{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "441036a7-aad3-4697-a6d9-8e9070191a22", "code": "14779-78-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14779-78-3", "code_system": "CAS", "references": [ "bba012dd-99bd-4380-b8b5-cddfa9ca3e7e", "11edb2e0-9b08-4bff-8d71-3e58ec525a0f" ] }, { "uuid": "e974825f-a71c-46ad-be43-7888aee98fe1", "code": "238-849-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.302", "code_system": "ECHA (EC/EINECS)", "references": [ "bba012dd-99bd-4380-b8b5-cddfa9ca3e7e" ] }, { "uuid": "63847cee-5773-4c22-918e-d211a0c5c564", "code": "26890", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26890", "code_system": "PUBCHEM", "references": [ "bba012dd-99bd-4380-b8b5-cddfa9ca3e7e" ] }, { "uuid": "5509b68f-1703-a945-8d87-b53b6cf05c02", "code": "DTXSID9065817", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9065817", "code_system": "EPA CompTox", "references": [ "679c0839-9e49-0a14-77cb-b6ca52148c6e" ] }, { "uuid": "30cd3052-42dd-4c6d-ab14-5f0206ecba4a", "code": "3I0HW37A8Q", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d30f88b3-c7c2-4028-8f8b-9c0f626f6c74", "name": "N-PENTYL P-DIMETHYLAMINOBENZOATE", "stdName": "N-PENTYL P-DIMETHYLAMINOBENZOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4c4b710a-7519-403a-a0b1-80a361b51420", "3422d5df-0d06-4665-a951-9f9b94c59b77" ], "display_name": false }, { "uuid": "000e3f6f-35e4-49cb-bb69-dbdfc25c50c9", "name": "PENTYL 4-DIMETHYLAMINOBENZOATE", "stdName": "PENTYL 4-DIMETHYLAMINOBENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9476509c-4fa5-4e80-ba0c-5b5bcdd10a1c", "3422d5df-0d06-4665-a951-9f9b94c59b77" ], "display_name": false }, { "uuid": "4922467b-54ac-4290-9673-5a71d30473e7", "name": "PENTYL P-DIMETHYLAMINOBENZOATE", "stdName": "PENTYL P-DIMETHYLAMINOBENZOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d21ccc1b-515a-4e92-8a28-9a4242c074ce", "3422d5df-0d06-4665-a951-9f9b94c59b77" ], "display_name": true } ], "references": [ { "uuid": "d21ccc1b-515a-4e92-8a28-9a4242c074ce", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3422d5df-0d06-4665-a951-9f9b94c59b77", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9476509c-4fa5-4e80-ba0c-5b5bcdd10a1c", "citation": "Martindale", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c4b710a-7519-403a-a0b1-80a361b51420", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bba012dd-99bd-4380-b8b5-cddfa9ca3e7e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391867000, "tags": [ "NOMEN" ] }, { "uuid": "94d7e615-84a4-4dd9-966f-d9b670019a5c", "citation": "SRS import [3I0HW37A8Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3I0HW37A8Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493391867000, "tags": [ "NOMEN" ] }, { "uuid": "679c0839-9e49-0a14-77cb-b6ca52148c6e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14779-78-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "11edb2e0-9b08-4bff-8d71-3e58ec525a0f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c3729e93-c9bb-4071-819b-8e2f83a861d4", "id": "c3729e93-c9bb-4071-819b-8e2f83a861d4", "molfile": "\n Marvin 01132110062D \n\n 17 17 0 0 0 0 999 V2000\n -1.0522 -3.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -3.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3601 -3.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0908 -3.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7982 -3.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5211 -3.7405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2363 -3.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2518 -2.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9438 -3.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6384 -3.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3252 -3.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3124 -4.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6564 -4.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9386 -4.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0816 -4.9676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8044 -4.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0893 -5.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 14 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 15 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 15 1 0 0 0 0\nM END", "smiles": "CCCCCOC(=O)c1ccc(cc1)N(C)C", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5b1aeb4c-fc19-4a78-8d64-6b1dc7799def" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f544a0a0-842a-4a28-a73c-983cf5d605da", "version": "3", "structure": { "id": "34ca1e71-b0ef-4af7-af8a-7ef338336ff8", "molfile": "\n Marvin 01132102492D \n\n 17 17 0 0 0 0 999 V2000\n 3.2363 -3.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9438 -3.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3124 -4.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0816 -4.9676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2518 -2.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9386 -4.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6384 -3.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3252 -3.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6564 -4.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5211 -3.7405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8044 -4.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0893 -5.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7982 -3.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0908 -3.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3370 -3.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3601 -3.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0522 -3.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 1 2 0 0 0 0\n 6 2 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 6 1 0 0 0 0\n 10 1 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 15 1 0 0 0 0\n 9 3 2 0 0 0 0\nM END", "smiles": "CCCCCOC(=O)c1ccc(cc1)N(C)C", "formula": "C14H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.3226", "optical_activity": "NONE", "references": [ "4c4b710a-7519-403a-a0b1-80a361b51420", "94d7e615-84a4-4dd9-966f-d9b670019a5c" ], "stereo_centers": 0 }, "unii": "3I0HW37A8Q" } ] }