{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "38bbf0e9-dd7f-4c53-a79b-f0b3d68d0232",
          "code": "59756-60-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59756-60-4",
          "code_system": "CAS",
          "references": [
            "dafe1332-756a-45b6-acfb-12f70e640c8c",
            "5df97a01-5f64-44b5-b8ce-922aa72c3e17"
          ]
        },
        {
          "uuid": "4f9dc7fc-d1a7-484a-9786-fe4b922ef302",
          "code": "112900",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2407",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "dafe1332-756a-45b6-acfb-12f70e640c8c"
          ]
        },
        {
          "uuid": "d627a900-9b56-4501-8d62-cc60f57eefa1",
          "code": "261-916-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.269",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dafe1332-756a-45b6-acfb-12f70e640c8c"
          ]
        },
        {
          "uuid": "931b6357-a554-40e8-a3ae-02854e39fa34",
          "code": "43079",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/43079",
          "code_system": "PUBCHEM",
          "references": [
            "dafe1332-756a-45b6-acfb-12f70e640c8c"
          ]
        },
        {
          "uuid": "060c9062-4bcd-1da0-4e89-77f095ec408e",
          "code": "6653",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6653",
          "code_system": "HSDB",
          "references": [
            "6b52cbb9-c6b7-be8e-607b-7b58d68b897c"
          ]
        },
        {
          "uuid": "17b3f81a-9a63-6dbe-bb7a-d59050fccdb0",
          "code": "DTXSID8024107",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024107",
          "code_system": "EPA CompTox",
          "references": [
            "45c718f5-7ae2-91cb-ed8c-48e050b9c23e"
          ]
        },
        {
          "uuid": "c20d6e38-9a09-123b-7b5d-b01a3c791d50",
          "code": "Fluridone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluridone",
          "code_system": "WIKIPEDIA",
          "references": [
            "dcdea93b-be18-a5e7-7332-80aa5e2238e0"
          ]
        },
        {
          "uuid": "917134be-f200-468b-bcfb-23df8cbb526e",
          "code": "3L0JQA61JX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e1aabf54-9afc-85b1-bd72-104c91809bdf",
          "code": "fluridone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluridone.html",
          "code_system": "ALANWOOD",
          "references": [
            "00ea00cf-494e-d0a2-fc98-907d11ebf862"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "09dca27d-77d3-4dc7-8a5b-2ee8584f4389",
          "name": "1-METHYL-3-PHENYL-5-(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL)-4-PYRIDONE",
          "stdName": "1-METHYL-3-PHENYL-5-(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL)-4-PYRIDONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a626f660-40e3-413b-96bd-3b19d900cbbe",
            "e18c272a-74d5-4d8b-816c-851251bc1059"
          ],
          "display_name": false
        },
        {
          "uuid": "55635214-94c4-4c47-b5ff-c0b7fb5dfbcb",
          "name": "1-METHYL-3-PHENYL-5-(3-(TRIFLUOROMETHYL)PHENYL)-4(1H)-PYRIDINONE",
          "stdName": "1-METHYL-3-PHENYL-5-(3-(TRIFLUOROMETHYL)PHENYL)-4(1H)-PYRIDINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d461d8-f9c8-4518-b468-596a5e83f051",
            "e18c272a-74d5-4d8b-816c-851251bc1059"
          ],
          "display_name": false
        },
        {
          "uuid": "0c12df6d-b9cb-497d-b482-5d2e6fc8ec4e",
          "name": "AVAST",
          "stdName": "AVAST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "a6b9667c-143f-45cc-bc3a-8337682becf0"
          ],
          "display_name": false
        },
        {
          "uuid": "c2dcee8e-7975-4796-934c-8e285b8aa7bd",
          "name": "EL-171",
          "stdName": "EL-171",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "a6b9667c-143f-45cc-bc3a-8337682becf0"
          ],
          "display_name": false
        },
        {
          "uuid": "c8c8d4c3-4fe3-4ee2-b92c-0c809e185bab",
          "name": "FLURIDONE",
          "stdName": "FLURIDONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06a43265-3647-4746-a8de-2a69eebb36e0",
            "12905362-138c-4b0c-b48b-a51483fe089d",
            "41a834cc-e388-4b08-8243-445fb1de0400",
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "dc942e2f-25a5-474b-b815-82655dc2b932",
            "718ada2c-6e4e-4874-bc51-9f9cfc4f0e9c"
          ],
          "display_name": true
        },
        {
          "uuid": "d38264a4-edd7-4100-92ba-cae618f4fe5c",
          "name": "FLURIDONE [HSDB]",
          "stdName": "FLURIDONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "718ada2c-6e4e-4874-bc51-9f9cfc4f0e9c"
          ],
          "display_name": false
        },
        {
          "uuid": "19660182-e682-4731-92da-a64e027a0c1f",
          "name": "FLURIDONE [ISO]",
          "stdName": "FLURIDONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06a43265-3647-4746-a8de-2a69eebb36e0",
            "af4659ee-79fa-474e-825f-002d193fe13a"
          ],
          "display_name": false
        },
        {
          "uuid": "0c6c3dcf-4bfd-44a5-a37e-41ff5a423969",
          "name": "PRIDE",
          "stdName": "PRIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "a6b9667c-143f-45cc-bc3a-8337682becf0"
          ],
          "display_name": false
        },
        {
          "uuid": "f1d9a612-bc40-4a5b-b51d-698649426f42",
          "name": "SONAR",
          "stdName": "SONAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af4659ee-79fa-474e-825f-002d193fe13a",
