{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "051c23c7-b9e0-4f9b-95dd-0d254283cf70",
          "code": "3072",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3072",
          "code_system": "INN",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "49ada7f8-8472-4d8c-a44d-358a65102d50",
          "code": "m618",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m618?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "63f0a733-898b-4c4c-ad72-db03c67f2683",
          "code": "CHEMBL1418182",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1418182",
          "code_system": "ChEMBL",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "e24eb554-e037-4b69-8279-f71f18ddadd5",
          "code": "244-387-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.337",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "5b4b3218-12aa-4d05-bef3-827e46a25041",
          "code": "30627",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/30627",
          "code_system": "PUBCHEM",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "44ce7290-76b9-4c5e-8223-b3322fb839b9",
          "code": "21434-91-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21434-91-3",
          "code_system": "CAS",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77",
            "16f15457-e500-470d-a029-06f54785eb00"
          ]
        },
        {
          "uuid": "36022f3d-b3bd-4147-ab95-eb5bdc5547a5",
          "code": "C80873",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80873",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "f3bac265-3046-41d6-88f0-24fb9af2ed3a",
          "code": "SUB06077MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f48c0d09-9200-4851-b49e-b85a3d21bb77"
          ]
        },
        {
          "uuid": "5efd49e8-9d80-fee7-ecc6-98fdec08b431",
          "code": "DTXSID3045695",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045695",
          "code_system": "EPA CompTox",
          "references": [
            "7d133673-6033-fb59-3a4a-2538433f02ac"
          ]
        },
        {
          "uuid": "c94ac1f7-ae70-984a-2210-00c53d920e13",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "90999d79-4096-e0f2-37eb-39a02f4c4ba0"
          ]
        },
        {
          "uuid": "c505f0f8-71ce-43e6-b4ee-6663ae0ee704",
          "code": "3R77T835TA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ade5bb8-d5c2-c4b7-9020-a5110267ffc2",
          "code": "481",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/481",
          "code_system": "DRUG CENTRAL",
          "references": [
            "90999d79-4096-e0f2-37eb-39a02f4c4ba0"
          ]
        },
        {
          "uuid": "7c536767-6231-2aa5-9797-a4a7f350886c",
          "code": "100000081604",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2d757ce8-c723-fb8c-f38f-7054f27f3fce"
          ]
        },
        {
          "uuid": "97055dcc-12d9-0943-9c95-68cc95a31d7a",
          "code": "759126",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759126",
          "code_system": "NSC",
          "references": [
            "ea0d200d-69a5-e5e6-1125-15bb30978947"
          ]
        },
        {
          "uuid": "d754e24b-fb04-260f-d627-ce33a3f2ed16",
          "code": "230936",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=230936",
          "code_system": "NSC",
          "references": [
            "ea0d200d-69a5-e5e6-1125-15bb30978947"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6484e21a-f5ee-45a1-80b0-07d0c297f7a8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0760394f-060e-4907-8802-6d87126a5096",
            "refuuid": "3673a66f-73f0-4f7e-a086-9b48908c17ba",
            "name": "CAPOBENIC ACID",
            "unii": "3R77T835TA",
            "linking_id": "3R77T835TA",
            "ref_pname": "CAPOBENIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e2acf28d-8300-4020-8661-49711dbeff70",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9d882400-236e-4557-bca5-5d6446dfe7ae",
            "refuuid": "b8f0cc07-40bc-4b27-9c29-1d0d85877ac4",
            "name": "CAPOBENATE SODIUM",
            "unii": "505434F98H",
            "linking_id": "505434F98H",
            "ref_pname": "CAPOBENATE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "04dc0610-2339-4f0d-b286-7a3251003575",
          "name": "6-(3,4,5-TRIMETHOXYBENZAMIDO)HEXANOIC ACID",
          "stdName": "6-(3,4,5-TRIMETHOXYBENZAMIDO)HEXANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f58c252-befb-459c-9610-5bcda18a8627"
          ],
          "display_name": false
        },
        {
          "uuid": "d73c80a6-ca5c-4cdb-8c24-e1a4fd78bac0",
          "name": "C-3",
          "stdName": "C-3",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a95d7f1-8089-478c-833c-dfca341734ab"
          ],
          "display_name": false
        },
        {
          "uuid": "4789d071-4545-4fbe-b0a7-071452e25abf",
          "name": "CAPOBENIC ACID",
          "stdName": "CAPOBENIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f58c252-befb-459c-9610-5bcda18a8627",
            "f9fd0838-0fb0-4dda-b5d9-c32eba51ba2d",
            "3726da35-08ca-40c0-a93f-c6079366e58d",
            "7c42cb97-5135-41a2-b70a-12a2fa08d942",
            "558332cd-817b-40a6-b3e7-09886be7be58",
            "c683a32b-758b-4f46-a148-04da5a313f35",
            "03bb9b23-db34-4e15-b2e8-82ecaf3b5f8b",
            "268f0c1a-cc23-45bf-97dc-59113f1b9ce0",
            "73b0e66f-d182-411c-b97d-c2232dfcf1a4"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c7889a75-9bf6-4bf0-960c-856800444c45",
              "name_org": "INN"
            },
            {
              "uuid": "ff0030e9-36eb-48a3-80ca-069577c8a9da",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "1c32f454-e24a-47cd-b216-01ee685d2a03",
          "name": "CAPOBENIC ACID [MART.]",
          "stdName": "CAPOBENIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9fd0838-0fb0-4dda-b5d9-c32eba51ba2d"
          ],
          "display_name": false
        },
        {
          "uuid": "642a11a9-7387-4115-af95-84def10c3a06",
          "name": "CAPOBENIC ACID [MI]",
          "stdName": "CAPOBENIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "268f0c1a-cc23-45bf-97dc-59113f1b9ce0"
          ],
          "display_name": false
        },
        {
          "uuid": "9ae0e2b2-cfd5-41cf-b477-fee9f6042be9",
          "name": "CAPOBENIC ACID [USAN]",
          "stdName": "CAPOBENIC ACID [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "558332cd-817b-40a6-b3e7-09886be7be58"
          ],
          "display_name": false
