{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "16201b01-be49-c16a-c24d-7c72bbe5759d", "code": "449126", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/449126", "code_system": "PUBCHEM", "references": [ "165da315-478a-53a6-dbc0-d5a31dc83b3e" ] }, { "uuid": "b7c1979a-cb1f-4a59-b694-1d2924fd4cdc", "code": "3M2B2SQW0I", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0c5c0b74-e996-05e5-f207-7c0fb9990079", "code": "156336-70-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=156336-70-8", "code_system": "CAS", "references": [ "d08dc9c0-b585-4e65-a39f-759c0a105f6c" ] }, { "uuid": "91ad9209-d39b-8d1d-71ed-72cdd5cac474", "code": "DB08061", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB08061", "code_system": "DRUG BANK", "references": [ "ff49463f-2b10-0434-4f65-6bf604cf993e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "784ee461-be44-eec0-7cfa-c003b6a6667d", "name": "4-(3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-YL)PIPERIDINE", "stdName": "4-(3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-YL)PIPERIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0ec7e524-565d-8ab8-a595-d9759d3a7eb9", "d08dc9c0-b585-4e65-a39f-759c0a105f6c" ], "display_name": false }, { "uuid": "f33b54f6-80bb-456b-a7f3-e74687d6ae4d", "name": "4-(5-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)PIPERIDINE", "stdName": "4-(5-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)PIPERIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d08dc9c0-b585-4e65-a39f-759c0a105f6c" ], "display_name": true }, { "uuid": "f9ae49de-b927-e001-f6ac-749b974d6d38", "name": "PIPERIDINE, 4-(5-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)-", "stdName": "PIPERIDINE, 4-(5-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d08dc9c0-b585-4e65-a39f-759c0a105f6c" ], "display_name": false } ], "references": [ { "uuid": "165da315-478a-53a6-dbc0-d5a31dc83b3e", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "0ec7e524-565d-8ab8-a595-d9759d3a7eb9", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "d08dc9c0-b585-4e65-a39f-759c0a105f6c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ff49463f-2b10-0434-4f65-6bf604cf993e", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e9c610d7-60b5-42e1-9dab-c6373778a155", "id": "e9c610d7-60b5-42e1-9dab-c6373778a155", "molfile": "\n Marvin 01132112062D \n\n 18 20 0 0 0 0 999 V2000\n 1.6500 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6500 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1349 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9196 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5870 -0.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3407 -0.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0081 -1.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9219 -1.8673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1682 -2.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5008 -1.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9196 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1349 0.6674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 18 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 17 1 0 0 0 0\n 6 7 1 0 0 0 0\n 16 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 10 1 0 0 0 0\n 14 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 2 0 0 0 0\nM END", "smiles": "c1cc(ccc1-c2cc(C3CCNCC3)[nH]n2)Cl", "formula": "C14H16ClN3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "87d62d80-581d-43b3-ade6-73cd02f15479" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.7504", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "029cbf0c-bbc8-4620-814c-00c76f9d8c32", "version": "8", "structure": { "id": "2023b317-6a45-4ff6-ae57-ea5a3c54bbc2", "molfile": "ZINC000005974200\n Marvin 01132101492D \n\n 18 20 0 0 0 0 999 V2000\n 18.5915 -3.3259 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7665 -3.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3540 -4.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5290 -4.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1165 -3.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2915 -3.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8066 -3.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0219 -3.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3545 -4.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6009 -3.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9335 -4.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0197 -5.1932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7733 -5.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4407 -5.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0219 -2.9134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8066 -2.6585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5290 -2.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3540 -2.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 8 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 5 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 2 1 0 0 0 0\n 16 6 2 0 0 0 0\n 14 9 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1-c2cc(C3CCNCC3)[nH]n2)Cl", "formula": "C14H16ClN3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.7504", "optical_activity": "NONE", "references": [ "0ec7e524-565d-8ab8-a595-d9759d3a7eb9", "d08dc9c0-b585-4e65-a39f-759c0a105f6c" ], "stereo_centers": 0 }, "unii": "3M2B2SQW0I" } ] }