{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a9dcffe1-9416-4164-b43e-84b4b330c438", "code": "3698-54-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3698-54-2", "code_system": "CAS", "references": [ "421443c0-ebfa-4c11-8ef0-850ba6c6babc", "795eae8c-00b9-4471-b2dd-528bfc5afa56" ] }, { "uuid": "0b580e73-1e2b-4621-a992-c4ca69fdabb1", "code": "19431", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19431", "code_system": "PUBCHEM", "references": [ "421443c0-ebfa-4c11-8ef0-850ba6c6babc" ] }, { "uuid": "334f952a-f7fb-9cf1-21c5-f43435e1f878", "code": "DTXSID6075300", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6075300", "code_system": "EPA CompTox", "references": [ "b9299ece-d56e-37ef-8a31-c57f8babebbb" ] }, { "uuid": "01a4abbc-6466-38f5-b9f4-0ecdeb92a92a", "code": "76526", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=76526", "code_system": "NSC", "references": [ "b8a13c62-b05c-aae7-c8a9-863265017183" ] }, { "uuid": "94b527f2-cb74-465c-bfa6-8f058439e2d4", "code": "3JRC28X3HG", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "795eae8c-00b9-4471-b2dd-528bfc5afa56" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e63f6270-7797-4ab7-b1ec-e7fe771fc046", "name": "2,3,4,6-Tetranitroaniline", "stdName": "2,3,4,6-TETRANITROANILINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "795eae8c-00b9-4471-b2dd-528bfc5afa56" ], "display_name": true }, { "uuid": "1137cafd-4f3d-4fd6-b0e0-30db85afbb2e", "name": "2,3,4,6-Tetranitrobenzenamine", "stdName": "2,3,4,6-TETRANITROBENZENAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e2ff1cd1-962f-4668-a577-c4611874b9bf", "e6806a99-dc24-4a17-a870-1fc3c93864d7" ], "display_name": false }, { "uuid": "6bb0251c-bc92-4883-9346-958122ac5e03", "name": "Aniline, 2,3,4,6-tetranitro-", "stdName": "ANILINE, 2,3,4,6-TETRANITRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "795eae8c-00b9-4471-b2dd-528bfc5afa56" ], "display_name": false }, { "uuid": "15d8aab0-dcaa-402a-8951-c2ce356dc6e3", "name": "Benzenamine, 2,3,4,6-tetranitro-", "stdName": "BENZENAMINE, 2,3,4,6-TETRANITRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "795eae8c-00b9-4471-b2dd-528bfc5afa56" ], "display_name": false }, { "uuid": "db2fcf80-262e-48c4-b1d2-9f2ba37b71b9", "name": "NSC-76526", "stdName": "NSC-76526", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e2ff1cd1-962f-4668-a577-c4611874b9bf", "e6806a99-dc24-4a17-a870-1fc3c93864d7" ], "display_name": false } ], "references": [ { "uuid": "e2ff1cd1-962f-4668-a577-c4611874b9bf", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e6806a99-dc24-4a17-a870-1fc3c93864d7", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "421443c0-ebfa-4c11-8ef0-850ba6c6babc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394135000, "tags": [ "NOMEN" ] }, { "uuid": "b9299ece-d56e-37ef-8a31-c57f8babebbb", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3698-54-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "795eae8c-00b9-4471-b2dd-528bfc5afa56", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b8a13c62-b05c-aae7-c8a9-863265017183", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e46533b8-b88b-4579-bd2a-65c991a6c28f", "id": "e46533b8-b88b-4579-bd2a-65c991a6c28f", "molfile": "\n Marvin 01132111492D \n\n 19 19 0 0 0 0 999 V2000\n -0.2589 1.7128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 0.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9726 0.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9726 -0.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 -0.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4506 -0.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4506 0.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1561 0.9033 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 1.1602 1.7250 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.8657 0.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1663 -0.7667 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 1.8881 -0.3670 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.1663 -1.5985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 -1.5802 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 0.4506 -2.0003 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -0.9726 -2.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6944 0.9033 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -2.4101 0.4832 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.6944 1.7128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 3 17 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 5 14 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 11 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\nM CHG 8 8 1 9 -1 11 1 12 -1 14 1 15 -1 17 1 18 -1\nM END", "smiles": "c1c(c(c(c(c1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])N)[N+](=O)[O-]", "formula": "C6H3N5O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4e131515-6b4d-413e-b7d6-3626e998286b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.117", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "963492b5-fc14-4631-8623-94e1807cd102", "version": "6", "structure": { "id": "b885891c-0267-405f-8e6b-1a7ac798442f", "molfile": "\n Marvin 01132109332D \n\n 19 19 0 0 0 0 999 V2000\n 0.4506 -0.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4506 0.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 -0.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1663 -0.7667 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.2589 0.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1561 0.9033 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.9726 -0.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 -1.5802 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 1.8881 -0.3670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1663 -1.5985 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -0.9726 0.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2589 1.7128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1602 1.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8657 0.4995 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.4506 -2.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9726 -2.0003 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.6944 0.9033 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -2.4101 0.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6944 1.7128 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 2 0 0 0 0\n 3 8 1 0 0 0 0\n 4 9 2 0 0 0 0\n 4 10 1 0 0 0 0\n 5 11 2 0 0 0 0\n 5 12 1 0 0 0 0\n 6 13 2 0 0 0 0\n 6 14 1 0 0 0 0\n 8 15 2 0 0 0 0\n 8 16 1 0 0 0 0\n 11 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 7 11 1 0 0 0 0\nM CHG 8 4 1 6 1 8 1 10 -1 14 -1 16 -1 17 1 19 -1\nM END", "smiles": "c1c(c(c(c(c1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])N)[N+](=O)[O-]", "formula": "C6H3N5O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.117", "optical_activity": "NONE", "references": [ "e2ff1cd1-962f-4668-a577-c4611874b9bf" ], "stereo_centers": 0 }, "unii": "3JRC28X3HG" } ] }