{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "34ea0cc7-9f9f-4a61-9bab-06042e9ae5d7", "code": "61788-76-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=61788-76-9", "code_system": "CAS", "references": [ "a942aab8-54bd-4778-ba3b-ffef8cfe48e5", "a10f824e-b6ec-43de-8397-bbf617063cea" ] }, { "uuid": "04ebeb68-4094-474a-868e-477bdb0949c9", "code": "CHLORINATED PARAFFINS", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Chlorinated_paraffins", "code_system": "WIKIPEDIA", "references": [ "a942aab8-54bd-4778-ba3b-ffef8cfe48e5" ] }, { "uuid": "6a9cf2c8-bbeb-47c3-a00f-7f6bdaf80475", "code": "263-004-3", "type": "PRIMARY", "code_system": "ECHA (EC/EINECS)", "references": [ "a942aab8-54bd-4778-ba3b-ffef8cfe48e5" ] }, { "uuid": "4917b025-f9c2-4289-8d99-980b431c5535", "code": "22833341", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22833341", "code_system": "PUBCHEM", "references": [ "a942aab8-54bd-4778-ba3b-ffef8cfe48e5" ] }, { "uuid": "18b1812b-3539-134a-dc75-3bd05d4e6952", "code": "DTXSID7028061", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7028061", "code_system": "EPA CompTox", "references": [ "f3c90d7c-01d0-3868-5f39-1f63f05f6b23" ] }, { "uuid": "27906b96-940a-fdcf-9981-7b1175dd65cd", "code": "C45386", "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-halide Carcinogen[C45183]|Carcinogenic Halogenated Hydrocarbon[C45184]|Carcinogenic Chlorinated Hydrocarbon", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45386", "code_system": "NCI_THESAURUS", "references": [ "90c77859-393d-acb2-38e0-fe98f7433539" ] }, { "uuid": "fd53c879-a1b1-6025-f1ed-49f3f0b1d008", "code": "C44354", "comments": "NCIT", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44354", "code_system": "NCI_THESAURUS", "references": [ "7bc7cba9-1454-2672-7112-bb915d5b4e6e" ] }, { "uuid": "aa7c41e8-d3d2-40f6-95a2-b0ed5f0e5bf5", "code": "3OE3NR58QP", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "91a6d764-bccd-eb6d-80a8-3672d7ecc810", "code": "3OE3NR58QP", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3OE3NR58QP", "code_system": "DAILYMED", "references": [ "7638c4d2-b692-6d02-d941-574340e91a2d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7bebff74-3f8a-4184-9bab-69e685e8b462", "name": "ALKANES, CHLORO-", "stdName": "ALKANES, CHLORO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54022751-d8cf-4ae9-a33e-be74ec04e744" ], "display_name": false }, { "uuid": "d2d5053e-025c-453b-a264-650a56b41d22", "name": "CHLORINATED ALKANES", "stdName": "CHLORINATED ALKANES", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ae2d6469-32e1-4ae8-b4d4-1901373091f7" ], "display_name": false }, { "uuid": "ee496351-53b2-49ab-9d08-ea52dd8a9bca", "name": "CHLORINATED PARAFFIN", "stdName": "CHLORINATED PARAFFIN", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "ae2d6469-32e1-4ae8-b4d4-1901373091f7" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f8c15c1d-962a-4a16-8540-7e98f09297d6", "name_org": "INCI" } ] }, { "uuid": "ccf6d218-0b86-4130-9822-0051245e764d", "name": "CLORAFIN", "stdName": "CLORAFIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ae2d6469-32e1-4ae8-b4d4-1901373091f7" ], "display_name": false }, { "uuid": "682d7753-9a0e-403c-8543-1e3b534e9a02", "name": "J2.509.215E", "stdName": "J2.509.215E", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5480a933-cbc3-4853-b569-f8f178ac0f3f" ], "display_name": false }, { "uuid": "970abbbf-2524-454a-9404-1b06cd8c5064", "name": "PARAFFINS (ALKANES), CHLORINATED", "stdName": "PARAFFINS (ALKANES), CHLORINATED", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ae2d6469-32e1-4ae8-b4d4-1901373091f7" ], "display_name": false }, { "uuid": "5517780f-46a7-440b-af64-c902e248408d", "name": "PARAFFINS, CHLORO-", "stdName": "PARAFFINS, CHLORO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4fe42e11-c09b-4287-ac58-3d79c01a7eef" ], "display_name": true } ], "references": [ { "uuid": "54022751-d8cf-4ae9-a33e-be74ec04e744", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ae2d6469-32e1-4ae8-b4d4-1901373091f7", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5480a933-cbc3-4853-b569-f8f178ac0f3f", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.509.215E", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.509.215E", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4fe42e11-c09b-4287-ac58-3d79c01a7eef", "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/61788-76-9", "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/61788-76-9", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cab3039e-0b47-417e-821c-0efe83229c37", "citation": "https://3bsccorp.com/lipids/2-4-5-8-11-12-14-17-octachloroicosane-detail", "url": "https://3bsccorp.com/lipids/2-4-5-8-11-12-14-17-octachloroicosane-detail", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a942aab8-54bd-4778-ba3b-ffef8cfe48e5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393302000, "tags": [ "NOMEN" ] }, { "uuid": "f3c90d7c-01d0-3868-5f39-1f63f05f6b23", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61788-76-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "90c77859-393d-acb2-38e0-fe98f7433539", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "a10f824e-b6ec-43de-8397-bbf617063cea", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7bc7cba9-1454-2672-7112-bb915d5b4e6e", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "7638c4d2-b692-6d02-d941-574340e91a2d", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f0d1d3a7-aa4f-4032-bf68-bc13da551ac6", "id": "f0d1d3a7-aa4f-4032-bf68-bc13da551ac6", "molfile": "\n Marvin 01132112302D \n\n 28 27 0 0 0 0 999 V2000\n 13.4363 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7242 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0255 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3134 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.3134 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6147 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9026 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1904 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.1904 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4918 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7796 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.7796 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0675 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.0675 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3688 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6567 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9445 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.9445 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2459 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5337 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8216 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8216 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1229 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1229 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4108 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7121 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.0000 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7121 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 28 1 0 0 0 0\nM END", "smiles": "CCCC(CCC(CC(C(CCC(CCC(C(CC(C)Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl", "formula": "C20H34Cl8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5f2fbe00-5362-48d1-afda-010651d017eb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "558.1082", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "REPRESENTATIVE", "uuid": "fa35658b-8963-408d-bf28-02a5134e6fc0", "version": "12", "structure": { "id": "e51de402-72be-49f2-8e57-2fcf95f40c7f", "molfile": "\n Marvin 01132111522D \n\n 28 27 0 0 0 0 999 V2000\n 0.0000 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7121 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4108 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1229 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8216 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5337 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2459 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9445 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6567 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3688 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0675 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7796 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4918 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1904 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9026 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6147 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3134 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0255 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7242 -1.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4363 -0.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7121 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8216 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9445 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0675 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1904 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3134 -2.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7796 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1229 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 21 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 28 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 22 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 23 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 24 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 27 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 25 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 26 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CCCC(CCC(CC(C(CCC(CCC(C(CC(C)Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl", "formula": "C20H34Cl8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "558.1082", "optical_activity": "UNSPECIFIED", "references": [ "54022751-d8cf-4ae9-a33e-be74ec04e744" ], "stereo_centers": 8 }, "unii": "3OE3NR58QP" } ] }