{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "78ccc1cf-9d6d-4bf9-8613-79213d43e763",
          "code": "1800101-60-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1800101-60-3",
          "code_system": "CAS",
          "references": [
            "44d3dfd1-afa8-4fb9-965b-0dc77206f443",
            "fcf03849-98ac-4fa5-96ee-e7147db2795c"
          ]
        },
        {
          "uuid": "03ba4f3e-08eb-4181-b58d-f885d366b807",
          "code": "5F-AB-PINACA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5F-AB-PINACA",
          "code_system": "WIKIPEDIA",
          "references": [
            "44d3dfd1-afa8-4fb9-965b-0dc77206f443"
          ]
        },
        {
          "uuid": "f95da616-3c3a-4a01-a0b4-2e311f9e49cc",
          "code": "91936927",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936927",
          "code_system": "PUBCHEM",
          "references": [
            "44d3dfd1-afa8-4fb9-965b-0dc77206f443"
          ]
        },
        {
          "uuid": "563fb164-882b-42e7-8256-b33a7a3c0fc3",
          "code": "7025",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "6633f4d1-6185-4439-97cd-9d35bad0e2dd"
          ]
        },
        {
          "uuid": "200a06db-964e-4952-a39a-2486d76d302b",
          "code": "3L83B2298V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b2509b19-853d-724f-7f1c-ee23ade2f25f",
          "code": "Designer-drugs-5F-AB-PINACA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indazole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "b0e8ce31-e750-efb5-7014-d1208be25dad"
          ]
        },
        {
          "uuid": "7752e37d-4b8f-2183-ce32-a1e94163c726",
          "code": "DTXSID401009970",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401009970",
          "code_system": "EPA CompTox",
          "references": [
            "86dc906f-bb99-f8f4-03ae-c69d76dd8e29"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c426fc3f-8103-42a1-b5b6-a7de4cd52d17",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5d82a4de-c60c-4eca-8d87-9e21bf7d8de7",
            "refuuid": "c032c1ff-77c6-4d8f-b1cc-92f5363ee58b",
            "name": "5-FLUORO-AB-PINACA",
            "unii": "3L83B2298V",
            "linking_id": "3L83B2298V",
            "ref_pname": "5-FLUORO-AB-PINACA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a7747811-59e4-4cc8-ae85-546b3c768129",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "a70d6d61-3160-488b-9495-36db2e941c36",
            "refuuid": "04ad8522-9cbd-48dd-9e2f-9803f15211f0",
            "name": "5-FLUORO-AB-PINACA, (±)-",
            "unii": "8FST4IAG3N",
            "linking_id": "8FST4IAG3N",
            "ref_pname": "5-FLUORO-AB-PINACA, (±)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5b049c1c-32ee-4299-97a5-5ad004396116",
          "amount": {
            "uuid": "02b6a4ff-7572-4ce5-a1f7-aac72fe0310d",
            "average": 2.6,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "283f46c8-2dfb-44df-a204-12008f91cd00"
          ],
          "related_substance": {
            "uuid": "ba5ab860-0add-457c-994c-a1a1112d6f27",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2"
          }
        },
        {
          "uuid": "67ef1c27-fb92-4fd6-9180-6e4f7e2c564c",
          "amount": {
            "uuid": "b247adcc-13b3-4a10-ab1e-8b19ca8290dd",
            "average": 0.48,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "23c316e7-bcf0-4099-bbbd-44d197830a05"
          ],
          "related_substance": {
            "uuid": "b6d151b7-c6cb-40ee-a8ec-09ecb14d920f",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1"
          }
        },
        {
          "uuid": "34d4b076-b233-4f2e-93ee-01e6c5948402",
          "amount": {
            "uuid": "0ffec9e4-c642-4217-97d2-964219acf869",
            "average": 3.77,
            "high": 4.02,
            "low": 3.52,
            "units": "NANOMOLAR"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "7ff855c1-bf1d-4daf-a4c2-71335ad460e3"
          ],
          "related_substance": {
            "uuid": "8104ab5c-3775-4295-a78f-de9fdc90fddd",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c7e415b1-7ca1-46d0-89d9-fda3d41ea4ee",
          "amount": {
            "uuid": "63b93879-ff98-4204-9062-bec8f9eaf6ff",
            "average": 4.96,
            "high": 6.33,
            "low": 3.59,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "references": [
            "7ff855c1-bf1d-4daf-a4c2-71335ad460e3"
          ],
          "related_substance": {
            "uuid": "49032a2a-d372-4ffa-a163-bac6cae026d6",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dd915a86-9050-4e46-b94a-9a1cfbf4e9bc",
          "name": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-(5-FLUOROPENTYL)-",
          "stdName": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-(5-FLUOROPENTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8361fe7-b76c-4001-95d2-336a6eb10515",
            "fcf03849-98ac-4fa5-96ee-e7147db2795c"
          ],
          "display_name": false
        },
        {
          "uuid": "9649f9f4-b0a0-4177-b263-98a32ebc6fc3",
          "name": "5-FLUORO-AB-PINACA",
          "stdName": "5-FLUORO-AB-PINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8361fe7-b76c-4001-95d2-336a6eb10515",
            "fcf03849-98ac-4fa5-96ee-e7147db2795c"
          ],
          "display_name": true
        },
        {
          "uuid": "9a2ebfa7-b880-4c84-be47-bf923a8bf59f",
          "name": "5F-AB-PINACA",
          "stdName": "5F-AB-PINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bc328af-e511-4600-a364-39c24b62e9d9",
            "fcf03849-98ac-4fa5-96ee-e7147db2795c"
          ],
          "display_name": false
        },
        {
          "uuid": "fb8974b3-1d05-469d-8206-e01d1635ad4c",
          "name": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "stdName": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5948e6f-5784-4498-a437-c07724b547c6",
            "fcf03849-98ac-4fa5-96ee-e7147db2795c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e8361fe7-b76c-4001-95d2-336a6eb10515",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fcf03849-98ac-4fa5-96ee-e7147db2795c",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bc328af-e511-4600-a364-39c24b62e9d9",
          "citation": "https://en.wikipedia.org/wiki/5F-AB-PINACA",
