{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f50adc85-61d6-4bc1-8cc6-a0ebc7f84af5",
          "code": "60239-68-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60239-68-1",
          "code_system": "CAS",
          "references": [
            "e1da2c4d-8198-4f57-8e2c-962f41a1ae03",
            "c661bfa9-2cf3-4065-af6c-c841200e7716"
          ]
        },
        {
          "uuid": "7b923290-e0da-41f7-b81f-0e55ec8b9738",
          "code": "SUB15655MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e1da2c4d-8198-4f57-8e2c-962f41a1ae03"
          ]
        },
        {
          "uuid": "7656f186-a3da-46b7-90ee-aaba49c68217",
          "code": "108909",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108909",
          "code_system": "PUBCHEM",
          "references": [
            "e1da2c4d-8198-4f57-8e2c-962f41a1ae03"
          ]
        },
        {
          "uuid": "4fcea681-92d9-4c47-a4d3-6c19708982fc",
          "code": "262-114-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.450",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e1da2c4d-8198-4f57-8e2c-962f41a1ae03"
          ]
        },
        {
          "uuid": "c24e1fb2-5257-4eee-9b59-68bc777d0b8c",
          "code": "DTXSID0069389",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0069389",
          "code_system": "EPA CompTox",
          "references": [
            "e41a4dab-123d-9ca2-1f69-c48f1aa8130f"
          ]
        },
        {
          "uuid": "eab316d8-b230-4681-a331-9e1b069630cc",
          "code": "3GO8L1Z099",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0c8b23a2-7c4a-741c-8462-203c7b6a0b40",
          "code": "100000077312",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b10b65f0-1bfa-7ef1-f0c9-d45c0be4a5a3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8eb2701f-d490-42e2-94ec-f8719ed224e8",
          "name": "10-UNDECENAMIDE, N,N-BIS(2-HYDROXYETHYL)-",
          "stdName": "10-UNDECENAMIDE, N,N-BIS(2-HYDROXYETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "64a1084c-d596-4fb9-960a-7c2f6711661d"
          ],
          "display_name": false
        },
        {
          "uuid": "1b67bed2-0193-4fcb-879a-99b4bc7dcac4",
          "name": "10-UNDECYLENIC ACID DIETHANOLAMIDE",
          "stdName": "10-UNDECYLENIC ACID DIETHANOLAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "5995f1a7-2d1b-4278-95dc-5b35ac6d261d"
          ],
          "display_name": false
        },
        {
          "uuid": "3406b6bf-d021-4971-9b33-ba61ec394e8b",
          "name": "DITANID",
          "stdName": "DITANID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "64a1084c-d596-4fb9-960a-7c2f6711661d"
          ],
          "display_name": false
        },
        {
          "uuid": "89f833ba-39c1-43de-b359-f65a1ecb35f9",
          "name": "J107.506C",
          "stdName": "J107.506C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "5995f1a7-2d1b-4278-95dc-5b35ac6d261d"
          ],
          "display_name": false
        },
        {
          "uuid": "d84b31d7-ca38-439f-aff1-58f12a4a7d6f",
          "name": "N,N-BIS(2-HYDROXYETHYL)-10-UNDECENAMIDE",
          "stdName": "N,N-BIS(2-HYDROXYETHYL)-10-UNDECENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "5995f1a7-2d1b-4278-95dc-5b35ac6d261d"
          ],
          "display_name": false
        },
        {
          "uuid": "224163b1-51b2-44ef-bbdf-fcc91ff36457",
          "name": "N,N-BIS(2-HYDROXYETHYL)UNDEC-10-ENAMIDE",
          "stdName": "N,N-BIS(2-HYDROXYETHYL)UNDEC-10-ENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ce95c2d-66b4-45c7-a533-7e54677b899d",
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176"
          ],
          "display_name": false
        },
        {
          "uuid": "ff1878de-917f-40a2-96f3-5fe88560922e",
          "name": "N,N-BIS(2-HYDROXYETHYL)UNDECENAMIDE",
          "stdName": "N,N-BIS(2-HYDROXYETHYL)UNDECENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "9597b154-4ebe-47d8-9dde-5b695aaa2655"
          ],
          "display_name": false
        },
        {
          "uuid": "eec8d9f9-231a-41cc-b829-b09f8f90df17",
          "name": "UNDECYLENAMIDE DEA",
          "stdName": "UNDECYLENAMIDE DEA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "37ff219a-b890-4ef9-8575-66ffafff9e5c",
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "64a1084c-d596-4fb9-960a-7c2f6711661d",
            "53c304cd-f730-4d08-ba1c-f254d4b63679"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "98093072-9dd6-4aa5-89f3-f8edf056b79e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "82319d58-da33-4e6e-9f9a-877225f7da44",
          "name": "UNDECYLENIC ACID DIETHANOLAMIDE",
          "stdName": "UNDECYLENIC ACID DIETHANOLAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "479a9208-91cb-438a-8d47-5d2044c8714a",
            "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
            "7e7a3aeb-f948-4757-aafa-f51cdf716167",
            "6dab9e51-3c24-40ce-b4fe-db69c182aa0f"
          ],
          "display_name": true
        },
        {
          "uuid": "6571a0db-139a-24be-55b9-e2a0b951beff",
          "name": "Undecylenic acid diethanolamide [WHO-DD]",
          "stdName": "UNDECYLENIC ACID DIETHANOLAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fa7ce54-c9e3-4609-f45d-666dca16ad0e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5995f1a7-2d1b-4278-95dc-5b35ac6d261d",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J107.506C",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J107.506C",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9597b154-4ebe-47d8-9dde-5b695aaa2655",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/60239-68-1",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/60239-68-1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ce95c2d-66b4-45c7-a533-7e54677b899d",
