{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a34b7409-fc39-4faa-b2cb-2e903f82dafd",
          "code": "1073606-36-6",
          "type": "GENERIC (FAMILY)",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1073606-36-6",
          "code_system": "CAS",
          "references": [
            "4808814a-87ed-44f3-83f6-c2c96458fa13",
            "95b892d0-fd72-44f2-8449-c7e76b2957a7"
          ]
        },
        {
          "uuid": "c6a5b488-0a98-4ad6-a61f-415d7ecf8339",
          "code": "1436961",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1436961/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4808814a-87ed-44f3-83f6-c2c96458fa13"
          ]
        },
        {
          "uuid": "5a7a8501-e5d8-4665-8fbe-9f07659ae566",
          "code": "3N703GY99W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d3db9b48-570d-0e5f-1808-0661f0af09ae",
          "code": "139033531",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/139033531",
          "code_system": "PUBCHEM",
          "references": [
            "a15a4376-25f8-847a-2187-e38e5fa51f44"
          ]
        },
        {
          "uuid": "df996f48-83f7-7b23-6d86-40c773ae2bac",
          "code": "3N703GY99W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3N703GY99W",
          "code_system": "DAILYMED",
          "references": [
            "242762ad-4b8f-b207-6c95-69382adefe50"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "022a4cf5-fb78-4f5c-a0ed-7c3d9358a564",
          "name": "CRODAMOL SFX",
          "stdName": "CRODAMOL SFX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59fa4dc3-37b8-4fb1-937f-24961398aacc",
            "3ee43b46-2b42-4a95-aee9-cbf744c4438d"
          ],
          "display_name": false
        },
        {
          "uuid": "b5412e66-7e6b-4018-93f6-3145852909e1",
          "name": "PPG-3 BENZYL ETHER ETHYLHEXANOATE",
          "stdName": "PPG-3 BENZYL ETHER ETHYLHEXANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bac8aafa-7e3b-4840-8dd5-aeed426b53f3",
            "59fa4dc3-37b8-4fb1-937f-24961398aacc",
            "3ee43b46-2b42-4a95-aee9-cbf744c4438d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "612dbb3b-7172-4f98-bf14-af616c776ca4",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "59fa4dc3-37b8-4fb1-937f-24961398aacc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3ee43b46-2b42-4a95-aee9-cbf744c4438d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4808814a-87ed-44f3-83f6-c2c96458fa13",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392040000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34eac8ab-b865-4aca-8bda-7d6b005d20b8",
          "citation": "SRS import [3N703GY99W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3N703GY99W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392040000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bac8aafa-7e3b-4840-8dd5-aeed426b53f3",
          "citation": "PPG-3 BENZYL ETHER ETHYLHEXANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95b892d0-fd72-44f2-8449-c7e76b2957a7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a15a4376-25f8-847a-2187-e38e5fa51f44",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "242762ad-4b8f-b207-6c95-69382adefe50",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6beae69e-0f5d-43c5-8ffb-01a9a878ad2a",
          "id": "6beae69e-0f5d-43c5-8ffb-01a9a878ad2a",
          "molfile": "\n  Marvin  01132105362D          \n\n 29 29  0  0  0  0            999 V2000\n   29.9130  -10.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1547  -10.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3760  -10.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5790  -10.5630    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   27.5563   -9.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4443   -9.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8003  -11.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0626  -10.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0535   -9.6523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2429  -11.0138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5274  -10.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8157  -11.0203    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   23.8197  -11.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1001  -10.6116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3884  -11.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6729  -10.6182    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   21.6691   -9.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9612  -11.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2456  -10.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5340  -11.0399    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   19.5377  -11.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8176  -10.6306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1051  -11.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3888  -10.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3850   -9.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6687   -9.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9561   -9.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9600  -10.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6763  -11.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 29  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CCCC(CC)CC(=O)OCC(C)OCC(C)OCC(C)OCc1ccccc1",
          "formula": "C24H40O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "779acbf2-00b0-44ec-8cae-2db1b7775c0c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "408.5723",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "dc8b68ac-ef36-40ff-a00a-468a354331a0",
      "version": "7",
      "structure": {
        "id": "ef2cf34f-c11e-46dd-9049-1ff875c5f52e",
        "molfile": "\n  Marvin  01132112242D          \n\n 29 29  0  0  0  0            999 V2000\n   26.8003  -11.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5790  -10.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0626  -10.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0535   -9.6523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3760  -10.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1547  -10.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5563   -9.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4443   -9.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9130  -10.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6729  -10.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6691   -9.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3884  -11.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1001  -10.6116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8157  -11.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5274  -10.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2429  -11.0138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8197  -11.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9612  -11.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2456  -10.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5340  -11.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8176  -10.6306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1051  -11.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3888  -10.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3850   -9.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6687   -9.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9561   -9.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9600  -10.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6763  -11.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5377  -11.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  2  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  3 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 10  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 23 28  1  0  0  0  0\n 20 29  1  0  0  0  0\nM  END",
        "smiles": "CCCC(CC)CC(=O)OCC(C)OCC(C)OCC(C)OCc1ccccc1",
        "formula": "C24H40O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "408.5723",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "59fa4dc3-37b8-4fb1-937f-24961398aacc",
          "34eac8ab-b865-4aca-8bda-7d6b005d20b8"
        ],
        "stereo_centers": 4
      },
      "unii": "3N703GY99W"
    }
  ]
}