            "a6b9667c-143f-45cc-bc3a-8337682becf0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "41a834cc-e388-4b08-8243-445fb1de0400",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e18c272a-74d5-4d8b-816c-851251bc1059",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a626f660-40e3-413b-96bd-3b19d900cbbe",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20d461d8-f9c8-4518-b468-596a5e83f051",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6b9667c-143f-45cc-bc3a-8337682becf0",
          "citation": "SITTIG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af4659ee-79fa-474e-825f-002d193fe13a",
          "citation": "KNOVEL CONTENT",
          "doc_type": "KNOVEL CONTENT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "718ada2c-6e4e-4874-bc51-9f9cfc4f0e9c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06a43265-3647-4746-a8de-2a69eebb36e0",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dafe1332-756a-45b6-acfb-12f70e640c8c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390959000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "288ddd1a-c421-4358-8d00-1adda73b09fd",
          "citation": "SRS import [3L0JQA61JX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3L0JQA61JX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390959000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b39d1033-97a2-497d-b141-7db6f4669479",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc942e2f-25a5-474b-b815-82655dc2b932",
          "citation": "FLURIDONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12905362-138c-4b0c-b48b-a51483fe089d",
          "citation": "FLURIDONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b52cbb9-c6b7-be8e-607b-7b58d68b897c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+59756-60-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "45c718f5-7ae2-91cb-ed8c-48e050b9c23e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59756-60-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dcdea93b-be18-a5e7-7332-80aa5e2238e0",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "00ea00cf-494e-d0a2-fc98-907d11ebf862",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "5df97a01-5f64-44b5-b8ce-922aa72c3e17",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3238bbab-d724-4dd4-9ed8-d2a03c029f76",
          "id": "3238bbab-d724-4dd4-9ed8-d2a03c029f76",
          "molfile": "\n  Marvin  01132102412D          \n\n 24 26  0  0  0  0            999 V2000\n    7.1015   -2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -3.0928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8174   -3.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8174   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5291   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2451   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9568   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9568   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2451   -5.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5291   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -5.5905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3851   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3851   -3.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2464   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2464   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -5.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -6.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -7.6538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1177   -6.8210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7825   -6.8210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "Cn1cc(-c2ccccc2)c(=O)c(c1)-c3cccc(c3)C(F)(F)F",
          "formula": "C19H14F3NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8cf57fc2-fbdd-4cdb-87bb-cf3f6e04ac91"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "329.3165",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "36c42790-35dd-401d-8345-9b3f298b109b",
      "version": "6",
      "structure": {
        "id": "d383b4d8-d128-4e1a-be1c-0707928492fd",
        "molfile": "\n  Marvin  01132110562D          \n\n 24 26  0  0  0  0            999 V2000\n    6.3851   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -5.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2464   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2464   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -6.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -7.6538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1177   -6.8210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7825   -6.8210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8174   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5291   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2451   -4.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9568   -4.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9568   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2451   -5.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5291   -5.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8174   -3.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -3.0928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3851   -3.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1015   -5.5905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 14 19  1  0  0  0  0\n 13 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n  1 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 12 24  2  0  0  0  0\nM  END",
        "smiles": "Cn1cc(-c2ccccc2)c(=O)c(c1)-c3cccc(c3)C(F)(F)F",
        "formula": "C19H14F3NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "329.3165",
        "optical_activity": "NONE",
        "references": [
          "b39d1033-97a2-497d-b141-7db6f4669479",
          "288ddd1a-c421-4358-8d00-1adda73b09fd"
        ],
        "stereo_centers": 0
      },
      "unii": "3L0JQA61JX"
    }
  ]
}