        },
        {
          "uuid": "d412e495-8bf9-4205-80a9-d88ab8d1c696",
          "name": "HEXANOIC ACID, 6-((3,4,5-TRIMETHOXYBENZOYL)AMINO)-",
          "stdName": "HEXANOIC ACID, 6-((3,4,5-TRIMETHOXYBENZOYL)AMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f58c252-befb-459c-9610-5bcda18a8627"
          ],
          "display_name": false
        },
        {
          "uuid": "ae0c964c-1bbb-857a-4f7f-be17456b4282",
          "name": "NSC-230936",
          "stdName": "NSC-230936",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea0d200d-69a5-e5e6-1125-15bb30978947"
          ],
          "display_name": false
        },
        {
          "uuid": "36138250-f621-3526-537d-0c751d861346",
          "name": "NSC-759126",
          "stdName": "NSC-759126",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea0d200d-69a5-e5e6-1125-15bb30978947"
          ],
          "display_name": false
        },
        {
          "uuid": "f85c0e33-7eb3-41d8-91e5-a33e9ade35b0",
          "name": "capobenic acid [INN]",
          "stdName": "CAPOBENIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c683a32b-758b-4f46-a148-04da5a313f35"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0f58c252-befb-459c-9610-5bcda18a8627",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c683a32b-758b-4f46-a148-04da5a313f35",
          "citation": "INN Proposed List 25",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL25.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "558332cd-817b-40a6-b3e7-09886be7be58",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9fd0838-0fb0-4dda-b5d9-c32eba51ba2d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "268f0c1a-cc23-45bf-97dc-59113f1b9ce0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a95d7f1-8089-478c-833c-dfca341734ab",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f48c0d09-9200-4851-b49e-b85a3d21bb77",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389674000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d1490d5-9a8e-4513-9c24-bb0fa7287b6d",
          "citation": "SRS import [3R77T835TA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3R77T835TA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389674000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3726da35-08ca-40c0-a93f-c6079366e58d",
          "citation": "CAPOBENIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c42cb97-5135-41a2-b70a-12a2fa08d942",
          "citation": "CAPOBENIC ACID [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03bb9b23-db34-4e15-b2e8-82ecaf3b5f8b",
          "citation": "CAPOBENIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "73b0e66f-d182-411c-b97d-c2232dfcf1a4",
          "citation": "CAPOBENIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d133673-6033-fb59-3a4a-2538433f02ac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=21434-91-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d757ce8-c723-fb8c-f38f-7054f27f3fce",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "90999d79-4096-e0f2-37eb-39a02f4c4ba0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "16f15457-e500-470d-a029-06f54785eb00",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea0d200d-69a5-e5e6-1125-15bb30978947",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fb6daf56-8c49-463e-b694-dac342936fca",
          "id": "fb6daf56-8c49-463e-b694-dac342936fca",
          "molfile": "\n  Marvin  01132113012D          \n\n 23 23  0  0  0  0            999 V2000\n    8.5907   -3.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5907   -2.8860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8769   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -2.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8769   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5829   -1.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5829   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7202   -2.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7202   -3.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -2.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3057   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5713   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4223   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -1.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 10  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n 13  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 10  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\nM  END",
          "smiles": "COc1cc(cc(c1OC)OC)C(=O)NCCCCCC(=O)O",
          "formula": "C16H23NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c56a7fb7-c574-4f98-b7a6-2905eb916a6f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "325.3575",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3673a66f-73f0-4f7e-a086-9b48908c17ba",
      "version": "11",
      "structure": {
        "id": "f6999924-cc0a-4455-9e10-2e086172a440",
        "molfile": "\n  Marvin  01132112472D          \n\n 23 23  0  0  0  0            999 V2000\n    7.8769   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8769   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7202   -2.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -2.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7202   -3.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -2.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5829   -1.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5907   -2.8860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -1.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4223   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3057   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5829   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5907   -3.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4339    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5713   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8 16  1  0  0  0  0\n  9  5  2  0  0  0  0\n 10  8  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 22  1  0  0  0  0\n  6  2  2  0  0  0  0\nM  END",
        "smiles": "COc1cc(cc(c1OC)OC)C(=O)NCCCCCC(=O)O",
        "formula": "C16H23NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "325.3575",
        "optical_activity": "NONE",
        "references": [
          "0f58c252-befb-459c-9610-5bcda18a8627",
          "9d1490d5-9a8e-4513-9c24-bb0fa7287b6d",
          "c683a32b-758b-4f46-a148-04da5a313f35"
        ],
        "stereo_centers": 0
      },
      "unii": "3R77T835TA"
    }
  ]
}