          "url": "https://en.wikipedia.org/wiki/5F-AB-PINACA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5948e6f-5784-4498-a437-c07724b547c6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44d3dfd1-afa8-4fb9-965b-0dc77206f443",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393366000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a26c7164-b30e-48e0-b60e-6ea64e788cd9",
          "citation": "SRS import [3L83B2298V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3L83B2298V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393366000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32ec733f-e54f-4fd2-b13b-984dbd77ed56",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "283f46c8-2dfb-44df-a204-12008f91cd00",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "23c316e7-bcf0-4099-bbbd-44d197830a05",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.5b00112",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "6633f4d1-6185-4439-97cd-9d35bad0e2dd",
          "citation": "Electronic Code of Federal Regulations",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b0e8ce31-e750-efb5-7014-d1208be25dad",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7ff855c1-bf1d-4daf-a4c2-71335ad460e3",
          "citation": "Schoeder, Clara T., et al. \"Pharmacological evaluation of new constituents of “Spice”: synthetic cannabinoids based on indole, indazole, benzimidazole and carbazole scaffolds.\" Forensic toxicology 36.2 (2018): 385-403.",
          "url": "https://link.springer.com/article/10.1007/s11419-018-0415-z",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "86dc906f-bb99-f8f4-03ae-c69d76dd8e29",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "816f41e0-d578-4021-8caa-c816efbde00d",
          "id": "816f41e0-d578-4021-8caa-c816efbde00d",
          "molfile": "\n  Marvin  01132106432D          \n\n 25 26  0  0  1  0            999 V2000\n    4.4987   -0.8669    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0868   -1.5817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2630   -1.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -0.8669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -2.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3342   -2.9640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -3.6315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0651   -4.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8623   -4.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0763   -5.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8689   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0830   -6.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8802   -6.6606    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0674   -3.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3525   -3.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6374   -3.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6374   -2.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3525   -2.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0674   -2.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0868   -0.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4987    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2630   -0.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3272   -0.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7391   -0.1566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7391   -1.5817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 20  1  0  0  0  0\n  1 23  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 19  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)N)NC(=O)c1c2ccccc2n(CCCCCF)n1",
          "formula": "C18H25FN4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "03ba8a9e-2ddc-42af-a1d8-787fb5d29341"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "348.4158",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c032c1ff-77c6-4d8f-b1cc-92f5363ee58b",
      "version": "15",
      "structure": {
        "id": "076ef4db-a26c-4e3d-83bb-40f6217fe1f6",
        "molfile": "\n  Marvin  01132100402D          \n\n 25 26  0  0  1  0            999 V2000\n    0.6374   -2.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6374   -3.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3525   -3.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0674   -3.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0674   -2.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3525   -2.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -2.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3342   -2.9640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -3.6315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0651   -4.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8623   -4.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0763   -5.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8689   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0830   -6.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8802   -6.6606    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2630   -1.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0868   -1.5817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4987   -0.8669    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3272   -0.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7391   -0.1566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7391   -1.5817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0868   -0.1566    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.4987    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2630   -0.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8510   -0.8669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  7 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 18 22  1  1  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 16 25  2  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C(=O)N)NC(=O)c1c2ccccc2n(CCCCCF)n1",
        "formula": "C18H25FN4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "348.4158",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "32ec733f-e54f-4fd2-b13b-984dbd77ed56",
          "a26c7164-b30e-48e0-b60e-6ea64e788cd9"
        ],
        "stereo_centers": 1
      },
      "unii": "3L83B2298V"
    }
  ]
}