{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "46e97003-9b32-436e-9a96-c43ee460f978",
          "code": "5197-58-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5197-58-0",
          "code_system": "CAS",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057",
            "784585a9-d82b-42ba-b8e6-7ca1a77a8be6"
          ]
        },
        {
          "uuid": "5913795d-dabc-4882-9ebc-3658abc15a81",
          "code": "C069085",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67069085",
          "code_system": "MESH",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "02becb91-499f-4793-b380-c7d4666af5e2",
          "code": "STENBOLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Stenbolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "3ea65e8e-2246-46fd-aec9-500707d4eefa",
          "code": "SUB10644MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "b57060e1-31ba-4df2-a487-05a3da97e45c",
          "code": "2294",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2294",
          "code_system": "INN",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "354ee52f-a676-4c17-9beb-095981da663f",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "b10160b1-7dd9-4c7a-8fb1-42ac971a5975",
          "code": "m10205",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10205?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "a1936127-8799-49aa-b77e-5c5751e09ede",
          "code": "CHEMBL2107251",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107251",
          "code_system": "ChEMBL",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "d6ad6233-54ee-4ee6-90cc-b4247787c29f",
          "code": "234454",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/234454",
          "code_system": "PUBCHEM",
          "references": [
            "33570f95-bfd8-4b08-8667-eff211cd3057"
          ]
        },
        {
          "uuid": "99e2821e-71ef-76e0-e0c9-7e7d27eb634f",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "93fc7721-0699-8f82-1a1f-c3b3275877ec"
          ]
        },
        {
          "uuid": "bf5751a6-1112-01c8-f411-397eca20e532",
          "code": "C152427",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152427",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0a94b438-a398-58e6-f971-9d3670288962"
          ]
        },
        {
          "uuid": "8b75819f-a965-4c8d-82b1-3a0173f5e153",
          "code": "3Q6FKA848S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "eacef644-b5f1-b698-609f-a98445052ac3",
          "code": "DTXSID70199935",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70199935",
          "code_system": "EPA CompTox",
          "references": [
            "19eb0b85-783a-20ef-dc61-3a419c58bfe9"
          ]
        },
        {
          "uuid": "054eb65b-5a5a-6317-1c3a-14b82d45abe6",
          "code": "65890",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=65890",
          "code_system": "NSC",
          "references": [
            "76c51971-936f-f92a-013a-74121c98257c"
          ]
        },
        {
          "uuid": "5c6cca17-54dc-cae7-8ebc-f27a33b4f246",
          "code": "100000083854",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f7dffd87-6b73-f586-0c14-b7f1e206da4d"
          ]
        },
        {
          "uuid": "9dfecfd8-d8a3-8e79-6ad1-bd8c014e857f",
          "code": "34418",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=34418",
          "code_system": "NSC",
          "references": [
            "76c51971-936f-f92a-013a-74121c98257c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "19ac8262-4948-4740-9ce8-fca0f2b5b517",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "da5be2ab-7b10-4e1c-82ea-0494d8309355",
            "refuuid": "39871ee8-ba1c-4789-b0cc-3544c5debdfe",
            "name": "STENBOLONE",
            "unii": "3Q6FKA848S",
            "linking_id": "3Q6FKA848S",
            "ref_pname": "STENBOLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "86c2f654-4be2-43e1-ba6c-7a766dc49433",
          "name": "17.BETA.-HYDROXY-2-METHYL-5.ALPHA.-ANDROST-1-EN-3-ONE",
          "stdName": "17.BETA.-HYDROXY-2-METHYL-5.ALPHA.-ANDROST-1-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b1f8ea-07f0-4b8c-947b-eb66c5d1733c",
            "caf46158-096f-4859-be0b-ab063982edf4"
          ],
          "display_name": false
        },
        {
          "uuid": "288ae531-ffd2-f42c-9762-b003e9954079",
          "name": "NSC-34418",
          "stdName": "NSC-34418",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76c51971-936f-f92a-013a-74121c98257c"
          ],
          "display_name": false
        },
        {
          "uuid": "559d864d-1616-62e2-81b2-657e7806cfde",
          "name": "NSC-65890",
          "stdName": "NSC-65890",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76c51971-936f-f92a-013a-74121c98257c"
          ],
          "display_name": false
        },
        {
          "uuid": "27b623b0-6f22-4894-93a3-2076dc6a5991",
          "name": "STENBOLONE",
          "stdName": "STENBOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2329f1ce-1e11-4d40-a96e-1bfb7b2b6113",
            "efe33524-b3f6-439a-971e-31c80c4fb86a",
            "caf46158-096f-4859-be0b-ab063982edf4",
            "4cd86442-1eae-4ddb-a174-18954faa57cf",
            "e6239dbd-5d86-4bc7-a163-05220c6191bd",
            "128dceff-14c7-4eb8-ac88-e5bf1d97bf49",
            "717ef14d-6d21-4b0f-85e8-97d1d7d6ad0b",
            "1cd43d80-2f5a-44b8-b2f8-00890cea2824"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fdec9ff7-4cd1-4a17-a240-ef68199fa45c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ae7fbcef-e16e-421a-b9c2-18bb264f0b02",
          "name": "STENBOLONE [MART.]",
          "stdName": "STENBOLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6239dbd-5d86-4bc7-a163-05220c6191bd"
          ],
          "display_name": false
        },
        {
          "uuid": "6f6f0f9e-0b93-4cfc-b140-14d5c26f8a1f",
          "name": "STENBOLONE [MI]",
          "stdName": "STENBOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caf46158-096f-4859-be0b-ab063982edf4",
            "717ef14d-6d21-4b0f-85e8-97d1d7d6ad0b"
          ],
          "display_name": false
        },
        {
          "uuid": "be649c41-5da1-47a5-bf88-06832c502fce",
          "name": "stenbolone [INN]",
          "stdName": "STENBOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cd43d80-2f5a-44b8-b2f8-00890cea2824",
            "4545f688-b243-41da-b914-842a9c902500"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "679442d9-22aa-40a1-956b-1c57534cc0cd",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efe33524-b3f6-439a-971e-31c80c4fb86a",
          "citation": "STENBOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "128dceff-14c7-4eb8-ac88-e5bf1d97bf49",
