "display_name": false }, { "uuid": "c723480c-8b3d-42fc-9be9-7f2518d99904", "name": "C.I. PIGMENT RED 48, CALCIUM SALT (1:1)", "stdName": "C.I. PIGMENT RED 48, CALCIUM SALT (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "a69043d4-395d-4046-907e-eacf72248928", "name": "CALCIUM 2B RUBINE X 2430", "stdName": "CALCIUM 2B RUBINE X 2430", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "8e94f90e-fba3-4b4b-a806-75a513fd03b5", "name": "CALCIUM RED 2B", "stdName": "CALCIUM RED 2B", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "06e853ec-2fc2-43ba-aba5-5b9850d07519", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "79b60064-c0f1-4755-be03-5fec97591e5f", "name": "CI PIGMENT RED 48, CALCIUM SALT", "stdName": "CI PIGMENT RED 48, CALCIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9a9ee4c-51e4-4318-9be0-d58309a4a7fb", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "61c3d5cd-4aaf-487e-8906-b77f8fa7ec92", "name": "CI PIGMENT RED 48, CALCIUM SALT (1:1)", "stdName": "CI PIGMENT RED 48, CALCIUM SALT (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9a9ee4c-51e4-4318-9be0-d58309a4a7fb", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false }, { "uuid": "5048e0eb-1ca0-45c6-af70-18164c4c285e", "name": "PIGMENT RED 48 CALCIUM", "stdName": "PIGMENT RED 48 CALCIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9a9ee4c-51e4-4318-9be0-d58309a4a7fb", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": true }, { "uuid": "2bba25cf-f241-4fa3-b17d-411862ea5242", "name": "PIGMENT RED 48, CALCIUM SALT", "stdName": "PIGMENT RED 48, CALCIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9a9ee4c-51e4-4318-9be0-d58309a4a7fb", "75236efb-dd9a-49d1-ab72-a4195a4c66ae" ], "display_name": false } ], "references": [ { "uuid": "4fad329b-5b36-4548-b06a-71ce9b1eee50", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e9a9ee4c-51e4-4318-9be0-d58309a4a7fb", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75236efb-dd9a-49d1-ab72-a4195a4c66ae", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "06e853ec-2fc2-43ba-aba5-5b9850d07519", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6bf0008e-84fc-495c-b298-e1f92293c8d1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391005000, "tags": [ "NOMEN" ] }, { "uuid": "3c532c2a-05c1-4cdd-8e5e-1a2c08b9ea25", "citation": "SRS import [3S62RPH1XY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3S62RPH1XY", "doc_type": "SRS", "public_domain": true, "document_date": 1493391005000, "tags": [ "NOMEN" ] }, { "uuid": "7ebdfa17-88dd-49ed-a6fd-59b3612b455e", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "768733fa-52aa-4c56-873c-8089268de2e2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f95ab17b-b8e9-4801-dfb5-34ff061033d7", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9c4207fe-9a32-4ea3-8e5b-e5c3103b83c5", "id": "9c4207fe-9a32-4ea3-8e5b-e5c3103b83c5", "molfile": "\n Marvin 01132108072D \n\n 1 0 0 0 0 0 999 V2000\n 4.3150 -10.2381 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Ca+2]", "formula": "Ca", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "91c73552-64ee-4674-91b4-f41f18b84cc3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "40.078", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "4cf41729-323c-4833-a78b-2b1742a6b53e", "id": "4cf41729-323c-4833-a78b-2b1742a6b53e", "molfile": "\n Marvin 01132104012D \n\n 28 30 0 0 0 0 999 V2000\n 8.2313 -7.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -8.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -8.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -9.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -9.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -8.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8029 -8.3889 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -11.2712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8192 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -12.0966 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.8192 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -13.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9604 -13.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -13.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -12.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9542 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -13.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3858 -13.3307 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.1035 -14.5632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6640 -10.0245 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3812 -10.4369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2568 -10.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0758 -9.3072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 25 1 0 0 0 0\n 5 6 2 0 0 0 0\n 9 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 21 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 22 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 2 0 0 0 0\nM CHG 2 13 -1 23 -1\nM END", "smiles": "Cc1cc(c(cc1Cl)/N=N/c2c3ccccc3cc(c2[O-])C(=O)[O-])S(=O)(=O)O", "formula": "C18H11ClN2O6S", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "66f1e8c1-2a4b-47ce-a024-453cf3d7cc7c" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "418.8095", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "8f1e6d4b-c513-4fa8-b463-c38859f757c9", "version": "3", "structure": { "id": "949aa573-dc45-4daf-9ec4-a21f5e40734f", "molfile": "\n Marvin 01132107432D \n\n 29 30 0 0 0 0 999 V2000\n 8.2460 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -11.2712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -9.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -8.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8029 -8.3889 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -8.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -7.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -8.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -9.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6640 -10.0245 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2568 -10.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0758 -9.3072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3812 -10.4369 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.8192 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -12.0966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8192 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -13.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3858 -13.3307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -14.5632 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.5265 -13.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9604 -13.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -13.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -12.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9542 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3150 -10.2381 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 5 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 13 16 1 0 0 0 0\n 2 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 1 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 1 1 0 0 0 0\nM CHG 3 16 -1 22 -1 29 2\nM END", "smiles": "Cc1cc(c(cc1Cl)/N=N/c2c3ccccc3cc(c2O)C(=O)[O-])S(=O)(=O)[O-].[Ca+2]", "formula": "C18H11ClN2O6S.Ca", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "458.8875", "optical_activity": "NONE", "references": [ "7ebdfa17-88dd-49ed-a6fd-59b3612b455e", "3c532c2a-05c1-4cdd-8e5e-1a2c08b9ea25" ], "stereo_centers": 0 }, "unii": "3S62RPH1XY" } ] }