{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "646b0e0f-ff32-4d43-bac5-9068d548c344",
          "code": "91-51-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=91-51-0",
          "code_system": "CAS",
          "references": [
            "2b5b5b40-3304-4671-a3a5-ffd078b6f9a9",
            "efc81ea4-be33-4796-8667-41930807c8eb"
          ]
        },
        {
          "uuid": "54534310-234b-41c9-9528-afcb51085cb8",
          "code": "202-073-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.885",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2b5b5b40-3304-4671-a3a5-ffd078b6f9a9"
          ]
        },
        {
          "uuid": "ed723db0-719c-7d85-6648-7eb2752d5e01",
          "code": "DTXSID2052609",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052609",
          "code_system": "EPA CompTox",
          "references": [
            "97223ddf-12e5-60bd-bf2e-e53501020b58"
          ]
        },
        {
          "uuid": "f71acf86-0a27-44f1-8e30-e536330107d0",
          "code": "3PWS757043",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d3e871c7-3173-4ecf-a3b2-49c96c4f2c5e",
          "name": "ANTHRANILIC ACID, N-(3-(P-TERT-BUTYLPHENYL)-2-METHYLPROPYLIDENE)-, METHYL ESTER",
          "stdName": "ANTHRANILIC ACID, N-(3-(P-TERT-BUTYLPHENYL)-2-METHYLPROPYLIDENE)-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae4884b5-e8e5-4688-9026-a7100d2294d6",
            "4b75986b-60a0-4236-8f47-7f5d6c31e449"
          ],
          "display_name": false
        },
        {
          "uuid": "a9397303-8414-4067-a55f-f64bc8096284",
          "name": "BENZOIC ACID, 2-((3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYLIDENE)AMINO)-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 2-((3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYLIDENE)AMINO)-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae4884b5-e8e5-4688-9026-a7100d2294d6",
            "4b75986b-60a0-4236-8f47-7f5d6c31e449"
          ],
          "display_name": false
        },
        {
          "uuid": "02fdce8d-902e-464c-9c2b-eda01fe2efd6",
          "name": "BUTYLPHENYL METHYLPROPIONAL METHYL ANTHRANILATE",
          "stdName": "BUTYLPHENYL METHYLPROPIONAL METHYL ANTHRANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe1af086-aab0-4b5e-8576-39506eed53a1",
            "4b75986b-60a0-4236-8f47-7f5d6c31e449"
          ],
          "display_name": true
        },
        {
          "uuid": "afa964ed-251e-4a1c-8bc1-0dbb19cbd7de",
          "name": "VERDANTIOL",
          "stdName": "VERDANTIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae4884b5-e8e5-4688-9026-a7100d2294d6",
            "4b75986b-60a0-4236-8f47-7f5d6c31e449"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ae4884b5-e8e5-4688-9026-a7100d2294d6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4b75986b-60a0-4236-8f47-7f5d6c31e449",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe1af086-aab0-4b5e-8576-39506eed53a1",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b5b5b40-3304-4671-a3a5-ffd078b6f9a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392231000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbae2850-0d14-469c-9b30-d3dd7997d526",
          "citation": "SRS import [3PWS757043]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3PWS757043",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392231000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97223ddf-12e5-60bd-bf2e-e53501020b58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=91-51-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "efc81ea4-be33-4796-8667-41930807c8eb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19807227-a9df-45d5-930c-045da20e48bc",
          "id": "19807227-a9df-45d5-930c-045da20e48bc",
          "molfile": "\n  Marvin  01132101302D          \n\n 25 26  0  0  0  0            999 V2000\n    0.0000   -0.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -1.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8615   -1.2231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5826   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2922   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2980   -0.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0076   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0018   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2865   -2.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2807   -3.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9845   -4.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7057   -3.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7172   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9787   -4.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -5.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7114   -5.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2173   -5.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 22 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)/C=N/c2ccccc2C(=O)OC",
          "formula": "C22H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b77be88e-85ee-4878-a492-84dc097a4cdf"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "337.4561",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "78d83eba-45ed-40f0-8e84-7a10eac377ca",
      "version": "3",
      "structure": {
        "id": "8a52bfd1-7ba6-4c66-95cc-4ec36129fab6",
        "molfile": "\n  Marvin  01132107112D          \n\n 25 26  0  0  0  0            999 V2000\n    1.4307   -1.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8615   -1.2231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9787   -4.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9845   -4.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5826   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2807   -3.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7057   -3.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0018   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0076   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2865   -2.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7172   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2922   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9903   -5.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7114   -5.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2173   -5.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1519   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2980   -0.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1 16  1  0  0  0  0\n  2  8  2  0  0  0  0\n  2 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4 21  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 18  1  0  0  0  0\n  5 19  1  0  0  0  0\n  5 20  1  0  0  0  0\n  6 10  1  0  0  0  0\n  6  9  2  0  0  0  0\n  7 17  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 22  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 13 17  1  0  0  0  0\n 16 24  2  0  0  0  0\n 17 23  1  0  0  0  0\n 21 25  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)/C=N/c2ccccc2C(=O)OC",
        "formula": "C22H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "337.4561",
        "optical_activity": "( + / - )",
        "references": [
          "fe1af086-aab0-4b5e-8576-39506eed53a1",
          "cbae2850-0d14-469c-9b30-d3dd7997d526"
        ],
        "stereo_centers": 1
      },
      "unii": "3PWS757043"
    }
  ]
}