{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "47360821-d514-43b4-906e-2dc9eec96e6d",
          "code": "853081-53-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=853081-53-5",
          "code_system": "CAS",
          "references": [
            "0526aa4e-17b5-40a9-9bf5-abf08856fcd1",
            "120d0605-43cf-45bd-b00d-64072e616880"
          ]
        },
        {
          "uuid": "6508874f-d2ae-4bd6-abbb-5fdc296073a9",
          "code": "4255950",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4255950",
          "code_system": "PUBCHEM",
          "references": [
            "0526aa4e-17b5-40a9-9bf5-abf08856fcd1"
          ]
        },
        {
          "uuid": "4608f0a3-ad17-7829-aecf-bf7b45b1b8c3",
          "code": "2046118",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2046118/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "feaac2df-cb4b-8a04-9c9e-b3d4bdb7e1e4"
          ]
        },
        {
          "uuid": "20c85d98-1dff-4102-a551-30438a371740",
          "code": "3HB4C300XB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3d4350a7-a783-c030-79bc-74510a57889c",
          "code": "3HB4C300XB",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3HB4C300XB",
          "code_system": "DAILYMED",
          "references": [
            "0a88fd90-637f-aa5a-38ee-ad8a9532e493"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b485fc76-007f-450c-9ca8-53426be89740",
          "name": "BENZAMIDE, 4-CHLORO-N-(2-METHOXYETHYL)-N-((3-((METHYLSULFONYL)OXY)PHENYL)METHYL)-",
          "stdName": "BENZAMIDE, 4-CHLORO-N-(2-METHOXYETHYL)-N-((3-((METHYLSULFONYL)OXY)PHENYL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1287fc5-92c2-42e2-8b91-6003e5529f5e",
            "b4902fae-54c6-45dc-b53a-e88f5f1a005d"
          ],
          "display_name": false
        },
        {
          "uuid": "42c85e19-2b6e-46bf-be7e-00732fec6de6",
          "name": "MESYLOXYBENZYL METHOXYETHYL CHLOROBENZAMIDE",
          "stdName": "MESYLOXYBENZYL METHOXYETHYL CHLOROBENZAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b117a012-b9b7-4999-bef0-55a2d135ac5a",
            "e1287fc5-92c2-42e2-8b91-6003e5529f5e",
            "b4902fae-54c6-45dc-b53a-e88f5f1a005d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "57d36980-2a65-442e-8fdf-7d8d29f93ade",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "84491f86-87c8-41bb-9faa-997c76f22a1c",
          "name": "MESYLOXYBENZYLMETHOXYETHLCHLOROBENZAMIDE",
          "stdName": "MESYLOXYBENZYLMETHOXYETHLCHLOROBENZAMIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1287fc5-92c2-42e2-8b91-6003e5529f5e",
            "b4902fae-54c6-45dc-b53a-e88f5f1a005d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1287fc5-92c2-42e2-8b91-6003e5529f5e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b4902fae-54c6-45dc-b53a-e88f5f1a005d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0526aa4e-17b5-40a9-9bf5-abf08856fcd1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393369000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac02ab1a-22b2-42b6-8801-588cd4e3e44a",
          "citation": "SRS import [3HB4C300XB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3HB4C300XB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393369000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c0213d3-c197-4855-9e90-8e0fd6c9ecbe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b117a012-b9b7-4999-bef0-55a2d135ac5a",
          "citation": "MESYLOXYBENZYL METHOXYETHYL CHLOROBENZAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "feaac2df-cb4b-8a04-9c9e-b3d4bdb7e1e4",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "120d0605-43cf-45bd-b00d-64072e616880",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0a88fd90-637f-aa5a-38ee-ad8a9532e493",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6c71b060-bb43-46ef-bf6d-a87d5019d7e9",
          "id": "6c71b060-bb43-46ef-bf6d-a87d5019d7e9",
          "molfile": "\n  Marvin  01132105382D          \n\n 26 27  0  0  0  0            999 V2000\n   15.9097   -6.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -6.8450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -7.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4808   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4808   -8.9074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7663   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0519   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0519   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3374   -7.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6230   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6230   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9085   -9.3199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1942   -8.9074    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7816   -9.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6066   -8.1929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4797   -8.4950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3374   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953  -10.1448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9097   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6242   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3386   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3386   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0531   -7.6700    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.6242   -7.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9097   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 18  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 17  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 26  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  2  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "COCCN(Cc1cccc(c1)OS(=O)(=O)C)C(=O)c2ccc(cc2)Cl",
          "formula": "C18H20ClNO5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3d162bab-49e6-4c46-9828-839fbc8a7c25"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "397.8748",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "875bee69-242d-445a-8d64-f3b0210b202b",
      "version": "6",
      "structure": {
        "id": "8e23d866-f59b-4149-a5c4-d992b49115ab",
        "molfile": "\n  Marvin  01132107222D          \n\n 26 27  0  0  0  0            999 V2000\n   13.7663   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0519   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0519   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3374   -7.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6230   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6230   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9085   -9.3199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1942   -8.9074    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6066   -8.1929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4797   -8.4950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7816   -9.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3374   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4808   -8.9074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4808   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -7.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -6.8450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9097   -6.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9097   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6242   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3386   -8.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3386   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0531   -7.6700    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.6242   -7.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9097   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1953  -10.1448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 12  6  1  0  0  0  0\n  2 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 19 25  2  0  0  0  0\n 18 26  2  0  0  0  0\nM  END",
        "smiles": "COCCN(Cc1cccc(c1)OS(=O)(=O)C)C(=O)c2ccc(cc2)Cl",
        "formula": "C18H20ClNO5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.8748",
        "optical_activity": "NONE",
        "references": [
          "3c0213d3-c197-4855-9e90-8e0fd6c9ecbe",
          "ac02ab1a-22b2-42b6-8801-588cd4e3e44a"
        ],
        "stereo_centers": 0
      },
      "unii": "3HB4C300XB"
    }
  ]
}