{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9380f0d7-d8ce-44c0-8a95-72462e360ffe",
          "code": "101-14-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101-14-4",
          "code_system": "CAS",
          "references": [
            "14d39343-dd0e-4669-9b22-fc35d095adda",
            "bc9e2fc4-81e5-415e-a3e1-0cdddb308273"
          ]
        },
        {
          "uuid": "9c378767-6342-4175-b34b-503585e827e3",
          "code": "C44319",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44319",
          "code_system": "NCI_THESAURUS",
          "references": [
            "14d39343-dd0e-4669-9b22-fc35d095adda"
          ]
        },
        {
          "uuid": "5b53e489-defe-4878-9694-3b38aebcb822",
          "code": "m7401",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7401?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "14d39343-dd0e-4669-9b22-fc35d095adda"
          ]
        },
        {
          "uuid": "3c98666d-bb9f-4053-8c5d-550c44ba91a7",
          "code": "202-918-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.654",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "14d39343-dd0e-4669-9b22-fc35d095adda"
          ]
        },
        {
          "uuid": "9e0f3ad3-97c3-46f3-ac9b-cf1359984543",
          "code": "7543",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7543",
          "code_system": "PUBCHEM",
          "references": [
            "14d39343-dd0e-4669-9b22-fc35d095adda"
          ]
        },
        {
          "uuid": "a164ea2b-604f-22c1-ef8f-5ac7b03b489e",
          "code": "2629",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2629",
          "code_system": "HSDB",
          "references": [
            "d7465935-3e73-26d5-77da-e0178779fb3b"
          ]
        },
        {
          "uuid": "9e995593-dc48-99a4-3e74-b9f3a6a619cb",
          "code": "DTXSID5020865",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020865",
          "code_system": "EPA CompTox",
          "references": [
            "2c30236b-640e-cc8e-86d3-903a53f16691"
          ]
        },
        {
          "uuid": "46d88d1d-9dc3-4d28-a189-c7c14f44eeb9",
          "code": "3L2W5VTT2A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7c263135-8ff2-84fc-dc69-4ac69a420bb6",
          "code": "4,4'-Methylenebis(2-chloroaniline)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/4,4%27-Methylenebis(2-chloroaniline)",
          "code_system": "WIKIPEDIA",
          "references": [
            "839f45e3-b642-ed83-a707-e418d34bfb70"
          ]
        },
        {
          "uuid": "bbd1771d-9d52-7e69-f4bb-b5f867722df7",
          "code": "52954",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=52954",
          "code_system": "NSC",
          "references": [
            "8d077c83-724c-a722-88c5-243ca17bfe0f"
          ]
        },
        {
          "uuid": "a15af1a9-5705-6c4f-d9ac-c5e24ef748f9",
          "code": "300000053717",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5336f9f0-a5b0-bf9d-c897-0b22f5bca572"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "04e0fe3a-b2ce-441f-a903-346979c4aba2",
          "name": "4,4'-DIAMINO-3,3'-DICHLORODIPHENYLMETHANE",
          "stdName": "4,4'-DIAMINO-3,3'-DICHLORODIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "9a797ee6-5e91-484c-8ce7-9dcf44670abc"
          ],
          "display_name": false
        },
        {
          "uuid": "31b8cd9e-b40c-414d-ad9d-ffe315ed29c1",
          "name": "4,4'-METHYLENEBIS(2-CHLOROANILINE)",
          "stdName": "4,4'-METHYLENEBIS(2-CHLOROANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "1ffb5cee-82bd-4bce-9f9f-08f2db2b175c",
            "82f686b7-811b-4b6c-b485-99fcdb52daf9",
            "280a50ed-9d4a-451d-b645-ce50719857a8"
          ],
          "display_name": true
        },
        {
          "uuid": "4f3c96c0-81ad-c6ac-7bf2-101f8f061758",
          "name": "4,4'-METHYLENEBIS(2-CHLOROANILINE) [IARC]",
          "stdName": "4,4'-METHYLENEBIS(2-CHLOROANILINE) [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27ad7dda-1986-3615-5af8-8fcb9796b441"
          ],
          "display_name": false
        },
        {
          "uuid": "b3d36d58-66e6-45ba-bfa1-e78640222f29",
          "name": "4,4'-METHYLENEBIS(2-CHLOROANILINE) [MI]",
          "stdName": "4,4'-METHYLENEBIS(2-CHLOROANILINE) [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "280a50ed-9d4a-451d-b645-ce50719857a8"
          ],
          "display_name": false
        },
        {
          "uuid": "b0633e58-3292-4b82-b259-6bc73d540b67",
          "name": "4,4'-METHYLENEBIS(2-CHLOROBENZENAMINE)",
          "stdName": "4,4'-METHYLENEBIS(2-CHLOROBENZENAMINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "9a797ee6-5e91-484c-8ce7-9dcf44670abc"
          ],
          "display_name": false
        },
        {
          "uuid": "e36842b2-1573-4855-a02a-e0a9df3a796b",
          "name": "BENZENAMINE, 4,4'-METHYLENEBIS(2-CHLORO-",
          "stdName": "BENZENAMINE, 4,4'-METHYLENEBIS(2-CHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "e9706b9c-d569-430c-92ce-4c7999d37f3d"
          ],
          "display_name": false
        },
        {
          "uuid": "18a6bbd3-f96c-46a2-ae34-1e32a898ee20",
          "name": "DI-(4-AMINO-3-CHLOROPHENYL)METHANE",
          "stdName": "DI-(4-AMINO-3-CHLOROPHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "9a797ee6-5e91-484c-8ce7-9dcf44670abc"
          ],
          "display_name": false
        },
        {
          "uuid": "075c25b9-d69d-45d9-b551-93bbeea7ccba",
          "name": "METHYLENEBIS(CHLOROANILINE) [HSDB]",
          "stdName": "METHYLENEBIS(CHLOROANILINE) [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53dd2285-8e53-47d3-be47-5cd4eab3bbf1",
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c"
