{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c3bd16ea-b3d4-4809-91fa-e0fe05ea641f",
          "code": "1117-52-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1117-52-8",
          "code_system": "CAS",
          "references": [
            "a49eb4d0-bf09-43b9-9b5f-13524854b333",
            "ebbfb507-ac9e-419b-aaca-9c65daa31e3a"
          ]
        },
        {
          "uuid": "48d34a1c-d110-4919-a5d0-8a3a460949eb",
          "code": "214-246-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.952",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a49eb4d0-bf09-43b9-9b5f-13524854b333"
          ]
        },
        {
          "uuid": "8c1da8af-cd5a-42c3-9eac-6fa37093f6ce",
          "code": "1711945",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1711945",
          "code_system": "PUBCHEM",
          "references": [
            "a49eb4d0-bf09-43b9-9b5f-13524854b333"
          ]
        },
        {
          "uuid": "0a53c6eb-8339-45eb-a0df-3b92d8931ae9",
          "code": "3S0G4N267H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "adebfc9d-2379-ee88-da1d-a8dcef0703ed",
          "code": "67252",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:67252",
          "code_system": "CHEBI",
          "references": [
            "b30eb9da-cb56-19eb-a9d6-be6d5d926e1e"
          ]
        },
        {
          "uuid": "e5843270-9de1-a410-5ba4-be04610f0646",
          "code": "DTXSID50883648",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50883648",
          "code_system": "EPA CompTox",
          "references": [
            "b30eb9da-cb56-19eb-a9d6-be6d5d926e1e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c078a9bf-50a8-4416-91f7-c667cf6fec5b",
          "name": "(5E,9E)-6,10,14-TRIMETHYL-5,9,13-PENTADECATRIEN-2-ONE",
          "stdName": "(5E,9E)-6,10,14-TRIMETHYL-5,9,13-PENTADECATRIEN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614398d6-82cb-43b6-8b58-b8abcf345620",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        },
        {
          "uuid": "8a66ad96-5743-48b4-87d1-c804b7f8e581",
          "name": "(E,E)-6,10,14-TRIMETHYL-5,9,13-PENTADECATRIEN-2-ONE",
          "stdName": "(E,E)-6,10,14-TRIMETHYL-5,9,13-PENTADECATRIEN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614398d6-82cb-43b6-8b58-b8abcf345620",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        },
        {
          "uuid": "512df360-db44-43aa-ad63-5a266b4d84ff",
          "name": "5,9,13-PENTADECATRIEN-2-ONE, 6,10,14-TRIMETHYL-, (5E,9E)-",
          "stdName": "5,9,13-PENTADECATRIEN-2-ONE, 6,10,14-TRIMETHYL-, (5E,9E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614398d6-82cb-43b6-8b58-b8abcf345620",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        },
        {
          "uuid": "82d2b35b-54fb-41c8-b225-c677fb6478de",
          "name": "E,E-FARNESYLACETONE",
          "stdName": "E,E-FARNESYLACETONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614398d6-82cb-43b6-8b58-b8abcf345620",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        },
        {
          "uuid": "21ab37e5-91c5-44a3-b915-3e90d511cf46",
          "name": "FARNESYL ACETONE, (5E,9E)-",
          "stdName": "FARNESYL ACETONE, (5E,9E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dced7984-02b6-454f-b89b-b5e7cf8d6c87",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": true
        },
        {
          "uuid": "bd40a7c5-fa6b-4e38-b473-75010da05c23",
          "name": "FEMA NO. 3442, (5E,9E)-",
          "stdName": "FEMA NO. 3442, (5E,9E)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dced7984-02b6-454f-b89b-b5e7cf8d6c87",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        },
        {
          "uuid": "91618e18-b059-4b56-98c8-dad6d29b82d2",
          "name": "TRANS,TRANS-FARNESYLACETONE",
          "stdName": "TRANS,TRANS-FARNESYLACETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "614398d6-82cb-43b6-8b58-b8abcf345620",
            "21b43b30-e259-4d3f-b044-7ba7600ac680"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "21b43b30-e259-4d3f-b044-7ba7600ac680",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "614398d6-82cb-43b6-8b58-b8abcf345620",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a49eb4d0-bf09-43b9-9b5f-13524854b333",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cc44aae-3d70-4284-9ed6-1c6f19255589",
          "citation": "SRS import [3S0G4N267H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3S0G4N267H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7b3ec8a-4680-429e-8e8d-029aaf2d7df9",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dced7984-02b6-454f-b89b-b5e7cf8d6c87",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b30eb9da-cb56-19eb-a9d6-be6d5d926e1e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ebbfb507-ac9e-419b-aaca-9c65daa31e3a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e73f1e75-a8fb-487f-abf6-dbefb765d189",
          "id": "e73f1e75-a8fb-487f-abf6-dbefb765d189",
          "molfile": "\n  Marvin  01132111582D          \n\n 19 18  0  0  0  0            999 V2000\n    9.9142   -9.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1997   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -9.6723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1997   -8.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -8.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -7.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7670   -6.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -7.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7670   -5.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -5.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3380   -4.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6197   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3380   -3.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6235   -3.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6235   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9052   -1.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9052   -1.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1908   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CCC(=O)C)/C)/C)C",
          "formula": "C18H30O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "06c5446e-d546-4f45-87b9-acc815e214ec"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "262.4309",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "19ff29f7-7c11-4f2e-b700-be758c0185a2",
      "version": "4",
      "structure": {
        "id": "164ae4c0-f866-4124-a96e-33cfa2c9fc10",
        "molfile": "\n  Marvin  01132101212D          \n\n 19 18  0  0  0  0            999 V2000\n    6.3380   -4.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -5.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7670   -5.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7670   -6.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -7.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -8.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1997   -8.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1997   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9142   -9.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4815   -9.6723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0525   -7.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3380   -3.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6235   -3.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6235   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9052   -1.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9052   -1.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1908   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6197   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  5 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n  1 19  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CCC(=O)C)/C)/C)C",
        "formula": "C18H30O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "262.4309",
        "optical_activity": "NONE",
        "references": [
          "6cc44aae-3d70-4284-9ed6-1c6f19255589",
          "a7b3ec8a-4680-429e-8e8d-029aaf2d7df9"
        ],
        "stereo_centers": 0
      },
      "unii": "3S0G4N267H"
    }
  ]
}