{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2df34e0c-5c8e-47d3-8baf-5026913380e7",
          "code": "138-37-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138-37-4",
          "code_system": "CAS",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101",
            "5314e511-77ed-4ca6-b074-27ee01520055"
          ]
        },
        {
          "uuid": "ddc914f3-5f0b-4515-b75b-41d5f109557d",
          "code": "C76107",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76107",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101"
          ]
        },
        {
          "uuid": "1ab653b1-602c-4660-aa28-91cb3c15ae0c",
          "code": "m6982",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6982?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101"
          ]
        },
        {
          "uuid": "bc9014fa-ca8a-4b1a-8dc1-05a287dba904",
          "code": "SUB02999MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101"
          ]
        },
        {
          "uuid": "4d056834-bfb0-4f2d-883d-adb1ad31c904",
          "code": "CHEMBL419",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL419",
          "code_system": "ChEMBL",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101"
          ]
        },
        {
          "uuid": "59682ddd-8604-4e3d-ba3d-5cff30d205ff",
          "code": "205-325-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.842",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1543e61b-1c50-4c16-a5c0-126536a69101"
          ]
        },
        {
          "uuid": "eaa45972-5649-f8ee-8c03-c976e893769b",
          "code": "DTXSID6045296",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045296",
          "code_system": "EPA CompTox",
          "references": [
            "e8a6fc40-b463-1990-961b-247096c86048"
          ]
        },
        {
          "uuid": "972fbf90-c382-5d6e-ff32-fcb4c0edfc26",
          "code": "C29577",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Carbonic Anhydrase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29577",
          "code_system": "NCI_THESAURUS",
          "references": [
            "749bdc10-96d1-dc62-0b77-aaf3496f145a"
          ]
        },
        {
          "uuid": "42ab5ea4-d4bc-1cb5-16cd-31f7292f6df2",
          "code": "67313",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67313",
          "code_system": "PUBCHEM",
          "references": [
            "95331634-2eca-3fed-53f6-0153b6ff8d0c"
          ]
        },
        {
          "uuid": "77ba128b-d84c-4d45-ad00-50d2a56f3cce",
          "code": "3J751V0284",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e25296e7-bb1e-453b-3cf8-3e99223d2f50",
          "code": "100000086175",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d08602b8-dc08-fa66-b1ed-ad4f5d7f98fb"
          ]
        },
        {
          "uuid": "7284965e-95d3-cdf4-65e0-aa438e85820c",
          "code": "3527",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3527",
          "code_system": "NSC",
          "references": [
            "f6288759-5ca6-9d01-1662-2e16a932aaab"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "548015b5-1d23-447b-b469-683db6cbf3bb",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2e9618d9-8793-4f15-8005-ea42c7ae758c",
            "refuuid": "5a1c9721-6047-495b-b3e7-5ee1ccd04b04",
            "name": "MAFENIDE",
            "unii": "58447S8P4L",
            "linking_id": "58447S8P4L",
            "ref_pname": "MAFENIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e41513c-7303-421f-ba15-2f40c98f78c2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ce2e202f-ddce-46ae-a27f-7feda92a0f5b",
            "refuuid": "5a1c9721-6047-495b-b3e7-5ee1ccd04b04",
            "name": "MAFENIDE",
            "unii": "58447S8P4L",
            "linking_id": "58447S8P4L",
            "ref_pname": "MAFENIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bde49424-8004-4656-be94-82439b5a64ee",
          "name": "4-(AMINOMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE",
          "stdName": "4-(AMINOMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        },
        {
          "uuid": "796b7483-8aa2-4f41-b641-65e460eca6f0",
          "name": "4-HOMOSULFANILAMIDE HYDROCHLORIDE",
          "stdName": "4-HOMOSULFANILAMIDE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        },
        {
          "uuid": "e9e73f73-ac2b-48eb-adab-20d4e9f0bb9a",
          "name": "AMBAMIDE HYDROCHLORIDE",
          "stdName": "AMBAMIDE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        },
        {
          "uuid": "0e89ae30-1de9-42d5-a543-4eed994ce2d3",
          "name": "BENZENESULFONAMIDE, 4-(AMINOMETHYL)-, MONOHYDROCHLORIDE",
          "stdName": "BENZENESULFONAMIDE, 4-(AMINOMETHYL)-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        },
        {
          "uuid": "6cab7873-e2b8-4cb3-9b77-86918ad07ed9",
          "name": "MAFENIDE HCL",
          "stdName": "MAFENIDE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "21c432e3-55dc-40fc-91ef-5bc8abc27805",
            "2b57a7db-7e82-42e0-b3ca-be763a9966a2",
            "ce60df52-4025-4582-8186-fa141bc0cb15",
            "115fa23e-ed57-4058-adde-845e4b752ec5"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7f873f9c-41a0-4882-88f7-123757bf0acf",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dbb6e90d-a964-48c9-a589-7f2ea3f70c33",
          "name": "MAFENIDE HYDROCHLORIDE",
          "stdName": "MAFENIDE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fc5d19e-be43-4109-8d72-ed44a91cabd0",
            "21c432e3-55dc-40fc-91ef-5bc8abc27805",
            "d629ae8e-de93-4493-9fac-6604ac64b705",
            "3a1bd1c1-d9e8-425d-a859-117f5650249d",
            "2c091b7f-715e-408c-b03c-6b6c9a5ebe53",
            "7aea8c6c-e389-4891-82e1-9e63a0efc588"
          ],
          "display_name": true
        },
        {
          "uuid": "94ddb39e-e2dd-4559-9846-ff60c0f0b83d",
          "name": "MAFENIDE HYDROCHLORIDE [MI]",
          "stdName": "MAFENIDE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21c432e3-55dc-40fc-91ef-5bc8abc27805",
            "2c091b7f-715e-408c-b03c-6b6c9a5ebe53"
          ],
          "display_name": false
        },
        {
          "uuid": "ca09fe49-55e5-40de-bf36-9ff75abede1e",
          "name": "MESUDIN HYDROCHLORIDE",
          "stdName": "MESUDIN HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        },
        {
