{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2b4f96ad-0843-426a-9c30-33847e88a1f3",
          "code": "90-98-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-98-2",
          "code_system": "CAS",
          "references": [
            "5604cf30-45d5-40b0-a086-186ce4023ef2",
            "b59ce7b3-da48-4363-b70b-6c2faecba5fd"
          ]
        },
        {
          "uuid": "d9e70ee4-e36f-4351-8a4a-8acd85b02add",
          "code": "202-030-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.846",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5604cf30-45d5-40b0-a086-186ce4023ef2"
          ]
        },
        {
          "uuid": "fd63d584-0c7e-45bf-a4f9-489b8f2e83fe",
          "code": "7034",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7034",
          "code_system": "PUBCHEM",
          "references": [
            "5604cf30-45d5-40b0-a086-186ce4023ef2"
          ]
        },
        {
          "uuid": "a0a4a56d-7d20-9690-b0a6-4f7ef24bd81d",
          "code": "4,4'-Dichlorobenzophenone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/4,4'-Dichlorobenzophenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "7ff3aac6-e297-3b72-bb62-ae575b36d4c8"
          ]
        },
        {
          "uuid": "3ca40b43-2af2-661a-c82b-1b1b86ee46e3",
          "code": "DTXSID3037626",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3037626",
          "code_system": "EPA CompTox",
          "references": [
            "1590081a-7cc7-4d51-c4b2-0465b2c2a3c6"
          ]
        },
        {
          "uuid": "f7cc753f-0fe3-42cd-99dc-caf316bb50d5",
          "code": "3MTL0YC2Q5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1e2686b9-f74d-f8f9-fcd8-2320fe2ba3d9",
          "code": "8787",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8787",
          "code_system": "NSC",
          "references": [
            "a86b494e-cd72-9d3d-98a6-7dc4d85ef94d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5484374e-54d0-4b70-b175-83cf999d8d50",
          "name": "4,4'-DICHLOROBENZOPHENONE",
          "stdName": "4,4'-DICHLOROBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48b8f88e-b00a-4c33-9e08-86a285a6c98f"
          ],
          "display_name": true
        },
        {
          "uuid": "9b53445b-5656-4d6a-853b-ac8fbfb63e88",
          "name": "BENZOPHENONE, 4,4'-DICHLORO-",
          "stdName": "BENZOPHENONE, 4,4'-DICHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f822a82-750d-4501-a000-f5da1dcdc38f",
            "7a6550bc-df99-49de-9110-e9fbcf3b674f"
          ],
          "display_name": false
        },
        {
          "uuid": "15ff4304-ced2-4c36-aca7-48e0a6498843",
          "name": "DCBP",
          "stdName": "DCBP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f822a82-750d-4501-a000-f5da1dcdc38f",
            "7a6550bc-df99-49de-9110-e9fbcf3b674f"
          ],
          "display_name": false
        },
        {
          "uuid": "120ab821-8c1d-4d65-90bf-673bbf51d18b",
          "name": "METHANONE, BIS(4-CHLOROPHENYL)-",
          "stdName": "METHANONE, BIS(4-CHLOROPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f822a82-750d-4501-a000-f5da1dcdc38f",
            "7a6550bc-df99-49de-9110-e9fbcf3b674f"
          ],
          "display_name": false
        },
        {
          "uuid": "b7f39190-695b-4219-b96d-8829bc531493",
          "name": "NSC-8787",
          "stdName": "NSC-8787",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f822a82-750d-4501-a000-f5da1dcdc38f",
            "7a6550bc-df99-49de-9110-e9fbcf3b674f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9f822a82-750d-4501-a000-f5da1dcdc38f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7a6550bc-df99-49de-9110-e9fbcf3b674f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48b8f88e-b00a-4c33-9e08-86a285a6c98f",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5604cf30-45d5-40b0-a086-186ce4023ef2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391228000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94b64899-20b0-4b60-a9af-cd4ecfb1d884",
          "citation": "SRS import [3MTL0YC2Q5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3MTL0YC2Q5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391228000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bb512db-b90c-4cfc-82eb-0900b78f8435",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ff3aac6-e297-3b72-bb62-ae575b36d4c8",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/4,4'-Dichlorobenzophenone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1590081a-7cc7-4d51-c4b2-0465b2c2a3c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-98-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b59ce7b3-da48-4363-b70b-6c2faecba5fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a86b494e-cd72-9d3d-98a6-7dc4d85ef94d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "47853c07-f7ea-4fca-a176-4fe6804afb3d",
          "id": "47853c07-f7ea-4fca-a176-4fe6804afb3d",
          "molfile": "\n  Marvin  01132103452D          \n\n 16 17  0  0  0  0            999 V2000\n    2.8876   -0.9055    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1693   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4511   -0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7411   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7411    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4511    0.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1693    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0032    0.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0032    1.6253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7345    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7345   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4511   -0.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1628   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9103   -0.8958    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1628    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4511    0.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C(=O)c2ccc(cc2)Cl)Cl",
          "formula": "C13H8Cl2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aca1ffc6-fd5b-495c-b243-15ebd05062dd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "251.1084",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7dab9c55-d767-4a4a-b5c0-71e8c13a1aee",
      "version": "6",
      "structure": {
        "id": "ca1aada0-fedd-485e-a5aa-da6e7cb10ca8",
        "molfile": "\n  Marvin  01132110262D          \n\n 16 17  0  0  0  0            999 V2000\n   -0.0032    0.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7411    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7345    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0032    1.6253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7411   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4511    0.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7345   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4511    0.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4511   -0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1693    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4511   -0.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1628    0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1693   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1628   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8876   -0.9055    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9103   -0.8958    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  2  0  0  0  0\n  7 11  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 10 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C(=O)c2ccc(cc2)Cl)Cl",
        "formula": "C13H8Cl2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.1084",
        "optical_activity": "NONE",
        "references": [
          "94b64899-20b0-4b60-a9af-cd4ecfb1d884",
          "2bb512db-b90c-4cfc-82eb-0900b78f8435"
        ],
        "stereo_centers": 0
      },
      "unii": "3MTL0YC2Q5"
    }
  ]
}