{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7464d97c-7bd9-4e99-9f7e-6bc1db6e3463", "code": "65322-65-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=65322-65-8", "code_system": "CAS", "references": [ "1af16d09-749e-4a4e-8529-10d73e9e8281", "51c9affa-594a-44c8-b048-2f9103a22fd7" ] }, { "uuid": "073c0801-3e2e-4380-aaff-96ba3024e603", "code": "103359", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/103359", "code_system": "PUBCHEM", "references": [ "1af16d09-749e-4a4e-8529-10d73e9e8281" ] }, { "uuid": "ed25ad46-79c9-44c3-8fca-44e6594e32f9", "code": "3RH99FJ7RP", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "33be0e21-6436-817e-b1e3-64bee81d4b1c", "code": "DTXSID6049434", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6049434", "code_system": "EPA CompTox", "references": [ "b1f972cb-987d-477d-e154-a3b785760eb1" ] } ], "relationships": [ { "uuid": "af60d609-a8d9-40c1-8f8f-f645ff4a960e", "amount": { "uuid": "5a948d90-059f-44d8-b2ce-c4bd6948b557" }, "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "d3726615-13d5-4515-a5f0-e818058e3888", "refuuid": "e24374c2-902e-47d1-970e-62f40ec74de0", "name": "1-(1-Naphthalenylmethyl)quinolinium", "unii": "UZE4WE3PER", "linking_id": "UZE4WE3PER", "ref_pname": "1-(1-Naphthalenylmethyl)quinolinium", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "fde576f0-024a-4477-a1d2-e7f500b91ced", "name": "1-(1-Naphthylmethyl)quinolinium chloride", "stdName": "1-(1-NAPHTHYLMETHYL)QUINOLINIUM CHLORIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "653fe9b7-6dfd-476d-ade4-3560c6ac7694" ], "display_name": true }, { "uuid": "6629363b-28da-4c31-9633-388c5a1fabd5", "name": "Quinolinium, 1-(1-naphthalenylmethyl)-, chloride (1:1)", "stdName": "QUINOLINIUM, 1-(1-NAPHTHALENYLMETHYL)-, CHLORIDE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "51c9affa-594a-44c8-b048-2f9103a22fd7" ], "display_name": false } ], "references": [ { "uuid": "653fe9b7-6dfd-476d-ade4-3560c6ac7694", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1af16d09-749e-4a4e-8529-10d73e9e8281", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392076000, "tags": [ "NOMEN" ] }, { "uuid": "b1f972cb-987d-477d-e154-a3b785760eb1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65322-65-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "51c9affa-594a-44c8-b048-2f9103a22fd7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b789e402-8aad-4612-af61-ed9c2a025c01", "id": "b789e402-8aad-4612-af61-ed9c2a025c01", "molfile": "\n Marvin 01132109302D \n\n 1 0 0 0 0 0 999 V2000\n 3.1554 -2.6090 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f9818c05-9f3c-46ce-9334-050384d0b5ad" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "da510659-f79d-48c9-ad77-d47531ba9371", "id": "da510659-f79d-48c9-ad77-d47531ba9371", "molfile": "\n Marvin 01132111192D \n\n 21 24 0 0 0 0 999 V2000\n 2.1429 -2.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4143 -2.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6857 -2.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -1.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -0.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4465 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -0.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -1.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4143 -1.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -3.6965 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 1.3822 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3822 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8555 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5251 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2537 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2537 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5251 -3.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8555 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 12 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 11 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 11 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 21 2 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\nM CHG 1 12 1\nM END", "smiles": "c1ccc2c(c1)cccc2C[n+]3cccc4ccccc43", "formula": "C20H16N", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8199233c-1027-417e-b052-f72fa80d8ae5" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "270.3485", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d65ca38b-b98e-41e6-a0fb-7649d25bd488", "version": "7", "structure": { "id": "8e8698b4-07be-403a-b6f1-027101c74a5c", "molfile": "\n Marvin 01132107242D \n\n 22 24 0 0 0 0 999 V2000\n 2.1429 -3.6965 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 2.8555 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8555 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3822 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5251 -3.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5251 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -5.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3822 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2537 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2537 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -2.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4143 -1.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -1.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -1.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -0.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4143 -2.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6857 -2.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4465 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1429 -0.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1554 -2.6090 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 4 1 0 0 0 0\n 1 11 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 7 2 0 0 0 0\n 4 8 2 0 0 0 0\n 5 10 2 0 0 0 0\n 6 9 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 17 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 14 21 2 0 0 0 0\n 15 20 2 0 0 0 0\n 16 19 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\nM CHG 2 1 1 22 -1\nM END", "smiles": "c1ccc2c(c1)cccc2C[n+]3cccc4ccccc43.[Cl-]", "formula": "C20H16N.Cl", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "305.8014", "optical_activity": "NONE", "references": [ "653fe9b7-6dfd-476d-ade4-3560c6ac7694" ], "stereo_centers": 0 }, "unii": "3RH99FJ7RP" } ] }