          "uuid": "cd4aacc4-ae78-59fd-8dd2-34352b7a6e8c",
          "name": "Mafenide hydrochloride [WHO-DD]",
          "stdName": "MAFENIDE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16e3494f-b93a-7f5b-989c-abc2612e6758"
          ],
          "display_name": false
        },
        {
          "uuid": "65262f17-c08b-4157-9039-7700435120f5",
          "name": "NSC-3527",
          "stdName": "NSC-3527",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21c432e3-55dc-40fc-91ef-5bc8abc27805",
            "46736afe-57a6-4b2d-a2e4-8bcec11e98ce"
          ],
          "display_name": false
        },
        {
          "uuid": "eb20e4d6-b15a-4a68-b89d-4585c28300df",
          "name": "P-TOLUENESULFONAMIDE, .ALPHA.-AMINO-, MONOHYDROCHLORIDE",
          "stdName": "P-TOLUENESULFONAMIDE, .ALPHA.-AMINO-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
            "06a89ce6-043a-402b-9f39-c2e30076d42d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "06a89ce6-043a-402b-9f39-c2e30076d42d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd771a6e-96ad-4fd2-8689-ba044f5c88c4",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fc5d19e-be43-4109-8d72-ed44a91cabd0",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce60df52-4025-4582-8186-fa141bc0cb15",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b57a7db-7e82-42e0-b3ca-be763a9966a2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21c432e3-55dc-40fc-91ef-5bc8abc27805",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d629ae8e-de93-4493-9fac-6604ac64b705",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c091b7f-715e-408c-b03c-6b6c9a5ebe53",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46736afe-57a6-4b2d-a2e4-8bcec11e98ce",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1543e61b-1c50-4c16-a5c0-126536a69101",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a240595-bdfe-4fe2-90f1-d39be220395a",
          "citation": "SRS import [3J751V0284]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3J751V0284",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fe6186d-fa4f-4294-9e0c-2b6259f477c7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "115fa23e-ed57-4058-adde-845e4b752ec5",
          "citation": "MAFENIDE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a1bd1c1-d9e8-425d-a859-117f5650249d",
          "citation": "MAFENIDE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7aea8c6c-e389-4891-82e1-9e63a0efc588",
          "citation": "MAFENIDE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8a6fc40-b463-1990-961b-247096c86048",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=138-37-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d08602b8-dc08-fa66-b1ed-ad4f5d7f98fb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "749bdc10-96d1-dc62-0b77-aaf3496f145a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5314e511-77ed-4ca6-b074-27ee01520055",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "95331634-2eca-3fed-53f6-0153b6ff8d0c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "f6288759-5ca6-9d01-1662-2e16a932aaab",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "16e3494f-b93a-7f5b-989c-abc2612e6758",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ad7e554b-88ce-4900-9c95-315bca5797f2",
          "id": "ad7e554b-88ce-4900-9c95-315bca5797f2",
          "molfile": "\n  Marvin  01132109002D          \n\n  1  0  0  0  0  0            999 V2000\n    0.1573   -3.1735    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6574b4d7-4e07-4af0-85bc-62a93e84a601"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "05c59f3e-a9e2-46d6-93f9-01ac60507713",
          "id": "05c59f3e-a9e2-46d6-93f9-01ac60507713",
          "molfile": "\n  Marvin  01132100352D          \n\n 12 12  0  0  0  0            999 V2000\n    1.0080   -1.4643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5981   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2475   -2.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6702   -1.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4694   -1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8999   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4823   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6625   -2.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7300   -2.1913    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7506   -1.4101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7068   -3.0084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5395   -2.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  9  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12  9  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1CN)S(=O)(=O)N",
          "formula": "C7H10N2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "55801252-eff8-48c1-a981-831033dd94ab"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "186.2329",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3ea5d119-a7c8-407f-858d-7e50df0d0615",
      "version": "11",
      "structure": {
        "id": "8ce22f3b-c298-47a8-bbd7-8ba556a59051",
        "molfile": "\n  Marvin  01132107192D          \n\n 13 12  0  0  0  0            999 V2000\n   -2.7300   -2.1913    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8999   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7068   -3.0084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5395   -2.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7506   -1.4101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4823   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4694   -1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6702   -1.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6625   -2.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2475   -2.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0080   -1.4643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5981   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1573   -3.1735    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 10  1  0  0  0  0\n 10  9  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1CN)S(=O)(=O)N.Cl",
        "formula": "C7H10N2O2S.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "222.6937",
        "optical_activity": "NONE",
        "references": [
          "4fe6186d-fa4f-4294-9e0c-2b6259f477c7",
          "7a240595-bdfe-4fe2-90f1-d39be220395a"
        ],
        "stereo_centers": 0
      },
      "unii": "3J751V0284"
    }
  ]
}