{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "edbf4e60-b41a-49ab-aa7c-6448efccee7d",
          "code": "16128-88-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16128-88-4",
          "code_system": "CAS",
          "references": [
            "04b60a94-88e4-404e-96db-8b2fc255ff9c",
            "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb"
          ]
        },
        {
          "uuid": "d6a90959-de24-475d-b1d7-49100b2cf820",
          "code": "542053",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/542053",
          "code_system": "PUBCHEM",
          "references": [
            "04b60a94-88e4-404e-96db-8b2fc255ff9c"
          ]
        },
        {
          "uuid": "72f69db9-9f0e-e47b-e941-d20b933cb439",
          "code": "2,5-Dimethoxy-4-ethoxyamphetamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2,5-Dimethoxy-4-ethoxyamphetamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "6f90a594-8b3d-1793-485f-0cb502332802"
          ]
        },
        {
          "uuid": "6592f3f8-f56f-2e2d-fb99-e5895ccef998",
          "code": "DTXSID00337348",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00337348",
          "code_system": "EPA CompTox",
          "references": [
            "3f25dfef-6a49-1013-a6a8-c77a05d0ecfa"
          ]
        },
        {
          "uuid": "0c8155e5-4941-4aed-8e48-3c3fbde4d34b",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "d2c87877-7eb0-439b-aef2-e1b495f6a241",
          "code": "3I0ORO8174",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8eabfa54-c9aa-d194-e9b0-f5e7120f2300",
          "code": "100000085625",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "00171c80-63cc-6ce3-5cc1-e3e0d495ba62"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9e11f4c2-5ae9-4ace-8ab2-88355615e3c6",
          "amount": {
            "uuid": "8750cd76-ec77-40f2-97d3-0ef9b28d602f"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "6f90a594-8b3d-1793-485f-0cb502332802"
          ],
          "related_substance": {
            "uuid": "19f75fd7-07f6-41bc-988e-9e6a5bbfb334",
            "refuuid": "ad3c9964-6127-49f7-96d4-7d1bb6454eb0",
            "name": "MEM",
            "unii": "3I0ORO8174",
            "linking_id": "3I0ORO8174",
            "ref_pname": "MEM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1a161ac3-4076-49a8-8ee6-b2dc22f0a334",
          "name": "(±)-1-(2,5-DIMETHOXY-4-ETHOXYPHENYL)-2-AMINOPROPANE",
          "stdName": "(+/-)-1-(2,5-DIMETHOXY-4-ETHOXYPHENYL)-2-AMINOPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb"
          ],
          "display_name": false
        },
        {
          "uuid": "adb41bef-c175-47fe-9861-783fdbf9e60a",
          "name": "(±)-1-(4-ETHOXY-2,5-DIMETHOXYPHENYL)-2-AMINOPROPANE",
          "stdName": "(+/-)-1-(4-ETHOXY-2,5-DIMETHOXYPHENYL)-2-AMINOPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb"
          ],
          "display_name": false
        },
        {
          "uuid": "302b17c2-8f7b-4f52-8441-1f6685c6f8e7",
          "name": "2,5-DIMETHOXY-4-ETHOXYAMPHETAMINE",
          "stdName": "2,5-DIMETHOXY-4-ETHOXYAMPHETAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f90a594-8b3d-1793-485f-0cb502332802"
          ],
          "display_name": false
        },
        {
          "uuid": "306d19a4-359c-472e-941f-f7fb09c803b9",
          "name": "BENZENEETHANAMINE, 4-ETHOXY-2,5-DIMETHOXY-.ALPHA.-METHYL-",
          "stdName": "BENZENEETHANAMINE, 4-ETHOXY-2,5-DIMETHOXY-.ALPHA.-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb"
          ],
          "display_name": false
        },
        {
          "uuid": "970cfd06-a004-45c7-a1cb-892e70b57ac6",
          "name": "MEM",
          "stdName": "MEM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f90a594-8b3d-1793-485f-0cb502332802"
          ],
          "display_name": true
        },
        {
          "uuid": "34b82f90-2aad-44f7-b1f2-63439f45b43d",
          "name": "MEM (PSYCHEDELIC)",
          "stdName": "MEM (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f90a594-8b3d-1793-485f-0cb502332802"
          ],
          "display_name": false
        },
        {
          "uuid": "396a2c7d-f91e-4def-a365-01895dcbfc8f",
          "name": "PHENETHYLAMINE, 4-ETHOXY-2,5-DIMETHOXY-.ALPHA.-METHYL-",
          "stdName": "PHENETHYLAMINE, 4-ETHOXY-2,5-DIMETHOXY-.ALPHA.-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "04b60a94-88e4-404e-96db-8b2fc255ff9c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393228000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21a091f8-a290-4e47-a060-dfa86b0cb61a",
          "citation": "SRS import [3I0ORO8174]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3I0ORO8174",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393228000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f90a594-8b3d-1793-485f-0cb502332802",
          "citation": "https://en.wikipedia.org/wiki/2,5-Dimethoxy-4-ethoxyamphetamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9461e8da-e7b7-b577-75fd-e31526810bf9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16128-88-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3f25dfef-6a49-1013-a6a8-c77a05d0ecfa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00171c80-63cc-6ce3-5cc1-e3e0d495ba62",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0595592a-44da-4fee-9add-a7e36c958469",
          "id": "0595592a-44da-4fee-9add-a7e36c958469",
          "molfile": "\n  Marvin  01132100352D          \n\n 17 17  0  0  0  0            999 V2000\n   10.9965   -5.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2820   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5675   -5.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1386   -5.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4241   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -5.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -5.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4241   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9952   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.2808   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9952   -4.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1386   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5675   -3.4217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2820   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 15  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  9  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCOc1cc(c(CC(C)N)cc1OC)OC",
          "formula": "C13H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3ebc9b5c-b8f0-4796-8ace-49f4b6c82820"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "239.3112",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ad3c9964-6127-49f7-96d4-7d1bb6454eb0",
      "version": "9",
      "structure": {
        "id": "8b32cb73-4918-40b4-971e-d92f24912b93",
        "molfile": "\n  Marvin  01132107142D          \n\n 17 17  0  0  0  0            999 V2000\n    5.9952   -4.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9952   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4241   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1386   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5675   -3.4217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2820   -3.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8531   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5675   -5.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2820   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9965   -5.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1386   -5.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4241   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -5.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7097   -5.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2808   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  6  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 13  2  0  0  0  0\n  4 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  2 17  1  0  0  0  0\nM  END",
        "smiles": "CCOc1cc(c(CC(C)N)cc1OC)OC",
        "formula": "C13H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "239.3112",
        "optical_activity": "( + / - )",
        "references": [
          "4518e021-f3b5-4cb9-90e1-9f65d2dfa2bb",
          "6f90a594-8b3d-1793-485f-0cb502332802"
        ],
        "stereo_centers": 1
      },
      "unii": "3I0ORO8174"
    }
  ]
}