{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9603d8dc-af02-4322-bec9-8da1b412739b",
          "code": "13224-93-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13224-93-6",
          "code_system": "CAS",
          "references": [
            "0176cecd-dd7f-3e18-ee51-3160e808b75e"
          ]
        },
        {
          "uuid": "cb2ff390-6da6-bd72-6975-20b7f4b6d746",
          "code": "444863",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444863",
          "code_system": "PUBCHEM",
          "references": [
            "5842fb89-f128-3896-a4a1-a66ff5f1109e"
          ]
        },
        {
          "uuid": "90a64f2e-11a7-62ff-cd13-347502e64c23",
          "code": "DB03283",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03283",
          "code_system": "DRUG BANK",
          "references": [
            "d5ec8961-3278-6e5d-d70e-b2994757f386"
          ]
        },
        {
          "uuid": "cc29edbe-00c3-4944-932d-a80021f766bf",
          "code": "3MLV1G4S4M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "30d9a60e-ac1a-970b-a108-c56dd057cfa3",
          "name": ".BETA.-L-FUCOPYRANOSE",
          "stdName": ".BETA.-L-FUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0176cecd-dd7f-3e18-ee51-3160e808b75e"
          ],
          "display_name": true
        },
        {
          "uuid": "0a1118e9-a7c8-226b-482e-fe4291f65112",
          "name": ".BETA.-L-GALACTOPYRANOSE, 6-DEOXY-",
          "stdName": ".BETA.-L-GALACTOPYRANOSE, 6-DEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0176cecd-dd7f-3e18-ee51-3160e808b75e"
          ],
          "display_name": false
        },
        {
          "uuid": "31f140a2-b08f-0041-4d0f-ec9afa77f9ec",
          "name": "6-DEOXY-.BETA.-L-GALACTOPYRANOSE",
          "stdName": "6-DEOXY-.BETA.-L-GALACTOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0176cecd-dd7f-3e18-ee51-3160e808b75e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0176cecd-dd7f-3e18-ee51-3160e808b75e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5842fb89-f128-3896-a4a1-a66ff5f1109e",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "d5ec8961-3278-6e5d-d70e-b2994757f386",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "663e2c08-0d11-adc9-1379-ad92ced2a5ae",
          "id": "663e2c08-0d11-adc9-1379-ad92ced2a5ae",
          "molfile": "\n  Marvin  01132105192D          \n\n 11 11  0  0  1  0            999 V2000\n   15.9907   -4.4826    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   16.7052   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9907   -3.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2763   -3.2450    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   15.2763   -2.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5618   -3.6576    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.8473   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5618   -4.4826    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.8473   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2763   -4.8950    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   15.2763   -5.7200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O)O1)O)O)O",
          "formula": "C6H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "66beb08c-d9dc-4096-85bd-c70dd2797bd3"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "164.1567",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6377d089-0225-41ad-9bf3-bfd09a4e57c4",
      "version": "6",
      "structure": {
        "id": "dc43caa0-d65c-bb03-8d3c-72b61c7d4aee",
        "molfile": "L-Galactopyranose, 6-deoxy-\n  Marvin  01132111252D          \n\n 11 11  0  0  1  0            999 V2000\n   15.2763   -5.7200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2763   -4.8950    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5618   -4.4826    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.8473   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5618   -3.6576    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.8473   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2763   -3.2450    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.9907   -3.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9907   -4.4826    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.7052   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2763   -2.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  7 11  1  1  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O)O1)O)O)O",
        "formula": "C6H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "164.1567",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0176cecd-dd7f-3e18-ee51-3160e808b75e"
        ],
        "stereo_centers": 5
      },
      "unii": "3MLV1G4S4M"
    }
  ]
}