          "citation": "STENBOLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4cd86442-1eae-4ddb-a174-18954faa57cf",
          "citation": "STENBOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2329f1ce-1e11-4d40-a96e-1bfb7b2b6113",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "caf46158-096f-4859-be0b-ab063982edf4",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6b1f8ea-07f0-4b8c-947b-eb66c5d1733c",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cd43d80-2f5a-44b8-b2f8-00890cea2824",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6239dbd-5d86-4bc7-a163-05220c6191bd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "717ef14d-6d21-4b0f-85e8-97d1d7d6ad0b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33570f95-bfd8-4b08-8667-eff211cd3057",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390874000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a592d3b-0c5a-4800-bf10-6edc72205963",
          "citation": "SRS import [3Q6FKA848S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3Q6FKA848S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390874000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62380020-5815-cca8-2f5e-650c3cc09b32",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5197-58-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f7dffd87-6b73-f586-0c14-b7f1e206da4d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "0a94b438-a398-58e6-f971-9d3670288962",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "93fc7721-0699-8f82-1a1f-c3b3275877ec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4545f688-b243-41da-b914-842a9c902500",
          "citation": "INN Proposed List 17",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL17.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "784585a9-d82b-42ba-b8e6-7ca1a77a8be6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "76c51971-936f-f92a-013a-74121c98257c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "19eb0b85-783a-20ef-dc61-3a419c58bfe9",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0afdc181-78a1-4fc4-a14f-918dfde6515d",
          "id": "0afdc181-78a1-4fc4-a14f-918dfde6515d",
          "molfile": "\n  Marvin  01132100492D          \n\n 22 25  0  0  1  0            999 V2000\n    9.3933   -4.3533    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.3933   -3.5011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1238   -4.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1238   -5.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6827   -5.5861    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9760   -6.0044    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9760   -6.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2645   -7.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5541   -6.8380    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8474   -7.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1170   -6.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3697   -7.2414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1170   -6.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3752   -5.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8165   -5.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5541   -6.0044    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.5541   -5.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2645   -5.5861    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.2645   -4.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9760   -4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6827   -4.7725    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.6827   -3.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 21  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 18  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "CC1=C[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]32)O)CC1=O",
          "formula": "C20H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f492712f-f43a-4c4c-90e5-ef30dc8a626c"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "302.4518",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39871ee8-ba1c-4789-b0cc-3544c5debdfe",
      "version": "14",
      "structure": {
        "id": "6b9713ec-b996-4a79-bb47-f2e9f4278de4",
        "molfile": "\n  Marvin  01132105352D          \n\n 26 29  0  0  1  0            999 V2000\n    5.1158   -6.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3742   -5.5748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8152   -5.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5526   -6.0030    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5526   -5.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2628   -5.5848    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2628   -6.4412    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2628   -4.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9742   -4.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6807   -4.7714    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6807   -3.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3911   -4.3523    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.3911   -3.5003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1215   -4.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1215   -5.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6807   -5.5848    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.6807   -6.3191    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9742   -6.0030    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9742   -5.1467    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9742   -6.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2628   -7.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5526   -6.8364    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5526   -7.6933    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8461   -7.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1158   -6.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3687   -7.2397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 10  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22  4  1  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n  1 25  1  0  0  0  0\n 18  6  1  0  0  0  0\nM  END",
        "smiles": "CC1=C[C@@]2(C)[C@@]([H])(CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]32[H])O)CC1=O",
        "formula": "C20H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "302.4518",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9a592d3b-0c5a-4800-bf10-6edc72205963",
          "679442d9-22aa-40a1-956b-1c57534cc0cd",
          "4545f688-b243-41da-b914-842a9c902500"
        ],
        "stereo_centers": 7
      },
      "unii": "3Q6FKA848S"
    }
  ]
}