{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "114fd5ec-33e1-4533-a2c0-e173dfd20d08",
          "code": "67460-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67460-68-8",
          "code_system": "CAS",
          "references": [
            "8ce8340e-4100-4be6-a3fa-903f7c30ca52",
            "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1"
          ]
        },
        {
          "uuid": "1c0f8dfa-d166-4663-a2c8-858fa8ec0e49",
          "code": "2,5-DIMETHOXY-4-NITROAMPHETAMINE",
          "comments": "2,5-Dimethoxy-4-nitroamphetamine (DON) is a recreational drug and amphetamine. It is a analog of DOM and DOB. It is also closely related to 2C-N. DON is in a class of compounds commonly known as alpha-methyl phenethylamines, or amphetamines and the full chemical name is 1-(2,5-dimethoxy-4-nitrophenyl)propan-2-amine. It has a stereocenter.DON is unscheduled in the United States, but because of its close similarity in structure and effects to DOM and DOB, possession and sale of DON may be subject to prosecution under the Federal Analog Act. DON is listed as a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act after the table of contents of Pihkal and Tihkal were added to the schedules.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2,5-Dimethoxy-4-nitroamphetamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "8ce8340e-4100-4be6-a3fa-903f7c30ca52"
          ]
        },
        {
          "uuid": "7dcb2c0a-3904-4f3b-883d-b5698ab28175",
          "code": "105432",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/105432",
          "code_system": "PUBCHEM",
          "references": [
            "8ce8340e-4100-4be6-a3fa-903f7c30ca52"
          ]
        },
        {
          "uuid": "9bf7b6bd-5f3d-604b-a2eb-261091cbc0a7",
          "code": "DTXSID00874243",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00874243",
          "code_system": "EPA CompTox",
          "references": [
            "d0fd9bf2-4deb-ff8b-cd8c-78287ce976f2"
          ]
        },
        {
          "uuid": "1b853eda-b009-424f-8fc2-7cf8cf9cf39a",
          "code": "3FIV60666J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "00e96b5e-3f67-3492-aac6-75d895df4dc5",
          "code": "Designer-drugs-2,5-Dimethoxy-4-nitroamphetamine",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|Dox",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "98dde356-0170-5179-14af-637852b2b96b"
          ]
        },
        {
          "uuid": "dff6e812-55c6-421c-ae12-56e69c23e1ef",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        }
      ],
      "relationships": [
        {
          "uuid": "697028b3-15ca-4858-bf9d-2acfe4052dfe",
          "amount": {
            "uuid": "8678e5ba-41d3-46bd-bd19-8adc6ea98465"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6649c562-f707-4bc2-ba49-515a9707799c",
            "refuuid": "9a0df2a4-42af-4fc2-b440-ac505c34ffe1",
            "name": "2,5-Dimethoxy-4-nitroamphetamine",
            "unii": "3FIV60666J",
            "linking_id": "3FIV60666J",
            "ref_pname": "2,5-Dimethoxy-4-nitroamphetamine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d492d50f-6527-421a-b117-f29b49d9940a",
          "amount": {
            "uuid": "4e39b44f-3380-4d51-86fd-0fe7361c6e3c"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "6a5a1631-2d9d-4df5-a614-0e373c3c19a3",
            "refuuid": "cab23111-cf20-4b03-bba0-e4f04ab8a636",
            "name": "2,5-Dimethoxy-4-nitroamphetamine, (R)-",
            "unii": "CCU5EE8DUU",
            "linking_id": "CCU5EE8DUU",
            "ref_pname": "2,5-Dimethoxy-4-nitroamphetamine, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e2033298-288e-4739-835c-773a7540378f",
          "amount": {
            "uuid": "9b6d5c77-084e-476e-97fc-c00c472fb68d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7babe84e-d2e4-4e7e-b125-3fda501b7034",
            "refuuid": "02df55a8-94e1-486e-bdf8-522bbc6ecf67",
            "name": "2,5-Dimethoxy-4-nitroamphetamine hydrochloride",
            "unii": "5ZJE79B6GE",
            "linking_id": "5ZJE79B6GE",
            "ref_pname": "2,5-Dimethoxy-4-nitroamphetamine hydrochloride",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8f3be05a-b983-47fd-8c53-5aabfc0c9aab",
          "name": "(±)-1-(2,5-DIMETHOXY-4-NITROPHENYL)-2-AMINOPROPANE",
          "stdName": "(+/-)-1-(2,5-DIMETHOXY-4-NITROPHENYL)-2-AMINOPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1"