          "citation": "http://pubchem.ncbi.nlm.nih.gov/compound/108909#section=Top",
          "url": "http://pubchem.ncbi.nlm.nih.gov/compound/108909#section=Top",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1da2c4d-8198-4f57-8e2c-962f41a1ae03",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfb405b5-6ace-4631-90da-b4acf405cc9c",
          "citation": "SRS import [3GO8L1Z099]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3GO8L1Z099",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "223042d4-4409-40c3-a85f-682180793567",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "479a9208-91cb-438a-8d47-5d2044c8714a",
          "citation": "UNDECYLENIC ACID DIETHANOLAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37ff219a-b890-4ef9-8575-66ffafff9e5c",
          "citation": "UNDECYLENAMIDE DEA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7e7a3aeb-f948-4757-aafa-f51cdf716167",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a4df1f19-e553-41f6-bd29-a6c3a66b9176",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53c304cd-f730-4d08-ba1c-f254d4b63679",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dab9e51-3c24-40ce-b4fe-db69c182aa0f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64a1084c-d596-4fb9-960a-7c2f6711661d",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e41a4dab-123d-9ca2-1f69-c48f1aa8130f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60239-68-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b10b65f0-1bfa-7ef1-f0c9-d45c0be4a5a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5e8b1bb4-8c72-45b6-7cb4-8f818b1ddd40",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c661bfa9-2cf3-4065-af6c-c841200e7716",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4fa7ce54-c9e3-4609-f45d-666dca16ad0e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a9580972-af11-41d3-8240-edc4480318eb",
          "id": "a9580972-af11-41d3-8240-edc4480318eb",
          "molfile": "\n  Marvin  01132108472D          \n\n 19 18  0  0  0  0            999 V2000\n   11.6699   -4.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9550   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5300   -3.8131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5300   -2.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -2.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -1.7539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8152   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8152   -5.0487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1002   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3854   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6706   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9557   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2409   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5261   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8159   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1010   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3862   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6714   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  8  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
          "smiles": "C=CCCCCCCCCC(=O)N(CCO)CCO",
          "formula": "C15H29NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1ae9c6b0-eb6a-47bc-a428-f2e191ecd2a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.3962",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eb7b143c-db88-448f-b81c-a4271a2323a7",
      "version": "8",
      "structure": {
        "id": "c141d303-2eb6-4c0f-9031-fc0dec4003ad",
        "molfile": "\n  Marvin  01132109592D          \n\n 19 18  0  0  0  0            999 V2000\n    8.8152   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1002   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3854   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6706   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9557   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2409   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5261   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8159   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1010   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3862   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6714   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8152   -5.0487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5300   -3.8131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9550   -3.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6699   -4.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5300   -2.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -2.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2402   -1.7539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  1 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "C=CCCCCCCCCC(=O)N(CCO)CCO",
        "formula": "C15H29NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "271.3962",
        "optical_activity": "NONE",
        "references": [
          "bfb405b5-6ace-4631-90da-b4acf405cc9c",
          "223042d4-4409-40c3-a85f-682180793567"
        ],
        "stereo_centers": 0
      },
      "unii": "3GO8L1Z099"
    }
  ]
}