{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c3a6f45e-16da-41fd-9dba-9f326cfddf98", "code": "64265-57-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=64265-57-2", "code_system": "CAS", "references": [ "9966ee52-a3a7-49aa-9db0-40b58f00cfd1", "8b4873c4-f018-4687-94bc-f6857edca3cb" ] }, { "uuid": "0f9f0742-18d6-4cf0-a516-09001c8d71dd", "code": "264-763-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.858", "code_system": "ECHA (EC/EINECS)", "references": [ "9966ee52-a3a7-49aa-9db0-40b58f00cfd1" ] }, { "uuid": "ca1e4ebc-d95f-4681-90e5-8fc18500f534", "code": "94611", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94611", "code_system": "PUBCHEM", "references": [ "9966ee52-a3a7-49aa-9db0-40b58f00cfd1" ] }, { "uuid": "9d02e991-4ebd-5696-a593-3bb1c8ad2bae", "code": "DTXSID1052327", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1052327", "code_system": "EPA CompTox", "references": [ "908029b9-02c6-49ed-4c2e-b831fef8550e" ] }, { "uuid": "7ccd8f3f-7c13-4a07-a704-52c0e446537e", "code": "3IBU45G41K", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "34ce8d90-920f-113b-7c53-ab3020a6d502", "name": "2-ETHYL-2-((3-(2-METHYL-1-AZIRIDINYL)-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL BIS(2-METHYL-1-AZIRIDINEPROPANOATE)", "stdName": "2-ETHYL-2-((3-(2-METHYL-1-AZIRIDINYL)-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL BIS(2-METHYL-1-AZIRIDINEPROPANOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2eef6dab-677e-dc02-cb2b-cb921ffbda2d" ], "display_name": false }, { "uuid": "71375482-9bda-082a-07e4-dedfd0226121", "name": "AS-316", "stdName": "AS-316", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2eef6dab-677e-dc02-cb2b-cb921ffbda2d" ], "display_name": false }, { "uuid": "b330bce1-f2e3-ceb7-aa72-664c94f75d25", "name": "PERMATEX XR 2500", "stdName": "PERMATEX XR 2500", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2eef6dab-677e-dc02-cb2b-cb921ffbda2d" ], "display_name": false }, { "uuid": "b1fd12e8-7a5f-b0a0-211c-7446d950163a", "name": "PZ-28", "stdName": "PZ-28", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2eef6dab-677e-dc02-cb2b-cb921ffbda2d" ], "display_name": false }, { "uuid": "ec504bce-4236-47d7-923a-03b26e3c39f4", "name": "TRIMETHYLOLPROPANE TRIS(2-METHYL-1-AZIRIDINEPROPIONATE)", "stdName": "TRIMETHYLOLPROPANE TRIS(2-METHYL-1-AZIRIDINEPROPIONATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "19c4935f-2c68-4427-8eca-0ad8537539a3", "e672a0fa-0215-4719-8225-a69e2d059f19" ], "display_name": true }, { "uuid": "418d3988-e2c6-e74d-e199-04302f7649bc", "name": "XR-2500", "stdName": "XR-2500", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2eef6dab-677e-dc02-cb2b-cb921ffbda2d" ], "display_name": false } ], "references": [ { "uuid": "e672a0fa-0215-4719-8225-a69e2d059f19", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "19c4935f-2c68-4427-8eca-0ad8537539a3", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9966ee52-a3a7-49aa-9db0-40b58f00cfd1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393945000, "tags": [ "NOMEN" ] }, { "uuid": "908029b9-02c6-49ed-4c2e-b831fef8550e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64265-57-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2eef6dab-677e-dc02-cb2b-cb921ffbda2d", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8b4873c4-f018-4687-94bc-f6857edca3cb", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5410de75-c284-4102-b0d3-113e5b086939", "id": "5410de75-c284-4102-b0d3-113e5b086939", "molfile": "\n Marvin 01132104222D \n\n 33 35 0 0 0 0 999 V2000\n 4.1550 -2.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8463 -3.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3849 -4.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0007 -3.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6243 -2.6900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3400 -3.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3429 -3.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0467 -2.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7624 -3.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4701 -2.6737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8704 -1.9555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2951 -2.6628 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.0133 -3.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1280 -4.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7490 -4.2014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4647 -4.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4676 -5.4339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1714 -4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8872 -4.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5949 -4.1851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9953 -3.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4199 -4.1742 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.1381 -4.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7144 -4.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9041 -4.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1892 -4.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1880 -5.4382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4817 -4.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7668 -4.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0551 -4.2056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6440 -3.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2329 -4.2056 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -0.4831 -4.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 14 3 1 0 0 0 0\n 3 24 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 20 22 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "CCC(COC(=O)CCN1CC1C)(COC(=O)CCN2CC2C)COC(=O)CCN3CC3C", "formula": "C24H41N3O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "91c02ce6-e11c-4789-a1f0-614c2783f681" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "467.5998", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "INCOMPLETE", "uuid": "b50a3ea6-e6a2-4f6d-871c-4741fb90e4aa", "version": "5", "structure": { "id": "6ff30834-0238-47ca-aab6-028b9fd94730", "molfile": "\n Marvin 01132105482D \n\n 33 35 0 0 0 0 999 V2000\n 17.2269 -4.2821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2240 -3.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5083 -3.0495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9307 -3.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6464 -3.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3541 -3.0332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1792 -3.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8974 -3.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7545 -2.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8847 -3.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3516 -5.7935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3487 -4.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6330 -4.5610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0120 -4.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2689 -4.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7302 -3.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0389 -3.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5984 -4.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7880 -4.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0731 -4.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0719 -5.7978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3656 -4.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6507 -4.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9390 -4.5651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5279 -3.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1167 -4.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0554 -4.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7712 -4.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4790 -4.5447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3040 -4.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0222 -4.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8794 -3.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4008 -4.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 10 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 9 6 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 24 1 0 0 0 0\n 15 10 1 0 0 0 0\n 12 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 32 29 1 0 0 0 0\n 1 2 2 0 0 0 0\n 26 33 1 0 0 0 0\nM END", "smiles": "CCC(COC(=O)CCN1CC1C)(COC(=O)CCN2CC2C)COC(=O)CCN3CC3C", "formula": "C24H41N3O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "467.5998", "optical_activity": "UNSPECIFIED", "references": [ "e672a0fa-0215-4719-8225-a69e2d059f19" ], "stereo_centers": 3 }, "unii": "3IBU45G41K" } ] }