          ],
          "display_name": false
        },
        {
          "uuid": "629113ae-1ac7-41dc-98fd-a62f9017ce4f",
          "name": "(±)-1-(4-NITRO-2,5-DIMETHOXYPHENYL)-2-AMINOPROPANE",
          "stdName": "(+/-)-1-(4-NITRO-2,5-DIMETHOXYPHENYL)-2-AMINOPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1"
          ],
          "display_name": false
        },
        {
          "uuid": "c65b0926-427b-4e7b-b84f-a6d20561d075",
          "name": "2,5-Dimethoxy-4-nitroamphetamine",
          "stdName": "2,5-DIMETHOXY-4-NITROAMPHETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1",
            "19d56c53-20a4-48e4-a347-765ecfd5273c"
          ],
          "display_name": true
        },
        {
          "uuid": "b1fe7ac6-6e73-41e7-ae6e-9e4128b3a471",
          "name": "BENZENEETHANAMINE, 2,5-DIMETHOXY-.ALPHA.-METHYL-4-NITRO-",
          "stdName": "BENZENEETHANAMINE, 2,5-DIMETHOXY-.ALPHA.-METHYL-4-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1"
          ],
          "display_name": false
        },
        {
          "uuid": "1d055ccb-4955-4686-b293-b49ba0601bfe",
          "name": "DON (PSYCHEDELIC)",
          "stdName": "DON (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5afdcaa-563f-4d4b-a98f-2a1966e940ed"
          ],
          "display_name": false
        },
        {
          "uuid": "0baba2bb-808c-4c5a-97c8-ff79615844bc",
          "name": "J275.080E",
          "stdName": "J275.080E",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09c3e35a-91e8-4f9e-a79a-a5df60e2a97b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "09c3e35a-91e8-4f9e-a79a-a5df60e2a97b",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J275.080E",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J275.080E",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19d56c53-20a4-48e4-a347-765ecfd5273c",
          "citation": "https://en.wikipedia.org/wiki/2,5-Dimethoxy-4-nitroamphetamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ce8340e-4100-4be6-a3fa-903f7c30ca52",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae8eca2b-dce7-47e0-899c-1fbfa2bbfb72",
          "citation": "SRS import [3FIV60666J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3FIV60666J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98dde356-0170-5179-14af-637852b2b96b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b5afdcaa-563f-4d4b-a98f-2a1966e940ed",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d0fd9bf2-4deb-ff8b-cd8c-78287ce976f2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5dfdf58e-7521-44fb-b319-65e611483c53",
          "id": "5dfdf58e-7521-44fb-b319-65e611483c53",
          "molfile": "\n  Marvin  01132104522D          \n\n 17 17  0  0  0  0            999 V2000\n    1.0717   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.7862    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    1.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -0.4125    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -1.2375    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 10  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  CHG  2  15   1  16  -1\nM  END",
          "smiles": "CC(Cc1cc(c(cc1OC)[N+](=O)[O-])OC)N",
          "formula": "C11H16N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "87254f31-b03a-44ea-997c-74bd80b04161"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2562",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a0df2a4-42af-4fc2-b440-ac505c34ffe1",
      "version": "16",
      "structure": {
        "id": "d5a80faa-e47b-4027-9862-bb4907f81b98",
        "molfile": "\n  Marvin  01132111042D          \n\n 17 17  0  0  0  0            999 V2000\n   -1.0717    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    1.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -0.4125    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.7862   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006    0.0000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\nM  CHG  2  15   1  17  -1\nM  END",
        "smiles": "CC(Cc1cc(c(cc1OC)[N+](=O)[O-])OC)N",
        "formula": "C11H16N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2562",
        "optical_activity": "( + / - )",
        "references": [
          "a763f9ca-d5d9-4ff6-adbc-6240bc0995b1",
          "19d56c53-20a4-48e4-a347-765ecfd5273c"
        ],
        "stereo_centers": 1
      },
      "unii": "3FIV60666J"
    }
  ]
}