{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fd93067b-d9e5-42f0-9b93-c108c8982342",
          "code": "1120360-11-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1120360-11-3",
          "code_system": "CAS",
          "references": [
            "46df4c2e-b585-4f8b-8805-e6aafdf878c3",
            "248a25e0-4afa-4fc2-8412-a16234d80f2f"
          ]
        },
        {
          "uuid": "a3555c88-941c-4f29-a906-bc28b8cba2bc",
          "code": "67267795",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67267795",
          "code_system": "PUBCHEM",
          "references": [
            "46df4c2e-b585-4f8b-8805-e6aafdf878c3"
          ]
        },
        {
          "uuid": "fa4e7819-28e1-4051-b30c-4ccc2dbf78c4",
          "code": "3R1Q5X5GGO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "139425d6-5cf4-2c30-5911-01598bb2ced3",
          "code": "DTXSID70149839",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70149839",
          "code_system": "EPA CompTox",
          "references": [
            "fb79323e-a4d1-41f2-b965-31ea0bb63289"
          ]
        },
        {
          "uuid": "d3438b45-48f6-2fb5-9866-8610e95ae9fc",
          "code": "3R1Q5X5GGO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(3R1Q5X5GGO)",
          "code_system": "DAILYMED",
          "references": [
            "8c313ec6-051f-9a93-096c-e23edfbf813c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bbdc0358-73de-4a15-be05-427ea1047181",
          "name": "3-GLYCERYL ASCORBATE",
          "stdName": "3-GLYCERYL ASCORBATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97768f65-4e21-4a08-8b51-06f5eafeb693",
            "d0de5763-ac95-49dd-a62c-635b884ded52",
            "6cb1a5a5-a640-4c11-aace-9f74f4d9c7ee"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "14fa3495-08ae-4e34-9fce-73a16eace401",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0a1e1534-a877-4dae-9267-5d1ae12bb6d2",
          "name": "AMITOSE 3GA",
          "stdName": "AMITOSE 3GA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97768f65-4e21-4a08-8b51-06f5eafeb693",
            "6cb1a5a5-a640-4c11-aace-9f74f4d9c7ee"
          ],
          "display_name": false
        },
        {
          "uuid": "17e1b2ee-4629-4a6b-8902-1a3a9f3992f5",
          "name": "L-ASCORBIC ACID, 3-O-(2,3-DIHYDROXYPROPYL)-",
          "stdName": "L-ASCORBIC ACID, 3-O-(2,3-DIHYDROXYPROPYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ae54b35-4741-4374-b719-9dfaa1b1bb42",
            "6cb1a5a5-a640-4c11-aace-9f74f4d9c7ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "97768f65-4e21-4a08-8b51-06f5eafeb693",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6cb1a5a5-a640-4c11-aace-9f74f4d9c7ee",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ae54b35-4741-4374-b719-9dfaa1b1bb42",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46df4c2e-b585-4f8b-8805-e6aafdf878c3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391407000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adaaa41a-5533-436a-b4f6-8b9a98f6d1ae",
          "citation": "SRS import [3R1Q5X5GGO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3R1Q5X5GGO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391407000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0de5763-ac95-49dd-a62c-635b884ded52",
          "citation": "3-GLYCERYL ASCORBATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfc7b822-283e-8b30-8a31-b6a28eb9a745",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1120360-11-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb79323e-a4d1-41f2-b965-31ea0bb63289",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "248a25e0-4afa-4fc2-8412-a16234d80f2f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8c313ec6-051f-9a93-096c-e23edfbf813c",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b75a14c2-be98-448c-8a8e-277af579dcc8",
          "id": "b75a14c2-be98-448c-8a8e-277af579dcc8",
          "molfile": "\n  Marvin  01132109292D          \n\n 17 17  0  0  1  0            999 V2000\n    7.8439   -8.0877    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8439   -7.2681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5671   -8.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5671   -9.3172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1207   -8.4976    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3575   -8.1644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8002   -8.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9704   -8.6880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2175   -9.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8782  -10.2298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0365   -9.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6540   -9.8592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4824  -10.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0998  -11.2060    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.9281  -12.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8934  -10.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0650  -10.1540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "C(C(COC1=C(C(=O)O[C@@H]1[C@H](CO)O)O)O)O",
          "formula": "C9H14O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4a133e77-e537-42e9-a783-1c18919c1f67"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "250.203",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4e3f7aa9-834b-4ee1-829f-4b5c806e8de6",
      "version": "7",
      "structure": {
        "id": "9b9ec305-3108-43cc-bc54-025b8ec72280",
        "molfile": "\n  Marvin  01132108052D          \n\n 18 18  0  0  1  0            999 V2000\n    5.8022   -8.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2199   -9.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0389   -9.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1231   -8.5008    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3599   -8.1672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8467   -8.0905    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5703   -8.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5703   -9.3204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8467   -7.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6241   -8.8667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6568   -9.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4852  -10.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1026  -11.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8966  -10.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0682  -10.1576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9309  -12.0145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8802  -10.2334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9724   -8.6912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  1  0  0  0\n  4 10  1  1  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n  1 18  2  0  0  0  0\nM  END",
        "smiles": "C(C(COC1=C(C(=O)O[C@]1([H])[C@H](CO)O)O)O)O",
        "formula": "C9H14O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "250.203",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "97768f65-4e21-4a08-8b51-06f5eafeb693",
          "adaaa41a-5533-436a-b4f6-8b9a98f6d1ae"
        ],
        "stereo_centers": 3
      },
      "unii": "3R1Q5X5GGO"
    }
  ]
}