{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2cffab12-1002-4c4b-b565-44ef9055f986",
          "code": "17834",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17834",
          "code_system": "PUBCHEM",
          "references": [
            "42130257-7cb0-4ec5-b5f9-23ae4411edea"
          ]
        },
        {
          "uuid": "1c860161-8dd9-42fc-bb39-a819f785984b",
          "code": "2847-05-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2847-05-4",
          "code_system": "CAS",
          "references": [
            "42130257-7cb0-4ec5-b5f9-23ae4411edea",
            "caf9fa7a-42a7-4c48-8e25-66df1c1cd538"
          ]
        },
        {
          "uuid": "b9746cff-839b-44c9-b13a-67bc6dd17fe8",
          "code": "220-647-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.771",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "42130257-7cb0-4ec5-b5f9-23ae4411edea"
          ]
        },
        {
          "uuid": "1f86043f-4c6e-4521-8646-bc3f6d261b50",
          "code": "SUB194894",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f15977a9-e9f8-b010-f011-48dc88d861a6"
          ]
        },
        {
          "uuid": "d0338907-ccd3-4e14-a6fd-f695da3c22ea",
          "code": "3M0U6DM996",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "37fb35ff-983d-077c-8254-72366f52e362",
          "code": "100000181308",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2ae7b55e-47b8-5a97-0327-9ce8b67adf51"
          ]
        },
        {
          "uuid": "07abd359-a47e-9923-5fe0-4fb3cb6726d9",
          "code": "DTXSID70951156",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70951156",
          "code_system": "EPA CompTox",
          "references": [
            "161aaf80-fb27-4d0a-0f97-98ab17aa1c67"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "03db7ba5-3f58-45ff-96b0-7179cd3d1c5d",
          "name": "BUTANEDIOIC ACID, HYDROXY-, ZINC SALT (1:1)",
          "stdName": "BUTANEDIOIC ACID, HYDROXY-, ZINC SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b28036e-e932-452d-9905-073b0c9ee335",
            "b7cc95c4-95fc-430c-84a3-bcca20eee875"
          ],
          "display_name": false
        },
        {
          "uuid": "3f570300-7213-4ffa-8372-baa255dcc498",
          "name": "MALIC ACID, ZINC SALT (1:1)",
          "stdName": "MALIC ACID, ZINC SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b28036e-e932-452d-9905-073b0c9ee335",
            "badcc943-2742-454e-a25d-c9707ecdd91a"
          ],
          "display_name": false
        },
        {
          "uuid": "3e2fc38b-0696-47fc-ab60-7a7b0a5aa2e2",
          "name": "ZINC MALATE",
          "stdName": "ZINC MALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b28036e-e932-452d-9905-073b0c9ee335",
            "56761c77-e34b-4593-8e1f-ca64e8d5102d"
          ],
          "display_name": true
        },
        {
          "uuid": "36d9f958-b687-4632-b304-f95d5e0399ce",
          "name": "ZINC MALATE, (DL)-",
          "stdName": "ZINC MALATE, (DL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b28036e-e932-452d-9905-073b0c9ee335",
            "4cccbfef-256e-4009-810f-42d9e4d50f70"
          ],
          "display_name": false
        },
        {
          "uuid": "071fd4bd-aafc-4512-813e-b98de3f4a440",
          "name": "ZINC MALATE, (±)-",
          "stdName": "ZINC MALATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b28036e-e932-452d-9905-073b0c9ee335",
            "4cccbfef-256e-4009-810f-42d9e4d50f70"
          ],
          "display_name": false
        },
        {
          "uuid": "f86c21b6-cfa9-6d8f-1422-8c4c68716a46",
          "name": "Zinc malate [WHO-DD]",
          "stdName": "ZINC MALATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30b65390-53ff-c7b4-8cdd-328d8039fdb1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b7cc95c4-95fc-430c-84a3-bcca20eee875",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8b28036e-e932-452d-9905-073b0c9ee335",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "badcc943-2742-454e-a25d-c9707ecdd91a",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56761c77-e34b-4593-8e1f-ca64e8d5102d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cccbfef-256e-4009-810f-42d9e4d50f70",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42130257-7cb0-4ec5-b5f9-23ae4411edea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510e5cf8-2480-4578-b9ac-336c04849734",
          "citation": "SRS import [3M0U6DM996]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3M0U6DM996",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "345ed729-1bed-eedb-3872-89fc0f4504c6",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2ae7b55e-47b8-5a97-0327-9ce8b67adf51",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f15977a9-e9f8-b010-f011-48dc88d861a6",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "caf9fa7a-42a7-4c48-8e25-66df1c1cd538",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "30b65390-53ff-c7b4-8cdd-328d8039fdb1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "161aaf80-fb27-4d0a-0f97-98ab17aa1c67",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "076ded65-554c-4211-855f-b295b1bad848",
          "id": "076ded65-554c-4211-855f-b295b1bad848",
          "molfile": "\n  Marvin  01132100402D          \n\n  1  0  0  0  0  0            999 V2000\n    4.2418   -0.4030    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "30468476-cb91-4341-a198-2c792cb81ab2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e21a7961-d84c-4356-aa21-8a4b7aa56855",
          "id": "e21a7961-d84c-4356-aa21-8a4b7aa56855",
          "molfile": "\n  Marvin  01132111422D          \n\n  9  8  0  0  0  0            999 V2000\n    1.4463    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463   -0.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1589   -1.2470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7380   -1.2470    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.0000   -0.8313    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7380   -2.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463   -2.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1589   -2.0783    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4463   -3.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  CHG  2   5  -1   8  -1\nM  END",
          "smiles": "C(C(C(=O)O)[O-])C(=O)[O-]",
          "formula": "C4H4O5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "563f1c5f-d11a-4da1-8a17-b5710f35a36a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "132.0717",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8eb16db9-b2a0-4f2a-80fb-510e9c3fce32",
      "version": "10",
      "structure": {
        "id": "a65c73be-03a5-4cb3-aa14-681e1d2440b2",
        "molfile": "\n  Marvin  01132108392D          \n\n 10  8  0  0  0  0            999 V2000\n    0.7380   -1.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7380   -2.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463   -0.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463   -2.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1589   -1.2470    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1589   -2.0783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4463   -3.3295    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.2414   -0.4030    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  5  9  1  0  0  0  0\nM  CHG  3   7  -1   9  -1  10   2\nM  END",
        "smiles": "C(C(C(=O)[O-])O)C(=O)[O-].[Zn+2]",
        "formula": "C4H4O5.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "197.4673",
        "optical_activity": "( + / - )",
        "references": [
          "56761c77-e34b-4593-8e1f-ca64e8d5102d",
          "510e5cf8-2480-4578-b9ac-336c04849734"
        ],
        "stereo_centers": 1
      },
      "unii": "3M0U6DM996"
    }
  ]
}