          ],
          "display_name": false
        },
        {
          "uuid": "0240a158-40fc-45eb-a77e-945791dda97f",
          "name": "METHYLENEBIS(O-CHLOROANILINE)",
          "stdName": "METHYLENEBIS(O-CHLOROANILINE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "9a797ee6-5e91-484c-8ce7-9dcf44670abc"
          ],
          "display_name": false
        },
        {
          "uuid": "511e8a7b-49be-4654-bedd-7f39c50e83a0",
          "name": "NSC-52954",
          "stdName": "NSC-52954",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
            "e9706b9c-d569-430c-92ce-4c7999d37f3d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1ffb5cee-82bd-4bce-9f9f-08f2db2b175c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9a797ee6-5e91-484c-8ce7-9dcf44670abc",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1640a367-8b1c-42f1-b146-e6a6b8f0521c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9706b9c-d569-430c-92ce-4c7999d37f3d",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "280a50ed-9d4a-451d-b645-ce50719857a8",
          "citation": "MI 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53dd2285-8e53-47d3-be47-5cd4eab3bbf1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14d39343-dd0e-4669-9b22-fc35d095adda",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71da165d-304e-4832-87d7-2ebf1c10646a",
          "citation": "SRS import [3L2W5VTT2A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3L2W5VTT2A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aca9db45-75ae-4c9b-a1eb-8fd91a4fefe7",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82f686b7-811b-4b6c-b485-99fcdb52daf9",
          "citation": "4,4'-METHYLENEBIS(2-CHLOROANILINE) [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7465935-3e73-26d5-77da-e0178779fb3b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+101-14-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c30236b-640e-cc8e-86d3-903a53f16691",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101-14-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27ad7dda-1986-3615-5af8-8fcb9796b441",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "839f45e3-b642-ed83-a707-e418d34bfb70",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "8d077c83-724c-a722-88c5-243ca17bfe0f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bc9e2fc4-81e5-415e-a3e1-0cdddb308273",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5336f9f0-a5b0-bf9d-c897-0b22f5bca572",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1d59abe0-7ea5-423d-ad33-a68ca2458c8f",
          "id": "1d59abe0-7ea5-423d-ad33-a68ca2458c8f",
          "molfile": "\n  Marvin  01132101412D          \n\n 17 18  0  0  0  0            999 V2000\n    9.8780   -4.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1587   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7197   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7197   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0107   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2991   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2991   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5820   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8627   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1384   -4.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8627   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1384   -5.8830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5820   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1587   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8780   -5.8830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 16  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 15  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Cc2ccc(c(c2)Cl)N)Cl)N",
          "formula": "C13H12Cl2N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3b7e7883-3945-4185-8cad-fbc702588206"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "267.1541",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cacfbc6d-949c-4e6d-903b-bf1354606841",
      "version": "11",
      "structure": {
        "id": "5024fbb1-0210-4426-bea4-d62fa4f7afa5",
        "molfile": "\n  Marvin  01132104112D          \n\n 17 18  0  0  0  0            999 V2000\n    4.8627   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8627   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5820   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2991   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2991   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5820   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0107   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7197   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -5.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1587   -5.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1587   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8780   -4.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7197   -4.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8780   -5.8830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1384   -4.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1384   -5.8830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n  8 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n  2 16  1  0  0  0  0\n  1 17  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Cc2ccc(c(c2)Cl)N)Cl)N",
        "formula": "C13H12Cl2N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "267.1541",
        "optical_activity": "NONE",
        "references": [
          "aca9db45-75ae-4c9b-a1eb-8fd91a4fefe7",
          "71da165d-304e-4832-87d7-2ebf1c10646a"
        ],
        "stereo_centers": 0
      },
      "unii": "3L2W5VTT2A"
    }
  ]
}